Shuangwang Au deposit, Shuangwang Taibai County, Baoji, Shaanxi, Chinai
Regional Level Types | |
---|---|
Shuangwang Au deposit | Deposit |
Shuangwang Taibai County | - not defined - |
Baoji | Prefecture-level City |
Shaanxi | Province |
China | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
33° 52' 30'' North , 107° 14' 30'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
Place | Population | Distance |
---|---|---|
Guozhen | 85,415 (2012) | 55.6km |
Mindat Locality ID:
134939
Long-form identifier:
mindat:1:2:134939:2
GUID (UUID V4):
f231dbc3-e655-43e8-9d71-4d1a5d31cf7e
Name(s) in local language(s):
双王金矿床, 太白县, 宝鸡市, 陕西省, 中国
Breccia-style gold deposit with more than 70 tons of Au. Eight orebodies, including KT2, KT6, KT6-1, KT5, KT7, KT9, KT8, and KT10, are delineated from
west to east.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
49 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
ⓘ Albite Formula: Na(AlSi3O8) References: |
ⓘ Andalusite Formula: Al2(SiO4)O |
ⓘ Anhydrite Formula: CaSO4 References: |
ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 References: |
ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
ⓘ Arsenopyrite Formula: FeAsS References: |
ⓘ Baryte Formula: BaSO4 |
ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
ⓘ Calaverite Formula: AuTe2 |
ⓘ Calcite Formula: CaCO3 References: |
ⓘ Chalcopyrite Formula: CuFeS2 |
ⓘ Cobaltite Formula: CoAsS |
ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) |
ⓘ Dickite Formula: Al2(Si2O5)(OH)4 References: |
ⓘ Dolomite Formula: CaMg(CO3)2 |
ⓘ Dolomite var. Iron-bearing Dolomite Formula: Ca(Mg,Fe)(CO3)2 |
ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ 'Feldspar Group' References: Jia, Shaohui, Liu, Jiajun, Wang, Jianping, Carranza, Emmanuel John M., Liu, Chonghao, Cheng, Feng (2024) Geochemistry and Zircon LA–ICP–MS U–Pb Geochronology of the Shuangwang Au Deposit, Shaanxi Province: Implications for Tectonic Evolution and Metallogenic Age. Minerals, 14 (4) doi:10.3390/min14040329 |
ⓘ Fluorite Formula: CaF2 References: |
ⓘ Galena Formula: PbS |
ⓘ Gold Formula: Au References: |
ⓘ Gold var. Electrum Formula: (Au,Ag) |
ⓘ Gold var. Platinum-bearing Gold Formula: (Au,Pt) |
ⓘ Goldmanite Formula: Ca3V3+2(SiO4)3 |
ⓘ Graphite Formula: C |
ⓘ Gypsum Formula: CaSO4 · 2H2O References: |
ⓘ Heazlewoodite Formula: Ni3S2 |
ⓘ Hessite Formula: Ag2Te |
ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
ⓘ Ilmenite Formula: Fe2+TiO3 |
ⓘ Imandrite Formula: Na12Ca3Fe3+2(Si6O18)2 |
ⓘ Linnaeite Formula: Co2+Co3+2S4 |
ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
ⓘ Marcasite Formula: FeS2 |
ⓘ Millerite Formula: NiS |
ⓘ Molybdenite Formula: MoS2 |
ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: Jia, Shaohui, Liu, Jiajun, Wang, Jianping, Carranza, Emmanuel John M., Liu, Chonghao, Cheng, Feng (2024) Geochemistry and Zircon LA–ICP–MS U–Pb Geochronology of the Shuangwang Au Deposit, Shaanxi Province: Implications for Tectonic Evolution and Metallogenic Age. Minerals, 14 (4) doi:10.3390/min14040329 |
ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 Description: vanadium-bearing |
ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 References: Jia, Shaohui, Liu, Jiajun, Wang, Jianping, Carranza, Emmanuel John M., Liu, Chonghao, Cheng, Feng (2024) Geochemistry and Zircon LA–ICP–MS U–Pb Geochronology of the Shuangwang Au Deposit, Shaanxi Province: Implications for Tectonic Evolution and Metallogenic Age. Minerals, 14 (4) doi:10.3390/min14040329 |
ⓘ 'Parisite' ? Formula: Ca(Ce/La/Nd/REE)2(CO3)3F2 Description: Chinese papers on this deposit report either synchysite or parisite, but never both, if they provide a list of minerals at all (e.g. Mao et al., 2002; Zhang et al., 2004; Hu, 2009 - see list of references). The Chinese name of synchysite is frequently mis-translated as parisite (as seen e.g. in several on-line dictionaries). This makes the report of both species questionable until analytical data can be found that confirm one or the other. |
ⓘ Parkerite Formula: Ni3(Bi,Pb)2S2 |
ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 References: Jia, Shaohui, Liu, Jiajun, Wang, Jianping, Carranza, Emmanuel John M., Liu, Chonghao, Cheng, Feng (2024) Geochemistry and Zircon LA–ICP–MS U–Pb Geochronology of the Shuangwang Au Deposit, Shaanxi Province: Implications for Tectonic Evolution and Metallogenic Age. Minerals, 14 (4) doi:10.3390/min14040329 |
ⓘ Polydymite Formula: Ni2+Ni3+2S4 |
ⓘ Pyrite Formula: FeS2 References: |
ⓘ Pyrite var. Gold-bearing Pyrite Formula: FeS2 |
ⓘ Pyrrhotite Formula: Fe1-xS |
ⓘ Quartz Formula: SiO2 References: |
ⓘ Quartz var. Chalcedony Formula: SiO2 |
ⓘ Roscoelite Formula: K(V3+,Al)2(AlSi3O10)(OH)2 |
ⓘ Rutile Formula: TiO2 |
ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ Siderite Formula: FeCO3 |
ⓘ Sphalerite Formula: ZnS |
ⓘ Synchysite-(Ce) ? Formula: CaCe(CO3)2F Description: Chinese papers on this deposit report either synchysite or parisite, but never both, if they provide a list of minerals at all (e.g. Mao et al., 2002; Zhang et al., 2004; Hu, 2009 - see list of references). The Chinese name of synchysite is frequently mis-translated as parisite (as seen e.g. in several on-line dictionaries). This makes the report of both species questionable until analytical data can be found that confirm one or the other. |
ⓘ Tellurobismuthite Formula: Bi2Te3 |
ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
ⓘ Villamanínite Formula: (Cu,Ni,Co,Fe)S2 |
ⓘ Violarite Formula: Fe2+Ni3+2S4 |
ⓘ Willyamite Formula: CoSbS |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
Group 1 - Elements | |||
---|---|---|---|
ⓘ | Gold var. Platinum-bearing Gold | 1.AA.05 | (Au,Pt) |
ⓘ | 1.AA.05 | Au | |
ⓘ | var. Electrum | 1.AA.05 | (Au,Ag) |
ⓘ | Graphite | 1.CB.05a | C |
Group 2 - Sulphides and Sulfosalts | |||
ⓘ | Hessite | 2.BA.60 | Ag2Te |
ⓘ | Heazlewoodite | 2.BB.05 | Ni3S2 |
ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
ⓘ | Parkerite | 2.BE.20 | Ni3(Bi,Pb)2S2 |
ⓘ | Sphalerite | 2.CB.05a | ZnS |
ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
ⓘ | Millerite | 2.CC.20 | NiS |
ⓘ | Galena | 2.CD.10 | PbS |
ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
ⓘ | Violarite | 2.DA.05 | Fe2+Ni3+2S4 |
ⓘ | Polydymite | 2.DA.05 | Ni2+Ni3+2S4 |
ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
ⓘ | Calaverite | 2.EA.10 | AuTe2 |
ⓘ | Molybdenite | 2.EA.30 | MoS2 |
ⓘ | Pyrite var. Gold-bearing Pyrite | 2.EB.05a | FeS2 |
ⓘ | Villamanínite | 2.EB.05a | (Cu,Ni,Co,Fe)S2 |
ⓘ | Pyrite | 2.EB.05a | FeS2 |
ⓘ | Marcasite | 2.EB.10a | FeS2 |
ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
ⓘ | Willyamite | 2.EB.25 | CoSbS |
ⓘ | Cobaltite | 2.EB.25 | CoAsS |
ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
Group 3 - Halides | |||
ⓘ | Fluorite | 3.AB.25 | CaF2 |
Group 4 - Oxides and Hydroxides | |||
ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
ⓘ | 4.DA.05 | SiO2 | |
ⓘ | Rutile | 4.DB.05 | TiO2 |
Group 5 - Nitrates and Carbonates | |||
ⓘ | Calcite | 5.AB.05 | CaCO3 |
ⓘ | Siderite | 5.AB.05 | FeCO3 |
ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
ⓘ | var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
ⓘ | Synchysite-(Ce) ? | 5.BD.20c | CaCe(CO3)2F |
Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
ⓘ | Baryte | 7.AD.35 | BaSO4 |
ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
Group 9 - Silicates | |||
ⓘ | Goldmanite | 9.AD.25 | Ca3V3+2(SiO4)3 |
ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
ⓘ | Imandrite | 9.CJ.15b | Na12Ca3Fe3+2(Si6O18)2 |
ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
ⓘ | Roscoelite | 9.EC.15 | K(V3+,Al)2(AlSi3O10)(OH)2 |
ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
Unclassified | |||
ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
ⓘ | 'Feldspar Group' | - | |
ⓘ | 'Parisite' ? | - | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
H | Hydrogen | |
---|---|---|
H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
H | ⓘ Gypsum | CaSO4 · 2H2O |
H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
H | ⓘ Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
B | Boron | |
B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
C | Carbon | |
C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
C | ⓘ Calcite | CaCO3 |
C | ⓘ Dolomite | CaMg(CO3)2 |
C | ⓘ Graphite | C |
C | ⓘ Siderite | FeCO3 |
C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
C | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
O | Oxygen | |
O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
O | ⓘ Albite | Na(AlSi3O8) |
O | ⓘ Andalusite | Al2(SiO4)O |
O | ⓘ Anhydrite | CaSO4 |
O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
O | ⓘ Baryte | BaSO4 |
O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
O | ⓘ Calcite | CaCO3 |
O | ⓘ Quartz var. Chalcedony | SiO2 |
O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
O | ⓘ Dolomite | CaMg(CO3)2 |
O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
O | ⓘ Goldmanite | Ca3V23+(SiO4)3 |
O | ⓘ Gypsum | CaSO4 · 2H2O |
O | ⓘ Ilmenite | Fe2+TiO3 |
O | ⓘ Imandrite | Na12Ca3Fe23+(Si6O18)2 |
O | ⓘ Magnetite | Fe2+Fe23+O4 |
O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
O | ⓘ Quartz | SiO2 |
O | ⓘ Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
O | ⓘ Rutile | TiO2 |
O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Siderite | FeCO3 |
O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
O | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
F | Fluorine | |
F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
F | ⓘ Fluorite | CaF2 |
F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
F | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
Na | Sodium | |
Na | ⓘ Albite | Na(AlSi3O8) |
Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
Na | ⓘ Imandrite | Na12Ca3Fe23+(Si6O18)2 |
Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
Mg | Magnesium | |
Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
Mg | ⓘ Dolomite | CaMg(CO3)2 |
Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
Al | Aluminium | |
Al | ⓘ Albite | Na(AlSi3O8) |
Al | ⓘ Andalusite | Al2(SiO4)O |
Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
Al | ⓘ Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
Si | Silicon | |
Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
Si | ⓘ Albite | Na(AlSi3O8) |
Si | ⓘ Andalusite | Al2(SiO4)O |
Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Si | ⓘ Quartz var. Chalcedony | SiO2 |
Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
Si | ⓘ Goldmanite | Ca3V23+(SiO4)3 |
Si | ⓘ Imandrite | Na12Ca3Fe23+(Si6O18)2 |
Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
Si | ⓘ Quartz | SiO2 |
Si | ⓘ Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
P | Phosphorus | |
P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
S | Sulfur | |
S | ⓘ Anhydrite | CaSO4 |
S | ⓘ Arsenopyrite | FeAsS |
S | ⓘ Pyrite var. Gold-bearing Pyrite | FeS2 |
S | ⓘ Baryte | BaSO4 |
S | ⓘ Chalcopyrite | CuFeS2 |
S | ⓘ Cobaltite | CoAsS |
S | ⓘ Galena | PbS |
S | ⓘ Gypsum | CaSO4 · 2H2O |
S | ⓘ Heazlewoodite | Ni3S2 |
S | ⓘ Linnaeite | Co2+Co23+S4 |
S | ⓘ Marcasite | FeS2 |
S | ⓘ Millerite | NiS |
S | ⓘ Molybdenite | MoS2 |
S | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
S | ⓘ Pentlandite | (NixFey)Σ9S8 |
S | ⓘ Polydymite | Ni2+Ni23+S4 |
S | ⓘ Pyrite | FeS2 |
S | ⓘ Pyrrhotite | Fe1-xS |
S | ⓘ Sphalerite | ZnS |
S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
S | ⓘ Villamanínite | (Cu,Ni,Co,Fe)S2 |
S | ⓘ Violarite | Fe2+Ni23+S4 |
S | ⓘ Willyamite | CoSbS |
Cl | Chlorine | |
Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
K | Potassium | |
K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
K | ⓘ Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
Ca | Calcium | |
Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
Ca | ⓘ Anhydrite | CaSO4 |
Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
Ca | ⓘ Calcite | CaCO3 |
Ca | ⓘ Dolomite | CaMg(CO3)2 |
Ca | ⓘ Fluorite | CaF2 |
Ca | ⓘ Goldmanite | Ca3V23+(SiO4)3 |
Ca | ⓘ Gypsum | CaSO4 · 2H2O |
Ca | ⓘ Imandrite | Na12Ca3Fe23+(Si6O18)2 |
Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
Ca | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
Ti | Titanium | |
Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Ti | ⓘ Ilmenite | Fe2+TiO3 |
Ti | ⓘ Rutile | TiO2 |
V | Vanadium | |
V | ⓘ Goldmanite | Ca3V23+(SiO4)3 |
V | ⓘ Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
Cr | Chromium | |
Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
Fe | Iron | |
Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
Fe | ⓘ Arsenopyrite | FeAsS |
Fe | ⓘ Pyrite var. Gold-bearing Pyrite | FeS2 |
Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Fe | ⓘ Chalcopyrite | CuFeS2 |
Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
Fe | ⓘ Ilmenite | Fe2+TiO3 |
Fe | ⓘ Imandrite | Na12Ca3Fe23+(Si6O18)2 |
Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
Fe | ⓘ Marcasite | FeS2 |
Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
Fe | ⓘ Pyrite | FeS2 |
Fe | ⓘ Pyrrhotite | Fe1-xS |
Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Fe | ⓘ Siderite | FeCO3 |
Fe | ⓘ Villamanínite | (Cu,Ni,Co,Fe)S2 |
Fe | ⓘ Violarite | Fe2+Ni23+S4 |
Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
Co | Cobalt | |
Co | ⓘ Cobaltite | CoAsS |
Co | ⓘ Linnaeite | Co2+Co23+S4 |
Co | ⓘ Villamanínite | (Cu,Ni,Co,Fe)S2 |
Co | ⓘ Willyamite | CoSbS |
Ni | Nickel | |
Ni | ⓘ Heazlewoodite | Ni3S2 |
Ni | ⓘ Millerite | NiS |
Ni | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
Ni | ⓘ Polydymite | Ni2+Ni23+S4 |
Ni | ⓘ Villamanínite | (Cu,Ni,Co,Fe)S2 |
Ni | ⓘ Violarite | Fe2+Ni23+S4 |
Cu | Copper | |
Cu | ⓘ Chalcopyrite | CuFeS2 |
Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
Cu | ⓘ Villamanínite | (Cu,Ni,Co,Fe)S2 |
Zn | Zinc | |
Zn | ⓘ Sphalerite | ZnS |
As | Arsenic | |
As | ⓘ Arsenopyrite | FeAsS |
As | ⓘ Cobaltite | CoAsS |
Mo | Molybdenum | |
Mo | ⓘ Molybdenite | MoS2 |
Ag | Silver | |
Ag | ⓘ Gold var. Electrum | (Au,Ag) |
Ag | ⓘ Hessite | Ag2Te |
Sb | Antimony | |
Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
Sb | ⓘ Willyamite | CoSbS |
Te | Tellurium | |
Te | ⓘ Calaverite | AuTe2 |
Te | ⓘ Hessite | Ag2Te |
Te | ⓘ Tellurobismuthite | Bi2Te3 |
Ba | Barium | |
Ba | ⓘ Baryte | BaSO4 |
La | Lanthanum | |
La | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
Ce | Cerium | |
Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
Ce | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
Nd | Neodymium | |
Nd | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
Pt | Platinum | |
Pt | ⓘ Gold var. Platinum-bearing Gold | (Au,Pt) |
Au | Gold | |
Au | ⓘ Calaverite | AuTe2 |
Au | ⓘ Gold var. Electrum | (Au,Ag) |
Au | ⓘ Gold | Au |
Au | ⓘ Gold var. Platinum-bearing Gold | (Au,Pt) |
Pb | Lead | |
Pb | ⓘ Galena | PbS |
Pb | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
Bi | Bismuth | |
Bi | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
Bi | ⓘ Tellurobismuthite | Bi2Te3 |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
[1]Jia, Shaohui, Liu, Jiajun, Wang, Jianping, Carranza, Emmanuel John M., Liu, Chonghao, Cheng, Feng (2024) Geochemistry and Zircon LA–ICP–MS U–Pb Geochronology of the Shuangwang Au Deposit, Shaanxi Province: Implications for Tectonic Evolution and Metallogenic Age. Minerals, 14 (4) doi:10.3390/min14040329