Fuerteventura Basal Complex, Fuerteventura, Las Palmas Province, Canary Islands, Spaini
Regional Level Types | |
---|---|
Fuerteventura Basal Complex | Complex |
Fuerteventura | Island Council |
Las Palmas Province | Province |
Canary Islands | Group of Autonomous Communities |
Spain | Group of Countries |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
28° North , 14° West (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~60km
Type:
Köppen climate type:
Mindat Locality ID:
135081
Long-form identifier:
mindat:1:2:135081:7
GUID (UUID V4):
abc0feed-27c3-46c5-b8a0-d93e1a68b44f
Name(s) in local language(s):
Complejo Basal de Fuerteventura, Fuerteventura, Provincia de Las Palmas, Islas Canarias
Calciocarbonatites enriched in strontium and REE.
On the island of Fuerteventura we find the best evidence of the origins and processes of formation of the Canary Islands. Im denudation processes (Tectonic, but that of erosion) have uncovered the foundations of the island, formed by a variety of processes with a variety of lithologies including ultra-alkalic rocks uncommon as Carbonatites.
This whole set is called "Basal Complex" and is forming an extensive central and western area of the island, with some outcrop located farther north.
Within the Basal Complex found several distinct units in relation to the type of rocks and consequently different geological processes.
1st - sedimentary rocks. They consist of a sequence of rocks deposited on the ocean floor formed by an alternation of calcareous sandstones and lutites known as turbidites, are the oldest rocks of the islands being the base where he began to build the building.
They are crossed by numerous dikes testimony of the origin of submarine eruption and produced a slight contact metamorphism.
His best outcrops are in the Barranco de Ajui (access road to the village of Ajui) and on the right side of Puerto de la Peña (Ajui beach).
2nd submarine volcanic rocks. Formed by the first eruptions, in the beginning of the phase of true creation of the island (sea-mount).
They are formed by breccias, tuffs and lava of basaltic to trachytic composition with structures typical of submarine eruptions (pillow).
Subsequently again is produced intense dike intrusion phase which in some cases reaches more than 70% of the rock.
In the lavas with pillow structures we find numerous fillings of Zeolites and carbonates as well as Pyrite disseminations.
3rd plutonic rocks. They form the portion majority of the basal complex and more interesting from the point of view petrological and mineralogical.
It is a variety of intrusive rocks formed at different stages corresponding to differentiation and assimilation processes due to the evolution in time of the magmas that formed the island.
We can distinguish:
* Ultra-alkaline rocks. form the oldest part of the intrusive rocks are obsevan in the coastline (cliffs) and especially in the Esquinzo ravine in the northern area. They are formed by rocks of complex composition such as Ijolites, Syenites, Nephelinites and Carbonatites (Sovites-Alvikites) with high concentrations of TR (Ce, La, Y) and especially high in Sr. In these rocks are located the sites of greatest interest mineralogical being the only of its type in Spain.
It should be noted complicated metasomatic processes (skarn) resulting from the interaction of the Carbonatites with silica-rich rocks (Syenites, Pyroxenites and Basalt dikes) leading to the formation of certain silicate minerals rich in Sr, as the possible Stronalsite
** Alkaline Rocks. Form a set of intrusions formed by Gabbro, Pyroxenite and syenites probably are a part lesser evolved which the Ultra-alkaline.
*** Ultramafic rocks. They are two major bodies of north-south alignment which is likely a large intrusion center consists of Werhlites and Pyroxenites.
**** Intrusions of Miocene age. These two buildings corresponding to the intrusive part of a stage of Miocene volcanism. We distinguish
- Annular complex of Vega del Rio Palma, this is a fantastic example of intrusion in the form of an inverted cone formed by annular estructruras varied composition ranging from alkaline gabbros to syenites and textures presented in many sub-volcanic cases which gives us insight into the shallowness of the intrusion.
- Building Betancuria, corresponds to a point of emission (deep part) of an eroded volcanic edifice. This consists of Syenites, Gabbros passing to basalts.
In conclusion we are facing a fantastic example of geological structure corresponding to the construction of a volcanic island and especially the intrusive processes associated with it, with the emergence of ultra-alkalines phases culminating in carbonatites and the existence of an unusual mineral assemblage rich in strontium.
Mineralogically forms a unique site in Spain and still a great unknown.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities73 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
List of minerals arranged by Strunz 10th Edition classification
Group 1 - Elements | |||
---|---|---|---|
ⓘ | Graphite | 1.CB.05a | C |
ⓘ | Diamond | 1.CB.10a | C |
Group 2 - Sulphides and Sulfosalts | |||
ⓘ | Chalcocite | 2.BA.05 | Cu2S |
ⓘ | Covellite | 2.CA.05a | CuS |
ⓘ | Sphalerite | 2.CB.05a | ZnS |
ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
ⓘ | Galena | 2.CD.10 | PbS |
ⓘ | Alabandite | 2.CD.10 | MnS |
ⓘ | Pyrite | 2.EB.05a | FeS2 |
Group 3 - Halides | |||
ⓘ | Fluorite | 3.AB.25 | CaF2 |
Group 4 - Oxides and Hydroxides | |||
ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ-n |
ⓘ | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
ⓘ | Wüstite | 4.AB.25 | FeO |
ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
ⓘ | Ulvöspinel | 4.BB.05 | TiFe2+2O4 |
ⓘ | Magnetite var. Titanium-bearing Magnetite | 4.BB.05 | Fe2+(Fe3+,Ti)2O4 |
ⓘ | Magnesioferrite | 4.BB.05 | MgFe3+2O4 |
ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
ⓘ | Jacobsite | 4.BB.05 | Mn2+Fe3+2O4 |
ⓘ | Spinel var. Pleonaste | 4.BB.05 | (Mg,Fe)Al2O4 |
ⓘ | Hematite | 4.CB.05 | Fe2O3 |
ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
ⓘ | Pyrophanite | 4.CB.05 | Mn2+TiO3 |
ⓘ | Perovskite | 4.CC.30 | CaTiO3 |
ⓘ | Quartz | 4.DA.05 | SiO2 |
ⓘ | Baddeleyite | 4.DE.35 | ZrO2 |
ⓘ | Fersmite | 4.DG.05 | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
Group 5 - Nitrates and Carbonates | |||
ⓘ | Calcite | 5.AB.05 | CaCO3 |
ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
ⓘ | Strontianite | 5.AB.15 | SrCO3 |
Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
ⓘ | Celestine | 7.AD.35 | SrSO4 |
ⓘ | Baryte | 7.AD.35 | BaSO4 |
Group 9 - Silicates | |||
ⓘ | Forsterite | 9.AC.05 | Mg2SiO4 |
ⓘ | Monticellite | 9.AC.10 | CaMgSiO4 |
ⓘ | Larnite | 9.AD.05 | Ca2SiO4 |
ⓘ | Kimzeyite | 9.AD.25 | Ca3Zr2(SiO4)(AlO4)2 |
ⓘ | Andradite var. Melanite | 9.AD.25 | Ca3(Fe3+,Ti)2(SiO4)3 |
ⓘ | Schorlomite | 9.AD.25 | Ca3Ti2(SiO4)(Fe3+O4)2 |
ⓘ | Morimotoite | 9.AD.25 | Ca3(TiFe2+)(SiO4)3 |
ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
ⓘ | Britholite-(Ce) | 9.AH.25 | (Ce,Ca)5(SiO4)3OH |
ⓘ | Gittinsite | 9.BC.05 | CaZrSi2O7 |
ⓘ | Baghdadite | 9.BE.17 | Ca6Zr2(Si2O7)2O4 |
ⓘ | Cuspidine | 9.BE.17 | Ca8(Si2O7)2F4 |
ⓘ | Niocalite | 9.BE.17 | (Ca,Nb)4(Si2O7)(O,OH,F)2 |
ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Diopside var. Titanium-bearing Diopside | 9.DA.15 | Ca(Mg,Fe2+,Ti4+)(Si,Al)2O6 |
ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
ⓘ | Aegirine-augite | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
ⓘ | Jadeite | 9.DA.25 | Na(Al,Fe3+)Si2O6 |
ⓘ | Kaersutite | 9.DE.15 | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
ⓘ | Hastingsite | 9.DE.15 | NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 |
ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
ⓘ | Kinoshitalite | 9.EC.35 | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
ⓘ | Clinochlore var. Sheridanite | 9.EC.55 | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
ⓘ | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 | |
ⓘ | Nepheline | 9.FA.05 | Na3K(Al4Si4O16) |
ⓘ | Celsian | 9.FA.30 | Ba(Al2Si2O8) |
ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
ⓘ | Sanidine | 9.FA.30 | K(AlSi3O8) |
ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
ⓘ | Stronalsite | 9.FA.60 | Na2SrAl4Si4O16 |
ⓘ | 'Zeolite Group' | 9.G0. | |
ⓘ | Scolecite | 9.GA.05 | CaAl2Si3O10 · 3H2O |
ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
ⓘ | Leucite | 9.GB.05 | K(AlSi2O6) |
Unclassified | |||
ⓘ | 'Chlorite Group' | - | |
ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
ⓘ | 'Olivine Group' | - | M2SiO4 |
ⓘ | 'Törnebohmite' | - | |
ⓘ | 'Melilite Group' | - | Ca2M(XSiO7) |
ⓘ | 'Britholite Group' | - | (REE,Ca)5[(Si,P)O4]3X |
ⓘ | 'Biotite var. Titanium-bearing Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
ⓘ | 'High-calcium pyroxene' | - | |
ⓘ | 'Alkali pyroxene' | - | |
ⓘ | 'Monazite' | - | REE(PO4) |
ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
ⓘ | 'K Feldspar' | - | |
ⓘ | 'Andradite-Grossular Series' | - | |
ⓘ | 'Clinopyroxene Subgroup' | - | |
ⓘ | 'Mica Group' | - | |
ⓘ | 'Limonite' | - | |
ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
ⓘ | 'Feldspar Group' | - | |
ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
ⓘ | 'Alkali Feldspar' | - |
List of minerals for each chemical element
H | Hydrogen | |
---|---|---|
H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
H | ⓘ Analcime | Na(AlSi2O6) · H2O |
H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
H | ⓘ Britholite-(Ce) | (Ce,Ca)5(SiO4)3OH |
H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
H | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
H | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
H | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
H | ⓘ Niocalite | (Ca,Nb)4(Si2O7)(O,OH,F)2 |
H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
H | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
H | ⓘ Talc | Mg3Si4O10(OH)2 |
H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
H | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
B | Boron | |
B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
C | Carbon | |
C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
C | ⓘ Calcite | CaCO3 |
C | ⓘ Diamond | C |
C | ⓘ Dolomite | CaMg(CO3)2 |
C | ⓘ Graphite | C |
C | ⓘ Strontianite | SrCO3 |
O | Oxygen | |
O | ⓘ Aegirine | NaFe3+Si2O6 |
O | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
O | ⓘ Albite | Na(AlSi3O8) |
O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
O | ⓘ Analcime | Na(AlSi2O6) · H2O |
O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
O | ⓘ Baddeleyite | ZrO2 |
O | ⓘ Baghdadite | Ca6Zr2(Si2O7)2O4 |
O | ⓘ Baryte | BaSO4 |
O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
O | ⓘ Britholite-(Ce) | (Ce,Ca)5(SiO4)3OH |
O | ⓘ Calcite | CaCO3 |
O | ⓘ Celestine | SrSO4 |
O | ⓘ Celsian | Ba(Al2Si2O8) |
O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
O | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
O | ⓘ Diopside | CaMgSi2O6 |
O | ⓘ Dolomite | CaMg(CO3)2 |
O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
O | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
O | ⓘ Forsterite | Mg2SiO4 |
O | ⓘ Gittinsite | CaZrSi2O7 |
O | ⓘ Grossular | Ca3Al2(SiO4)3 |
O | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
O | ⓘ Hedenbergite | CaFe2+Si2O6 |
O | ⓘ Hematite | Fe2O3 |
O | ⓘ Ilmenite | Fe2+TiO3 |
O | ⓘ Jacobsite | Mn2+Fe23+O4 |
O | ⓘ Jadeite | Na(Al,Fe3+)Si2O6 |
O | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
O | ⓘ Kimzeyite | Ca3Zr2(SiO4)(AlO4)2 |
O | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
O | ⓘ Larnite | Ca2SiO4 |
O | ⓘ Leucite | K(AlSi2O6) |
O | ⓘ Magnesioferrite | MgFe23+O4 |
O | ⓘ Magnetite | Fe2+Fe23+O4 |
O | ⓘ Monazite | REE(PO4) |
O | ⓘ Monticellite | CaMgSiO4 |
O | ⓘ Morimotoite | Ca3(TiFe2+)(SiO4)3 |
O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
O | ⓘ Nepheline | Na3K(Al4Si4O16) |
O | ⓘ Niocalite | (Ca,Nb)4(Si2O7)(O,OH,F)2 |
O | ⓘ Orthoclase | K(AlSi3O8) |
O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
O | ⓘ Perovskite | CaTiO3 |
O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
O | ⓘ Pyrophanite | Mn2+TiO3 |
O | ⓘ Quartz | SiO2 |
O | ⓘ Sanidine | K(AlSi3O8) |
O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Schorlomite | Ca3Ti2(SiO4)(Fe3+O4)2 |
O | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
O | ⓘ Spinel | MgAl2O4 |
O | ⓘ Stronalsite | Na2SrAl4Si4O16 |
O | ⓘ Strontianite | SrCO3 |
O | ⓘ Talc | Mg3Si4O10(OH)2 |
O | ⓘ Titanite | CaTi(SiO4)O |
O | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
O | ⓘ Ulvöspinel | TiFe22+O4 |
O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
O | ⓘ Wüstite | FeO |
O | ⓘ Wollastonite | Ca3(Si3O9) |
O | ⓘ Zircon | Zr(SiO4) |
O | ⓘ Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
O | ⓘ Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
O | ⓘ Pyroxene Group | ADSi2O6 |
O | ⓘ Garnet Group | X3Z2(SiO4)3 |
O | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
O | ⓘ Olivine Group | M2SiO4 |
O | ⓘ Melilite Group | Ca2M(XSiO7) |
O | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
O | ⓘ Diopside var. Titanium-bearing Diopside | Ca(Mg,Fe2+,Ti4+)(Si,Al)2O6 |
F | Fluorine | |
F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
F | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
F | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
F | ⓘ Fluorite | CaF2 |
F | ⓘ Niocalite | (Ca,Nb)4(Si2O7)(O,OH,F)2 |
F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
Na | Sodium | |
Na | ⓘ Aegirine | NaFe3+Si2O6 |
Na | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
Na | ⓘ Albite | Na(AlSi3O8) |
Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
Na | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
Na | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
Na | ⓘ Jadeite | Na(Al,Fe3+)Si2O6 |
Na | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
Na | ⓘ Nepheline | Na3K(Al4Si4O16) |
Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Na | ⓘ Stronalsite | Na2SrAl4Si4O16 |
Mg | Magnesium | |
Mg | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
Mg | ⓘ Diopside | CaMgSi2O6 |
Mg | ⓘ Dolomite | CaMg(CO3)2 |
Mg | ⓘ Forsterite | Mg2SiO4 |
Mg | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
Mg | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
Mg | ⓘ Magnesioferrite | MgFe23+O4 |
Mg | ⓘ Monticellite | CaMgSiO4 |
Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
Mg | ⓘ Spinel | MgAl2O4 |
Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
Mg | ⓘ Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
Mg | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
Mg | ⓘ Diopside var. Titanium-bearing Diopside | Ca(Mg,Fe2+,Ti4+)(Si,Al)2O6 |
Al | Aluminium | |
Al | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
Al | ⓘ Albite | Na(AlSi3O8) |
Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Al | ⓘ Celsian | Ba(Al2Si2O8) |
Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
Al | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
Al | ⓘ Jadeite | Na(Al,Fe3+)Si2O6 |
Al | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
Al | ⓘ Kimzeyite | Ca3Zr2(SiO4)(AlO4)2 |
Al | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
Al | ⓘ Leucite | K(AlSi2O6) |
Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Al | ⓘ Nepheline | Na3K(Al4Si4O16) |
Al | ⓘ Orthoclase | K(AlSi3O8) |
Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
Al | ⓘ Sanidine | K(AlSi3O8) |
Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
Al | ⓘ Spinel | MgAl2O4 |
Al | ⓘ Stronalsite | Na2SrAl4Si4O16 |
Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
Al | ⓘ Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
Al | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
Al | ⓘ Diopside var. Titanium-bearing Diopside | Ca(Mg,Fe2+,Ti4+)(Si,Al)2O6 |
Si | Silicon | |
Si | ⓘ Aegirine | NaFe3+Si2O6 |
Si | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
Si | ⓘ Albite | Na(AlSi3O8) |
Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
Si | ⓘ Baghdadite | Ca6Zr2(Si2O7)2O4 |
Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Si | ⓘ Britholite-(Ce) | (Ce,Ca)5(SiO4)3OH |
Si | ⓘ Celsian | Ba(Al2Si2O8) |
Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Si | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
Si | ⓘ Diopside | CaMgSi2O6 |
Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Si | ⓘ Forsterite | Mg2SiO4 |
Si | ⓘ Gittinsite | CaZrSi2O7 |
Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
Si | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
Si | ⓘ Jadeite | Na(Al,Fe3+)Si2O6 |
Si | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
Si | ⓘ Kimzeyite | Ca3Zr2(SiO4)(AlO4)2 |
Si | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
Si | ⓘ Larnite | Ca2SiO4 |
Si | ⓘ Leucite | K(AlSi2O6) |
Si | ⓘ Monticellite | CaMgSiO4 |
Si | ⓘ Morimotoite | Ca3(TiFe2+)(SiO4)3 |
Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Si | ⓘ Nepheline | Na3K(Al4Si4O16) |
Si | ⓘ Niocalite | (Ca,Nb)4(Si2O7)(O,OH,F)2 |
Si | ⓘ Orthoclase | K(AlSi3O8) |
Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
Si | ⓘ Quartz | SiO2 |
Si | ⓘ Sanidine | K(AlSi3O8) |
Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | ⓘ Schorlomite | Ca3Ti2(SiO4)(Fe3+O4)2 |
Si | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
Si | ⓘ Stronalsite | Na2SrAl4Si4O16 |
Si | ⓘ Talc | Mg3Si4O10(OH)2 |
Si | ⓘ Titanite | CaTi(SiO4)O |
Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
Si | ⓘ Wollastonite | Ca3(Si3O9) |
Si | ⓘ Zircon | Zr(SiO4) |
Si | ⓘ Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
Si | ⓘ Pyroxene Group | ADSi2O6 |
Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
Si | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
Si | ⓘ Olivine Group | M2SiO4 |
Si | ⓘ Melilite Group | Ca2M(XSiO7) |
Si | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
Si | ⓘ Diopside var. Titanium-bearing Diopside | Ca(Mg,Fe2+,Ti4+)(Si,Al)2O6 |
P | Phosphorus | |
P | ⓘ Monazite | REE(PO4) |
P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
P | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
S | Sulfur | |
S | ⓘ Alabandite | MnS |
S | ⓘ Baryte | BaSO4 |
S | ⓘ Celestine | SrSO4 |
S | ⓘ Chalcopyrite | CuFeS2 |
S | ⓘ Chalcocite | Cu2S |
S | ⓘ Covellite | CuS |
S | ⓘ Galena | PbS |
S | ⓘ Pyrite | FeS2 |
S | ⓘ Pyrrhotite | Fe1-xS |
S | ⓘ Sphalerite | ZnS |
Cl | Chlorine | |
Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
K | Potassium | |
K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
K | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
K | ⓘ Leucite | K(AlSi2O6) |
K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
K | ⓘ Nepheline | Na3K(Al4Si4O16) |
K | ⓘ Orthoclase | K(AlSi3O8) |
K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
K | ⓘ Sanidine | K(AlSi3O8) |
K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
Ca | Calcium | |
Ca | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
Ca | ⓘ Baghdadite | Ca6Zr2(Si2O7)2O4 |
Ca | ⓘ Britholite-(Ce) | (Ce,Ca)5(SiO4)3OH |
Ca | ⓘ Calcite | CaCO3 |
Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Ca | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
Ca | ⓘ Diopside | CaMgSi2O6 |
Ca | ⓘ Dolomite | CaMg(CO3)2 |
Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Ca | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
Ca | ⓘ Fluorite | CaF2 |
Ca | ⓘ Gittinsite | CaZrSi2O7 |
Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
Ca | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
Ca | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
Ca | ⓘ Kimzeyite | Ca3Zr2(SiO4)(AlO4)2 |
Ca | ⓘ Larnite | Ca2SiO4 |
Ca | ⓘ Monticellite | CaMgSiO4 |
Ca | ⓘ Morimotoite | Ca3(TiFe2+)(SiO4)3 |
Ca | ⓘ Niocalite | (Ca,Nb)4(Si2O7)(O,OH,F)2 |
Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
Ca | ⓘ Perovskite | CaTiO3 |
Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
Ca | ⓘ Schorlomite | Ca3Ti2(SiO4)(Fe3+O4)2 |
Ca | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
Ca | ⓘ Titanite | CaTi(SiO4)O |
Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
Ca | ⓘ Wollastonite | Ca3(Si3O9) |
Ca | ⓘ Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
Ca | ⓘ Melilite Group | Ca2M(XSiO7) |
Ca | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
Ca | ⓘ Diopside var. Titanium-bearing Diopside | Ca(Mg,Fe2+,Ti4+)(Si,Al)2O6 |
Ti | Titanium | |
Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Ti | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
Ti | ⓘ Ilmenite | Fe2+TiO3 |
Ti | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
Ti | ⓘ Morimotoite | Ca3(TiFe2+)(SiO4)3 |
Ti | ⓘ Perovskite | CaTiO3 |
Ti | ⓘ Pyrophanite | Mn2+TiO3 |
Ti | ⓘ Schorlomite | Ca3Ti2(SiO4)(Fe3+O4)2 |
Ti | ⓘ Titanite | CaTi(SiO4)O |
Ti | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
Ti | ⓘ Ulvöspinel | TiFe22+O4 |
Ti | ⓘ Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
Ti | ⓘ Diopside var. Titanium-bearing Diopside | Ca(Mg,Fe2+,Ti4+)(Si,Al)2O6 |
Mn | Manganese | |
Mn | ⓘ Alabandite | MnS |
Mn | ⓘ Jacobsite | Mn2+Fe23+O4 |
Mn | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
Mn | ⓘ Pyrophanite | Mn2+TiO3 |
Fe | Iron | |
Fe | ⓘ Aegirine | NaFe3+Si2O6 |
Fe | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Fe | ⓘ Chalcopyrite | CuFeS2 |
Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Fe | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
Fe | ⓘ Hematite | Fe2O3 |
Fe | ⓘ Ilmenite | Fe2+TiO3 |
Fe | ⓘ Jacobsite | Mn2+Fe23+O4 |
Fe | ⓘ Jadeite | Na(Al,Fe3+)Si2O6 |
Fe | ⓘ Magnesioferrite | MgFe23+O4 |
Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
Fe | ⓘ Morimotoite | Ca3(TiFe2+)(SiO4)3 |
Fe | ⓘ Pyrite | FeS2 |
Fe | ⓘ Pyrrhotite | Fe1-xS |
Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Fe | ⓘ Schorlomite | Ca3Ti2(SiO4)(Fe3+O4)2 |
Fe | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
Fe | ⓘ Ulvöspinel | TiFe22+O4 |
Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
Fe | ⓘ Wüstite | FeO |
Fe | ⓘ Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
Fe | ⓘ Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
Fe | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
Fe | ⓘ Diopside var. Titanium-bearing Diopside | Ca(Mg,Fe2+,Ti4+)(Si,Al)2O6 |
Cu | Copper | |
Cu | ⓘ Chalcopyrite | CuFeS2 |
Cu | ⓘ Chalcocite | Cu2S |
Cu | ⓘ Covellite | CuS |
Zn | Zinc | |
Zn | ⓘ Sphalerite | ZnS |
Sr | Strontium | |
Sr | ⓘ Celestine | SrSO4 |
Sr | ⓘ Stronalsite | Na2SrAl4Si4O16 |
Sr | ⓘ Strontianite | SrCO3 |
Y | Yttrium | |
Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
Zr | Zirconium | |
Zr | ⓘ Baddeleyite | ZrO2 |
Zr | ⓘ Baghdadite | Ca6Zr2(Si2O7)2O4 |
Zr | ⓘ Gittinsite | CaZrSi2O7 |
Zr | ⓘ Kimzeyite | Ca3Zr2(SiO4)(AlO4)2 |
Zr | ⓘ Zircon | Zr(SiO4) |
Nb | Niobium | |
Nb | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
Nb | ⓘ Niocalite | (Ca,Nb)4(Si2O7)(O,OH,F)2 |
Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
Ba | Barium | |
Ba | ⓘ Baryte | BaSO4 |
Ba | ⓘ Celsian | Ba(Al2Si2O8) |
Ba | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
Ce | Cerium | |
Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
Ce | ⓘ Britholite-(Ce) | (Ce,Ca)5(SiO4)3OH |
Ce | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
Nd | Neodymium | |
Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
Ta | Tantalum | |
Ta | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
Ta | ⓘ Microlite Group | A2-mTa2X6-wZ-n |
Pb | Lead | |
Pb | ⓘ Galena | PbS |
Localities in this Region
- Canary Islands
- Las Palmas Province
- Fuerteventura
- Fuerteventura Basal Complex
- Fuerteventura
- Las Palmas Province
Other Regions, Features and Areas containing this locality
African PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Ahijado, A., Casillas, R., Nagy, G., Fernández, C. (2005) Sr-rich minerals in a carbonatite skarn, Fuerteventura, Canary Islands (Spain) Mineralogy and Petrology, 84 (1) 107-127 doi:10.1007/s00710-005-0074-8