Irani
| Regional Level Types | |
|---|---|
| Iran | Country |
This page is currently not sponsored. Click here to sponsor this page.
Area:
1,648,195 km2
Type:
Mindat Locality ID:
14407
Long-form identifier:
mindat:1:2:14407:9
GUID (UUID V4):
976dd620-c9fe-4428-b78f-ea2dfba00d3d
Other/historical names associated with this locality:
Persia
Other Languages:
Farsi/Persian:
ایران
French:
Iran
German:
Iran
Italian:
Iran
Russian:
Иран
Simplified Chinese:
伊朗
Spanish:
Irán
Abkhaz:
Џьамтәыла
Achinese:
Iran
Adyghe:
Иран
Afrikaans:
Iran
Akan:
Iran
Albanian:
Irani
Alemannic:
Iran
Amharic:
ፋርስ
Anglo-Saxon:
Persealand
Arabic:
إيران
Aragonese:
Irán
Aramaic:
ܐܝܪܐܢ
Armenian:
Իրան
Aromanian:
Iran
Assamese:
ইৰাণ
Asturian:
Irán
Azeri:
İran
Bambara:
Iraŋ
Bashkir:
Иран
Basque:
Iran
Bavarian:
Iran
Belarusian:
Іран
Belarusian (Tarashkevitsa):
Іран
Bengali:
ইরান
Bishnupriya Manipuri:
ইরান
Bosnian:
Iran
Breton:
Iran
Buginese:
Iran
Bulgarian:
Иран
Burmese:
အီရန်နိုင်ငံ
Catalan:
Iran
Cebuano:
Iran
Central Bikol:
Iran
Central Kurdish/Sorani:
ئێران
Chavacano:
Irán
Chechen:
Иран
Cherokee:
ᎢᎴᏂ
Chuvash:
Иран
Classical Chinese:
伊朗
Cornish:
Iran
Corsican:
Iranu
Crimean Tatar (Latin):
İran
Croatian:
Iran
Czech:
Írán
Danish:
Iran
Doteli:
इरान
Dutch:
Iran
Dutch Low Saxon:
Iran
Dzongkha:
ཨི་རཱན་
Egyptian Arabic:
ايران
Erzya:
Иран Мастор
Esperanto:
Irano
Estonian:
Iraan
Ewe:
Iran nutome
Extremaduran:
Irán
Faroese:
Iran
Fiji Hindi:
Iran
Fijian:
Iran
Finnish:
Iran
Franco-Provençal:
Éran
Friulian:
Iran
Fula:
Iraan
Gagauz:
İran
Galician:
Irán
Gan:
伊朗
Georgian:
ირანი
Gilaki:
ايران
Greek:
Ιράν
Greenlandic:
Iran
Guarani:
Iran
Gujarati:
ઈરાન
Haitian:
Iran
Hakka:
Iran
Hausa:
Iran
Hawaiian:
‘Ilana
Hebrew:
איראן
Hindi:
ईरान
Hungarian:
Irán
Icelandic:
Íran
Ido:
Iran
Iloko:
Iran
Indonesian:
Iran
Ingush:
ХIиран
Interlingua:
Iran
Interlingue:
Iran
Irish Gaelic:
An Iaráin
Jamaican Patois:
Iran
Japanese:
イラン
Javanese:
Iran
Judaeo-Spanish:
Iran
Kabardian:
Къажэрей
Kabiye:
Iranɩ
Kabyle:
Iṛan
Kalmyk:
Сарта Иранмудин Орн
Kannada:
ಇರಾನ್
Kapampangan:
Iran
Karachay-Balkar:
Иран
Karakalpak:
İran
Kashmiri:
ایٖران
Kashubian:
Iran
Kazakh (Cyrillic Script):
Иран
Khmer:
អ៊ីរ៉ង់
Kikuyu:
Iran
Kinyarwanda:
Irani
Komi:
Иран
Kongo:
Iran
Konkani:
ईराण
Korean:
이란
Kurdish (Latin Script):
Îran
Kyrgyz:
Иран
Lao:
ປະເທດອິຫຼ້ານ
Latin:
Irania
Latvian:
Irāna
Lezghian:
Иран
Ligurian:
Iran
Limburgian:
Iran
Lingala:
Iran
Lingua Franca Nova:
Iran
Lithuanian:
Iranas
Livvi-Karelian:
Iran
Lojban:
iran
Lombard:
Iran
Low Saxon/Low German:
Iran
Lower Sorbian:
Iran
Luganda:
Yiraani
Luri:
ایران
Luxembourgish:
Iran
Macedonian:
Иран
Maithili:
इरान
Malagasy:
Iràna
Malay:
Iran
Malayalam:
ഇറാൻ
Maltese:
Iran
Manx:
Yn Eeraan
Maori:
Īrāna
Marathi:
इराण
Mazanderani:
ایران
Meadow Mari:
Иран
Min Dong Chinese:
Iran
Minangkabau:
Iran
Mingrelian:
ირანი
Minnan / Hokkien-Taiwanese:
Iran
Moksha:
Иран
Mongolian:
Иран улс
Nahuatl:
Iran
Nauruan:
Iran
Navajo:
Tsiikʼi Déíbaalí Bikéyah
Neapolitan:
Iran
Nepali:
इरान
Newar / Nepal Bhasa:
इरान
Norfolk:
Eraan
Northern Frisian:
Iraan
Northern Sami:
Iran
Northern Sotho:
Iran
Norwegian:
Iran
Norwegian (Nynorsk):
Iran
Novial:
Iran
Occitan:
Iran
Odia:
ଇରାନ
Oromo:
Iraan
Ossetian:
Иран
Pali:
ईरान
Pangasinan:
Iran
Papiamento:
Iran
Pashto:
ايران
Pennsylvania German:
Iraen
Picard:
Iran
Piedmontese:
Iran
Polish:
Iran
Portuguese:
Irão
Punjabi:
ਈਰਾਨ
Quechua:
Iran
Ripuarian:
Erahn
Romanian:
Iran
Romansh:
Iran
Rundi:
Irani
Russia Buriat:
Иран
Rusyn:
Іран
Samoan:
Iran
Samogitian:
Irans
Sango:
Iran
Sanskrit:
ईरान
Sardinian:
Iran
Saterland Frisian:
Iroan
Scots:
Iran
Scottish Gaelic:
Ioràn
Serbian:
Иран
Serbo-Croatian:
Iran
Shona:
Iran
Sicilian:
Iran
Silesian:
Iran
Sindhi:
ایران
Sinhalese:
ඉරානය
Slovak:
Irán
Slovenian:
Iran
Somali:
Iiraan
South Azerbaijani:
ایران
Sundanese:
Iran
Swahili:
Uajemi
Swati:
I-Irani
Swedish:
Iran
Tagalog:
Iran
Tajik (Cyrillic Script):
Эрон
Tamil:
ஈரான்
Tarantino:
Iran
Tatar:
Иран
Telugu:
ఇరాన్
Tetum:
Iraun
Thai:
ประเทศอิหร่าน
Tibetan (Standard):
ཡི་ལང་།
Tigrinya:
ኢራን
Tok Pisin:
Iran
Tongan:
ʻIulaani
Traditional Chinese:
伊朗
Tsonga:
Iran
Tulu:
ಇರಾನ್
Tumbuka:
Iran
Turkish:
İran
Turkmen:
Eýran
Tuvan:
Ирaн
Twi:
Iran
Udmurt:
Иран
Ukrainian:
Іран
Upper Sorbian:
Iran
Urdu:
ایران
Uyghur:
ئىران
Uzbek (Latin Script):
Eron
Venetian:
Iran
Veps:
Iran
Vietnamese:
Iran
Volapük:
Lirän
Võro:
Iraan
Walloon:
Iran
Waray:
Iran
Welsh:
Iran
West Flemish:
Iran
West Frisian:
Iran
Western Punjabi:
ایران
Wolof:
Iraan
Wu Chinese:
伊朗
Yakut:
Ираан
Yiddish:
איראן
Yoruba:
Ìránì
Zazaki:
İran
Zeelandic:
Iran
Zhuang:
Iran
Zulu:
I-Irani
Iran is divided into 31 ostanha (sing. ostan: provinces); the 31st province, Alborz, was created in June 2010. The provinces are subdivided into shahrestan (counties), which are in turn subdivided into bakhsh (districts).
Note: Westerners used to preferentially call the country "Persia" until 1935.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities451 valid minerals. 12 (TL) - type locality of valid minerals. 4 erroneous literature entries.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Localities: Reported from at least 6 localities in this region. |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Reported from at least 22 localities in this region. |
| ⓘ Adamite Formula: Zn2(AsO4)(OH) |
| ⓘ Aegirine Formula: NaFe3+Si2O6 Localities: References: |
| ⓘ Aegirine-augite Formula: (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 Localities: |
| ⓘ Aguilarite Formula: Ag4SeS |
| ⓘ Aikinite Formula: PbCuBiS3 Localities: References: |
| ⓘ Aktashite Formula: Cu6Hg3As4S12 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 41 localities in this region. References: |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] Locality: Glojeh district, Zanjan Province, Iran |
| ⓘ Albite var. Anorthoclase Formula: (Na,K)AlSi3O8 Localities: |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Al-chamosite' |
| ⓘ Algodonite Formula: (Cu1-xAsx) |
| ⓘ 'Alkali Feldspar' Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Alloclasite Formula: Co1-xFexAsS |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Locality: Alvand Mountains, Hamadan Province, Iran |
| ⓘ Altaite Formula: PbTe |
| ⓘ Althausite Formula: Mg4(PO4)2(OH,O)(F,◻) |
| ⓘ Alum-(K) Formula: KAl(SO4)2 · 12H2O |
| ⓘ Alunite Formula: KAl3(SO4)2(OH)6 Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Alunite Group' Formula: A0.5-1 B3[SO4]2(OH)6 Localities: |
| ⓘ Alunogen Formula: Al2(SO4)3 · 17H2O Localities: References: |
| ⓘ Amarantite Formula: Fe3+2(SO4)2O · 7H2O |
| ⓘ Amesite Formula: Mg2Al(AlSiO5)(OH)4 Localities: |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Localities: Reported from at least 25 localities in this region. |
| ⓘ 'Amphibole Supergroup var. Byssolite' Formula: AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Analcime Formula: Na(AlSi2O6) · H2O Localities: Reported from at least 14 localities in this region. References: |
| ⓘ Anatase Formula: TiO2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Andalusite Formula: Al2(SiO4)O Localities: |
| ⓘ 'Andorite' Formula: AgPbSb3S6 |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Localities: Reported from at least 9 localities in this region. Description: The individual demantoid crystals from these localities can reach more than 5 cm. Even though the majority of crystals are much smaller, there are surprisingly many crystals over 2 cm, often giving nice matrix specimens. The crystals are rarely transparent, and the locality is of limited interest for the gem industry. References: |
| ⓘ Andradite var. Demantoid Formula: Ca3Fe3+2(SiO4)3 Localities: Description: Demantoid from the area near Bagh Borj has been known in the international gem market since 2001. There are several active operations, both in tunnels and open cuts. Individual demantoid crystals may reach up to 5 cm, but are normally much smaller. Crystals of more than 1.5 cm must be considered large for the locality. Gem crystals are normally much smaller. The color ranges from yellowish green to deep green. |
| ⓘ Andradite var. Topazolite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 14 localities in this region. References: |
| ⓘ Anhydrite Formula: CaSO4 Localities: Reported from at least 19 localities in this region. |
| ⓘ Anilite Formula: Cu7S4 Localities: References: |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: Reported from at least 15 localities in this region. References: |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O Localities: References: |
| ⓘ Annabergite var. Magnesium-bearing Annabergite Formula: (Ni,Mg)3(AsO4)2 · 8H2O |
| ⓘ 'Annabergite-Erythrite Series' |
| ⓘ Annite Formula: KFe2+3(AlSi3O10)(OH)2 |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) Localities: Reported from at least 9 localities in this region. |
| ⓘ Anorthite var. Bytownite Formula: (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] Localities: |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 Localities: |
| ⓘ Formula: Sb Locality: Valilu Mines, Siahrud District, Jolfa County, East Azerbaijan Province, Iran - erroneously reported Description: Mined element, not native metal. |
| ⓘ Antlerite Formula: Cu3(SO4)(OH)4 Localities: |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: Reported from at least 30 localities in this region. References: |
| ⓘ Aphthitalite Formula: (K,Na)3Na(SO4)2 Localities: Habit: well formed hexagonal crystals up to about 7 cm Colour: white of a white/tan color in clusters |
| ⓘ Aragonite Formula: CaCO3 Localities: Reported from at least 11 localities in this region. |
| ⓘ Arcanite Formula: K2SO4 |
| ⓘ Arcubisite Formula: Ag6CuBiS4 |
| ⓘ Arfvedsonite Formula: [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 Localities: References: |
| ⓘ 'Arsenobismite' |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 25 localities in this region. References: |
| ⓘ Arsenquatrandorite (TL) Formula: Ag17.6Pb12.8Sb38.1As11.5S96 Type Locality: |
| ⓘ Atacamite Formula: Cu2(OH)3Cl Localities: Reported from at least 8 localities in this region. References: |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Localities: Reported from at least 15 localities in this region. |
| ⓘ Augite var. Ferroaugite |
| ⓘ Augite var. Titanium-bearing Augite Formula: (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 Localities: Reported from at least 6 localities in this region. Habit: acicular Colour: turqoise-blue-green References: |
| ⓘ Aurostibite Formula: AuSb2 |
| ⓘ Awaruite Formula: Ni3Fe |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH |
| ⓘ 'Axinite Group' |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Reported from at least 45 localities in this region. References: |
| ⓘ Baddeleyite Formula: ZrO2 |
| ⓘ Baksanite Formula: Bi6Te2S3 |
| ⓘ Barikaite (TL) Formula: Ag3Pb10(Sb8As11)S40 Type Locality: |
| ⓘ 'Barkevikite' |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 51 localities in this region. |
| ⓘ Baumhauerite Formula: Pb12As16S36 |
| ⓘ Bayerite Formula: Al(OH)3 |
| ⓘ Beaverite-(Cu) Formula: Pb(Fe3+2Cu)(SO4)2(OH)6 Localities: |
| ⓘ Benleonardite ? Formula: [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| ⓘ Bernalite Formula: Fe(OH)3 · nH2O (n = 0.0 to 0.25) |
| ⓘ Berryite Formula: Cu3Ag2Pb3Bi7S16 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: |
| ⓘ Beudantite Formula: PbFe3(AsO4)(SO4)(OH)6 |
| ⓘ 'Beudantite Group' Formula: AM3(XO4)(SO4)(OH)6 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 38 localities in this region. References: |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuth Formula: Bi Localities: Reported from at least 6 localities in this region. |
| ⓘ Bismuthinite Formula: Bi2S3 Localities: |
| ⓘ Bixbyite-(Mn) Formula: Mn3+2O3 |
| ⓘ Böhmite Formula: AlO(OH) Localities: Mombi Bauxite Deposit, Kohgiluyeh County, Kohgiluyeh and Boyer-Ahmad Province, Iran Mombi bauxite deposit, Qaleh Mombi, Bahmai County, Kohgiluyeh and Boyer-Ahmad Province, Iran Bidgol deposit, Marvdasht County, Fars Province, Iran Dopolan bauxite deposit, Kiar County, Chaharmahal and Bakhtiari Province, Iran |
| ⓘ Boleite Formula: KPb26Ag9Cu24(OH)48Cl62 |
| ⓘ Boltwoodite Formula: (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| ⓘ Bonattite Formula: CuSO4 · 3H2O |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 48 localities in this region. |
| ⓘ Botryogen Formula: MgFe3+(SO4)2(OH) · 7H2O |
| ⓘ Boulangerite Formula: Pb5Sb4S11 Localities: |
| ⓘ Bournonite Formula: PbCuSbS3 Localities: References: |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 Localities: |
| ⓘ 'Britholite Group' Formula: (REE,Ca)5[(Si,P)O4]3X |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Qaleh-Zari Mine (Ghale Zari Mine), Nehbandan County, South Khorasan Province, Iran Sar Cheshmeh Mine (Sarcheshmeh Mine), Pariz, Sirjan County, Kerman Province, Iran Lāghe Morād mines, Veshnaveh, Aran and Bidgol County, Isfahan Province, Iran Nahand-Ivand area, Shabestar County, East Azerbaijan Province, Iran Bayche-Bagh Mine, Mahneshan County, Zanjan Province, Iran References: |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Brushite Formula: Ca(PO3OH) · 2H2O |
| ⓘ Bustamite Formula: CaMn2+(Si2O6) |
| ⓘ Butlerite Formula: Fe3+(SO4)(OH) · 2H2O Localities: References: |
| ⓘ Cadwaladerite Formula: Al5(H2O)3(OH)12 · n(Cl,H2O) |
| ⓘ 'Calamine' |
| ⓘ Calaverite Formula: AuTe2 |
| ⓘ 'Calcic plagioclase' |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 112 localities in this region. References: |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 |
| ⓘ 'Calcite Group' Formula: AXO3 |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 Localities: References: |
| ⓘ Cassiterite Formula: SnO2 Localities: |
| ⓘ Celadonite Formula: K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ Celestine Formula: SrSO4 Localities: |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 34 localities in this region. |
| ⓘ Cesanite Formula: Na3Ca2(SO4)3(OH) |
| ⓘ 'Chabazite' |
| ⓘ Chabazite-Ca Formula: (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O Locality: Kahrizak Mountains, Qom Province, Iran |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O Localities: References: |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 51 localities in this region. |
| ⓘ Chalcophanite Formula: ZnMn4+3O7 · 3H2O |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 112 localities in this region. References: |
| ⓘ Chalcostibite Formula: CuSbS2 |
| ⓘ Chamosite Formula: (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ Chamosite var. Brunsvigite Formula: (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| ⓘ Chlorapatite Formula: Ca5(PO4)3Cl |
| ⓘ 'Chlorite Group' Localities: Reported from at least 76 localities in this region. |
| ⓘ Christite ? Formula: TlHgAsS3 Description: "bright, needle-shaped inclusions in massive orpiment, too small (<5 μm) to be analysed quantitatively." (Asadi et al., 2001). |
| ⓘ 'Chrome-Spinel (of Dana)' |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 Localities: Reported from at least 9 localities in this region. |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: Reported from at least 18 localities in this region. |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Cinnabar Formula: HgS Localities: |
| ⓘ 'Clay minerals' |
| ⓘ Clinoatacamite Formula: Cu2(OH)3Cl |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: Reported from at least 11 localities in this region. |
| ⓘ Clinochlore var. Ripidolite Formula: (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| ⓘ 'Clinopyroxene Subgroup' Localities: Reported from at least 18 localities in this region. |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: |
| ⓘ Clintonite Formula: CaAlMg2(SiAl3O10)(OH)2 |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Cobaltpentlandite Formula: Co9S8 |
| ⓘ Coffinite Formula: U(SiO4) · nH2O |
| ⓘ Colemanite Formula: Ca[B3O4(OH)3] · H2O |
| ⓘ Coloradoite Formula: HgTe |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Description: Crystal aggregates of 1cm by 0.5cm in pegmatites, found in an outcrop during a road construction. |
| ⓘ Conichalcite Formula: CaCu(AsO4)(OH) |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ Copiapite Formula: Fe2+Fe3+4(SO4)6(OH)2 · 20H2O Localities: References: |
| ⓘ Copper Formula: Cu Localities: Reported from at least 17 localities in this region. |
| ⓘ Coquimbite Formula: AlFe3(SO4)6(H2O)12 · 6H2O Localities: |
| ⓘ Corderoite ? Formula: Hg2+3S2Cl2 Description: Suspicious bromine and chlorine contents of some mercury sulphide grains suggest the presence of corderoite. |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 Localities: References: |
| ⓘ Cosalite Formula: Pb2Bi2S5 |
| ⓘ Cotunnite Formula: PbCl2 |
| ⓘ Covellite Formula: CuS Localities: Reported from at least 56 localities in this region. References: |
| ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 |
| ⓘ Cubanite Formula: CuFe2S3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Cuprite Formula: Cu2O Localities: Reported from at least 13 localities in this region. References: |
| ⓘ Cuprosklodowskite Formula: Cu(UO2)2(SiO3OH)2 · 6H2O |
| ⓘ Cuprospinel Formula: Cu2+Fe3+2O4 |
| ⓘ Curite Formula: Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| ⓘ Daliranite (TL) Formula: PbHgAs2S5 Type Locality: |
| ⓘ Danburite Formula: CaB2Si2O8 Localities: |
| ⓘ Formula: Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 Locality: Chogart Mine, Bafq County, Yazd Province, Iran - erroneously reported Description: Submicroscopic crystals of an unusual complex REE-rich iron-titanate from the apatite-magnetite ore of the Chogart mine/Iran were proved to be davidite. Average calculated unit-cell composition from microprobe analyses, normalized to 38 oxygens, is (Ce0.38, La0.35) Σ0.73 (Y0.69, Ti13,20, Fe6,33, V0.43, Mn0.21, Mg0.09) Σ20.95O38. The mineral appears as traces and as small euhedral crystals representing a late-stage mineral phase in minute open spaces and finest fractures of the magnetite ore. The mineral is opaque and behaves totally isotropic in the reflected light. The reflectance is 18-6 % in air (546 nm) |
| ⓘ Davidite-(La) Formula: La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| ⓘ Delafossite Formula: CuFeO2 Localities: |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) Localities: Chah Milleh Mine (Chah Mileh Mine; Tchah-Mille Mine), Chah Milleh (Chah-Mileh; Tchah-Mille), Anarak District, Nain County, Isfahan Province, Iran Chah Khouni Mine, Anarak District, Nain County, Isfahan Province, Iran Gowd Mine (Gowde-Mine; Maadan-e-Gowde), Anarak District, Nain County, Isfahan Province, Iran References: |
| ⓘ Diaboleite Formula: Pb2CuCl2(OH)4 Localities: References: |
| ⓘ Diaspore Formula: AlO(OH) Localities: Mombi Bauxite Deposit, Kohgiluyeh County, Kohgiluyeh and Boyer-Ahmad Province, Iran Mombi bauxite deposit, Qaleh Mombi, Bahmai County, Kohgiluyeh and Boyer-Ahmad Province, Iran Bidgol deposit, Marvdasht County, Fars Province, Iran Dopolan bauxite deposit, Kiar County, Chaharmahal and Bakhtiari Province, Iran Huri bauxite deposit, Ajab Shir County, East Azerbaijan Province, Iran |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 Localities: |
| ⓘ Digenite Formula: Cu9S5 Localities: Reported from at least 18 localities in this region. |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: Reported from at least 19 localities in this region. |
| ⓘ Diopside var. Salite Localities: |
| ⓘ Dioptase Formula: CuSiO3 · H2O Localities: |
| ⓘ Djurleite Formula: Cu31S16 Localities: |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 52 localities in this region. |
| ⓘ Dolomite var. Iron-bearing Dolomite Formula: Ca(Mg,Fe)(CO3)2 Localities: References: |
| ⓘ Domeykite Formula: Cu3As Localities: References: |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Edenite Formula: NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ Emplectite Formula: CuBiS2 |
| ⓘ Enargite Formula: Cu3AsS4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Enstatite Formula: Mg2Si2O6 Localities: Reported from at least 7 localities in this region. |
| ⓘ Enstatite var. Bronzite Formula: (Mg,Fe2+)2[SiO3]2 Localities: |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 45 localities in this region. References: |
| ⓘ Epistilbite Formula: CaAl2Si6O16 · 5H2O |
| ⓘ Eriochalcite Formula: CuCl2 · 2H2O |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O Localities: |
| ⓘ Erythrosiderite Formula: K2[Fe3+Cl5(H2O)] |
| ⓘ Fairfieldite Formula: Ca2Mn2+(PO4)2 · 2H2O |
| ⓘ Famatinite Formula: Cu3SbS4 Localities: |
| ⓘ Fayalite Formula: Fe2+2SiO4 Localities: |
| ⓘ 'Fayalite-Forsterite Series' Localities: Reported from at least 19 localities in this region. |
| ⓘ 'Feldspar Group' Localities: Reported from at least 14 localities in this region. |
| ⓘ 'Feldspar Group var. Perthite' Localities: Reported from at least 6 localities in this region. |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Ferdowsiite (TL) Formula: Ag8(Sb5As3)S16 Type Locality: |
| ⓘ Ferdowsiite var. Lead-bearing Ferdowsiite Formula: (Ag,Pb)8(Sb5As3)S16 |
| ⓘ Ferro-actinolite Formula: ◻Ca2Fe2+5(Si8O22)(OH)2 |
| ⓘ Ferro-hornblende Formula: ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: Agh-Darreh Mine, Takab County, West Azerbaijan Province, Iran Chogart Mine, Bafq County, Yazd Province, Iran Chador Malu Fe deposit, Ardakan County, Yazd Province, Iran Panj-Kuh iron deposit (Panj-Kuh iron mine), Damghan County, Semnan Province, Iran Qalat Payeen, Bandar Abbas County, Hormozgan Province, Iran |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 13 localities in this region. |
| ⓘ Fornacite Formula: Pb2Cu(CrO4)(AsO4)(OH) Localities: |
| ⓘ Forsterite Formula: Mg2SiO4 Localities: Reported from at least 7 localities in this region. |
| ⓘ Francoanellite Formula: K3Al5(PO3OH)6(PO4)2 · 12H2O |
| ⓘ Friedrichite Formula: Pb5Cu5Bi7S18 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 90 localities in this region. References: |
| ⓘ Galena var. Bismuth-bearing Galena Formula: (Pb,Bi,Ag)S |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag |
| ⓘ Galenobismutite Formula: PbBi2S4 |
| ⓘ Galkhaite Formula: (Hg5Cu)CsAs4S12 |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 11 localities in this region. |
| ⓘ 'Garnierite' |
| ⓘ Geerite Formula: Cu8S5 Localities: Baryte deposit, Ardakan (Ardekan), Ardakan County, Yazd Province, Iran Unnamed prosects (Sharosh Village), Qandil range, Kurdistan Province, Iran Chah-Mesi epithermal vein deposit, Shahr-e Babak, Shahr-e Babak County, Kerman Province, Iran Nahand-Ivand area, Shabestar County, East Azerbaijan Province, Iran References: |
| ⓘ Gehlenite Formula: Ca2Al[AlSiO7] |
| ⓘ Geocronite Formula: Pb14Sb6S23 Localities: |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ Getchellite Formula: AsSbS3 Localities: References: |
| ⓘ Gibbsite Formula: Al(OH)3 Localities: |
| ⓘ 'Glass' Localities: Reported from at least 8 localities in this region. |
| ⓘ Glauberite Formula: Na2Ca(SO4)2 |
| ⓘ Glaucophane Formula: ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| ⓘ Godlevskite Formula: (Ni,Fe)9S8 |
| ⓘ Goethite Formula: α-Fe3+O(OH) Localities: Reported from at least 55 localities in this region. |
| ⓘ Gold Formula: Au Localities: Reported from at least 39 localities in this region. |
| ⓘ Gold var. Electrum Formula: (Au,Ag) Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Gonnardite Formula: (Na,Ca)2(Si,Al)5O10 · 3H2O Locality: Kahrizak Mountains, Qom Province, Iran |
| ⓘ Görgeyite Formula: K2Ca5(SO4)6 · H2O |
| ⓘ Goyazite Formula: SrAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Graphite Formula: C Localities: References: |
| ⓘ Greenalite Formula: (Fe2+,Fe3+)2-3Si2O5(OH)4 Localities: |
| ⓘ Greenockite Formula: CdS Localities: |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 Localities: |
| ⓘ Guettardite Formula: Pb8(Sb0.56As0.44)16S32 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 29 localities in this region. |
| ⓘ Halite Formula: NaCl Localities: Reported from at least 18 localities in this region. |
| ⓘ Halloysite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Halotrichite Formula: FeAl2(SO4)4 · 22H2O |
| ⓘ Haüyne Formula: Na3Ca(Si3Al3)O12(SO4) Localities: References: |
| ⓘ Hawleyite Formula: CdS |
| ⓘ Haycockite Formula: Cu4Fe5S8 |
| ⓘ Hayyanite (TL) Formula: Cu5Ag11Pb76Sb71As17(As2+)8S224 Type Locality: |
| ⓘ Heazlewoodite Formula: Ni3S2 Localities: |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 Localities: |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 102 localities in this region. References: |
| ⓘ Hematite var. Martite Formula: Fe2O3 Localities: |
| ⓘ Hematite var. Specularite Formula: Fe2O3 Localities: Reported from at least 8 localities in this region. |
| ⓘ Hemihedrite Formula: Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| ⓘ 'Hemihedrite-Iranite Series' |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Localities: Reported from at least 23 localities in this region. References: |
| ⓘ Herbertsmithite Formula: Cu3Zn(OH)6Cl2 Localities: References: |
| ⓘ Hercynite Formula: Fe2+Al2O4 |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ Hetaerolite Formula: ZnMn2O4 Localities: |
| ⓘ Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ Hexahydrite Formula: MgSO4 · 6H2O |
| ⓘ Hollandite Formula: Ba(Mn4+6Mn3+2)O16 |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Hörnesite Formula: Mg3(AsO4)2 · 8H2O |
| ⓘ Hutchinsonite Formula: TlPbAs5S9 |
| ⓘ Hydroboracite Formula: CaMg[B3O4(OH)3]2 · 3H2O |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 |
| ⓘ Hydromagnesite Formula: Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ 'Hydromolysite' Formula: FeCl3 · 6H2O |
| ⓘ Hydroniumjarosite Formula: (H3O)Fe3+3(SO4)2(OH)6 |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 Localities: Reported from at least 12 localities in this region. References: |
| ⓘ 'Hypersthene' Formula: (Mg,Fe)SiO3 |
| ⓘ Hyršlite Formula: Pb8As10Sb6S32 Localities: Description: Note: The "unidentified sulphosalt" with an ideal formula of "Pb(As,Sb)2S4" (empirical formula Pb1.085(As,Sb)1.86S4.06) and an As:Sb ratio of 2:1 (Asadi et al., 2001; note that the text erroneously gives a ratio of 1:2, contradicting the values and empirical formula in table 7) is hyršlite. |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 14 localities in this region. |
| ⓘ Ingodite Formula: Bi2TeS |
| ⓘ Iodargyrite Formula: AgI |
| ⓘ Iranite (TL) Formula: Pb10Cu(CrO4)6(SiO4)2(OH)2 Localities: |
| ⓘ Iron Formula: Fe Localities: Chahnaly deposit (Chahnali prospect), Bazman Volcano, Iranshahr County, Sistan and Baluchestan Province, Iran Veramin meteorite, Karand, Tehran Province, Iran Naragh meteorite, Naragh (Naraq; Narāq; Narāk), Delijan County, Markazi Province, Iran Famenin meteorite, Famenin County, Hamadan Province, Iran |
| ⓘ Iron var. Kamacite Formula: (Fe,Ni) Localities: References: |
| ⓘ 'Iron-bearing pargasite' |
| ⓘ 'Iron Group' Localities: Kerman 001 meteorite, Kerman meteorite field, Kerman County, Kerman Province, Iran Kerman 002 meteorite, Kerman meteorite field, Kerman County, Kerman Province, Iran Kerman 003 meteorite, Kerman meteorite field, Kerman County, Kerman Province, Iran Shahdad meteorite, Kerman meteorite field, Kerman County, Kerman Province, Iran |
| ⓘ 'Iron oxide' |
| ⓘ 'Iron sulfide' |
| ⓘ Jacobsite Formula: Mn2+Fe3+2O4 |
| ⓘ Jalpaite Formula: Ag3CuS2 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 Localities: Reported from at least 17 localities in this region. |
| ⓘ 'Jasper' Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Joséite' Formula: Bi4TeS2 |
| ⓘ Kaersutite Formula: NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 Localities: |
| ⓘ Kainite Formula: KMg(SO4)Cl · 3H2O |
| ⓘ Kalinite Formula: KAl(SO4)2 · 11H2O |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 28 localities in this region. |
| ⓘ Kermesite Formula: Sb2S2O Localities: |
| ⓘ 'K Feldspar' Localities: Reported from at least 21 localities in this region. |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 Localities: |
| ⓘ Khademite (TL) Formula: Al(SO4)F · 5H2O Type Locality: |
| ⓘ Kieserite Formula: MgSO4 · H2O |
| ⓘ Kobellite Formula: Pb22Cu4(Bi,Sb)30S69 |
| ⓘ Kornelite Formula: Fe2(SO4)3 · 7H2O |
| ⓘ Koutekite Formula: Cu5As2 Localities: References: |
| ⓘ Krauskopfite Formula: BaSi2O5 · 3H2O |
| ⓘ Krupkaite Formula: PbCuBi3S6 |
| ⓘ Kutinaite Formula: Ag6Cu14As7 |
| ⓘ Kutnohorite Formula: CaMn2+(CO3)2 |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O Localities: |
| ⓘ Lautite Formula: CuAsS Localities: |
| ⓘ Lavendulan Formula: NaCaCu5(AsO4)4Cl · 5H2O Localities: |
| ⓘ Lawsonite Formula: CaAl2(Si2O7)(OH)2 · H2O |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 Localities: |
| ⓘ Lemanskiite Formula: NaCaCu5(AsO4)4Cl · 3H2O |
| ⓘ Leonite Formula: K2Mg(SO4)2 · 4H2O |
| ⓘ Lepidocrocite Formula: γ-Fe3+O(OH) Localities: |
| ⓘ Leucite Formula: K(AlSi2O6) Localities: |
| ⓘ 'Leucite phonolite' |
| ⓘ Leucophosphite Formula: KFe3+2(PO4)2(OH) · 2H2O |
| ⓘ 'Lévyne' Locality: Kahrizak Mountains, Qom Province, Iran |
| ⓘ 'Limonite' Localities: Reported from at least 44 localities in this region. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 Localities: Qaleh-Zari Mine (Ghale Zari Mine), Nehbandan County, South Khorasan Province, Iran Darreh Zanjir Mine, Taft County, Yazd Province, Iran Chah Milleh Mine (Chah Mileh Mine; Tchah-Mille Mine), Chah Milleh (Chah-Mileh; Tchah-Mille), Anarak District, Nain County, Isfahan Province, Iran Ray County, Tehran Province, Iran Gowd Mine (Gowde-Mine; Maadan-e-Gowde), Anarak District, Nain County, Isfahan Province, Iran References: |
| ⓘ Lindackerite Formula: CuCu4(AsO4)2(HAsO4)2 · 9H2O |
| ⓘ Lishizhenite Formula: ZnFe2(SO4)4 · 14H2O |
| ⓘ Litharge Formula: PbO Localities: |
| ⓘ Löllingite Formula: FeAs2 Localities: |
| ⓘ Lopatkaite Formula: Pb5Sb3AsS11 |
| ⓘ Lorándite Formula: TlAsS2 |
| ⓘ Formula: PbFe3+4As3+10O22 Locality: Zareh Shuran Mine, Takab County, West Azerbaijan Province, Iran - erroneously reported |
| ⓘ Luzonite Formula: Cu3AsS4 |
| ⓘ Maghemite Formula: (Fe3+0.67◻0.33)Fe3+2O4 Localities: Kerman 001 meteorite, Kerman meteorite field, Kerman County, Kerman Province, Iran Kerman 002 meteorite, Kerman meteorite field, Kerman County, Kerman Province, Iran Kerman 003 meteorite, Kerman meteorite field, Kerman County, Kerman Province, Iran Shahdad meteorite, Kerman meteorite field, Kerman County, Kerman Province, Iran |
| ⓘ Magnesiocopiapite Formula: MgFe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ Magnesio-hornblende Formula: ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ Magnesite Formula: MgCO3 Localities: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 62 localities in this region. |
| ⓘ Magnetite var. Titanium-bearing Magnetite Formula: Fe2+(Fe3+,Ti)2O4 Localities: |
| ⓘ Makovickyite Formula: Cu1.12Ag0.81Pb0.27Bi5.35S9 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 78 localities in this region. References: |
| ⓘ Maldonite Formula: Au2Bi |
| ⓘ 'Manganese Oxides' Localities: Agh-Darreh Mine, Takab County, West Azerbaijan Province, Iran Angouran Mine, Sheykhlar, Mahneshan County, Zanjan Province, Iran Kopeh Halvaei area, Anarak District, Nain County, Isfahan Province, Iran Sangan iron ore mine, Razavi Khorasan Province, Iran Kolijan bauxite deposit, Mahabad County, West Azerbaijan Province, Iran |
| ⓘ 'Manganese Oxides var. Manganese Dendrites' |
| ⓘ Manganite Formula: Mn3+O(OH) Localities: References: |
| ⓘ Mansfieldite Formula: AlAsO4 · 2H2O |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 18 localities in this region. |
| ⓘ Marialite Formula: Na4Al3Si9O24Cl Localities: |
| ⓘ Marrite Formula: AgPbAsS3 |
| ⓘ 'Maskelynite' Description: Glass of composition close to that of the meteorites largely equilibrated albitic plagioclase (10 vol%)is found in a few chondrules and elsewhere. |
| ⓘ Matildite Formula: AgBiS2 Localities: References: |
| ⓘ Maucherite Formula: Ni11As8 |
| ⓘ Melanothallite Formula: Cu2Cl2O |
| ⓘ Melanterite Formula: Fe2+(H2O)6SO4 · H2O |
| ⓘ 'Melilite Group' Formula: Ca2M(XSiO7) |
| ⓘ 'Melnikovite' Localities: |
| ⓘ Meneghinite Formula: Pb13CuSb7S24 |
| ⓘ Merrillite Formula: Ca9NaMg(PO4)7 |
| ⓘ Mesolite Formula: Na2Ca2Si9Al6O30 · 8H2O Localities: |
| ⓘ Metacinnabar Formula: HgS |
| ⓘ Metavoltine (TL) Formula: K2Na6Fe2+Fe3+6O2(SO4)12 · 18H2O Localities: Description: Occurs as an alteration of pyritic trachyte. References: |
| ⓘ Metazeunerite Formula: Cu(UO2)2(AsO4)2 · 8H2O |
| ⓘ 'Meteoritic Iron' Description: Only kamacite is explicitly reported by McCausland et al.,2016. |
| ⓘ Miargyrite Formula: AgSbS2 |
| ⓘ 'Mica Group' Localities: |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Microlite Group' Formula: A2-mTa2X6-wZ-n Localities: References: |
| ⓘ Millerite Formula: NiS |
| ⓘ Millosevichite Formula: Al2(SO4)3 |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Mimetite-Pyromorphite Series' |
| ⓘ Minium Formula: Pb3O4 |
| ⓘ Mitscherlichite Formula: K2CuCl4 · 2H2O |
| ⓘ Mixite Formula: BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 15 localities in this region. References: |
| ⓘ 'Monazite' Formula: REE(PO4) Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O Localities: Reported from at least 12 localities in this region. References: |
| ⓘ Mordenite Formula: (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O Locality: Kahrizak Mountains, Qom Province, Iran |
| ⓘ Murdochite Formula: Cu12Pb2O15Cl2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 75 localities in this region. |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 Localities: Reported from at least 19 localities in this region. |
| ⓘ Muscovite var. Phengite Formula: KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 Localities: |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 53 localities in this region. |
| ⓘ Nacrite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Natrojarosite Formula: NaFe3(SO4)2(OH)6 Localities: |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O Localities: |
| ⓘ Natrouranospinite Formula: Na2(UO2)2(AsO4)2 · 5H2O |
| ⓘ Naumannite Formula: Ag2Se |
| ⓘ Nepheline Formula: Na3K(Al4Si4O16) Localities: Reported from at least 8 localities in this region. |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Nickelskutterudite Formula: (Ni,Co,Fe)As3 |
| ⓘ Niter Formula: KNO3 |
| ⓘ Nontronite Formula: Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ Nukundamite Formula: Cu3.33Fe0.66S4 |
| ⓘ 'Olivine Group' Formula: M2SiO4 Localities: |
| ⓘ Omphacite Formula: (NaaCabFe2+cMgd)(AleFe3+fFe2+gMgh)Si2O6 |
| ⓘ Opal Formula: SiO2 · nH2O Locality: Kuh-e-Aradeh, Tehran Province, Iran |
| ⓘ Orpiment Formula: As2S3 Localities: Reported from at least 8 localities in this region. |
| ⓘ Orthoclase Formula: K(AlSi3O8) Localities: Reported from at least 12 localities in this region. References: |
| ⓘ 'Orthopyroxene Subgroup' Localities: Reported from at least 8 localities in this region. Description: Orthopyroxene [71 vol% of silicates], compositional range [En~60-80%] following Prinz et al.(1980) References: |
| ⓘ Osmium Formula: (Os,Ir,Ru) |
| ⓘ Palygorskite Formula: ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O Localities: |
| ⓘ Parabutlerite Formula: Fe3+(SO4)(OH) · 2H2O |
| ⓘ Paragonite Formula: NaAl2(AlSi3O10)(OH)2 |
| ⓘ Pararammelsbergite Formula: NiAs2 Localities: |
| ⓘ Paratacamite Formula: Cu3(Cu,Zn)(OH)6Cl2 Localities: References: |
| ⓘ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ Parisite-(Ce) Formula: CaCe2(CO3)3F2 |
| ⓘ Pearceite Formula: [Ag6As2S7][Ag9CuS4] Localities: |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 Localities: |
| ⓘ Pertlikite (TL) Formula: K2(Fe2+,Mg)2Mg4Fe3+2Al(SO4)12 · 18H2O Type Locality: Description: Single crystals up to 1 cm in pyrite-bearing trachytic eruptive rock with metavoltine, botryogen, pyrite and alunite. Probably formed after the decomposition of pyrite. |
| ⓘ 'Petroleum' |
| ⓘ 'Petroleum var. Bitumen' Localities: References: |
| ⓘ Pharmacolite Formula: Ca(HAsO4) · 2H2O |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Phoenicochroite Formula: Pb2(CrO4)O Localities: |
| ⓘ Phosgenite Formula: Pb2CO3Cl2 |
| ⓘ Phosphammite Formula: (NH4)2(PO3OH) |
| ⓘ Picromerite Formula: K2Mg(SO4)2 · 6H2O |
| ⓘ Picropharmacolite Formula: Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| ⓘ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ Pitticite Formula: (Fe, AsO4, H2O) (?) |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: Reported from at least 43 localities in this region. |
| ⓘ Plagionite Formula: Pb5Sb8S17 |
| ⓘ Planerite Formula: Al6(PO4)2(PO3OH)2(OH)8 · 4H2O Localities: |
| ⓘ Plattnerite Formula: PbO2 Localities: Reported from at least 8 localities in this region. References: |
| ⓘ 'Plessite' |
| ⓘ Plumbogummite Formula: PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ 'Plumbogummite Group' |
| ⓘ Plumbojarosite Formula: Pb0.5Fe3+3(SO4)2(OH)6 Localities: |
| ⓘ Poitevinite Formula: (Cu,Fe)SO4 · H2O |
| ⓘ Polhemusite Formula: (Zn,Hg)S |
| ⓘ Polybasite Formula: [Ag6Sb2S7][Ag9CuS4] |
| ⓘ Polydymite Formula: Ni2+Ni3+2S4 |
| ⓘ Polyhalite Formula: K2Ca2Mg(SO4)4 · 2H2O |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O |
| ⓘ Powellite Formula: Ca(MoO4) |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Pseudoboleite Formula: Pb31Cu24Cl62(OH)48 |
| ⓘ 'Pseudoleucite' |
| ⓘ 'Psilomelane' Localities: Bavanat deposit (Jian deposit), Bavanat County, Fars Province, Iran Kharapeh deposit, Piranshahr intrusion, Piranshahr County, West Azerbaijan Province, Iran Dehoo manganese deposit, Dehoo, Zahedan County, Sistan and Baluchestan Province, Iran Garmab-e-Paein deposit, Shahrud County, Semnan Province, Iran Ab‐Bid deposit, Ravar County, Kerman Province, Iran |
| ⓘ 'Pumpellyite Subgroup' Formula: Ca2XAl2[Si2O6(OH)][SiO4](OH)2A Localities: |
| ⓘ Pyrargyrite Formula: Ag3SbS3 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 133 localities in this region. References: |
| ⓘ Pyrite var. Arsenic-bearing Pyrite Formula: Fe(S,As)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Pyrite var. Gold-bearing Pyrite Formula: FeS2 |
| ⓘ 'Pyrocoproite' Formula: (K,Na)2Mg(P2O7) |
| ⓘ Pyrolusite Formula: Mn4+O2 Localities: Reported from at least 12 localities in this region. |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Darreh Zanjir Mine, Taft County, Yazd Province, Iran Chah Kuh, Esfahan (Isfahan), Isfahan County, Isfahan Province, Iran Angouran Mine, Sheykhlar, Mahneshan County, Zanjan Province, Iran Chah Kharboze Mine (Tchah-Kharboze Mine; Chah-Karbuzeh Mine), Chah Kharboze (Tchah-Kharboze), Anarak District, Nain County, Isfahan Province, Iran Ahmad Abad Mine, Bafq County, Yazd Province, Iran |
| ⓘ Pyrophyllite Formula: Al2Si4O10(OH)2 Localities: Arabshah kaolin deposit, Takab geothermal field, Takab County, West Azerbaijan Province, Iran Mighan Playa, Arak County, Markazi Province, Iran Chah-Mesi epithermal vein deposit, Shahr-e Babak, Shahr-e Babak County, Kerman Province, Iran Huri bauxite deposit, Ajab Shir County, East Azerbaijan Province, Iran |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 Localities: Reported from at least 18 localities in this region. |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 29 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 138 localities in this region. |
| ⓘ Quartz var. Agate Localities: |
| ⓘ Quartz var. Agate-Jasper Formula: SiO2 |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Quartz var. Dendritic Agate Formula: SiO2 |
| ⓘ Quartz var. Fortification Agate Formula: SiO2 |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Quartz var. Moss Agate Formula: SiO2 |
| ⓘ Quartz var. Plume Agate Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rammelsbergite Formula: NiAs2 Localities: References: |
| ⓘ Realgar Formula: As4S4 Localities: Reported from at least 8 localities in this region. |
| ⓘ Rhodochrosite Formula: MnCO3 Localities: |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] |
| ⓘ 'Rhombohedral Carbonate' Formula: (Ca/Mg/Fe/Mn etc)CO3 |
| ⓘ Riebeckite Formula: ◻[Na2][Fe2+3Fe3+2]Si8O22(OH)2 |
| ⓘ Rinneite Formula: K3Na[FeCl6] |
| ⓘ Römerite Formula: Fe2+Fe3+2(SO4)4 · 14H2O Localities: References: |
| ⓘ Rooseveltite Formula: Bi(AsO4) Localities: |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 Localities: Kali Kafi Mine, Anarak District, Nain County, Isfahan Province, Iran Chah Kuh, Esfahan (Isfahan), Isfahan County, Isfahan Province, Iran Darreh Zanjir Mine, Taft County, Yazd Province, Iran Qaleh-Zari Mine (Ghale Zari Mine), Nehbandan County, South Khorasan Province, Iran Chah Khouni Mine, Anarak District, Nain County, Isfahan Province, Iran References: |
| ⓘ Roselite Formula: Ca2Co(AsO4)2 · 2H2O |
| ⓘ Roxbyite Formula: Cu9S5 |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 25 localities in this region. |
| ⓘ Safflorite Formula: (Co,Ni,Fe)As2 Localities: References: |
| ⓘ Sanidine Formula: K(AlSi3O8) Localities: Reported from at least 8 localities in this region. |
| ⓘ Sardashtite (TL) Formula: Ag9Cu2.5Pb41Sb36.5As7S112 Type Locality: |
| ⓘ Sauconite Formula: Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| ⓘ 'Saussurite' Localities: |
| ⓘ 'Scapolite' |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Reported from at least 6 localities in this region. |
| ⓘ Schneiderhöhnite Formula: Fe2+Fe3+3As3+5O13 |
| ⓘ Schreibersite Formula: (Fe,Ni)3P Description: As a very minor constituent |
| ⓘ Scolecite Formula: CaAl2Si3O10 · 3H2O Localities: |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Seelite (TL) Formula: Mg(UO2)(As3+O3)0.7(AsO4)0.3 · 7H2O Localities: References: |
| ⓘ Seligmannite Formula: PbCuAsS3 Localities: |
| ⓘ Semseyite Formula: Pb9Sb8S21 Localities: |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: |
| ⓘ Serpierite Formula: Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 18 localities in this region. References: |
| ⓘ Siderite var. Oligonite Formula: (Fe,Mn)CO3 |
| ⓘ 'Silica' |
| ⓘ Silver Formula: Ag Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Simonite Formula: TlHgAs3S6 |
| ⓘ Sklodowskite Formula: Mg(UO2)2(SiO3OH)2 · 6H2O |
| ⓘ Skutterudite Formula: CoAs3 Localities: References: |
| ⓘ 'Smectite Group' Formula: A0.3D2-3[T4O10]Z2 · nH2O Localities: |
| ⓘ Smithite Formula: AgAsS2 |
| ⓘ Smithsonite Formula: ZnCO3 Localities: Reported from at least 17 localities in this region. References: |
| ⓘ Sodalite Formula: Na4(Si3Al3)O12Cl Localities: |
| ⓘ Soddyite Formula: (UO2)2SiO4 · 2H2O |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 88 localities in this region. References: |
| ⓘ Spheniscidite Formula: (NH4,K)(Fe3+,Al)2(PO4)2(OH) · 2H2O |
| ⓘ Spinel Formula: MgAl2O4 Localities: |
| ⓘ Spionkopite Formula: Cu39S28 Localities: References: |
| ⓘ Stannite Formula: Cu2FeSnS4 Localities: |
| ⓘ Stephanite Formula: Ag5SbS4 |
| ⓘ Sterryite Formula: Cu(Ag,Cu)3Pb19(Sb,As)22(As-As)S56 |
| ⓘ 'Stibiconite' Formula: Sb3+Sb5+2O6(OH) Localities: |
| ⓘ Stibiopalladinite Formula: Pd5Sb2 |
| ⓘ Stibnite Formula: Sb2S3 Localities: Reported from at least 12 localities in this region. |
| ⓘ Stilbite-Ca Formula: NaCa4(Si27Al9)O72 · 28H2O |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ Strengite Formula: FePO4 · 2H2O |
| ⓘ Stromeyerite Formula: AgCuS |
| ⓘ Strontianite Formula: SrCO3 |
| ⓘ Sulphotsumoite Formula: Bi3Te2S |
| ⓘ Sulphur Formula: S8 Localities: Reported from at least 7 localities in this region. |
| ⓘ Sylvite Formula: KCl |
| ⓘ Szomolnokite Formula: FeSO4 · H2O |
| ⓘ 'Sztrókayite' Formula: Bi3TeS2 |
| ⓘ Taenite Formula: (Fe,Ni) Localities: References: |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Talmessite (TL) Formula: Ca2Mg(AsO4)2 · 2H2O Type Locality: |
| ⓘ Tamarugite Formula: NaAl(SO4)2 · 6H2O Localities: |
| ⓘ Taranakite Formula: (K,NH4)Al3(PO4)3(OH) · 9H2O |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Tennantite-Tetrahedrite Series' Localities: Sungun Mine (Songun Mine), Varzaqan county, East Azerbaijan Province, Iran Sargaz Mine, Esfandaqeh, Jiroft County, Kerman Province, Iran Barika ore deposit, Sardasht, Sardasht County, West Azerbaijan Province, Iran North Narbaghi Cu-Ag deposit, Saveh County, Markazi Province, Iran Shah-Ali-Beiglou deposit, Mianeh County, East Azerbaijan Province, Iran |
| ⓘ Tenorite Formula: CuO Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Tetrahedrite Group' Formula: M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: Reported from at least 21 localities in this region. |
| ⓘ Tetrahedrite-(Zn) Formula: Cu6(Cu4Zn2)Sb4S12S |
| ⓘ 'Tetranatrolite' |
| ⓘ Tetrataenite Formula: FeNi |
| ⓘ Thénardite Formula: Na2SO4 Localities: |
| ⓘ 'Thomsonite Subgroup' Localities: |
| ⓘ Thorianite Formula: ThO2 Localities: |
| ⓘ Thorianite var. Uranothorianite Formula: (Th,U)O2 Localities: |
| ⓘ Thorite Formula: Th(SiO4) Localities: |
| ⓘ Thorite var. Thorogummite Formula: (Th,U)(SiO4)1-x(OH)4x |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: Reported from at least 13 localities in this region. References: |
| ⓘ Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ Tolovkite Formula: IrSbS |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Reported from at least 15 localities in this region. |
| ⓘ Trechmannite Formula: AgAsS2 |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: Reported from at least 12 localities in this region. |
| ⓘ Tridymite Formula: SiO2 |
| ⓘ Troilite Formula: FeS Localities: Reported from at least 8 localities in this region. |
| ⓘ Tschermakite Formula: ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ Turquoise Formula: CuAl6(PO4)4(OH)8 · 4H2O Localities: Reported from at least 10 localities in this region. Description: Occurs in irregular patches and narrow seams in a brecciated trachyte and in the surrounding clay-slate. References: |
| ⓘ 'Turquoise Group' |
| ⓘ Twinnite Formula: Pb0.8Tl0.1Sb1.3As0.8S4 Localities: |
| ⓘ Tyrolite Formula: Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ Ulexite Formula: NaCa[B5O6(OH)6] · 5H2O |
| ⓘ 'UM1970-15-O:Pb' Formula: Pb9O16 |
| ⓘ 'UM1983-02-As:Cu' Formula: Cu2As Localities: References: |
| ⓘ 'UM2008-42-S:AsPbSb' Formula: Pb(As,Sb)2S4 |
| ⓘ 'Unnamed (Ag Diiodide)' Formula: AgI2 |
| ⓘ Uraninite Formula: UO2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Uraninite var. Pitchblende Formula: UO2 Localities: |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ Uranospinite Formula: Ca(UO2)2(AsO4)2 · 10H2O |
| ⓘ Urea Formula: CO(NH2)2 |
| ⓘ Formula: Ca3Cr2(SiO4)3 Locality: Soghan, Arzuiyeh County, Kerman Province, Iran - erroneously reported |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl Localities: References: |
| ⓘ Variscite Formula: AlPO4 · 2H2O |
| ⓘ Veenite Formula: Pb16Sb9-xAs7+xS40, x ~ 0-0.5 |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 Localities: |
| ⓘ Violarite Formula: Fe2+Ni3+2S4 |
| ⓘ Voltaite Formula: K2Fe2+5Fe3+3Al(SO4)12 · 18H2O Localities: |
| ⓘ 'Wad' Localities: References: |
| ⓘ 'White mica' |
| ⓘ Whitlockite Formula: Ca9Mg(PO4)6(PO3OH) Localities: |
| ⓘ Willemite Formula: Zn2SiO4 Localities: Chah Milleh Mine (Chah Mileh Mine; Tchah-Mille Mine), Chah Milleh (Chah-Mileh; Tchah-Mille), Anarak District, Nain County, Isfahan Province, Iran Darreh Zanjir Mine, Taft County, Yazd Province, Iran Angouran Mine, Sheykhlar, Mahneshan County, Zanjan Province, Iran Chah Khouni Mine, Anarak District, Nain County, Isfahan Province, Iran References: |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ Wollastonite Formula: Ca3(Si3O9) Localities: Anjerd Mine, Ahar, Ahar County, East Azerbaijan Province, Iran Kharvana Cu-Au prospect, Kharvana (Kharvanaq), Kharvana District, Varzaqan County, East Azerbaijan Province, Iran Miveh Rud (Miveh Rood; Mivehrood; Movārī; Muvāri; Myuvari), Arzil Rural District, Kharvana District, Varzaqan County, East Azerbaijan Province, Iran |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: Reported from at least 11 localities in this region. |
| ⓘ Wurtzite Formula: (Zn,Fe)S |
| ⓘ 'Xenotime' Localities: |
| ⓘ Xenotime-(Y) Formula: Y(PO4) Localities: References: |
| ⓘ Yarrowite Formula: Cu9S8 Localities: References: |
| ⓘ Yukonite Formula: Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| ⓘ Zaratite Formula: Ni3(CO3)(OH)4 · 4H2O ? |
| ⓘ 'Zeolite Group' Localities: Reported from at least 6 localities in this region. |
| ⓘ Zeunerite Formula: Cu(UO2)2(AsO4)2 · 12H2O |
| ⓘ Zincite Formula: ZnO Localities: |
| ⓘ Zincmelanterite Formula: (Zn,Cu,Fe)SO4 · 7H2O |
| ⓘ Zincobotryogen Formula: (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| ⓘ Zincrosasite Formula: (Zn,Cu)2(CO3)(OH)2 |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 15 localities in this region. |
| ⓘ Zirconolite Formula: CaZrTi2O7 |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: |
| ⓘ Zunyite Formula: Al13Si5O20(OH,F)18Cl Localities: Description: Joan Rosell - Rosell Minerals XRD and XRF confirmation.
https://www.rosellminerals.com/en/archivos/minerals/Zunyita-XRD.jpg References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Iron | 1.AE.05 | Fe |
| ⓘ | var. Kamacite | 1.AE.05 | (Fe,Ni) |
| ⓘ | Taenite | 1.AE.10 | (Fe,Ni) |
| ⓘ | Tetrataenite | 1.AE.10 | FeNi |
| ⓘ | Awaruite | 1.AE.20 | Ni3Fe |
| ⓘ | Osmium | 1.AF.05 | (Os,Ir,Ru) |
| ⓘ | Schreibersite | 1.BD.05 | (Fe,Ni)3P |
| ⓘ | Antimony ? | 1.CA.05 | Sb |
| ⓘ | Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Algodonite | 2.AA.10a | (Cu1-xAsx) |
| ⓘ | Domeykite | 2.AA.10b | Cu3As |
| ⓘ | Koutekite | 2.AA.10d | Cu5As2 |
| ⓘ | Kutinaite | 2.AA.25 | Ag6Cu14As7 |
| ⓘ | Maldonite | 2.AA.40 | Au2Bi |
| ⓘ | Maucherite | 2.AB.15 | Ni11As8 |
| ⓘ | Stibiopalladinite | 2.AC.20a | Pd5Sb2 |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Roxbyite | 2.BA.05 | Cu9S5 |
| ⓘ | Geerite | 2.BA.05 | Cu8S5 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Anilite | 2.BA.10 | Cu7S4 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Jalpaite | 2.BA.45 | Ag3CuS2 |
| ⓘ | Aguilarite | 2.BA.55 | Ag4SeS |
| ⓘ | Naumannite | 2.BA.55 | Ag2Se |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Heazlewoodite | 2.BB.05 | Ni3S2 |
| ⓘ | Cobaltpentlandite | 2.BB.15 | Co9S8 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Godlevskite | 2.BB.15 | (Ni,Fe)9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Spionkopite | 2.CA.05c | Cu39S28 |
| ⓘ | Yarrowite | 2.CA.05d | Cu9S8 |
| ⓘ | Nukundamite | 2.CA.10 | Cu3.33Fe0.66S4 |
| ⓘ | Metacinnabar | 2.CB.05a | HgS |
| ⓘ | Coloradoite | 2.CB.05a | HgTe |
| ⓘ | Hawleyite | 2.CB.05a | CdS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Polhemusite | 2.CB.05c | (Zn,Hg)S |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Haycockite | 2.CB.10b | Cu4Fe5S8 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Lautite | 2.CB.40 | CuAsS |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Troilite | 2.CC.10 | FeS |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Galena var. Bismuth-bearing Galena | 2.CD.10 | (Pb,Bi,Ag)S |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Violarite | 2.DA.05 | Fe2+Ni3+2S4 |
| ⓘ | Polydymite | 2.DA.05 | Ni2+Ni3+2S4 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Baksanite | 2.DC.05 | Bi6Te2S3 |
| ⓘ | Ingodite | 2.DC.05 | Bi2TeS |
| ⓘ | Sulphotsumoite | 2.DC.05 | Bi3Te2S |
| ⓘ | 'Joséite' | 2.DC.05 | Bi4TeS2 |
| ⓘ | 'Sztrókayite' | 2.DC.05 | Bi3TeS2 |
| ⓘ | Calaverite | 2.EA.10 | AuTe2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite var. Arsenic-bearing Pyrite | 2.EB.05a | Fe(S,As)2 |
| ⓘ | var. Gold-bearing Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Aurostibite | 2.EB.05a | AuSb2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Alloclasite | 2.EB.10b | Co1-xFexAsS |
| ⓘ | Pararammelsbergite | 2.EB.10e | NiAs2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Tolovkite | 2.EB.25 | IrSbS |
| ⓘ | Nickelskutterudite | 2.EC.05 | (Ni,Co,Fe)As3 |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| ⓘ | Getchellite | 2.FA.35 | AsSbS3 |
| ⓘ | Corderoite ? | 2.FC.15a | Hg2+3S2Cl2 |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | Aktashite | 2.GA.30 | Cu6Hg3As4S12 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | Seligmannite | 2.GA.50 | PbCuAsS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Tetrahedrite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)Sb4S12S |
| ⓘ | Stephanite | 2.GB.10 | Ag5SbS4 |
| ⓘ | Pearceite | 2.GB.15 | [Ag6As2S7][Ag9CuS4] |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| ⓘ | Galkhaite | 2.GB.20 | (Hg5Cu)CsAs4S12 |
| ⓘ | Simonite | 2.GC.20 | TlHgAs3S6 |
| ⓘ | Smithite | 2.GC.30 | AgAsS2 |
| ⓘ | Trechmannite | 2.GC.35 | AgAsS2 |
| ⓘ | Chalcostibite | 2.HA.05 | CuSbS2 |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| ⓘ | Miargyrite | 2.HA.10 | AgSbS2 |
| ⓘ | Sardashtite (TL) | 2.HB. | Ag9Cu2.5Pb41Sb36.5As7S112 |
| ⓘ | Barikaite (TL) | 2.HB. | Ag3Pb10(Sb8As11)S40 |
| ⓘ | Friedrichite | 2.HB.05a | Pb5Cu5Bi7S18 |
| ⓘ | Aikinite | 2.HB.05a | PbCuBiS3 |
| ⓘ | Krupkaite | 2.HB.05a | PbCuBi3S6 |
| ⓘ | Meneghinite | 2.HB.05b | Pb13CuSb7S24 |
| ⓘ | Kobellite | 2.HB.10a | Pb22Cu4(Bi,Sb)30S69 |
| ⓘ | Berryite | 2.HB.20d | Cu3Ag2Pb3Bi7S16 |
| ⓘ | Guettardite | 2.HC.05a | Pb8(Sb0.56As0.44)16S32 |
| ⓘ | Hyršlite | 2.HC.05a | Pb8As10Sb6S32 |
| ⓘ | Twinnite | 2.HC.05a | Pb0.8Tl0.1Sb1.3As0.8S4 |
| ⓘ | Baumhauerite | 2.HC.05b | Pb12As16S36 |
| ⓘ | Veenite | 2.HC.05d | Pb16Sb9-xAs7+xS40, x ~ 0-0.5 |
| ⓘ | Plagionite | 2.HC.10b | Pb5Sb8S17 |
| ⓘ | Semseyite | 2.HC.10d | Pb9Sb8S21 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Lopatkaite | 2.HC.50 | Pb5Sb3AsS11 |
| ⓘ | Lorándite | 2.HD.05 | TlAsS2 |
| ⓘ | Christite ? | 2.HD.15 | TlHgAsS3 |
| ⓘ | Hutchinsonite | 2.HD.45 | TlPbAs5S9 |
| ⓘ | Ferdowsiite var. Lead-bearing Ferdowsiite | 2.JA. | (Ag,Pb)8(Sb5As3)S16 |
| ⓘ | (TL) | 2.JA. | Ag8(Sb5As3)S16 |
| ⓘ | Makovickyite | 2.JA.05d | Cu1.12Ag0.81Pb0.27Bi5.35S9 |
| ⓘ | Matildite | 2.JA.20 | AgBiS2 |
| ⓘ | Arsenquatrandorite (TL) | 2.JB. | Ag17.6Pb12.8Sb38.1As11.5S96 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Marrite | 2.JB.15 | AgPbAsS3 |
| ⓘ | Geocronite | 2.JB.30a | Pb14Sb6S23 |
| ⓘ | Daliranite (TL) | 2.JB.70 | PbHgAs2S5 |
| ⓘ | Galenobismutite | 2.JC.25e | PbBi2S4 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| ⓘ | Luzonite | 2.KA.10 | Cu3AsS4 |
| ⓘ | Famatinite | 2.KA.10 | Cu3SbS4 |
| ⓘ | Arcubisite | 2.LA.40 | Ag6CuBiS4 |
| ⓘ | Benleonardite ? | 2.LA.50 | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| ⓘ | Hayyanite (TL) | 2.LB. | Cu5Ag11Pb76Sb71As17(As2+)8S224 |
| ⓘ | Sterryite | 2.LB.30 | Cu(Ag,Cu)3Pb19(Sb,As)22(As-As)S56 |
| Group 3 - Halides | |||
| ⓘ | Iodargyrite | 3.AA.10 | AgI |
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Sylvite | 3.AA.20 | KCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Cotunnite | 3.AB.85 | PbCl2 |
| ⓘ | Eriochalcite | 3.BB.05 | CuCl2 · 2H2O |
| ⓘ | 'Hydromolysite' | 3.BC.10 | FeCl3 · 6H2O |
| ⓘ | Cadwaladerite | 3.BD.05 | Al5(H2O)3(OH)12 · n(Cl,H2O) |
| ⓘ | Rinneite | 3.CJ.05 | K3Na[FeCl6] |
| ⓘ | Erythrosiderite | 3.CJ.10 | K2[Fe3+Cl5(H2O)] |
| ⓘ | Mitscherlichite | 3.CJ.15 | K2CuCl4 · 2H2O |
| ⓘ | Melanothallite | 3.DA.05 | Cu2Cl2O |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Clinoatacamite | 3.DA.10b | Cu2(OH)3Cl |
| ⓘ | Paratacamite | 3.DA.10c | Cu3(Cu,Zn)(OH)6Cl2 |
| ⓘ | Herbertsmithite | 3.DA.10c | Cu3Zn(OH)6Cl2 |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ | Diaboleite | 3.DB.05 | Pb2CuCl2(OH)4 |
| ⓘ | Pseudoboleite | 3.DB.10 | Pb31Cu24Cl62(OH)48 |
| ⓘ | Boleite | 3.DB.15 | KPb26Ag9Cu24(OH)48Cl62 |
| ⓘ | Murdochite | 3.DB.45 | Cu12Pb2O15Cl2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ-n |
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Delafossite | 4.AB.15 | CuFeO2 |
| ⓘ | Zincite | 4.AB.20 | ZnO |
| ⓘ | Litharge | 4.AC.20 | PbO |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Cuprospinel | 4.BB.05 | Cu2+Fe3+2O4 |
| ⓘ | Magnetite var. Titanium-bearing Magnetite | 4.BB.05 | Fe2+(Fe3+,Ti)2O4 |
| ⓘ | Hercynite | 4.BB.05 | Fe2+Al2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Jacobsite | 4.BB.05 | Mn2+Fe3+2O4 |
| ⓘ | Hetaerolite | 4.BB.10 | ZnMn2O4 |
| ⓘ | Maghemite | 4.BB.15 | (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ | Minium | 4.BD.05 | Pb3O4 |
| ⓘ | Hematite var. Martite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Bixbyite-(Mn) | 4.CB.10 | Mn3+2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Davidite-(La) | 4.CC.40 | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| ⓘ | Davidite-(Ce) ? | 4.CC.40 | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var. Moss Agate | 4.DA.05 | SiO2 |
| ⓘ | var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Agate-Jasper | 4.DA.05 | SiO2 |
| ⓘ | var. Agate | 4.DA.05 | SiO2 |
| ⓘ | var. Fortification Agate | 4.DA.05 | SiO2 |
| ⓘ | var. Dendritic Agate | 4.DA.05 | SiO2 |
| ⓘ | var. Plume Agate | 4.DA.05 | SiO2 |
| ⓘ | Tridymite | 4.DA.10 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Plattnerite | 4.DB.05 | PbO2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Baddeleyite | 4.DE.35 | ZrO2 |
| ⓘ | 'Stibiconite' | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Zirconolite | 4.DH.30 | CaZrTi2O7 |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Hollandite | 4.DK.05a | Ba(Mn4+6Mn3+2)O16 |
| ⓘ | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ | Thorianite var. Uranothorianite | 4.DL.05 | (Th,U)O2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Thorianite | 4.DL.05 | ThO2 |
| ⓘ | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | Bernalite | 4.FC.05 | Fe(OH)3 · nH2O (n = 0.0 to 0.25) |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Bayerite | 4.FE.10 | Al(OH)3 |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| ⓘ | Böhmite | 4.FE.15 | AlO(OH) |
| ⓘ | Lepidocrocite | 4.FE.15 | γ-Fe3+O(OH) |
| ⓘ | Chalcophanite | 4.FL.20 | ZnMn4+3O7 · 3H2O |
| ⓘ | Curite | 4.GB.55 | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| ⓘ | Schneiderhöhnite | 4.JA.35 | Fe2+Fe3+3As3+5O13 |
| ⓘ | Ludlockite ? | 4.JA.45 | PbFe3+4As3+10O22 |
| ⓘ | Seelite (TL) | 4.JD.10 | Mg(UO2)(As3+O3)0.7(AsO4)0.3 · 7H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Calcite var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | 5.AB.05 | CaCO3 | |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite var. Oligonite | 5.AB.05 | (Fe,Mn)CO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Kutnohorite | 5.AB.10 | CaMn2+(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Strontianite | 5.AB.15 | SrCO3 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Zincrosasite | 5.BA.10 | (Zn,Cu)2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Parisite-(Ce) | 5.BD.20b | CaCe2(CO3)3F2 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Phosgenite | 5.BE.20 | Pb2CO3Cl2 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ | Zaratite | 5.DA.15 | Ni3(CO3)(OH)4 · 4H2O ? |
| ⓘ | Niter | 5.NA.10 | KNO3 |
| Group 6 - Borates | |||
| ⓘ | Colemanite | 6.CB.10 | Ca[B3O4(OH)3] · H2O |
| ⓘ | Hydroboracite | 6.CB.15 | CaMg[B3O4(OH)3]2 · 3H2O |
| ⓘ | Ulexite | 6.EA.25 | NaCa[B5O6(OH)6] · 5H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Millosevichite | 7.AB.05 | Al2(SO4)3 |
| ⓘ | Aphthitalite | 7.AC.35 | (K,Na)3Na(SO4)2 |
| ⓘ | Arcanite | 7.AD.05 | K2SO4 |
| ⓘ | Glauberite | 7.AD.25 | Na2Ca(SO4)2 |
| ⓘ | Thénardite | 7.AD.25 | Na2SO4 |
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Celestine | 7.AD.35 | SrSO4 |
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Hydroniumjarosite | 7.BC.10 | (H3O)Fe3+3(SO4)2(OH)6 |
| ⓘ | Beaverite-(Cu) | 7.BC.10 | Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ | Natrojarosite | 7.BC.10 | NaFe3(SO4)2(OH)6 |
| ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
| ⓘ | Plumbojarosite | 7.BC.10 | Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Cesanite | 7.BD.20 | Na3Ca2(SO4)3(OH) |
| ⓘ | Szomolnokite | 7.CB.05 | FeSO4 · H2O |
| ⓘ | Poitevinite | 7.CB.05 | (Cu,Fe)SO4 · H2O |
| ⓘ | Kieserite | 7.CB.05 | MgSO4 · H2O |
| ⓘ | Bonattite | 7.CB.10 | CuSO4 · 3H2O |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Hexahydrite | 7.CB.25 | MgSO4 · 6H2O |
| ⓘ | Zincmelanterite | 7.CB.35 | (Zn,Cu,Fe)SO4 · 7H2O |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6SO4 · H2O |
| ⓘ | Alunogen | 7.CB.45 | Al2(SO4)3 · 17H2O |
| ⓘ | Coquimbite | 7.CB.55 | AlFe3(SO4)6(H2O)12 · 6H2O |
| ⓘ | Kornelite | 7.CB.60 | Fe2(SO4)3 · 7H2O |
| ⓘ | Lishizhenite | 7.CB.75 | ZnFe2(SO4)4 · 14H2O |
| ⓘ | Römerite | 7.CB.75 | Fe2+Fe3+2(SO4)4 · 14H2O |
| ⓘ | Halotrichite | 7.CB.85 | FeAl2(SO4)4 · 22H2O |
| ⓘ | Tamarugite | 7.CC.10 | NaAl(SO4)2 · 6H2O |
| ⓘ | Kalinite | 7.CC.15 | KAl(SO4)2 · 11H2O |
| ⓘ | Alum-(K) | 7.CC.20 | KAl(SO4)2 · 12H2O |
| ⓘ | Voltaite | 7.CC.25 | K2Fe2+5Fe3+3Al(SO4)12 · 18H2O |
| ⓘ | Pertlikite (TL) | 7.CC.25 | K2(Fe2+,Mg)2Mg4Fe3+2Al(SO4)12 · 18H2O |
| ⓘ | Leonite | 7.CC.55 | K2Mg(SO4)2 · 4H2O |
| ⓘ | Picromerite | 7.CC.60 | K2Mg(SO4)2 · 6H2O |
| ⓘ | Polyhalite | 7.CC.65 | K2Ca2Mg(SO4)4 · 2H2O |
| ⓘ | Görgeyite | 7.CD.30 | K2Ca5(SO4)6 · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Khademite (TL) | 7.DB.10 | Al(SO4)F · 5H2O |
| ⓘ | Amarantite | 7.DB.30 | Fe3+2(SO4)2O · 7H2O |
| ⓘ | Magnesiocopiapite | 7.DB.35 | MgFe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Butlerite | 7.DC.10 | Fe3+(SO4)(OH) · 2H2O |
| ⓘ | Parabutlerite | 7.DC.10 | Fe3+(SO4)(OH) · 2H2O |
| ⓘ | Zincobotryogen | 7.DC.25 | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| ⓘ | Botryogen | 7.DC.25 | MgFe3+(SO4)2(OH) · 7H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ | Kainite | 7.DF.10 | KMg(SO4)Cl · 3H2O |
| ⓘ | Metavoltine (TL) | 7.DF.35 | K2Na6Fe2+Fe3+6O2(SO4)12 · 18H2O |
| ⓘ | Phoenicochroite | 7.FB.05 | Pb2(CrO4)O |
| ⓘ | Fornacite | 7.FC.10 | Pb2Cu(CrO4)(AsO4)(OH) |
| ⓘ | Hemihedrite | 7.FC.15 | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| ⓘ | Iranite (TL) | 7.FC.15 | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Merrillite | 8.AC.45 | Ca9NaMg(PO4)7 |
| ⓘ | Whitlockite | 8.AC.45 | Ca9Mg(PO4)6(PO3OH) |
| ⓘ | Phosphammite | 8.AD.20 | (NH4)2(PO3OH) |
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Rooseveltite | 8.AD.50 | Bi(AsO4) |
| ⓘ | Althausite | 8.BB.25 | Mg4(PO4)2(OH,O)(F,◻) |
| ⓘ | Adamite | 8.BB.30 | Zn2(AsO4)(OH) |
| ⓘ | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Beudantite | 8.BL.05 | PbFe3(AsO4)(SO4)(OH)6 |
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Plumbogummite | 8.BL.10 | PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Goyazite | 8.BL.10 | SrAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Chlorapatite | 8.BN.05 | Ca5(PO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Variscite | 8.CD.10 | AlPO4 · 2H2O |
| ⓘ | Mansfieldite | 8.CD.10 | AlAsO4 · 2H2O |
| ⓘ | Strengite | 8.CD.10 | FePO4 · 2H2O |
| ⓘ | Lindackerite | 8.CE.30 | CuCu4(AsO4)2(HAsO4)2 · 9H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Hörnesite | 8.CE.40 | Mg3(AsO4)2 · 8H2O |
| ⓘ | Annabergite var. Magnesium-bearing Annabergite | 8.CE.40 | (Ni,Mg)3(AsO4)2 · 8H2O |
| ⓘ | 8.CE.40 | Ni3(AsO4)2 · 8H2O | |
| ⓘ | Fairfieldite | 8.CG.05 | Ca2Mn2+(PO4)2 · 2H2O |
| ⓘ | Talmessite (TL) | 8.CG.05 | Ca2Mg(AsO4)2 · 2H2O |
| ⓘ | Roselite | 8.CG.10 | Ca2Co(AsO4)2 · 2H2O |
| ⓘ | Picropharmacolite | 8.CH.15 | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| ⓘ | Francoanellite | 8.CH.25 | K3Al5(PO3OH)6(PO4)2 · 12H2O |
| ⓘ | Taranakite | 8.CH.25 | (K,NH4)Al3(PO4)3(OH) · 9H2O |
| ⓘ | Pharmacolite | 8.CJ.50 | Ca(HAsO4) · 2H2O |
| ⓘ | Brushite | 8.CJ.50 | Ca(PO3OH) · 2H2O |
| ⓘ | Pitticite | 8.DB.05 | (Fe, AsO4, H2O) (?) |
| ⓘ | Turquoise | 8.DD.15 | CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ | Planerite | 8.DD.15 | Al6(PO4)2(PO3OH)2(OH)8 · 4H2O |
| ⓘ | Lavendulan | 8.DG.05 | NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ | Lemanskiite | 8.DG.05 | NaCaCu5(AsO4)4Cl · 3H2O |
| ⓘ | Spheniscidite | 8.DH.10 | (NH4,K)(Fe3+,Al)2(PO4)2(OH) · 2H2O |
| ⓘ | Leucophosphite | 8.DH.10 | KFe3+2(PO4)2(OH) · 2H2O |
| ⓘ | Mixite | 8.DL.15 | BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Tyrolite | 8.DM.10 | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ | Yukonite | 8.DM.25 | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| ⓘ | Zeunerite | 8.EB.05 | Cu(UO2)2(AsO4)2 · 12H2O |
| ⓘ | Uranospinite | 8.EB.05 | Ca(UO2)2(AsO4)2 · 10H2O |
| ⓘ | Metazeunerite | 8.EB.10 | Cu(UO2)2(AsO4)2 · 8H2O |
| ⓘ | Natrouranospinite | 8.EB.15 | Na2(UO2)2(AsO4)2 · 5H2O |
| ⓘ | 'Pyrocoproite' | 8.FA.20 | (K,Na)2Mg(P2O7) |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.. | Mg3(Si2O5)(OH)4 |
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Fayalite | 9.AC.05 | Fe2+2SiO4 |
| ⓘ | Forsterite | 9.AC.05 | Mg2SiO4 |
| ⓘ | Andradite var. Topazolite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Uvarovite ? | 9.AD.25 | Ca3Cr2(SiO4)3 |
| ⓘ | Andradite var. Demantoid | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Thorite var. Thorogummite | 9.AD.30 | (Th,U)(SiO4)1-x(OH)4x |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Coffinite | 9.AD.30 | U(SiO4) · nH2O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Soddyite | 9.AK.05 | (UO2)2SiO4 · 2H2O |
| ⓘ | Cuprosklodowskite | 9.AK.10 | Cu(UO2)2(SiO3OH)2 · 6H2O |
| ⓘ | Sklodowskite | 9.AK.10 | Mg(UO2)2(SiO3OH)2 · 6H2O |
| ⓘ | Boltwoodite | 9.AK.15 | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Gehlenite | 9.BB.10 | Ca2Al[AlSiO7] |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Lawsonite | 9.BE.05 | CaAl2(Si2O7)(OH)2 · H2O |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Zunyite | 9.BJ.55 | Al13Si5O20(OH,F)18Cl |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Dioptase | 9.CJ.30 | CuSiO3 · H2O |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite var. Bronzite | 9.DA.05 | (Mg,Fe2+)2[SiO3]2 |
| ⓘ | 9.DA.05 | Mg2Si2O6 | |
| ⓘ | Augite var. Ferroaugite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside var. Salite | 9.DA.15 | CaMgSi2O6 |
| ⓘ | 9.DA.15 | CaMgSi2O6 | |
| ⓘ | Augite var. Titanium-bearing Augite | 9.DA.15 | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Aegirine-augite | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ | Omphacite | 9.DA.20 | (NaaCabFe2+cMgd)(AleFe3+fFe2+gMgh)Si2O6 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Magnesio-hornblende | 9.DE.10 | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-hornblende | 9.DE.10 | ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ | Tschermakite | 9.DE.10 | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Ferro-actinolite | 9.DE.10 | ◻Ca2Fe2+5(Si8O22)(OH)2 |
| ⓘ | Edenite | 9.DE.15 | NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ | Kaersutite | 9.DE.15 | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Glaucophane | 9.DE.25 | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| ⓘ | Arfvedsonite | 9.DE.25 | [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 |
| ⓘ | Riebeckite | 9.DE.25 | ◻[Na2][Fe2+3Fe3+2]Si8O22(OH)2 |
| ⓘ | Bustamite | 9.DG.05 | CaMn2+(Si2O6) |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Krauskopfite | 9.DH.30 | BaSi2O5 · 3H2O |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Celadonite | 9.EC.15 | K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | var. Phengite | 9.EC.15 | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ | Paragonite | 9.EC.15 | NaAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Annite | 9.EC.20 | KFe2+3(AlSi3O10)(OH)2 |
| ⓘ | Clintonite | 9.EC.35 | CaAlMg2(SiAl3O10)(OH)2 |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Sauconite | 9.EC.45 | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ | var. Brunsvigite | 9.EC.55 | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| ⓘ | Clinochlore var. Ripidolite | 9.EC.55 | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Nacrite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Halloysite | 9.ED.10 | Al2(Si2O5)(OH)4 |
| ⓘ | Greenalite | 9.ED.15 | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| ⓘ | Amesite | 9.ED.15 | Mg2Al(AlSiO5)(OH)4 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Palygorskite | 9.EE.20 | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Nepheline | 9.FA.05 | Na3K(Al4Si4O16) |
| ⓘ | Sanidine | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Anorthite var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Albite var. Anorthoclase | 9.FA.35 | (Na,K)AlSi3O8 |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Bytownite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Danburite | 9.FA.65 | CaB2Si2O8 |
| ⓘ | Haüyne | 9.FB.10 | Na3Ca(Si3Al3)O12(SO4) |
| ⓘ | Sodalite | 9.FB.10 | Na4(Si3Al3)O12Cl |
| ⓘ | Marialite | 9.FB.15 | Na4Al3Si9O24Cl |
| ⓘ | 'Zeolite Group' | 9.G0. | |
| ⓘ | Gonnardite | 9.GA.05 | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| ⓘ | Mesolite | 9.GA.05 | Na2Ca2Si9Al6O30 · 8H2O |
| ⓘ | Scolecite | 9.GA.05 | CaAl2Si3O10 · 3H2O |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | 'Tetranatrolite' | 9.GA.20 | |
| ⓘ | Leucite | 9.GB.05 | K(AlSi2O6) |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Chabazite-Ca | 9.GD.10 | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ | Mordenite | 9.GD.35 | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| ⓘ | Epistilbite | 9.GD.45 | CaAl2Si6O16 · 5H2O |
| ⓘ | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ | Stilbite-Ca | 9.GE.10 | NaCa4(Si27Al9)O72 · 28H2O |
| Group 10 - Organic Compounds | |||
| ⓘ | Urea | 10.CA.35 | CO(NH2)2 |
| Unclassified | |||
| ⓘ | 'Britholite Group' | - | (REE,Ca)5[(Si,P)O4]3X |
| ⓘ | 'Tetrahedrite Group' | - | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| ⓘ | 'Mimetite-Pyromorphite Series' | - | |
| ⓘ | 'Andorite' | - | AgPbSb3S6 |
| ⓘ | 'Turquoise Group' | - | |
| ⓘ | 'Axinite Group' | - | |
| ⓘ | 'Melilite Group' | - | Ca2M(XSiO7) |
| ⓘ | 'Beudantite Group' | - | AM3(XO4)(SO4)(OH)6 |
| ⓘ | 'Olivine Group' | - | M2SiO4 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Tennantite-Tetrahedrite Series' | - | |
| ⓘ | 'Plumbogummite Group' | - | |
| ⓘ | 'Calcite Group' | - | AXO3 |
| ⓘ | 'Thomsonite Subgroup' | - | |
| ⓘ | 'Saussurite' | - | |
| ⓘ | 'Alkali Feldspar' | - | |
| ⓘ | 'Al-chamosite' | - | |
| ⓘ | 'Pseudoleucite' | - | |
| ⓘ | 'Iron sulfide' | - | |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'UM2008-42-S:AsPbSb' | - | Pb(As,Sb)2S4 |
| ⓘ | 'Rhombohedral Carbonate' | - | (Ca/Mg/Fe/Mn etc)CO3 |
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Iron oxide' | - | |
| ⓘ | 'Leucite phonolite' | - | |
| ⓘ | 'Calcic plagioclase' | - | |
| ⓘ | 'Unnamed (Ag Diiodide)' | - | AgI2 |
| ⓘ | 'UM1983-02-As:Cu' | - | Cu2As |
| ⓘ | 'Alunite Group' | - | A0.5-1 B3[SO4]2(OH)6 |
| ⓘ | 'UM1970-15-O:Pb' | - | Pb9O16 |
| ⓘ | 'White mica' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Pumpellyite Subgroup' | - | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| ⓘ | 'Iron Group' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Melnikovite' | - | |
| ⓘ | 'Manganese Oxides var. Manganese Dendrites' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Annabergite-Erythrite Series' | - | |
| ⓘ | 'Calamine' | - | |
| ⓘ | 'Maskelynite' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Lévyne' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Arsenobismite' | - | |
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Jasper' | - | |
| ⓘ | 'Hypersthene' | - | (Mg,Fe)SiO3 |
| ⓘ | 'Hemihedrite-Iranite Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Glass' | - | |
| ⓘ | 'Amphibole Supergroup var. Byssolite' | - | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Barkevikite' | - | |
| ⓘ | 'Smectite Group' | - | A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Plessite' | - | |
| ⓘ | 'Garnierite' | - | |
| ⓘ | 'Silica' | - | |
| ⓘ | 'Meteoritic Iron' | - | |
| ⓘ | 'Petroleum var. Bitumen' | - | |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Iron-bearing pargasite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Chrome-Spinel (of Dana)' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Petroleum' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Adamite | Zn2(AsO4)(OH) |
| H | ⓘ Althausite | Mg4(PO4)2(OH,O)(F,◻) |
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| H | ⓘ Amarantite | Fe23+(SO4)2O · 7H2O |
| H | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bayerite | Al(OH)3 |
| H | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| H | ⓘ Bernalite | Fe(OH)3 · nH2O (n = 0.0 to 0.25) |
| H | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Böhmite | AlO(OH) |
| H | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| H | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| H | ⓘ Bonattite | CuSO4 · 3H2O |
| H | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| H | ⓘ Butlerite | Fe3+(SO4)(OH) · 2H2O |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Annabergite var. Magnesium-bearing Annabergite | (Ni,Mg)3(AsO4)2 · 8H2O |
| H | ⓘ Cadwaladerite | Al5(H2O)3(OH)12 · n(Cl,H2O) |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| H | ⓘ Cesanite | Na3Ca2(SO4)3(OH) |
| H | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Clintonite | CaAlMg2(SiAl3O10)(OH)2 |
| H | ⓘ Coffinite | U(SiO4) · nH2O |
| H | ⓘ Colemanite | Ca[B3O4(OH)3] · H2O |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| H | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| H | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| H | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Dioptase | CuSiO3 · H2O |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| H | ⓘ Eriochalcite | CuCl2 · 2H2O |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Erythrosiderite | K2[Fe3+Cl5(H2O)] |
| H | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| H | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| H | ⓘ Francoanellite | K3Al5(PO3OH)6(PO4)2 · 12H2O |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| H | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| H | ⓘ Görgeyite | K2Ca5(SO4)6 · H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| H | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| H | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hexahydrite | MgSO4 · 6H2O |
| H | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| H | ⓘ Hydroboracite | CaMg[B3O4(OH)3]2 · 3H2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | ⓘ Hydromolysite | FeCl3 · 6H2O |
| H | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kainite | KMg(SO4)Cl · 3H2O |
| H | ⓘ Kalinite | KAl(SO4)2 · 11H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Khademite | Al(SO4)F · 5H2O |
| H | ⓘ Kieserite | MgSO4 · H2O |
| H | ⓘ Kornelite | Fe2(SO4)3 · 7H2O |
| H | ⓘ Krauskopfite | BaSi2O5 · 3H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| H | ⓘ Lawsonite | CaAl2(Si2O7)(OH)2 · H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Leonite | K2Mg(SO4)2 · 4H2O |
| H | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| H | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Lindackerite | CuCu4(AsO4)2(HAsO4)2 · 9H2O |
| H | ⓘ Lishizhenite | ZnFe2(SO4)4 · 14H2O |
| H | ⓘ Magnesiocopiapite | MgFe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mansfieldite | AlAsO4 · 2H2O |
| H | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| H | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| H | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| H | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| H | ⓘ Mitscherlichite | K2CuCl4 · 2H2O |
| H | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| H | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| H | ⓘ Parabutlerite | Fe3+(SO4)(OH) · 2H2O |
| H | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| H | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| H | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Phosphammite | (NH4)2(PO3OH) |
| H | ⓘ Picromerite | K2Mg(SO4)2 · 6H2O |
| H | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| H | ⓘ Planerite | Al6(PO4)2(PO3OH)2(OH)8 · 4H2O |
| H | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| H | ⓘ Poitevinite | (Cu,Fe)SO4 · H2O |
| H | ⓘ Polyhalite | K2Ca2Mg(SO4)4 · 2H2O |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| H | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| H | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| H | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Roselite | Ca2Co(AsO4)2 · 2H2O |
| H | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| H | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Seelite | Mg(UO2)(As3+O3)0.7(AsO4)0.3 · 7H2O |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| H | ⓘ Natrouranospinite | Na2(UO2)2(AsO4)2 · 5H2O |
| H | ⓘ Soddyite | (UO2)2SiO4 · 2H2O |
| H | ⓘ Spheniscidite | (NH4,K)(Fe3+,Al)2(PO4)2(OH) · 2H2O |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Strengite | FePO4 · 2H2O |
| H | ⓘ Szomolnokite | FeSO4 · H2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| H | ⓘ Tamarugite | NaAl(SO4)2 · 6H2O |
| H | ⓘ Taranakite | (K,NH4)Al3(PO4)3(OH) · 9H2O |
| H | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| H | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| H | ⓘ Ulexite | NaCa[B5O6(OH)6] · 5H2O |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Uranospinite | Ca(UO2)2(AsO4)2 · 10H2O |
| H | ⓘ Urea | CO(NH2)2 |
| H | ⓘ Variscite | AlPO4 · 2H2O |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| H | ⓘ Yukonite | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| H | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| H | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| H | ⓘ Zincmelanterite | (Zn,Cu,Fe)SO4 · 7H2O |
| H | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| H | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Zunyite | Al13Si5O20(OH,F)18Cl |
| H | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| H | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| H | ⓘ Lemanskiite | NaCaCu5(AsO4)4Cl · 3H2O |
| H | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Herbertsmithite | Cu3Zn(OH)6Cl2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Beudantite Group | AM3(XO4)(SO4)(OH)6 |
| H | ⓘ Pertlikite | K2(Fe2+,Mg)2Mg4Fe23+Al(SO4)12 · 18H2O |
| H | ⓘ Alunite Group | A0.5-1 B3[SO4]2(OH)6 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Colemanite | Ca[B3O4(OH)3] · H2O |
| B | ⓘ Danburite | CaB2Si2O8 |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Hydroboracite | CaMg[B3O4(OH)3]2 · 3H2O |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | ⓘ Ulexite | NaCa[B5O6(OH)6] · 5H2O |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite var. Oligonite | (Fe,Mn)CO3 |
| C | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| C | ⓘ Phosgenite | Pb2CO3Cl2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Strontianite | SrCO3 |
| C | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| C | ⓘ Urea | CO(NH2)2 |
| C | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| C | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| C | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| N | Nitrogen | |
| N | ⓘ Niter | KNO3 |
| N | ⓘ Phosphammite | (NH4)2(PO3OH) |
| N | ⓘ Spheniscidite | (NH4,K)(Fe3+,Al)2(PO4)2(OH) · 2H2O |
| N | ⓘ Taranakite | (K,NH4)Al3(PO4)3(OH) · 9H2O |
| N | ⓘ Urea | CO(NH2)2 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Adamite | Zn2(AsO4)(OH) |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | ⓘ Quartz var. Agate-Jasper | SiO2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Althausite | Mg4(PO4)2(OH,O)(F,◻) |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| O | ⓘ Amarantite | Fe23+(SO4)2O · 7H2O |
| O | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Aphthitalite | (K,Na)3Na(SO4)2 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arcanite | K2SO4 |
| O | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baddeleyite | ZrO2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bayerite | Al(OH)3 |
| O | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| O | ⓘ Bernalite | Fe(OH)3 · nH2O (n = 0.0 to 0.25) |
| O | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bixbyite-(Mn) | Mn23+O3 |
| O | ⓘ Böhmite | AlO(OH) |
| O | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| O | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| O | ⓘ Bonattite | CuSO4 · 3H2O |
| O | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| O | ⓘ Bustamite | CaMn2+(Si2O6) |
| O | ⓘ Butlerite | Fe3+(SO4)(OH) · 2H2O |
| O | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Annabergite var. Magnesium-bearing Annabergite | (Ni,Mg)3(AsO4)2 · 8H2O |
| O | ⓘ Cadwaladerite | Al5(H2O)3(OH)12 · n(Cl,H2O) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| O | ⓘ Celestine | SrSO4 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cesanite | Na3Ca2(SO4)3(OH) |
| O | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Clintonite | CaAlMg2(SiAl3O10)(OH)2 |
| O | ⓘ Coffinite | U(SiO4) · nH2O |
| O | ⓘ Colemanite | Ca[B3O4(OH)3] · H2O |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| O | ⓘ Cuprospinel | Cu2+Fe23+O4 |
| O | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| O | ⓘ Danburite | CaB2Si2O8 |
| O | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| O | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| O | ⓘ Delafossite | CuFeO2 |
| O | ⓘ Andradite var. Demantoid | Ca3Fe23+(SiO4)3 |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dioptase | CuSiO3 · H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| O | ⓘ Eriochalcite | CuCl2 · 2H2O |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Erythrosiderite | K2[Fe3+Cl5(H2O)] |
| O | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| O | ⓘ Fayalite | Fe22+SiO4 |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| O | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| O | ⓘ Forsterite | Mg2SiO4 |
| O | ⓘ Francoanellite | K3Al5(PO3OH)6(PO4)2 · 12H2O |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Gehlenite | Ca2Al[AlSiO7] |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| O | ⓘ Glauberite | Na2Ca(SO4)2 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| O | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| O | ⓘ Görgeyite | K2Ca5(SO4)6 · H2O |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| O | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| O | ⓘ Haüyne | Na3Ca(Si3Al3)O12(SO4) |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hercynite | Fe2+Al2O4 |
| O | ⓘ Hetaerolite | ZnMn2O4 |
| O | ⓘ Hexahydrite | MgSO4 · 6H2O |
| O | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| O | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| O | ⓘ Hydroboracite | CaMg[B3O4(OH)3]2 · 3H2O |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | ⓘ Hydromolysite | FeCl3 · 6H2O |
| O | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| O | ⓘ Jacobsite | Mn2+Fe23+O4 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| O | ⓘ Kainite | KMg(SO4)Cl · 3H2O |
| O | ⓘ Kalinite | KAl(SO4)2 · 11H2O |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Khademite | Al(SO4)F · 5H2O |
| O | ⓘ Kieserite | MgSO4 · H2O |
| O | ⓘ Kornelite | Fe2(SO4)3 · 7H2O |
| O | ⓘ Krauskopfite | BaSi2O5 · 3H2O |
| O | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| O | ⓘ Lawsonite | CaAl2(Si2O7)(OH)2 · H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Leonite | K2Mg(SO4)2 · 4H2O |
| O | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| O | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Lindackerite | CuCu4(AsO4)2(HAsO4)2 · 9H2O |
| O | ⓘ Lishizhenite | ZnFe2(SO4)4 · 14H2O |
| O | ⓘ Ludlockite | PbFe43+As103+O22 |
| O | ⓘ Leucite | K(AlSi2O6) |
| O | ⓘ Litharge | PbO |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnesiocopiapite | MgFe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Mansfieldite | AlAsO4 · 2H2O |
| O | ⓘ Marialite | Na4Al3Si9O24Cl |
| O | ⓘ Hematite var. Martite | Fe2O3 |
| O | ⓘ Melanothallite | Cu2Cl2O |
| O | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| O | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| O | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| O | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Millosevichite | Al2(SO4)3 |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Minium | Pb3O4 |
| O | ⓘ Mitscherlichite | K2CuCl4 · 2H2O |
| O | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| O | ⓘ Quartz var. Moss Agate | SiO2 |
| O | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| O | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| O | ⓘ Nepheline | Na3K(Al4Si4O16) |
| O | ⓘ Niter | KNO3 |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Siderite var. Oligonite | (Fe,Mn)CO3 |
| O | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| O | ⓘ Parabutlerite | Fe3+(SO4)(OH) · 2H2O |
| O | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| O | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| O | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| O | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Phoenicochroite | Pb2(CrO4)O |
| O | ⓘ Phosgenite | Pb2CO3Cl2 |
| O | ⓘ Phosphammite | (NH4)2(PO3OH) |
| O | ⓘ Picromerite | K2Mg(SO4)2 · 6H2O |
| O | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| O | ⓘ Planerite | Al6(PO4)2(PO3OH)2(OH)8 · 4H2O |
| O | ⓘ Plattnerite | PbO2 |
| O | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| O | ⓘ Poitevinite | (Cu,Fe)SO4 · H2O |
| O | ⓘ Polyhalite | K2Ca2Mg(SO4)4 · 2H2O |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| O | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| O | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| O | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| O | ⓘ Rooseveltite | Bi(AsO4) |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Roselite | Ca2Co(AsO4)2 · 2H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sanidine | K(AlSi3O8) |
| O | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schneiderhöhnite | Fe2+Fe33+As53+O13 |
| O | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Seelite | Mg(UO2)(As3+O3)0.7(AsO4)0.3 · 7H2O |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Natrouranospinite | Na2(UO2)2(AsO4)2 · 5H2O |
| O | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| O | ⓘ Soddyite | (UO2)2SiO4 · 2H2O |
| O | ⓘ Spheniscidite | (NH4,K)(Fe3+,Al)2(PO4)2(OH) · 2H2O |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Strengite | FePO4 · 2H2O |
| O | ⓘ Strontianite | SrCO3 |
| O | ⓘ Szomolnokite | FeSO4 · H2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| O | ⓘ Tamarugite | NaAl(SO4)2 · 6H2O |
| O | ⓘ Taranakite | (K,NH4)Al3(PO4)3(OH) · 9H2O |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Thénardite | Na2SO4 |
| O | ⓘ Thorianite | ThO2 |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| O | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tridymite | SiO2 |
| O | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| O | ⓘ Ulexite | NaCa[B5O6(OH)6] · 5H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Uranospinite | Ca(UO2)2(AsO4)2 · 10H2O |
| O | ⓘ Thorianite var. Uranothorianite | (Th,U)O2 |
| O | ⓘ Urea | CO(NH2)2 |
| O | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Variscite | AlPO4 · 2H2O |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Yukonite | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| O | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| O | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| O | ⓘ Zincmelanterite | (Zn,Cu,Fe)SO4 · 7H2O |
| O | ⓘ Zincite | ZnO |
| O | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| O | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zirconolite | CaZrTi2O7 |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Zunyite | Al13Si5O20(OH,F)18Cl |
| O | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| O | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| O | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Pyrocoproite | (K,Na)2Mg(P2O7) |
| O | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| O | ⓘ Andradite var. Topazolite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Quartz var. Dendritic Agate | SiO2 |
| O | ⓘ Quartz var. Fortification Agate | SiO2 |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| O | ⓘ Lemanskiite | NaCaCu5(AsO4)4Cl · 3H2O |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| O | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Quartz var. Plume Agate | SiO2 |
| O | ⓘ Herbertsmithite | Cu3Zn(OH)6Cl2 |
| O | ⓘ Calcite Group | AXO3 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Olivine Group | M2SiO4 |
| O | ⓘ Beudantite Group | AM3(XO4)(SO4)(OH)6 |
| O | ⓘ Melilite Group | Ca2M(XSiO7) |
| O | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
| O | ⓘ Pertlikite | K2(Fe2+,Mg)2Mg4Fe23+Al(SO4)12 · 18H2O |
| O | ⓘ Alunite Group | A0.5-1 B3[SO4]2(OH)6 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ UM1970-15-O:Pb | Pb9O16 |
| O | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| F | Fluorine | |
| F | ⓘ Althausite | Mg4(PO4)2(OH,O)(F,◻) |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| F | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Khademite | Al(SO4)F · 5H2O |
| F | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| F | ⓘ Zunyite | Al13Si5O20(OH,F)18Cl |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Na | ⓘ Aphthitalite | (K,Na)3Na(SO4)2 |
| Na | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Na | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| Na | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Cesanite | Na3Ca2(SO4)3(OH) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Na | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Na | ⓘ Glauberite | Na2Ca(SO4)2 |
| Na | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Haüyne | Na3Ca(Si3Al3)O12(SO4) |
| Na | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Na | ⓘ Marialite | Na4Al3Si9O24Cl |
| Na | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Na | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| Na | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Na | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Na | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Na | ⓘ Rinneite | K3Na[FeCl6] |
| Na | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Na | ⓘ Natrouranospinite | Na2(UO2)2(AsO4)2 · 5H2O |
| Na | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Na | ⓘ Tamarugite | NaAl(SO4)2 · 6H2O |
| Na | ⓘ Thénardite | Na2SO4 |
| Na | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Na | ⓘ Ulexite | NaCa[B5O6(OH)6] · 5H2O |
| Na | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Na | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Na | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Pyrocoproite | (K,Na)2Mg(P2O7) |
| Na | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Lemanskiite | NaCaCu5(AsO4)4Cl · 3H2O |
| Na | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | ⓘ Althausite | Mg4(PO4)2(OH,O)(F,◻) |
| Mg | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Annabergite var. Magnesium-bearing Annabergite | (Ni,Mg)3(AsO4)2 · 8H2O |
| Mg | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clintonite | CaAlMg2(SiAl3O10)(OH)2 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Forsterite | Mg2SiO4 |
| Mg | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Mg | ⓘ Hexahydrite | MgSO4 · 6H2O |
| Mg | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| Mg | ⓘ Hydroboracite | CaMg[B3O4(OH)3]2 · 3H2O |
| Mg | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Mg | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Mg | ⓘ Kainite | KMg(SO4)Cl · 3H2O |
| Mg | ⓘ Kieserite | MgSO4 · H2O |
| Mg | ⓘ Leonite | K2Mg(SO4)2 · 4H2O |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Magnesiocopiapite | MgFe43+(SO4)6(OH)2 · 20H2O |
| Mg | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Mg | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Picromerite | K2Mg(SO4)2 · 6H2O |
| Mg | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Mg | ⓘ Polyhalite | K2Ca2Mg(SO4)4 · 2H2O |
| Mg | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Mg | ⓘ Seelite | Mg(UO2)(As3+O3)0.7(AsO4)0.3 · 7H2O |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| Mg | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| Mg | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| Mg | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Mg | ⓘ Pyrocoproite | (K,Na)2Mg(P2O7) |
| Mg | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| Mg | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Mg | ⓘ Pertlikite | K2(Fe2+,Mg)2Mg4Fe23+Al(SO4)12 · 18H2O |
| Mg | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| Al | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Bayerite | Al(OH)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Böhmite | AlO(OH) |
| Al | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cadwaladerite | Al5(H2O)3(OH)12 · n(Cl,H2O) |
| Al | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Clintonite | CaAlMg2(SiAl3O10)(OH)2 |
| Al | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Francoanellite | K3Al5(PO3OH)6(PO4)2 · 12H2O |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Gehlenite | Ca2Al[AlSiO7] |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Al | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| Al | ⓘ Haüyne | Na3Ca(Si3Al3)O12(SO4) |
| Al | ⓘ Hercynite | Fe2+Al2O4 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Al | ⓘ Kalinite | KAl(SO4)2 · 11H2O |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Khademite | Al(SO4)F · 5H2O |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Lawsonite | CaAl2(Si2O7)(OH)2 · H2O |
| Al | ⓘ Leucite | K(AlSi2O6) |
| Al | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Mansfieldite | AlAsO4 · 2H2O |
| Al | ⓘ Marialite | Na4Al3Si9O24Cl |
| Al | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Millosevichite | Al2(SO4)3 |
| Al | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Al | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Planerite | Al6(PO4)2(PO3OH)2(OH)8 · 4H2O |
| Al | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Al | ⓘ Sanidine | K(AlSi3O8) |
| Al | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Al | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Al | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Al | ⓘ Spheniscidite | (NH4,K)(Fe3+,Al)2(PO4)2(OH) · 2H2O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Tamarugite | NaAl(SO4)2 · 6H2O |
| Al | ⓘ Taranakite | (K,NH4)Al3(PO4)3(OH) · 9H2O |
| Al | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Al | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Variscite | AlPO4 · 2H2O |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Zunyite | Al13Si5O20(OH,F)18Cl |
| Al | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Al | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| Al | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Al | ⓘ Pertlikite | K2(Fe2+,Mg)2Mg4Fe23+Al(SO4)12 · 18H2O |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | ⓘ Quartz var. Agate-Jasper | SiO2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Bustamite | CaMn2+(Si2O6) |
| Si | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Clintonite | CaAlMg2(SiAl3O10)(OH)2 |
| Si | ⓘ Coffinite | U(SiO4) · nH2O |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| Si | ⓘ Danburite | CaB2Si2O8 |
| Si | ⓘ Andradite var. Demantoid | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dioptase | CuSiO3 · H2O |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| Si | ⓘ Fayalite | Fe22+SiO4 |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Forsterite | Mg2SiO4 |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Gehlenite | Ca2Al[AlSiO7] |
| Si | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Si | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Si | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Haüyne | Na3Ca(Si3Al3)O12(SO4) |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Si | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Krauskopfite | BaSi2O5 · 3H2O |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Lawsonite | CaAl2(Si2O7)(OH)2 · H2O |
| Si | ⓘ Leucite | K(AlSi2O6) |
| Si | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Marialite | Na4Al3Si9O24Cl |
| Si | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| Si | ⓘ Quartz var. Moss Agate | SiO2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Si | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Si | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Si | ⓘ Sanidine | K(AlSi3O8) |
| Si | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Si | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Si | ⓘ Soddyite | (UO2)2SiO4 · 2H2O |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Tridymite | SiO2 |
| Si | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Zunyite | Al13Si5O20(OH,F)18Cl |
| Si | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Si | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Si | ⓘ Andradite var. Topazolite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Quartz var. Dendritic Agate | SiO2 |
| Si | ⓘ Quartz var. Fortification Agate | SiO2 |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Quartz var. Plume Agate | SiO2 |
| Si | ⓘ Olivine Group | M2SiO4 |
| Si | ⓘ Melilite Group | Ca2M(XSiO7) |
| Si | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Althausite | Mg4(PO4)2(OH,O)(F,◻) |
| P | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| P | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Francoanellite | K3Al5(PO3OH)6(PO4)2 · 12H2O |
| P | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Phosphammite | (NH4)2(PO3OH) |
| P | ⓘ Planerite | Al6(PO4)2(PO3OH)2(OH)8 · 4H2O |
| P | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Schreibersite | (Fe,Ni)3P |
| P | ⓘ Spheniscidite | (NH4,K)(Fe3+,Al)2(PO4)2(OH) · 2H2O |
| P | ⓘ Strengite | FePO4 · 2H2O |
| P | ⓘ Taranakite | (K,NH4)Al3(PO4)3(OH) · 9H2O |
| P | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Variscite | AlPO4 · 2H2O |
| P | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| P | ⓘ Pyrocoproite | (K,Na)2Mg(P2O7) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aguilarite | Ag4SeS |
| S | ⓘ Aikinite | PbCuBiS3 |
| S | ⓘ Aktashite | Cu6Hg3As4S12 |
| S | ⓘ Alloclasite | Co1-xFexAsS |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| S | ⓘ Amarantite | Fe23+(SO4)2O · 7H2O |
| S | ⓘ Andorite | AgPbSb3S6 |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Anilite | Cu7S4 |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Aphthitalite | (K,Na)3Na(SO4)2 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Arcanite | K2SO4 |
| S | ⓘ Arcubisite | Ag6CuBiS4 |
| S | ⓘ Pyrite var. Gold-bearing Pyrite | FeS2 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Baumhauerite | Pb12As16S36 |
| S | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| S | ⓘ Berryite | Cu3Ag2Pb3Bi7S16 |
| S | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bonattite | CuSO4 · 3H2O |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Butlerite | Fe3+(SO4)(OH) · 2H2O |
| S | ⓘ Benleonardite | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Celestine | SrSO4 |
| S | ⓘ Cesanite | Na3Ca2(SO4)3(OH) |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcostibite | CuSbS2 |
| S | ⓘ Christite | TlHgAsS3 |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Cobaltpentlandite | Co9S8 |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| S | ⓘ Corderoite | Hg32+S2Cl2 |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Famatinite | Cu3SbS4 |
| S | ⓘ Friedrichite | Pb5Cu5Bi7S18 |
| S | ⓘ Galena | PbS |
| S | ⓘ Galenobismutite | PbBi2S4 |
| S | ⓘ Galkhaite | (Hg5Cu)CsAs4S12 |
| S | ⓘ Geerite | Cu8S5 |
| S | ⓘ Geocronite | Pb14Sb6S23 |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Getchellite | AsSbS3 |
| S | ⓘ Glauberite | Na2Ca(SO4)2 |
| S | ⓘ Godlevskite | (Ni,Fe)9S8 |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Görgeyite | K2Ca5(SO4)6 · H2O |
| S | ⓘ Guettardite | Pb8(Sb0.56As0.44)16S32 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| S | ⓘ Haüyne | Na3Ca(Si3Al3)O12(SO4) |
| S | ⓘ Hawleyite | CdS |
| S | ⓘ Haycockite | Cu4Fe5S8 |
| S | ⓘ Heazlewoodite | Ni3S2 |
| S | ⓘ Hexahydrite | MgSO4 · 6H2O |
| S | ⓘ Hutchinsonite | TlPbAs5S9 |
| S | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| S | ⓘ Ingodite | Bi2TeS |
| S | ⓘ Jalpaite | Ag3CuS2 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Joséite | Bi4TeS2 |
| S | ⓘ Kainite | KMg(SO4)Cl · 3H2O |
| S | ⓘ Kalinite | KAl(SO4)2 · 11H2O |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Khademite | Al(SO4)F · 5H2O |
| S | ⓘ Kieserite | MgSO4 · H2O |
| S | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| S | ⓘ Kornelite | Fe2(SO4)3 · 7H2O |
| S | ⓘ Krupkaite | PbCuBi3S6 |
| S | ⓘ Lautite | CuAsS |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Leonite | K2Mg(SO4)2 · 4H2O |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Lishizhenite | ZnFe2(SO4)4 · 14H2O |
| S | ⓘ Lorándite | TlAsS2 |
| S | ⓘ Luzonite | Cu3AsS4 |
| S | ⓘ Magnesiocopiapite | MgFe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Makovickyite | Cu1.12Ag0.81Pb0.27Bi5.35S9 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Marrite | AgPbAsS3 |
| S | ⓘ Matildite | AgBiS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| S | ⓘ Meneghinite | Pb13CuSb7S24 |
| S | ⓘ Metacinnabar | HgS |
| S | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| S | ⓘ Miargyrite | AgSbS2 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Millosevichite | Al2(SO4)3 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| S | ⓘ Nukundamite | Cu3.33Fe0.66S4 |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Parabutlerite | Fe3+(SO4)(OH) · 2H2O |
| S | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Picromerite | K2Mg(SO4)2 · 6H2O |
| S | ⓘ Plagionite | Pb5Sb8S17 |
| S | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| S | ⓘ Poitevinite | (Cu,Fe)SO4 · H2O |
| S | ⓘ Polhemusite | (Zn,Hg)S |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Polydymite | Ni2+Ni23+S4 |
| S | ⓘ Polyhalite | K2Ca2Mg(SO4)4 · 2H2O |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| S | ⓘ Roxbyite | Cu9S5 |
| S | ⓘ Seligmannite | PbCuAsS3 |
| S | ⓘ Semseyite | Pb9Sb8S21 |
| S | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Simonite | TlHgAs3S6 |
| S | ⓘ Smithite | AgAsS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Spionkopite | Cu39S28 |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stephanite | Ag5SbS4 |
| S | ⓘ Sterryite | Cu(Ag,Cu)3Pb19(Sb,As)22(As-As)S56 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Sulphotsumoite | Bi3Te2S |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Szomolnokite | FeSO4 · H2O |
| S | ⓘ Tamarugite | NaAl(SO4)2 · 6H2O |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Thénardite | Na2SO4 |
| S | ⓘ Tolovkite | IrSbS |
| S | ⓘ Trechmannite | AgAsS2 |
| S | ⓘ Troilite | FeS |
| S | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| S | ⓘ Veenite | Pb16Sb9-xAs7+xS40, x ~ 0-0.5 |
| S | ⓘ Violarite | Fe2+Ni23+S4 |
| S | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Yarrowite | Cu9S8 |
| S | ⓘ Zincmelanterite | (Zn,Cu,Fe)SO4 · 7H2O |
| S | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| S | ⓘ Baksanite | Bi6Te2S3 |
| S | ⓘ Sztrókayite | Bi3TeS2 |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| S | ⓘ Pyrite var. Arsenic-bearing Pyrite | Fe(S,As)2 |
| S | ⓘ Beudantite Group | AM3(XO4)(SO4)(OH)6 |
| S | ⓘ Tetrahedrite Group | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| S | ⓘ Galena var. Bismuth-bearing Galena | (Pb,Bi,Ag)S |
| S | ⓘ Pertlikite | K2(Fe2+,Mg)2Mg4Fe23+Al(SO4)12 · 18H2O |
| S | ⓘ Daliranite | PbHgAs2S5 |
| S | ⓘ Alunite Group | A0.5-1 B3[SO4]2(OH)6 |
| S | ⓘ Barikaite | Ag3Pb10(Sb8As11)S40 |
| S | ⓘ Ferdowsiite | Ag8(Sb5As3)S16 |
| S | ⓘ Lopatkaite | Pb5Sb3AsS11 |
| S | ⓘ Arsenquatrandorite | Ag17.6Pb12.8Sb38.1As11.5S96 |
| S | ⓘ Ferdowsiite var. Lead-bearing Ferdowsiite | (Ag,Pb)8(Sb5As3)S16 |
| S | ⓘ Hyršlite | Pb8As10Sb6S32 |
| S | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| S | ⓘ UM2008-42-S:AsPbSb | Pb(As,Sb)2S4 |
| S | ⓘ Sardashtite | Ag9Cu2.5Pb41Sb36.5As7S112 |
| S | ⓘ Hayyanite | Cu5Ag11Pb76Sb71As17(As2+)8S224 |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cl | ⓘ Cadwaladerite | Al5(H2O)3(OH)12 · n(Cl,H2O) |
| Cl | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Cl | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Corderoite | Hg32+S2Cl2 |
| Cl | ⓘ Cotunnite | PbCl2 |
| Cl | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| Cl | ⓘ Eriochalcite | CuCl2 · 2H2O |
| Cl | ⓘ Erythrosiderite | K2[Fe3+Cl5(H2O)] |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Hydromolysite | FeCl3 · 6H2O |
| Cl | ⓘ Kainite | KMg(SO4)Cl · 3H2O |
| Cl | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cl | ⓘ Marialite | Na4Al3Si9O24Cl |
| Cl | ⓘ Melanothallite | Cu2Cl2O |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Mitscherlichite | K2CuCl4 · 2H2O |
| Cl | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Cl | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cl | ⓘ Phosgenite | Pb2CO3Cl2 |
| Cl | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Rinneite | K3Na[FeCl6] |
| Cl | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Cl | ⓘ Sylvite | KCl |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Zunyite | Al13Si5O20(OH,F)18Cl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Lemanskiite | NaCaCu5(AsO4)4Cl · 3H2O |
| Cl | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Herbertsmithite | Cu3Zn(OH)6Cl2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| K | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| K | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| K | ⓘ Aphthitalite | (K,Na)3Na(SO4)2 |
| K | ⓘ Arcanite | K2SO4 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| K | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| K | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Erythrosiderite | K2[Fe3+Cl5(H2O)] |
| K | ⓘ Francoanellite | K3Al5(PO3OH)6(PO4)2 · 12H2O |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Görgeyite | K2Ca5(SO4)6 · H2O |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Kainite | KMg(SO4)Cl · 3H2O |
| K | ⓘ Kalinite | KAl(SO4)2 · 11H2O |
| K | ⓘ Leonite | K2Mg(SO4)2 · 4H2O |
| K | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| K | ⓘ Leucite | K(AlSi2O6) |
| K | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Mitscherlichite | K2CuCl4 · 2H2O |
| K | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Nepheline | Na3K(Al4Si4O16) |
| K | ⓘ Niter | KNO3 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Picromerite | K2Mg(SO4)2 · 6H2O |
| K | ⓘ Polyhalite | K2Ca2Mg(SO4)4 · 2H2O |
| K | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| K | ⓘ Rinneite | K3Na[FeCl6] |
| K | ⓘ Sanidine | K(AlSi3O8) |
| K | ⓘ Spheniscidite | (NH4,K)(Fe3+,Al)2(PO4)2(OH) · 2H2O |
| K | ⓘ Sylvite | KCl |
| K | ⓘ Taranakite | (K,NH4)Al3(PO4)3(OH) · 9H2O |
| K | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| K | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| K | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| K | ⓘ Pyrocoproite | (K,Na)2Mg(P2O7) |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Pertlikite | K2(Fe2+,Mg)2Mg4Fe23+Al(SO4)12 · 18H2O |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| Ca | ⓘ Bustamite | CaMn2+(Si2O6) |
| Ca | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Cesanite | Na3Ca2(SO4)3(OH) |
| Ca | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Clintonite | CaAlMg2(SiAl3O10)(OH)2 |
| Ca | ⓘ Colemanite | Ca[B3O4(OH)3] · H2O |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Danburite | CaB2Si2O8 |
| Ca | ⓘ Andradite var. Demantoid | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| Ca | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Ca | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gehlenite | Ca2Al[AlSiO7] |
| Ca | ⓘ Glauberite | Na2Ca(SO4)2 |
| Ca | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Ca | ⓘ Görgeyite | K2Ca5(SO4)6 · H2O |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Haüyne | Na3Ca(Si3Al3)O12(SO4) |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Hydroboracite | CaMg[B3O4(OH)3]2 · 3H2O |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Ca | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Ca | ⓘ Lawsonite | CaAl2(Si2O7)(OH)2 · H2O |
| Ca | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Ca | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ca | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| Ca | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Polyhalite | K2Ca2Mg(SO4)4 · 2H2O |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Roselite | Ca2Co(AsO4)2 · 2H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Ca | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Ca | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Ca | ⓘ Ulexite | NaCa[B5O6(OH)6] · 5H2O |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Uranospinite | Ca(UO2)2(AsO4)2 · 10H2O |
| Ca | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Yukonite | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| Ca | ⓘ Zirconolite | CaZrTi2O7 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Ca | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Ca | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Ca | ⓘ Andradite var. Topazolite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Lemanskiite | NaCaCu5(AsO4)4Cl · 3H2O |
| Ca | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Melilite Group | Ca2M(XSiO7) |
| Ca | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
| Ca | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Ti | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Ti | ⓘ Zirconolite | CaZrTi2O7 |
| Ti | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| V | Vanadium | |
| V | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| V | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Cr | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Cr | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Cr | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Cr | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Cr | ⓘ Phoenicochroite | Pb2(CrO4)O |
| Cr | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| Mn | Manganese | |
| Mn | ⓘ Bixbyite-(Mn) | Mn23+O3 |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Bustamite | CaMn2+(Si2O6) |
| Mn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| Mn | ⓘ Hetaerolite | ZnMn2O4 |
| Mn | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Mn | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Mn | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Siderite var. Oligonite | (Fe,Mn)CO3 |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mn | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Fe | ⓘ Alloclasite | Co1-xFexAsS |
| Fe | ⓘ Amarantite | Fe23+(SO4)2O · 7H2O |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Pyrite var. Gold-bearing Pyrite | FeS2 |
| Fe | ⓘ Awaruite | Ni3Fe |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Fe | ⓘ Bernalite | Fe(OH)3 · nH2O (n = 0.0 to 0.25) |
| Fe | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| Fe | ⓘ Butlerite | Fe3+(SO4)(OH) · 2H2O |
| Fe | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Cuprospinel | Cu2+Fe23+O4 |
| Fe | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Fe | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Fe | ⓘ Delafossite | CuFeO2 |
| Fe | ⓘ Andradite var. Demantoid | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Erythrosiderite | K2[Fe3+Cl5(H2O)] |
| Fe | ⓘ Fayalite | Fe22+SiO4 |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | ⓘ Godlevskite | (Ni,Fe)9S8 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| Fe | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| Fe | ⓘ Haycockite | Cu4Fe5S8 |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hercynite | Fe2+Al2O4 |
| Fe | ⓘ Hydromolysite | FeCl3 · 6H2O |
| Fe | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Iron | Fe |
| Fe | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Iron var. Kamacite | (Fe,Ni) |
| Fe | ⓘ Kornelite | Fe2(SO4)3 · 7H2O |
| Fe | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| Fe | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| Fe | ⓘ Lishizhenite | ZnFe2(SO4)4 · 14H2O |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Ludlockite | PbFe43+As103+O22 |
| Fe | ⓘ Magnesiocopiapite | MgFe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Hematite var. Martite | Fe2O3 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| Fe | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| Fe | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Fe | ⓘ Nickelskutterudite | (Ni,Co,Fe)As3 |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Nukundamite | Cu3.33Fe0.66S4 |
| Fe | ⓘ Siderite var. Oligonite | (Fe,Mn)CO3 |
| Fe | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Fe | ⓘ Parabutlerite | Fe3+(SO4)(OH) · 2H2O |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Fe | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| Fe | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Poitevinite | (Cu,Fe)SO4 · H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Fe | ⓘ Rinneite | K3Na[FeCl6] |
| Fe | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Fe | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Schneiderhöhnite | Fe2+Fe33+As53+O13 |
| Fe | ⓘ Schreibersite | (Fe,Ni)3P |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Spheniscidite | (NH4,K)(Fe3+,Al)2(PO4)2(OH) · 2H2O |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Strengite | FePO4 · 2H2O |
| Fe | ⓘ Szomolnokite | FeSO4 · H2O |
| Fe | ⓘ Taenite | (Fe,Ni) |
| Fe | ⓘ Tetrataenite | FeNi |
| Fe | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Fe | ⓘ Troilite | FeS |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | ⓘ Violarite | Fe2+Ni23+S4 |
| Fe | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Yukonite | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| Fe | ⓘ Zincmelanterite | (Zn,Cu,Fe)SO4 · 7H2O |
| Fe | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| Fe | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Andradite var. Topazolite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| Fe | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Fe | ⓘ Pyrite var. Arsenic-bearing Pyrite | Fe(S,As)2 |
| Fe | ⓘ Pertlikite | K2(Fe2+,Mg)2Mg4Fe23+Al(SO4)12 · 18H2O |
| Fe | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| Co | Cobalt | |
| Co | ⓘ Alloclasite | Co1-xFexAsS |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Cobaltpentlandite | Co9S8 |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Nickelskutterudite | (Ni,Co,Fe)As3 |
| Co | ⓘ Roselite | Ca2Co(AsO4)2 · 2H2O |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Co | ⓘ Skutterudite | CoAs3 |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Awaruite | Ni3Fe |
| Ni | ⓘ Annabergite var. Magnesium-bearing Annabergite | (Ni,Mg)3(AsO4)2 · 8H2O |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Godlevskite | (Ni,Fe)9S8 |
| Ni | ⓘ Heazlewoodite | Ni3S2 |
| Ni | ⓘ Iron var. Kamacite | (Fe,Ni) |
| Ni | ⓘ Maucherite | Ni11As8 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickelskutterudite | (Ni,Co,Fe)As3 |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pararammelsbergite | NiAs2 |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Polydymite | Ni2+Ni23+S4 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Ni | ⓘ Schreibersite | (Fe,Ni)3P |
| Ni | ⓘ Taenite | (Fe,Ni) |
| Ni | ⓘ Tetrataenite | FeNi |
| Ni | ⓘ Violarite | Fe2+Ni23+S4 |
| Ni | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| Cu | Copper | |
| Cu | ⓘ Aikinite | PbCuBiS3 |
| Cu | ⓘ Aktashite | Cu6Hg3As4S12 |
| Cu | ⓘ Algodonite | (Cu1-xAsx) |
| Cu | ⓘ Anilite | Cu7S4 |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Arcubisite | Ag6CuBiS4 |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Cu | ⓘ Berryite | Cu3Ag2Pb3Bi7S16 |
| Cu | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cu | ⓘ Bonattite | CuSO4 · 3H2O |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Benleonardite | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chalcostibite | CuSbS2 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| Cu | ⓘ Cuprospinel | Cu2+Fe23+O4 |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Delafossite | CuFeO2 |
| Cu | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Dioptase | CuSiO3 · H2O |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Domeykite | Cu3As |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Eriochalcite | CuCl2 · 2H2O |
| Cu | ⓘ Famatinite | Cu3SbS4 |
| Cu | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cu | ⓘ Friedrichite | Pb5Cu5Bi7S18 |
| Cu | ⓘ Galkhaite | (Hg5Cu)CsAs4S12 |
| Cu | ⓘ Geerite | Cu8S5 |
| Cu | ⓘ Haycockite | Cu4Fe5S8 |
| Cu | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Cu | ⓘ Jalpaite | Ag3CuS2 |
| Cu | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Cu | ⓘ Koutekite | Cu5As2 |
| Cu | ⓘ Krupkaite | PbCuBi3S6 |
| Cu | ⓘ Kutinaite | Ag6Cu14As7 |
| Cu | ⓘ Lautite | CuAsS |
| Cu | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Lindackerite | CuCu4(AsO4)2(HAsO4)2 · 9H2O |
| Cu | ⓘ Luzonite | Cu3AsS4 |
| Cu | ⓘ Makovickyite | Cu1.12Ag0.81Pb0.27Bi5.35S9 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Melanothallite | Cu2Cl2O |
| Cu | ⓘ Meneghinite | Pb13CuSb7S24 |
| Cu | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| Cu | ⓘ Mitscherlichite | K2CuCl4 · 2H2O |
| Cu | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Cu | ⓘ Nukundamite | Cu3.33Fe0.66S4 |
| Cu | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cu | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Cu | ⓘ Poitevinite | (Cu,Fe)SO4 · H2O |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Roxbyite | Cu9S5 |
| Cu | ⓘ Seligmannite | PbCuAsS3 |
| Cu | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Spionkopite | Cu39S28 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Sterryite | Cu(Ag,Cu)3Pb19(Sb,As)22(As-As)S56 |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Yarrowite | Cu9S8 |
| Cu | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| Cu | ⓘ Zincmelanterite | (Zn,Cu,Fe)SO4 · 7H2O |
| Cu | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| Cu | ⓘ Lemanskiite | NaCaCu5(AsO4)4Cl · 3H2O |
| Cu | ⓘ Herbertsmithite | Cu3Zn(OH)6Cl2 |
| Cu | ⓘ UM1983-02-As:Cu | Cu2As |
| Cu | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Cu | ⓘ Sardashtite | Ag9Cu2.5Pb41Sb36.5As7S112 |
| Cu | ⓘ Hayyanite | Cu5Ag11Pb76Sb71As17(As2+)8S224 |
| Zn | Zinc | |
| Zn | ⓘ Adamite | Zn2(AsO4)(OH) |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hetaerolite | ZnMn2O4 |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Lishizhenite | ZnFe2(SO4)4 · 14H2O |
| Zn | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Zn | ⓘ Polhemusite | (Zn,Hg)S |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Zn | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| Zn | ⓘ Zincmelanterite | (Zn,Cu,Fe)SO4 · 7H2O |
| Zn | ⓘ Zincite | ZnO |
| Zn | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| Zn | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| Zn | ⓘ Herbertsmithite | Cu3Zn(OH)6Cl2 |
| Zn | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| As | Arsenic | |
| As | ⓘ Adamite | Zn2(AsO4)(OH) |
| As | ⓘ Aktashite | Cu6Hg3As4S12 |
| As | ⓘ Algodonite | (Cu1-xAsx) |
| As | ⓘ Alloclasite | Co1-xFexAsS |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Baumhauerite | Pb12As16S36 |
| As | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| As | ⓘ Benleonardite | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| As | ⓘ Annabergite var. Magnesium-bearing Annabergite | (Ni,Mg)3(AsO4)2 · 8H2O |
| As | ⓘ Christite | TlHgAsS3 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Domeykite | Cu3As |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| As | ⓘ Galkhaite | (Hg5Cu)CsAs4S12 |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Getchellite | AsSbS3 |
| As | ⓘ Guettardite | Pb8(Sb0.56As0.44)16S32 |
| As | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| As | ⓘ Hutchinsonite | TlPbAs5S9 |
| As | ⓘ Koutekite | Cu5As2 |
| As | ⓘ Kutinaite | Ag6Cu14As7 |
| As | ⓘ Lautite | CuAsS |
| As | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| As | ⓘ Lindackerite | CuCu4(AsO4)2(HAsO4)2 · 9H2O |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Lorándite | TlAsS2 |
| As | ⓘ Ludlockite | PbFe43+As103+O22 |
| As | ⓘ Luzonite | Cu3AsS4 |
| As | ⓘ Mansfieldite | AlAsO4 · 2H2O |
| As | ⓘ Marrite | AgPbAsS3 |
| As | ⓘ Maucherite | Ni11As8 |
| As | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Nickelskutterudite | (Ni,Co,Fe)As3 |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Pararammelsbergite | NiAs2 |
| As | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| As | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| As | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| As | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Rooseveltite | Bi(AsO4) |
| As | ⓘ Roselite | Ca2Co(AsO4)2 · 2H2O |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Schneiderhöhnite | Fe2+Fe33+As53+O13 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Seelite | Mg(UO2)(As3+O3)0.7(AsO4)0.3 · 7H2O |
| As | ⓘ Seligmannite | PbCuAsS3 |
| As | ⓘ Simonite | TlHgAs3S6 |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Smithite | AgAsS2 |
| As | ⓘ Natrouranospinite | Na2(UO2)2(AsO4)2 · 5H2O |
| As | ⓘ Sterryite | Cu(Ag,Cu)3Pb19(Sb,As)22(As-As)S56 |
| As | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Trechmannite | AgAsS2 |
| As | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| As | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| As | ⓘ Uranospinite | Ca(UO2)2(AsO4)2 · 10H2O |
| As | ⓘ Veenite | Pb16Sb9-xAs7+xS40, x ~ 0-0.5 |
| As | ⓘ Yukonite | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| As | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| As | ⓘ Lemanskiite | NaCaCu5(AsO4)4Cl · 3H2O |
| As | ⓘ Pyrite var. Arsenic-bearing Pyrite | Fe(S,As)2 |
| As | ⓘ Daliranite | PbHgAs2S5 |
| As | ⓘ Barikaite | Ag3Pb10(Sb8As11)S40 |
| As | ⓘ Ferdowsiite | Ag8(Sb5As3)S16 |
| As | ⓘ Lopatkaite | Pb5Sb3AsS11 |
| As | ⓘ Arsenquatrandorite | Ag17.6Pb12.8Sb38.1As11.5S96 |
| As | ⓘ Ferdowsiite var. Lead-bearing Ferdowsiite | (Ag,Pb)8(Sb5As3)S16 |
| As | ⓘ UM1983-02-As:Cu | Cu2As |
| As | ⓘ Hyršlite | Pb8As10Sb6S32 |
| As | ⓘ UM2008-42-S:AsPbSb | Pb(As,Sb)2S4 |
| As | ⓘ Sardashtite | Ag9Cu2.5Pb41Sb36.5As7S112 |
| As | ⓘ Hayyanite | Cu5Ag11Pb76Sb71As17(As2+)8S224 |
| Se | Selenium | |
| Se | ⓘ Aguilarite | Ag4SeS |
| Se | ⓘ Naumannite | Ag2Se |
| Sr | Strontium | |
| Sr | ⓘ Celestine | SrSO4 |
| Sr | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Sr | ⓘ Strontianite | SrCO3 |
| Sr | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Y | Yttrium | |
| Y | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Y | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Baddeleyite | ZrO2 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Zirconolite | CaZrTi2O7 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ru | Ruthenium | |
| Ru | ⓘ Osmium | (Os,Ir,Ru) |
| Pd | Palladium | |
| Pd | ⓘ Stibiopalladinite | Pd5Sb2 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Aguilarite | Ag4SeS |
| Ag | ⓘ Andorite | AgPbSb3S6 |
| Ag | ⓘ Arcubisite | Ag6CuBiS4 |
| Ag | ⓘ Berryite | Cu3Ag2Pb3Bi7S16 |
| Ag | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Ag | ⓘ Benleonardite | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| Ag | ⓘ Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Iodargyrite | AgI |
| Ag | ⓘ Jalpaite | Ag3CuS2 |
| Ag | ⓘ Kutinaite | Ag6Cu14As7 |
| Ag | ⓘ Makovickyite | Cu1.12Ag0.81Pb0.27Bi5.35S9 |
| Ag | ⓘ Marrite | AgPbAsS3 |
| Ag | ⓘ Matildite | AgBiS2 |
| Ag | ⓘ Miargyrite | AgSbS2 |
| Ag | ⓘ Naumannite | Ag2Se |
| Ag | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Silver | Ag |
| Ag | ⓘ Smithite | AgAsS2 |
| Ag | ⓘ Stephanite | Ag5SbS4 |
| Ag | ⓘ Sterryite | Cu(Ag,Cu)3Pb19(Sb,As)22(As-As)S56 |
| Ag | ⓘ Stromeyerite | AgCuS |
| Ag | ⓘ Trechmannite | AgAsS2 |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Ag | ⓘ Galena var. Bismuth-bearing Galena | (Pb,Bi,Ag)S |
| Ag | ⓘ Barikaite | Ag3Pb10(Sb8As11)S40 |
| Ag | ⓘ Ferdowsiite | Ag8(Sb5As3)S16 |
| Ag | ⓘ Arsenquatrandorite | Ag17.6Pb12.8Sb38.1As11.5S96 |
| Ag | ⓘ Ferdowsiite var. Lead-bearing Ferdowsiite | (Ag,Pb)8(Sb5As3)S16 |
| Ag | ⓘ Unnamed (Ag Diiodide) | AgI2 |
| Ag | ⓘ Sardashtite | Ag9Cu2.5Pb41Sb36.5As7S112 |
| Ag | ⓘ Hayyanite | Cu5Ag11Pb76Sb71As17(As2+)8S224 |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Cd | ⓘ Hawleyite | CdS |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Andorite | AgPbSb3S6 |
| Sb | ⓘ Antimony | Sb |
| Sb | ⓘ Aurostibite | AuSb2 |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Benleonardite | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| Sb | ⓘ Chalcostibite | CuSbS2 |
| Sb | ⓘ Famatinite | Cu3SbS4 |
| Sb | ⓘ Geocronite | Pb14Sb6S23 |
| Sb | ⓘ Getchellite | AsSbS3 |
| Sb | ⓘ Guettardite | Pb8(Sb0.56As0.44)16S32 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Sb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Sb | ⓘ Miargyrite | AgSbS2 |
| Sb | ⓘ Plagionite | Pb5Sb8S17 |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Semseyite | Pb9Sb8S21 |
| Sb | ⓘ Stibiopalladinite | Pd5Sb2 |
| Sb | ⓘ Stephanite | Ag5SbS4 |
| Sb | ⓘ Sterryite | Cu(Ag,Cu)3Pb19(Sb,As)22(As-As)S56 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Tolovkite | IrSbS |
| Sb | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Sb | ⓘ Veenite | Pb16Sb9-xAs7+xS40, x ~ 0-0.5 |
| Sb | ⓘ Barikaite | Ag3Pb10(Sb8As11)S40 |
| Sb | ⓘ Ferdowsiite | Ag8(Sb5As3)S16 |
| Sb | ⓘ Lopatkaite | Pb5Sb3AsS11 |
| Sb | ⓘ Arsenquatrandorite | Ag17.6Pb12.8Sb38.1As11.5S96 |
| Sb | ⓘ Ferdowsiite var. Lead-bearing Ferdowsiite | (Ag,Pb)8(Sb5As3)S16 |
| Sb | ⓘ Hyršlite | Pb8As10Sb6S32 |
| Sb | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Sb | ⓘ UM2008-42-S:AsPbSb | Pb(As,Sb)2S4 |
| Sb | ⓘ Sardashtite | Ag9Cu2.5Pb41Sb36.5As7S112 |
| Sb | ⓘ Hayyanite | Cu5Ag11Pb76Sb71As17(As2+)8S224 |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Benleonardite | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| Te | ⓘ Calaverite | AuTe2 |
| Te | ⓘ Coloradoite | HgTe |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Ingodite | Bi2TeS |
| Te | ⓘ Joséite | Bi4TeS2 |
| Te | ⓘ Sulphotsumoite | Bi3Te2S |
| Te | ⓘ Baksanite | Bi6Te2S3 |
| Te | ⓘ Sztrókayite | Bi3TeS2 |
| I | Iodine | |
| I | ⓘ Iodargyrite | AgI |
| I | ⓘ Unnamed (Ag Diiodide) | AgI2 |
| Cs | Caesium | |
| Cs | ⓘ Galkhaite | (Hg5Cu)CsAs4S12 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Ba | ⓘ Krauskopfite | BaSi2O5 · 3H2O |
| Ba | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| La | Lanthanum | |
| La | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Ce | Cerium | |
| Ce | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ta | Tantalum | |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ-n |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| Os | Osmium | |
| Os | ⓘ Osmium | (Os,Ir,Ru) |
| Ir | Iridium | |
| Ir | ⓘ Osmium | (Os,Ir,Ru) |
| Ir | ⓘ Tolovkite | IrSbS |
| Au | Gold | |
| Au | ⓘ Aurostibite | AuSb2 |
| Au | ⓘ Calaverite | AuTe2 |
| Au | ⓘ Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Gold | Au |
| Au | ⓘ Maldonite | Au2Bi |
| Hg | Mercury | |
| Hg | ⓘ Aktashite | Cu6Hg3As4S12 |
| Hg | ⓘ Christite | TlHgAsS3 |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Coloradoite | HgTe |
| Hg | ⓘ Corderoite | Hg32+S2Cl2 |
| Hg | ⓘ Galkhaite | (Hg5Cu)CsAs4S12 |
| Hg | ⓘ Metacinnabar | HgS |
| Hg | ⓘ Polhemusite | (Zn,Hg)S |
| Hg | ⓘ Simonite | TlHgAs3S6 |
| Hg | ⓘ Daliranite | PbHgAs2S5 |
| Tl | Thallium | |
| Tl | ⓘ Christite | TlHgAsS3 |
| Tl | ⓘ Hutchinsonite | TlPbAs5S9 |
| Tl | ⓘ Lorándite | TlAsS2 |
| Tl | ⓘ Simonite | TlHgAs3S6 |
| Tl | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Pb | Lead | |
| Pb | ⓘ Aikinite | PbCuBiS3 |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Andorite | AgPbSb3S6 |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Baumhauerite | Pb12As16S36 |
| Pb | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Pb | ⓘ Berryite | Cu3Ag2Pb3Bi7S16 |
| Pb | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Cotunnite | PbCl2 |
| Pb | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| Pb | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Pb | ⓘ Friedrichite | Pb5Cu5Bi7S18 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Galenobismutite | PbBi2S4 |
| Pb | ⓘ Geocronite | Pb14Sb6S23 |
| Pb | ⓘ Guettardite | Pb8(Sb0.56As0.44)16S32 |
| Pb | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Pb | ⓘ Hutchinsonite | TlPbAs5S9 |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Pb | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Pb | ⓘ Krupkaite | PbCuBi3S6 |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Ludlockite | PbFe43+As103+O22 |
| Pb | ⓘ Litharge | PbO |
| Pb | ⓘ Makovickyite | Cu1.12Ag0.81Pb0.27Bi5.35S9 |
| Pb | ⓘ Marrite | AgPbAsS3 |
| Pb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Minium | Pb3O4 |
| Pb | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Pb | ⓘ Phoenicochroite | Pb2(CrO4)O |
| Pb | ⓘ Phosgenite | Pb2CO3Cl2 |
| Pb | ⓘ Plagionite | Pb5Sb8S17 |
| Pb | ⓘ Plattnerite | PbO2 |
| Pb | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Pb | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Seligmannite | PbCuAsS3 |
| Pb | ⓘ Semseyite | Pb9Sb8S21 |
| Pb | ⓘ Sterryite | Cu(Ag,Cu)3Pb19(Sb,As)22(As-As)S56 |
| Pb | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Veenite | Pb16Sb9-xAs7+xS40, x ~ 0-0.5 |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Pb | ⓘ Galena var. Bismuth-bearing Galena | (Pb,Bi,Ag)S |
| Pb | ⓘ Daliranite | PbHgAs2S5 |
| Pb | ⓘ Barikaite | Ag3Pb10(Sb8As11)S40 |
| Pb | ⓘ Lopatkaite | Pb5Sb3AsS11 |
| Pb | ⓘ Arsenquatrandorite | Ag17.6Pb12.8Sb38.1As11.5S96 |
| Pb | ⓘ Ferdowsiite var. Lead-bearing Ferdowsiite | (Ag,Pb)8(Sb5As3)S16 |
| Pb | ⓘ UM1970-15-O:Pb | Pb9O16 |
| Pb | ⓘ Hyršlite | Pb8As10Sb6S32 |
| Pb | ⓘ UM2008-42-S:AsPbSb | Pb(As,Sb)2S4 |
| Pb | ⓘ Sardashtite | Ag9Cu2.5Pb41Sb36.5As7S112 |
| Pb | ⓘ Hayyanite | Cu5Ag11Pb76Sb71As17(As2+)8S224 |
| Bi | Bismuth | |
| Bi | ⓘ Aikinite | PbCuBiS3 |
| Bi | ⓘ Arcubisite | Ag6CuBiS4 |
| Bi | ⓘ Berryite | Cu3Ag2Pb3Bi7S16 |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Friedrichite | Pb5Cu5Bi7S18 |
| Bi | ⓘ Galenobismutite | PbBi2S4 |
| Bi | ⓘ Ingodite | Bi2TeS |
| Bi | ⓘ Joséite | Bi4TeS2 |
| Bi | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Bi | ⓘ Krupkaite | PbCuBi3S6 |
| Bi | ⓘ Makovickyite | Cu1.12Ag0.81Pb0.27Bi5.35S9 |
| Bi | ⓘ Maldonite | Au2Bi |
| Bi | ⓘ Matildite | AgBiS2 |
| Bi | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Bi | ⓘ Rooseveltite | Bi(AsO4) |
| Bi | ⓘ Sulphotsumoite | Bi3Te2S |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| Bi | ⓘ Baksanite | Bi6Te2S3 |
| Bi | ⓘ Sztrókayite | Bi3TeS2 |
| Bi | ⓘ Galena var. Bismuth-bearing Galena | (Pb,Bi,Ag)S |
| Th | Thorium | |
| Th | ⓘ Thorianite | ThO2 |
| Th | ⓘ Thorite | Th(SiO4) |
| Th | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| Th | ⓘ Thorianite var. Uranothorianite | (Th,U)O2 |
| U | Uranium | |
| U | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| U | ⓘ Coffinite | U(SiO4) · nH2O |
| U | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| U | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| U | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| U | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| U | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Seelite | Mg(UO2)(As3+O3)0.7(AsO4)0.3 · 7H2O |
| U | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| U | ⓘ Natrouranospinite | Na2(UO2)2(AsO4)2 · 5H2O |
| U | ⓘ Soddyite | (UO2)2SiO4 · 2H2O |
| U | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| U | ⓘ Uranospinite | Ca(UO2)2(AsO4)2 · 10H2O |
| U | ⓘ Thorianite var. Uranothorianite | (Th,U)O2 |
| U | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
Geochronology
Mineralization age: Phanerozoic : 80.1 ± 3.1 Ma to 0.5 ± 0.15 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Iran |
|---|---|
| Wikidata ID: | Q794 |
| GeoNames ID: | 130758 |
Mindat Articles
The Jurassic age in North Of Mahallat With Thrust Fault by Farid MohammadiLocalities in this Region
- Kohgiluyeh and Boyer-Ahmad Province
- Kurdistan Province
- Lorestan Province
- Markazi Province
- Mazandaran Province
- North Khorasan Province
- Qazvin Province
- Qom Province
- Razavi Khorasan Province
- Semnan Province
- Sistan and Baluchestan Province
- South Khorasan Province
- Tehran Province
- West Azerbaijan Province
- Yazd Province
- Zanjan Province
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsOther DatabasesArticlesLocalities in RegionOther RegionsReferences
Iran