Lanlivery, Cornwall, England, UKi
| Regional Level Types | |
|---|---|
| Lanlivery | Civil Parish |
| Cornwall | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Mindat Locality ID:
19236
Long-form identifier:
mindat:1:2:19236:8
GUID (UUID V4):
290aa2e8-2538-4820-a1c0-7721899d51bb
Other Languages:
Cornish:
Lannlyvri, Kernow, Pow Sows, Ruwvaneth Unys
French:
Lanlivery, Cornouailles, Angleterre, Royaume-Uni
Italian:
Lanlivery, Cornovaglia, Inghilterra, Regno Unito
Arabic:
ΩΩΩΩΩΨ±Ω, ΩΩΨ±ΩΩΨ§Ω, Ψ₯ΩΨ¬ΩΨͺΨ±Ψ§, Ψ§ΩΩ
Ω
ΩΩΨ© Ψ§ΩΩ
ΨͺΨΨ―Ψ©
Basque:
Lanlivery, Kornualles, Ingalaterra, Erresuma Batua
Bulgarian:
ΠΠ°Π½Π»ΠΈΠ²Π΅ΡΠΉ, ΠΠΎΡΠ½ΡΠΎΠ», ΠΠ½Π³Π»ΠΈΡ, ΠΠ±Π΅Π΄ΠΈΠ½Π΅Π½ΠΎ ΠΊΡΠ°Π»ΡΡΠ²ΠΎ ΠΠ΅Π»ΠΈΠΊΠΎΠ±ΡΠΈΡΠ°Π½ΠΈΡ ΠΈ Π‘Π΅Π²Π΅ΡΠ½Π° ΠΡΠ»Π°Π½Π΄ΠΈΡ
Cebuano:
Lanlivery, Cornwall, Inglatera, Hiniusang Gingharian
Dutch:
Lanlivery, Cornwall, Engeland, Verenigd Koninkrijk
Farsi/Persian:
ΩΨ§ΩΩΫΩΨ±Ϋ, Ϊ©ΩΨ±ΩΩΨ§Ω, Ψ§ΩΪ―ΩΨ³ΨͺΨ§Ω, Ψ¨Ψ±ΫΨͺΨ§ΩΫΨ§
Latin:
Penknight, Cornubia, Anglia, Britanniarum regnum
Polish:
Lanlivery, Kornwalia, Anglia, Wielka Brytania
South Azerbaijani:
ΩΨ§ΩΩΫΩΨ±Ϋ, Ψ§ΫΩΪ―ΫΩΫΨ³, Ψ¨ΫΨ±ΩΨ΄Ω
ΫΨ΄ Ψ΄Ψ§ΩΩΫΩ
Swedish:
Lanlivery, Cornwall, England, Storbritannien
Welsh:
Lanlivery, Cernyw, Lloegr, Y Deyrnas Unedig
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities22 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| β Albite ? Formula: Na(AlSi3O8) Description: Kingsbury reference. |
| β Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Description: Kingsbury (1958): "The best-known apatites from here are pale blue in colour and from the development of many faces in the pyramid zones have a rather rounded appearance and habit. Other crystals are, however, sometimes more prismatic in habit and show other shades of colour, from colourless to whitish, yellowish, and greenish." |
| β Bismuthinite Formula: Bi2S3 |
| β Bismutite Formula: (BiO)2CO3 |
| β Brochantite Formula: Cu4(SO4)(OH)6 |
| β Cannonite Formula: Bi2(SO4)O(OH)2 |
| β Cassiterite Formula: SnO2 Localities: |
| β Cassiterite var. Toad's Eye Tin |
| β 'Chabazite' |
| β Chalcocite Formula: Cu2S |
| β Chalcopyrite Formula: CuFeS2 |
| β Copper Formula: Cu |
| β 'Feldspar Group' ? Colour: cream-coloured Description: Kingsbury reference. |
| β Fluorapatite Formula: Ca5(PO4)3F Localities: |
| β Fluorapatite var. Carbonate-rich Fluorapatite Formula: Ca5(PO4,CO3)3(F,O) |
| β Fluorite Formula: CaF2 |
| β Goethite Formula: Ξ±-Fe3+O(OH) |
| β Gold Formula: Au |
| β Formula: CaBe(PO4)F Locality: Colcerrow Quarry (Gready Quarry), Lanlivery, Cornwall, England, UK - erroneously reported Description: Kingsbury reference. |
| β Malachite Formula: Cu2(CO3)(OH)2 |
| β Mixite Formula: BiCu6(AsO4)3(OH)6 · 3H2O |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β Muscovite var. Gilbertite Formula: KAl2(AlSi3O10)(OH)2 Habit: globular aggregates |
| β Orthoclase Formula: K(AlSi3O8) Localities: |
| β Pyrite Formula: FeS2 |
| β Quartz Formula: SiO2 |
| β Quartz var. Smoky Quartz ? Formula: SiO2 Description: Kingsbury reference. |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: |
| β Siderite Formula: FeCO3 |
| β 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| β 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Gold | 1.AA.05 | Au |
| β | Copper | 1.AA.05 | Cu |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Chalcocite | 2.BA.05 | Cu2S |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Bismuthinite | 2.DB.05 | Bi2S3 |
| β | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Goethite | 4.00. | Ξ±-Fe3+O(OH) |
| β | Quartz var. Smoky Quartz ? | 4.DA.05 | SiO2 |
| β | 4.DA.05 | SiO2 | |
| β | Cassiterite | 4.DB.05 | SnO2 |
| β | var. Toad's Eye Tin | 4.DB.05 | SnO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Siderite | 5.AB.05 | FeCO3 |
| β | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| β | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| β | Cannonite | 7.BD.35 | Bi2(SO4)O(OH)2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Herderite ? | 8.BA.10 | CaBe(PO4)F |
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| β | var. Carbonate-rich Fluorapatite | 8.BN.05 | Ca5(PO4,CO3)3(F,O) |
| β | Mixite | 8.DL.15 | BiCu6(AsO4)3(OH)6 Β· 3H2O |
| Group 9 - Silicates | |||
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Muscovite var. Gilbertite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| β | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 Β· 2.5-3H2O |
| β | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| β | Albite ? | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| β | 'Feldspar Group' ? | - | |
| β | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] Β· nH2O |
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| β | 'Chabazite' | - | |
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | β Brochantite | Cu4(SO4)(OH)6 |
| H | β Cannonite | Bi2(SO4)O(OH)2 |
| H | β Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| H | β Goethite | Ξ±-Fe3+O(OH) |
| H | β Malachite | Cu2(CO3)(OH)2 |
| H | β Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Be | Beryllium | |
| Be | β Herderite | CaBe(PO4)F |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | β Bismutite | (BiO)2CO3 |
| C | β Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| C | β Malachite | Cu2(CO3)(OH)2 |
| C | β Siderite | FeCO3 |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | β Bismutite | (BiO)2CO3 |
| O | β Brochantite | Cu4(SO4)(OH)6 |
| O | β Cannonite | Bi2(SO4)O(OH)2 |
| O | β Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| O | β Cassiterite | SnO2 |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| O | β Goethite | Ξ±-Fe3+O(OH) |
| O | β Herderite | CaBe(PO4)F |
| O | β Malachite | Cu2(CO3)(OH)2 |
| O | β Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Siderite | FeCO3 |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | β Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| F | β Fluorapatite | Ca5(PO4)3F |
| F | β Fluorite | CaF2 |
| F | β Herderite | CaBe(PO4)F |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | β Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | β Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| P | Phosphorus | |
| P | β Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| P | β Fluorapatite | Ca5(PO4)3F |
| P | β Herderite | CaBe(PO4)F |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | β Bismuthinite | Bi2S3 |
| S | β Brochantite | Cu4(SO4)(OH)6 |
| S | β Cannonite | Bi2(SO4)O(OH)2 |
| S | β Chalcopyrite | CuFeS2 |
| S | β Chalcocite | Cu2S |
| S | β Pyrite | FeS2 |
| Cl | Chlorine | |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | β Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | β Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Fluorite | CaF2 |
| Ca | β Herderite | CaBe(PO4)F |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Fe | Iron | |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Goethite | Ξ±-Fe3+O(OH) |
| Fe | β Pyrite | FeS2 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Siderite | FeCO3 |
| Cu | Copper | |
| Cu | β Brochantite | Cu4(SO4)(OH)6 |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Chalcocite | Cu2S |
| Cu | β Copper | Cu |
| Cu | β Malachite | Cu2(CO3)(OH)2 |
| Cu | β Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| As | Arsenic | |
| As | β Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Sn | Tin | |
| Sn | β Cassiterite | SnO2 |
| Au | Gold | |
| Au | β Gold | Au |
| Bi | Bismuth | |
| Bi | β Bismuthinite | Bi2S3 |
| Bi | β Bismutite | (BiO)2CO3 |
| Bi | β Cannonite | Bi2(SO4)O(OH)2 |
| Bi | β Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Lanlivery |
|---|---|
| Wikidata ID: | Q3313245 |
| GeoNames ID: | 7294627 |
Localities in this Region
Other Regions, Features and Areas that Intersect
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
UK
- England
- Cornwall
- St Austell Mining DistrictMining District
- Devon and Cornwall metalliferous mining districtMining District
- Cornwall
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
New Fowey Consols, Lanlivery, Cornwall, England, UK