Oberschöna, Mittelsachsen, Saxony, Germanyi
| Regional Level Types | |
|---|---|
| Oberschöna | Municipality |
| Mittelsachsen | District |
| Saxony | State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Oberschöna | 3,764 (2017) |
Mindat Locality ID:
203297
Long-form identifier:
mindat:1:2:203297:2
GUID (UUID V4):
4f5a752d-077e-4115-9869-92d6ba31b516
Other Languages:
French:
Oberschöna, Saxe centrale, Saxe (Land), Allemagne
German:
Oberschöna, Mittelsachsen, Sachsen, Deutschland
Italian:
Oberschöna, circondario della Sassonia Centrale, Sassonia, Germania
Russian:
Обершёна, Средняя Саксония, Саксония (земля), Германия
Simplified Chinese:
上舍纳, 萨克森自由州, 德国
Spanish:
Oberschöna, Mittelsachsen, Sajonia, Alemania
Bashkir:
Обершёна, Саксония, Германия
Basque:
Oberschöna, Saxonia, Alemania
Catalan:
Oberschöna, Mittelsachsen, Saxònia, Alemanya
Dutch:
Oberschöna, Landkreis Mittelsachsen, Saksen (deelstaat), Duitsland
Esperanto:
Oberschöna, Distrikto Centra Saksio, Saksio, Germanio
Estonian:
Oberschöna vald, Kesk-Saksimaa kreis, Saksimaa, Saksamaa
Farsi/Persian:
اوبرشونا, ميتلزاكسن, زاکسن, آلمان
Hungarian:
Oberschöna, Szászország, Németország
Japanese:
オーバーシェーナ, ミッテルザクセン郡, ザクセン州, ドイツ
Kazakh (Cyrillic Script):
Обершёна, Орталық Саксония, Саксония еркін мемлекеті, Германия
Kyrgyz:
Обершөна, Германия
Macedonian:
Обершена, Мителзаксен, Саксонија, Германија
Malay:
Oberschöna, Mittelsachsen, Sachsen, Jerman
Norwegian:
Oberschöna, Landkreis Mittelsachsen, Sachsen, Tyskland
Occitan:
Oberschöna, Saxònia (land), Alemanha
Polish:
Oberschöna, Powiat Mittelsachsen, Saksonia, Niemcy
Romanian:
Oberschöna, Saxonia, Germania
Serbian:
Обершена, Саксонија, Њемачка
Serbo-Croatian:
Oberschöna, Saksonija, Njemačka
Ukrainian:
Обершена, Середня Саксонія, Саксонія, Німеччина
Uzbek (Latin Script):
Oberschöna, Mittelsachsen, Saksoniya, Germaniya
Vietnamese:
Oberschöna, Mittelsachsen, Sachsen, Đức
Volapük:
Oberschöna, Saxän, Deutän
Waray:
Oberschöna, Mittelsachsen, Sachsen, Alemanya
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities59 valid minerals. 3 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Anatase Formula: TiO2 Localities: |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ 'Andorite' Formula: AgPbSb3S6 |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Berthierite Formula: FeSb2S4 Localities: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Boulangerite Formula: Pb5Sb4S11 |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: |
| ⓘ Chapmanite Formula: Fe3+2Sb3+(Si2O5)O3(OH) |
| ⓘ 'Chlorite Group' |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Diaphorite (TL) Formula: Ag3Pb2Sb3S8 Type Locality: |
| ⓘ 'Feldspar Group' |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ Freieslebenite Formula: AgPbSbS3 |
| ⓘ Fülöppite Formula: Pb3Sb8S15 |
| ⓘ Galena Formula: PbS Localities: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Halotrichite Formula: FeAl2(SO4)4 · 22H2O |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 |
| ⓘ Kermesite (TL) Formula: Sb2S2O Localities: |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Kutnohorite Formula: CaMn2+(CO3)2 |
| ⓘ Lindbergite Formula: Mn2+(C2O4) · 2H2O |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Marcasite Formula: FeS2 Localities: |
| ⓘ Metastibnite Formula: Sb2S3 |
| ⓘ Miargyrite (TL) Formula: AgSbS2 Type Locality: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Nickelskutterudite Formula: (Ni,Co,Fe)As3 |
| ⓘ Pitticite Formula: (Fe, AsO4, H2O) (?) |
| ⓘ Polybasite Formula: [Ag6Sb2S7][Ag9CuS4] |
| ⓘ Proustite Formula: Ag3AsS3 |
| ⓘ 'Psilomelane' |
| ⓘ Pyrargyrite Formula: Ag3SbS3 |
| ⓘ Pyrite Formula: FeS2 Localities: |
| ⓘ Pyrostilpnite Formula: Ag3SbS3 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: |
| ⓘ Quartz Formula: SiO2 Localities: Neue Hoffnung Gottes Mine, Bräunsdorf, Oberschöna, Mittelsachsen, Saxony, Germany Quartzite quarry, Oberschöna, Mittelsachsen, Saxony, Germany Unverhoffter Segen Gottes Mine, Zenith Mine field, Oberschöna, Mittelsachsen, Saxony, Germany Kühschacht, Bräunsdorf, Oberschöna, Mittelsachsen, Saxony, Germany |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Semseyite Formula: Pb9Sb8S21 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Silver Formula: Ag |
| ⓘ Sphalerite Formula: ZnS Localities: |
| ⓘ Stephanite Formula: Ag5SbS4 |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Strontianite Formula: SrCO3 |
| ⓘ Sulphur Formula: S8 |
| ⓘ 'Tecticite' |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: |
| ⓘ Valentinite Formula: Sb2O3 |
| ⓘ Zinkenite Formula: Pb9Sb22S42 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Metastibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Nickelskutterudite | 2.EC.05 | (Ni,Co,Fe)As3 |
| ⓘ | Kermesite (TL) | 2.FD.05 | Sb2S2O |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrostilpnite | 2.GA.10 | Ag3SbS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Stephanite | 2.GB.10 | Ag5SbS4 |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| ⓘ | Miargyrite (TL) | 2.HA.10 | AgSbS2 |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Fülöppite | 2.HC.10a | Pb3Sb8S15 |
| ⓘ | Semseyite | 2.HC.10d | Pb9Sb8S21 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Diaphorite (TL) | 2.JB.05 | Ag3Pb2Sb3S8 |
| ⓘ | Freieslebenite | 2.JB.15 | AgPbSbS3 |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Kutnohorite | 5.AB.10 | CaMn2+(CO3)2 |
| ⓘ | Strontianite | 5.AB.15 | SrCO3 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Halotrichite | 7.CB.85 | FeAl2(SO4)4 · 22H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Pitticite | 8.DB.05 | (Fe, AsO4, H2O) (?) |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Chapmanite | 9.ED.25 | Fe3+2Sb3+(Si2O5)O3(OH) |
| Group 10 - Organic Compounds | |||
| ⓘ | Lindbergite | 10.AB.05 | Mn2+(C2O4) · 2H2O |
| Unclassified | |||
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Andorite' | - | AgPbSb3S6 |
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Tecticite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chapmanite | Fe23+Sb3+(Si2O5)O3(OH) |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Lindbergite | Mn2+(C2O4) · 2H2O |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Strontianite | SrCO3 |
| C | ⓘ Lindbergite | Mn2+(C2O4) · 2H2O |
| O | Oxygen | |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Chapmanite | Fe23+Sb3+(Si2O5)O3(OH) |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Strontianite | SrCO3 |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Lindbergite | Mn2+(C2O4) · 2H2O |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Chapmanite | Fe23+Sb3+(Si2O5)O3(OH) |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Andorite | AgPbSb3S6 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| S | ⓘ Fülöppite | Pb3Sb8S15 |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Freieslebenite | AgPbSbS3 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Metastibnite | Sb2S3 |
| S | ⓘ Miargyrite | AgSbS2 |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrostilpnite | Ag3SbS3 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Semseyite | Pb9Sb8S21 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stephanite | Ag5SbS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Rutile | TiO2 |
| Mn | Manganese | |
| Mn | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Mn | ⓘ Lindbergite | Mn2+(C2O4) · 2H2O |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chapmanite | Fe23+Sb3+(Si2O5)O3(OH) |
| Fe | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Nickelskutterudite | (Ni,Co,Fe)As3 |
| Fe | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Co | Cobalt | |
| Co | ⓘ Nickelskutterudite | (Ni,Co,Fe)As3 |
| Ni | Nickel | |
| Ni | ⓘ Nickelskutterudite | (Ni,Co,Fe)As3 |
| Cu | Copper | |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Nickelskutterudite | (Ni,Co,Fe)As3 |
| As | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Sr | Strontium | |
| Sr | ⓘ Strontianite | SrCO3 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Andorite | AgPbSb3S6 |
| Ag | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Freieslebenite | AgPbSbS3 |
| Ag | ⓘ Miargyrite | AgSbS2 |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Pyrostilpnite | Ag3SbS3 |
| Ag | ⓘ Silver | Ag |
| Ag | ⓘ Stephanite | Ag5SbS4 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Andorite | AgPbSb3S6 |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Chapmanite | Fe23+Sb3+(Si2O5)O3(OH) |
| Sb | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Sb | ⓘ Fülöppite | Pb3Sb8S15 |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Freieslebenite | AgPbSbS3 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Metastibnite | Sb2S3 |
| Sb | ⓘ Miargyrite | AgSbS2 |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Pyrostilpnite | Ag3SbS3 |
| Sb | ⓘ Semseyite | Pb9Sb8S21 |
| Sb | ⓘ Stephanite | Ag5SbS4 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Pb | Lead | |
| Pb | ⓘ Andorite | AgPbSb3S6 |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Pb | ⓘ Fülöppite | Pb3Sb8S15 |
| Pb | ⓘ Freieslebenite | AgPbSbS3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Semseyite | Pb9Sb8S21 |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Obersch%C3%B6na |
|---|---|
| Wikidata ID: | Q71025 |
| GeoNames ID: | 6548524 |
Localities in this Region
- Saxony
- Saxony
- Mittelsachsen
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
Europe
- Bohemian MassifMassif
- Ore MountainsMountain Range
Germany
- Saxony
- Mittelsachsen
- Freiberg Mining DistrictMining District
- Mittelsachsen
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Neue Hoffnung Gottes Mine, Bräunsdorf, Oberschöna, Mittelsachsen, Saxony, Germany