Askersund, Örebro County, Swedeni
| Regional Level Types | |
|---|---|
| Askersund | Municipality |
| Örebro County | County |
| Sweden | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Askersund | 3,997 (2017) |
| Åsbro | 1,321 (2017) |
| Åmmeberg | 443 (2017) |
| Zinkgruvan | 316 (2017) |
| Rönneshytta | 279 (2017) |
| Hammar | 266 (2017) |
Mindat Locality ID:
23961
Long-form identifier:
mindat:1:2:23961:4
GUID (UUID V4):
95c151e2-ec85-4831-9e12-efc8dd3a1db6
Other Languages:
French:
Askersund, Comté d'Örebro, Suède
German:
Askersund , Örebro län, Schweden
Italian:
Askersund , Contea di Örebro, Svezia
Russian:
коммуна Аскерсунд, Эребру, Швеция
Simplified Chinese:
阿斯克松德市, 厄勒布鲁省, 瑞典
Spanish:
municipio de Askersund, Provincia de Örebro, Suecia
Swedish:
Askersunds kommun, Örebro län, Sverige
Armenian:
Ասկերսունդ համայնք, Շվեդիա
Asturian:
Askersunds, Provincia d'Örebro, Suecia
Basque:
Askersund udalerria, Örebroko konderria, Suedia
Belarusian:
Аскерсунд , Эрэбру, Швецыя
Belarusian (Tarashkevitsa):
камуна Аскерсунд, Эрэбру, Швэцыя
Bulgarian:
Аскершунд , Йоребру, Швеция
Catalan:
municipi de Askersund, Comtat d'Örebro, Suècia
Cebuano:
Askersund komyun, Örebro län, Suwesya
Czech:
Olshammar, Örebro, Švédsko
Danish:
Askersunds kommun, Örebro län, Sverige
Dutch:
Askersund , Örebro län, Zweden
Estonian:
Askersundi vald, Örebro lään, Rootsi
Faroese:
Askersunds kommuna, Örebro län, Svøríki
Farsi/Persian:
بخش اسکشوند, شهرستان اوربرو, سوئد
Finnish:
Askersundin kunta, Örebron lääni, Ruotsi
Galician:
concello de Askersund, Condado de Örebro, Suecia
Georgian:
ასკერსუნდი, შვედეთი
Greek:
δήμος της Ασκερσουντς, Σουηδία
Hungarian:
Askersund község, Örebro megye, Svédország
Icelandic:
Askersund sveitarfélag, Svíþjóð
Japanese:
アスケシュンド自治体, エレブルー県, スウェーデン
Korean:
아스케르순드 시, 외레브로주, 스웨덴
Latvian:
Askersund pašvaldība, Erebrū lēne, Zviedrija
Limburgian:
Askersund, Örebro län, Zwede
Lithuanian:
Askersundo savivaldybė, Erebru lėnas, Švedija
Low Saxon/Low German:
Kommun Askersund, Lehn Örebro, Sweden
Minnan / Hokkien-Taiwanese:
Askersund Chū-tī-chhī, Sūi-tián
Northern Sami:
Askersunda gielda, Örebro leatna, Ruoŧŧa
Norwegian:
Askersund kommune, Örebro län, Sverige
Norwegian (Nynorsk):
Askersunds kommun, Örebro län, Sverige
Polish:
gmina Askersund, Örebro, Szwecja
Portuguese:
Askersund , Örebro, Suécia
Romanian:
Comuna Askersund, Örebro län, Suedia
Tatar:
Аскерсунд коммунасы, Швеция
Traditional Chinese:
阿斯克松德市, 瑞典
Turkish:
Askersund belediyesi, Örebro ili, İsveç
Ukrainian:
Аскерсунд , Еребру, Швеція
Vietnamese:
Askersund , Örebro, Thụy Điển
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities106 valid minerals. 4 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: References: |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Andalusite Formula: Al2(SiO4)O Localities: |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ Anthophyllite Formula: ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Antimony Formula: Sb |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: References: |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O22]X · 8H2O |
| ⓘ Argentopentlandite Formula: Ag(Fe,Ni)8S8 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Localities: |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Barytocalcite Formula: BaCa(CO3)2 |
| ⓘ Benavidesite Formula: Pb4MnSb6S14 |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 Locality: Falla, Askersund, Örebro County, Sweden |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismuth Formula: Bi Localities: |
| ⓘ Bismuthinite Formula: Bi2S3 Localities: References: |
| ⓘ Bismuthinite var. Antimony-bearing Bismuthinite Formula: (Bi,Sb)2S3 |
| ⓘ Bornite Formula: Cu5FeS4 Localities: |
| ⓘ Breithauptite Formula: NiSb Localities: |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Calcite Formula: CaCO3 Localities: |
| ⓘ Carnotite Formula: K2(UO2)2(VO4)2 · 3H2O |
| ⓘ Cerchiaraite-(Al) Formula: Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| ⓘ Cerchiaraite-(Fe) Formula: Ba4Fe3+4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Chlorite Group' Localities: References: |
| ⓘ 'Clino-ferro-suenoite' Formula: ◻{Mn2+2}{Fe2+5}(Si8O22)(OH)2 |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cobaltite Formula: CoAsS Localities: Reported from at least 6 localities in this region. |
| ⓘ Cobaltpentlandite Formula: Co9S8 |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ Copper Formula: Cu |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) Localities: |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Costibite Formula: CoSbS Localities: References: |
| ⓘ Covellite Formula: CuS |
| ⓘ Cubanite Formula: CuFe2S3 Localities: |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: References: |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Habit: Longprismatic, striated. Colour: Black to brown |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: |
| ⓘ Fayalite Formula: Fe2+2SiO4 |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ 'Fayalite-Tephroite Series' |
| ⓘ 'Fayalite-Tephroite Series var. Knebelite' Formula: from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| ⓘ 'Feldspar Group' |
| ⓘ Ferro-hornblende ? Formula: ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorapatite var. Manganapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Forsterite Formula: Mg2SiO4 |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ Gahnite Formula: ZnAl2O4 |
| ⓘ Galena Formula: PbS Localities: References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ Giessenite Formula: Pb27Cu2(Bi,Sb)19S57 |
| ⓘ 'Gigantolite' |
| ⓘ Glaucodot Formula: (Co0.50Fe0.50)AsS Localities: |
| ⓘ Goethite Formula: α-Fe3+O(OH) Localities: References: |
| ⓘ Gold Formula: Au |
| ⓘ Graphite Formula: C |
| ⓘ Gudmundite Formula: FeSbS Localities: Reported from at least 6 localities in this region. |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: |
| ⓘ Izoklakeite (TL) Formula: Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 Type Locality: Habit: aggregates up to a few mm in diameter Description: Aggregates intergrown with Jaskólskiite, native bismuth, galena, pyrrhotite and, rarely, native antimony. |
| ⓘ Jaskólskiite (TL) Formula: CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) Type Locality: |
| ⓘ Kieftite Formula: CoSb3 Localities: |
| ⓘ Kobellite (TL) Formula: Pb22Cu4(Bi,Sb)30S69 Type Locality: |
| ⓘ Kobellite var. Antimony-bearing Kobellite Formula: Pb22Cu4(Bi,Sb)30S69 |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ Lillianite Formula: Pb3-2xAgxBi2+xS6 |
| ⓘ Mackinawite Formula: FeS Localities: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 7 localities in this region. |
| ⓘ Marcasite Formula: FeS2 Localities: |
| ⓘ Marialite Formula: Na4Al3Si9O24Cl |
| ⓘ Maucherite Formula: Ni11As8 |
| ⓘ Meneghinite Formula: Pb13CuSb7S24 |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: |
| ⓘ Molybdenite Formula: MoS2 Localities: References: |
| ⓘ 'Monazite' Formula: REE(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Nickeline Formula: NiAs Localities: References: |
| ⓘ Nickelskutterudite Formula: (Ni,Co,Fe)As3 |
| ⓘ Formula: CoSbS Locality: Vena Mines, Hammar, Askersund, Örebro County, Sweden - erroneously reported Description: May possibly be costibite |
| ⓘ Parkerite Formula: Ni3(Bi,Pb)2S2 |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 Localities: References: |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pyrite Formula: FeS2 Localities: |
| ⓘ 'Pyrobitumen' Localities: |
| ⓘ 'Pyrobitumen var. Thucholite' Localities: |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 6 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Safflorite Formula: (Co,Ni,Fe)As2 Localities: References: |
| ⓘ 'Scapolite' Localities: |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: References: The Swedish Museum of Natural History, Stockholm (Naturhistoriska riksmuseet) CollectionsIdentification: Dealer/Collection Label |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Sillimanite Formula: Al2(SiO4)O Localities: References: |
| ⓘ Silver Formula: Ag Localities: Zinkgruvan mine, Zinkgruvan, Askersund, Örebro County, Sweden Knalla Mine, Zinkgruvan mine, Zinkgruvan, Askersund, Örebro County, Sweden Nygruvan Vilain XIV, Zinkgruvan mine, Zinkgruvan, Askersund, Örebro County, Sweden Périer shaft, Zinkgruvan mine, Zinkgruvan, Askersund, Örebro County, Sweden Burkland Cu deposit, Knalla Mine, Zinkgruvan mine, Zinkgruvan, Askersund, Örebro County, Sweden References: |
| ⓘ Skutterudite Formula: CoAs3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 7 localities in this region. |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Triplite Formula: Mn2+2(PO4)F |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Uraninite var. Pitchblende Formula: UO2 |
| ⓘ Valleriite Formula: (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Wagnerite Formula: (Mg,Fe2+)2(PO4)F Localities: References: The Swedish Museum of Natural History, Stockholm (Naturhistoriska riksmuseet) CollectionsIdentification: Dealer/Collection Label |
| ⓘ Witherite Formula: BaCO3 |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Zhangpeishanite Formula: BaFCl |
| ⓘ Zinkgruvanite (TL) Formula: Ba4Mn2+4Fe3+2(Si2O7)2(SO4)2O2(OH)2 Type Locality: |
| ⓘ Zippeite Formula: K3(UO2)4(SO4)2O3(OH) · 3H2O |
| ⓘ Zircon Formula: Zr(SiO4) Localities: References: |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Bismuth | 1.CA.05 | Bi |
| ⓘ | Antimony | 1.CA.05 | Sb |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Maucherite | 2.AB.15 | Ni11As8 |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Argentopentlandite | 2.BB.15 | Ag(Fe,Ni)8S8 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Cobaltpentlandite | 2.BB.15 | Co9S8 |
| ⓘ | Parkerite | 2.BE.20 | Ni3(Bi,Pb)2S2 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Breithauptite | 2.CC.05 | NiSb |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | var. Antimony-bearing Bismuthinite | 2.DB.05 | (Bi,Sb)2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| ⓘ | Costibite | 2.EB.10d | CoSbS |
| ⓘ | Paracostibite ? | 2.EB.10e | CoSbS |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Gudmundite | 2.EB.20 | FeSbS |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Nickelskutterudite | 2.EC.05 | (Ni,Co,Fe)As3 |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Kieftite | 2.EC.05 | CoSb3 |
| ⓘ | Valleriite | 2.FD.30 | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | Meneghinite | 2.HB.05b | Pb13CuSb7S24 |
| ⓘ | Jaskólskiite (TL) | 2.HB.05c | CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| ⓘ | Kobellite var. Antimony-bearing Kobellite | 2.HB.10a | Pb22Cu4(Bi,Sb)30S69 |
| ⓘ | (TL) | 2.HB.10a | Pb22Cu4(Bi,Sb)30S69 |
| ⓘ | Izoklakeite (TL) | 2.HB.10b | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| ⓘ | Giessenite | 2.HB.10b | Pb27Cu2(Bi,Sb)19S57 |
| ⓘ | Benavidesite | 2.HB.15 | Pb4MnSb6S14 |
| ⓘ | Lillianite | 2.JB.40a | Pb3-2xAgxBi2+xS6 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Zhangpeishanite | 3.DC.25 | BaFCl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | 4.DL.05 | UO2 | |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Carnotite | 4.HB.05 | K2(UO2)2(VO4)2 · 3H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| ⓘ | Barytocalcite | 5.AB.45 | BaCa(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Zippeite | 7.EC.05 | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Triplite | 8.BB.10 | Mn2+2(PO4)F |
| ⓘ | Wagnerite | 8.BB.15 | (Mg,Fe2+)2(PO4)F |
| ⓘ | Fluorapatite var. Manganapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | 8.BN.05 | Ca5(PO4)3F | |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| Group 9 - Silicates | |||
| ⓘ | Fayalite | 9.AC.05 | Fe2+2SiO4 |
| ⓘ | Forsterite | 9.AC.05 | Mg2SiO4 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Zinkgruvanite (TL) | 9.BE. | Ba4Mn2+4Fe3+2(Si2O7)2(SO4)2O2(OH)2 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Cerchiaraite-(Fe) | 9.CF.25 | Ba4Fe3+4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| ⓘ | Cerchiaraite-(Al) | 9.CF.25 | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Anthophyllite | 9.DD.05 | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | 'Clino-ferro-suenoite' | 9.DE.10 | ◻{Mn2+2}{Fe2+5}(Si8O22)(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-hornblende ? | 9.DE.10 | ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Marialite | 9.FB.15 | Na4Al3Si9O24Cl |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| Unclassified | |||
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Pyrobitumen' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O22]X · 8H2O |
| ⓘ | 'Pyrobitumen var. Thucholite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Fayalite-Tephroite Series var. Knebelite' | - | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Fayalite-Tephroite Series' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Gigantolite' | - | |
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Scapolite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Cerchiaraite-(Al) | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| H | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| H | ⓘ Clino-ferro-suenoite | ◻{Mn22+}{Fe52+}(Si8O22)(OH)2 |
| H | ⓘ Zinkgruvanite | Ba4Mn42+Fe23+(Si2O7)2(SO4)2O2(OH)2 |
| Be | Beryllium | |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Barytocalcite | BaCa(CO3)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Witherite | BaCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Barytocalcite | BaCa(CO3)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fayalite | Fe22+SiO4 |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Forsterite | Mg2SiO4 |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Marialite | Na4Al3Si9O24Cl |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Triplite | Mn22+(PO4)F |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wagnerite | (Mg,Fe2+)2(PO4)F |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Fluorapatite var. Manganapatite | Ca5(PO4)3F |
| O | ⓘ Cerchiaraite-(Al) | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| O | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Clino-ferro-suenoite | ◻{Mn22+}{Fe52+}(Si8O22)(OH)2 |
| O | ⓘ Zinkgruvanite | Ba4Mn42+Fe23+(Si2O7)2(SO4)2O2(OH)2 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Triplite | Mn22+(PO4)F |
| F | ⓘ Wagnerite | (Mg,Fe2+)2(PO4)F |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Fluorapatite var. Manganapatite | Ca5(PO4)3F |
| F | ⓘ Zhangpeishanite | BaFCl |
| Na | Sodium | |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Marialite | Na4Al3Si9O24Cl |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Forsterite | Mg2SiO4 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Wagnerite | (Mg,Fe2+)2(PO4)F |
| Al | Aluminium | |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Marialite | Na4Al3Si9O24Cl |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Cerchiaraite-(Al) | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fayalite | Fe22+SiO4 |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Forsterite | Mg2SiO4 |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Marialite | Na4Al3Si9O24Cl |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Cerchiaraite-(Al) | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Si | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Clino-ferro-suenoite | ◻{Mn22+}{Fe52+}(Si8O22)(OH)2 |
| Si | ⓘ Zinkgruvanite | Ba4Mn42+Fe23+(Si2O7)2(SO4)2O2(OH)2 |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Triplite | Mn22+(PO4)F |
| P | ⓘ Wagnerite | (Mg,Fe2+)2(PO4)F |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Fluorapatite var. Manganapatite | Ca5(PO4)3F |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Benavidesite | Pb4MnSb6S14 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Cobaltpentlandite | Co9S8 |
| S | ⓘ Costibite | CoSbS |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Giessenite | Pb27Cu2(Bi,Sb)19S57 |
| S | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| S | ⓘ Gudmundite | FeSbS |
| S | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| S | ⓘ Jaskólskiite | CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| S | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| S | ⓘ Lillianite | Pb3-2xAgxBi2+xS6 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Meneghinite | Pb13CuSb7S24 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Paracostibite | CoSbS |
| S | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| S | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| S | ⓘ Kobellite var. Antimony-bearing Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| S | ⓘ Bismuthinite var. Antimony-bearing Bismuthinite | (Bi,Sb)2S3 |
| S | ⓘ Zinkgruvanite | Ba4Mn42+Fe23+(Si2O7)2(SO4)2O2(OH)2 |
| Cl | Chlorine | |
| Cl | ⓘ Marialite | Na4Al3Si9O24Cl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Cl | ⓘ Zhangpeishanite | BaFCl |
| Cl | ⓘ Cerchiaraite-(Al) | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Cl | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Barytocalcite | BaCa(CO3)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Fluorapatite var. Manganapatite | Ca5(PO4)3F |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| V | Vanadium | |
| V | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| Mn | Manganese | |
| Mn | ⓘ Benavidesite | Pb4MnSb6S14 |
| Mn | ⓘ Triplite | Mn22+(PO4)F |
| Mn | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| Mn | ⓘ Clino-ferro-suenoite | ◻{Mn22+}{Fe52+}(Si8O22)(OH)2 |
| Mn | ⓘ Zinkgruvanite | Ba4Mn42+Fe23+(Si2O7)2(SO4)2O2(OH)2 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Fayalite | Fe22+SiO4 |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Gudmundite | FeSbS |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Nickelskutterudite | (Ni,Co,Fe)As3 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Wagnerite | (Mg,Fe2+)2(PO4)F |
| Fe | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| Fe | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Fe | ⓘ Clino-ferro-suenoite | ◻{Mn22+}{Fe52+}(Si8O22)(OH)2 |
| Fe | ⓘ Zinkgruvanite | Ba4Mn42+Fe23+(Si2O7)2(SO4)2O2(OH)2 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Cobaltpentlandite | Co9S8 |
| Co | ⓘ Costibite | CoSbS |
| Co | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Co | ⓘ Kieftite | CoSb3 |
| Co | ⓘ Nickelskutterudite | (Ni,Co,Fe)As3 |
| Co | ⓘ Paracostibite | CoSbS |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Co | ⓘ Skutterudite | CoAs3 |
| Ni | Nickel | |
| Ni | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| Ni | ⓘ Breithauptite | NiSb |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Maucherite | Ni11As8 |
| Ni | ⓘ Nickelskutterudite | (Ni,Co,Fe)As3 |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Giessenite | Pb27Cu2(Bi,Sb)19S57 |
| Cu | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Cu | ⓘ Jaskólskiite | CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| Cu | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Cu | ⓘ Meneghinite | Pb13CuSb7S24 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Cu | ⓘ Kobellite var. Antimony-bearing Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Zn | Zinc | |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| As | ⓘ Maucherite | Ni11As8 |
| As | ⓘ Nickelskutterudite | (Ni,Co,Fe)As3 |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Skutterudite | CoAs3 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Ag | ⓘ Lillianite | Pb3-2xAgxBi2+xS6 |
| Ag | ⓘ Silver | Ag |
| Sb | Antimony | |
| Sb | ⓘ Antimony | Sb |
| Sb | ⓘ Benavidesite | Pb4MnSb6S14 |
| Sb | ⓘ Breithauptite | NiSb |
| Sb | ⓘ Costibite | CoSbS |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Giessenite | Pb27Cu2(Bi,Sb)19S57 |
| Sb | ⓘ Gudmundite | FeSbS |
| Sb | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Sb | ⓘ Jaskólskiite | CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| Sb | ⓘ Kieftite | CoSb3 |
| Sb | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Sb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Sb | ⓘ Paracostibite | CoSbS |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Kobellite var. Antimony-bearing Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Sb | ⓘ Bismuthinite var. Antimony-bearing Bismuthinite | (Bi,Sb)2S3 |
| Ba | Barium | |
| Ba | ⓘ Barytocalcite | BaCa(CO3)2 |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Witherite | BaCO3 |
| Ba | ⓘ Zhangpeishanite | BaFCl |
| Ba | ⓘ Cerchiaraite-(Al) | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Ba | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Ba | ⓘ Zinkgruvanite | Ba4Mn42+Fe23+(Si2O7)2(SO4)2O2(OH)2 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Benavidesite | Pb4MnSb6S14 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Giessenite | Pb27Cu2(Bi,Sb)19S57 |
| Pb | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Pb | ⓘ Jaskólskiite | CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| Pb | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Pb | ⓘ Lillianite | Pb3-2xAgxBi2+xS6 |
| Pb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Pb | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| Pb | ⓘ Kobellite var. Antimony-bearing Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Bi | Bismuth | |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Giessenite | Pb27Cu2(Bi,Sb)19S57 |
| Bi | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Bi | ⓘ Jaskólskiite | CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| Bi | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Bi | ⓘ Lillianite | Pb3-2xAgxBi2+xS6 |
| Bi | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| Bi | ⓘ Kobellite var. Antimony-bearing Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Bi | ⓘ Bismuthinite var. Antimony-bearing Bismuthinite | (Bi,Sb)2S3 |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
Geochronology
Mineralization age: Paleoproterozoic : 1924 Ma to 1865 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | |||||||||
|---|---|---|---|---|---|---|---|---|---|---|
| Precambrian | ||||||||||
| Proterozoic | ||||||||||
| Paleoproterozoic | ||||||||||
| Orosirian |
| |||||||||
Fossils
There are 1 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 37 |
|---|---|
| Youngest Fossil Listed | 466 Ma (Middle Ordovician) |
| Oldest Fossil Listed | 479 Ma (Early/Lower Ordovician) |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Askersund_Municipality |
|---|---|
| Wikidata ID: | Q509501 |
| GeoNames ID: | 2724776 |
Localities in this Region
- Örebro County
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsOther DatabasesLocalities in RegionOther Regions
Zinkgruvan mine, Zinkgruvan, Askersund, Örebro County, Sweden