Las Pirquitas Dam, Fray Mamerto Esquiú Department, Catamarca Province, Argentinai
| Regional Level Types | |
|---|---|
| Las Pirquitas Dam | Dam |
| Fray Mamerto Esquiú Department | Department |
| Catamarca Province | Province |
| Argentina | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
28° 16' 8'' South , 65° 44' 13'' West
Latitude & Longitude (decimal):
Locality type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| El Rodeo | 1,083 (2016) | 14.7km |
| San Fernando del Valle de Catamarca | 188,812 (2016) | 22.8km |
| San Antonio | 4,290 (2015) | 29.0km |
| Los Altos | 6,421 (2016) | 33.8km |
| Los Varela | 1,908 (2016) | 37.1km |
Located 864 meters above sea level.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Andalusite Formula: Al2(SiO4)O Reference: Raúl Jorge Tauber Larry |
ⓘ 'Chlorite Group' Reference: Raúl Jporge Tauber Larry |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Reference: Raúl Jorge Tauber Larry, personally collected |
| ⓘ Microcline Formula: K(AlSi3O8) Reference: Raul Jorge Tauber Larry specimen |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Reference: Raúl Jorge Tauber Larry´s collection |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 Reference: Raúl Jorge Tauber Larry |
| ⓘ Orthoclase Formula: K(AlSi3O8) Reference: Raúl Jorge Tauber Larry´s collection |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Reference: Raúl Jorge Tauber Larry´s collection |
| ⓘ Quartz Formula: SiO2 Reference: Raúl Jorge Tauber Larry´s collection |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Reference: Raúl Jorge Tauber Larry |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 9 - Silicates | |||
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Unclassified Minerals, Rocks, etc. | |||
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| Na | Sodium | |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Si | Silicon | |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| K | Potassium | |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Cr | Chromium | |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Fe | Iron | |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
External Links
http://www.worldlake-db.com/detail/?id=82&cid=2
https://www.youtube.com/watch?v=pQ9j59ZDoTc
https://www.issmge.org/uploads/publications/1/39/1965_02_0097.pdf
https://www.youtube.com/watch?v=pQ9j59ZDoTc
https://www.issmge.org/uploads/publications/1/39/1965_02_0097.pdf
Other Regions, Features and Areas containing this locality
Argentina
- Pampean Pegmatite ProvinceMineral Province
South AmericaContinent
- AndesMountain Range
South America PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Las Pirquitas Dam, Fray Mamerto Esquiú Department, Catamarca Province, Argentina