Tha-gyi-loo, Thurein-taung, Kyauk-Pyat-That, Mogok Township, Pyin-Oo-Lwin District, Mandalay Region, Myanmari
| Regional Level Types | |
|---|---|
| Tha-gyi-loo | - not defined - |
| Thurein-taung | - not defined - |
| Kyauk-Pyat-That | - not defined - |
| Mogok Township | Township |
| Pyin-Oo-Lwin District | District |
| Mandalay Region | Region |
| Myanmar | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
22° 54' 2'' North , 96° 21' 50'' East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~0km
KΓΆppen climate type:
Mindat Locality ID:
243775
Long-form identifier:
mindat:1:2:243775:3
GUID (UUID V4):
1db7f17f-2848-42bb-b172-33f7e147cdfe
Other/historical names associated with this locality:
Burma
The skarn deposit (between marble and leucogranite) is situated on the SW side, near the summit of Thurein-taung. Painite is found here, often with ruby. Associated minerals are dark red sphene, dark blue anatase, dark-red rutile, dark-brownish-orange baddeleyite, axinite, black srilankite, green elbaite, schorl, dravite, yellowish-red zircon and other. - Ted Themelis (2008) Gems and Mines of Mogok.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| β Anatase Formula: TiO2 |
| β 'Axinite Group' |
| β Baddeleyite Formula: ZrO2 |
| β Corundum Formula: Al2O3 |
| β Corundum var. Ruby Formula: Al2O3 |
| β Corundum var. Sapphire Formula: Al2O3 |
| β Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Painite Formula: CaZrAl9(BO3)O15 |
| β Rutile Formula: TiO2 |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Srilankite Formula: ZrTi2O6 |
| β Titanite Formula: CaTi(SiO4)O |
| β Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| β | Corundum var. Ruby | 4.CB.05 | Al2O3 |
| β | 4.CB.05 | Al2O3 | |
| β | var. Sapphire | 4.CB.05 | Al2O3 |
| β | Rutile | 4.DB.05 | TiO2 |
| β | Srilankite | 4.DB.25 | ZrTi2O6 |
| β | Anatase | 4.DD.05 | TiO2 |
| β | Baddeleyite | 4.DE.35 | ZrO2 |
| Group 6 - Borates | |||
| β | Painite | 6.AB.85 | CaZrAl9(BO3)O15 |
| Group 9 - Silicates | |||
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Unclassified | |||
| β | 'Axinite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | Lithium | |
| Li | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | Boron | |
| B | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Painite | CaZrAl9(BO3)O15 |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | β Anatase | TiO2 |
| O | β Baddeleyite | ZrO2 |
| O | β Corundum | Al2O3 |
| O | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Painite | CaZrAl9(BO3)O15 |
| O | β Corundum var. Ruby | Al2O3 |
| O | β Rutile | TiO2 |
| O | β Corundum var. Sapphire | Al2O3 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Srilankite | ZrTi2O6 |
| O | β Titanite | CaTi(SiO4)O |
| O | β Zircon | Zr(SiO4) |
| Na | Sodium | |
| Na | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | β Corundum | Al2O3 |
| Al | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Painite | CaZrAl9(BO3)O15 |
| Al | β Corundum var. Ruby | Al2O3 |
| Al | β Corundum var. Sapphire | Al2O3 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Zircon | Zr(SiO4) |
| Ca | Calcium | |
| Ca | β Painite | CaZrAl9(BO3)O15 |
| Ca | β Titanite | CaTi(SiO4)O |
| Ti | Titanium | |
| Ti | β Anatase | TiO2 |
| Ti | β Rutile | TiO2 |
| Ti | β Srilankite | ZrTi2O6 |
| Ti | β Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Zr | Zirconium | |
| Zr | β Baddeleyite | ZrO2 |
| Zr | β Painite | CaZrAl9(BO3)O15 |
| Zr | β Srilankite | ZrTi2O6 |
| Zr | β Zircon | Zr(SiO4) |
Other Regions, Features and Areas containing this locality
AsiaContinent
Eurasian PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Tha-gyi-loo, Thurein-taung, Kyauk-Pyat-That, Mogok Township, Pyin-Oo-Lwin District, Mandalay Region, Myanmar