Berry-Havey Quarry (Havey Quarry; Berry Quarry), Poland, Androscoggin County, Maine, USAi
| Regional Level Types | |
|---|---|
| Berry-Havey Quarry (Havey Quarry; Berry Quarry) | Quarry |
| Poland | Town |
| Androscoggin County | County |
| Maine | State |
| USA | Country |
This page kindly sponsored by Steve Bonney
Latitude & Longitude (WGS84):
44° 4' 18'' North , 70° 17' 54'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Minot | 2,337 (2017) | 2.3km |
| Auburn | 22,871 (2017) | 6.1km |
| Lewiston | 36,202 (2017) | 7.4km |
| Poland | 5,314 (2017) | 7.7km |
| Mechanic Falls | 2,237 (2017) | 8.7km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Oxford County Mineral and Gem Association | South Paris, Maine | 24km |
| Kennebec Rocks and Minerals Club | Winthrop, Maine | 36km |
| Maine Mineralogical & Geological Society | Portland, Maine | 46km |
Mindat Locality ID:
3802
Long-form identifier:
mindat:1:2:3802:0
GUID (UUID V4):
8ec334fa-2cfb-4f70-a15b-6d2b95e8d6eb
Granite pegmatite. Oxford Field. The Berry Quarry (south side) and Havey Quarry (north side) are in the same pegmatite and excavations have overlapped. The name of the united excavation is the Berry-Havey Quarry. The southern part of the pegmatite was operated by Forrest Havey, at least by 1909, while the northern portion was operated by A. R. Berry, beginning in 1900, who owned the farm.
This locality is the "type" location for the variety "watermelon tourmaline" and that name first appeared in print by George Howe in August, 1910. The name first received international circulation in 1911.
As of 2014 was being operated commercially by Jeff Morrison for gemstone and mineral specimen production.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
67 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) References: |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) References: |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 References: |
| ⓘ Amblygonite Formula: LiAl(PO4)F |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ Behoite Formula: Be(OH)2 |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) References: |
| ⓘ Beryl var. Aquamarine Formula: Be3Al2Si6O18 |
| ⓘ Beryl var. Morganite Formula: Be3Al2(Si6O18) References: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 References: |
| ⓘ Calcite Formula: CaCO3 Habit: massive Description: Found in the metamorphic country rock adjacent to the pegmatite body. References: |
| ⓘ Cassiterite Formula: SnO2 References: |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ 'Columbite Group' References: |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 References: |
| ⓘ Cookeite Formula: (LiAl4◻)[AlSi3O10](OH)8 References: |
| ⓘ Correianevesite Formula: Fe2+Mn2+2(PO4)2 · 3H2O Description: Correianevesite is the unoxidized equivalent to landesite for which the Berry-Havey Quarry is the type locality. Complete chemical analysis of what is now correianevesite was made by Ian Steele of the University of Chicago in 2002 (unpublished), but a crystal structure refinement was not made to propose a new species at that time. References: |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 |
| ⓘ Darrellhenryite Formula: Na(Al2Li)Al6(Si6O18)(BO3)3(OH)3O References: |
| ⓘ Dickinsonite-(KMnNa) Formula: (KNa)(Mn2+◻)Ca(Na2Na)Mn2+13Al(PO4)11(PO4)(OH)2 References: |
| ⓘ Diopside Formula: CaMgSi2O6 References: |
| ⓘ Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Eosphorite Formula: Mn2+Al(PO4)(OH)2 · H2O |
| ⓘ Fairfieldite Formula: Ca2Mn2+(PO4)2 · 2H2O |
| ⓘ 'Feldspar Group' |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F References: |
| ⓘ Fluor-elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ Fluor-schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ Foitite Formula: ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 References: |
| ⓘ Goethite Formula: α-Fe3+O(OH) References: |
| ⓘ Hureaulite Formula: Mn2+5(PO3OH)2(PO4)2 · 4H2O |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) |
| ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite Formula: Ca5(PO4,CO3)3(OH,O) |
| ⓘ Hydroxylherderite Formula: CaBe(PO4)(OH) References: |
| ⓘ Landesite (TL) Formula: Mn2+3-xFe3+x(PO4)2(OH)x · (3-x)H2O Type Locality: |
| ⓘ 'Lepidolite' References: |
| ⓘ Lithiophilite Formula: LiMn2+PO4 Description: Moore (2000) analyzed lithiophilite from this locality and found the Mn/Mn + Fe ratio was 0.74 References: |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ 'Manganese Oxides' References: |
| ⓘ Meta-autunite Formula: Ca(UO2)2(PO4)2 · 6H2O |
| ⓘ Metaschoepite Formula: (UO2)8O2(OH)12 · 10H2O |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ 'Microlite Group' Formula: A2-mTa2X6-wZ-n References: |
| ⓘ Mitridatite Formula: Ca2Fe3+3(PO4)3O2 · 3H2O |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Montebrasite Formula: LiAl(PO4)(OH) References: |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Oxy-schorl Formula: Na(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3O |
| ⓘ Phosphosiderite Formula: FePO4 · 2H2O |
| ⓘ Phosphuranylite Formula: KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O Habit: thin coating Colour: yellow Description: Thin bright yellow coating on pegmatite matrix with relatively weak yellow-green fluorescence (compared to autunite). References: |
| ⓘ Pollucite Formula: (Cs,Na)2(Al2Si4O12) · 2H2O |
| ⓘ Purpurite Formula: Mn3+(PO4) |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 References: |
| ⓘ Reddingite Formula: (Mn2+,Fe2+)3(PO4)2 · 3H2O References: |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rockbridgeite Formula: Fe2+Fe3+4(PO4)3(OH)5 |
| ⓘ Rossmanite Formula: ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Schoepite Formula: (UO2)8O2(OH)12 · 12H2O |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Spodumene Formula: LiAlSi2O6 |
| ⓘ Stewartite Formula: Mn2+Fe3+2(PO4)2(OH)2 · 8H2O References: |
| ⓘ Strunzite Formula: Mn2+Fe3+2(PO4)2(OH)2 · 6H2O References: |
| ⓘ Tantalite-(Mn) ? Formula: Mn2+Ta2O6 References: |
| ⓘ Titanite Formula: CaTi(SiO4)O Colour: pale green/brown Description: Found in the metamorphic country rock adjacent to the pegmatite body. References: |
| ⓘ Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O References: |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z References: |
| ⓘ 'Tourmaline var. Rubellite' Formula: A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ 'Tourmaline var. Verdelite' Formula: A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ 'Tourmaline var. Watermelon Tourmaline' Formula: A(D3)G6(T6O18)(BO3)3X3Z Description: This is the type location for watermelon tourmaline as a named variety. The name was given by George Howe [1860-1950] in 1910 in an article in the Lewiston Evening Journal newspaper when he was working for the quarry operator appraising tourmalines. The name was first publicized internationally by Douglas Sterrett in his Gems and Precious Stones chapter in 1911 of Mineral Resources of the United States. |
| ⓘ Triplite Formula: Mn2+2(PO4)F |
| ⓘ Uraninite Formula: UO2 References: |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O References: |
| ⓘ Wardite Formula: NaAl3(PO4)2(OH)4 · 2H2O References: |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ-n |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Tantalite-(Mn) ? | 4.DB.35 | Mn2+Ta2O6 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Behoite | 4.FA.05a | Be(OH)2 |
| ⓘ | Schoepite | 4.GA.05 | (UO2)8O2(OH)12 · 12H2O |
| ⓘ | Metaschoepite | 4.GA.05 | (UO2)8O2(OH)12 · 10H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Lithiophilite | 8.AB.10 | LiMn2+PO4 |
| ⓘ | Purpurite | 8.AB.10 | Mn3+(PO4) |
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Hydroxylherderite | 8.BA.10 | CaBe(PO4)(OH) |
| ⓘ | Amblygonite | 8.BB.05 | LiAl(PO4)F |
| ⓘ | Montebrasite | 8.BB.05 | LiAl(PO4)(OH) |
| ⓘ | Triplite | 8.BB.10 | Mn2+2(PO4)F |
| ⓘ | Rockbridgeite | 8.BC.10 | Fe2+Fe3+4(PO4)3(OH)5 |
| ⓘ | Dickinsonite-(KMnNa) | 8.BF.05 | (KNa)(Mn2+◻)Ca(Na2Na)Mn2+13Al(PO4)11(PO4)(OH)2 |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | var. Carbonate-rich Hydroxylapatite | 8.BN.05 | Ca5(PO4,CO3)3(OH,O) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Hureaulite | 8.CB.10 | Mn2+5(PO3OH)2(PO4)2 · 4H2O |
| ⓘ | Correianevesite | 8.CC. | Fe2+Mn2+2(PO4)2 · 3H2O |
| ⓘ | Reddingite | 8.CC.05 | (Mn2+,Fe2+)3(PO4)2 · 3H2O |
| ⓘ | Landesite (TL) | 8.CC.05 | Mn2+3-xFe3+x(PO4)2(OH)x · (3-x)H2O |
| ⓘ | Phosphosiderite | 8.CD.05 | FePO4 · 2H2O |
| ⓘ | Fairfieldite | 8.CG.05 | Ca2Mn2+(PO4)2 · 2H2O |
| ⓘ | Strunzite | 8.DC.25 | Mn2+Fe3+2(PO4)2(OH)2 · 6H2O |
| ⓘ | Stewartite | 8.DC.30 | Mn2+Fe3+2(PO4)2(OH)2 · 8H2O |
| ⓘ | Eosphorite | 8.DD.20 | Mn2+Al(PO4)(OH)2 · H2O |
| ⓘ | Mitridatite | 8.DH.30 | Ca2Fe3+3(PO4)3O2 · 3H2O |
| ⓘ | Wardite | 8.DL.10 | NaAl3(PO4)2(OH)4 · 2H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Meta-autunite | 8.EB.10 | Ca(UO2)2(PO4)2 · 6H2O |
| ⓘ | Phosphuranylite | 8.EC.10 | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Beryl var. Morganite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | Fluor-schorl | 9.CK. | NaFe2+3Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ | Darrellhenryite | 9.CK. | Na(Al2Li)Al6(Si6O18)(BO3)3(OH)3O |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Rossmanite | 9.CK.05 | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Foitite | 9.CK.05 | ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Fluor-elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ | Oxy-schorl | 9.CK.05 | Na(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3O |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Cookeite | 9.EC.55 | (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Pollucite | 9.GB.05 | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Unclassified | |||
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Columbite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Tourmaline var. Watermelon Tourmaline' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'var. Verdelite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Tourmaline var. Rubellite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Behoite | Be(OH)2 |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| H | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | ⓘ Dickinsonite-(KMnNa) | (KNa)(Mn2+◻)Ca(Na2Na)Mn132+Al(PO4)11(PO4)(OH)2 |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| H | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| H | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
| H | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Landesite | Mn2+3-xFex3+(PO4)2(OH)x · (3-x)H2O |
| H | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| H | ⓘ Metaschoepite | (UO2)8O2(OH)12 · 10H2O |
| H | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| H | ⓘ Montebrasite | LiAl(PO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| H | ⓘ Phosphosiderite | FePO4 · 2H2O |
| H | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| H | ⓘ Reddingite | (Mn2+,Fe2+)3(PO4)2 · 3H2O |
| H | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| H | ⓘ Schoepite | (UO2)8O2(OH)12 · 12H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Stewartite | Mn2+Fe23+(PO4)2(OH)2 · 8H2O |
| H | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| H | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| H | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| H | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| H | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| H | ⓘ Darrellhenryite | Na(Al2Li)Al6(Si6O18)(BO3)3(OH)3O |
| H | ⓘ Correianevesite | Fe2+Mn22+(PO4)2 · 3H2O |
| Li | Lithium | |
| Li | ⓘ Amblygonite | LiAl(PO4)F |
| Li | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Lithiophilite | LiMn2+PO4 |
| Li | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Li | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Li | ⓘ Darrellhenryite | Na(Al2Li)Al6(Si6O18)(BO3)3(OH)3O |
| Be | Beryllium | |
| Be | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | ⓘ Behoite | Be(OH)2 |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| Be | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline var. Rubellite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | ⓘ Tourmaline var. Verdelite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline var. Watermelon Tourmaline | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| B | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| B | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| B | ⓘ Darrellhenryite | Na(Al2Li)Al6(Si6O18)(BO3)3(OH)3O |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amblygonite | LiAl(PO4)F |
| O | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Behoite | Be(OH)2 |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Dickinsonite-(KMnNa) | (KNa)(Mn2+◻)Ca(Na2Na)Mn132+Al(PO4)11(PO4)(OH)2 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| O | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
| O | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Landesite | Mn2+3-xFex3+(PO4)2(OH)x · (3-x)H2O |
| O | ⓘ Lithiophilite | LiMn2+PO4 |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| O | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| O | ⓘ Metaschoepite | (UO2)8O2(OH)12 · 10H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Montebrasite | LiAl(PO4)(OH) |
| O | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| O | ⓘ Phosphosiderite | FePO4 · 2H2O |
| O | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| O | ⓘ Purpurite | Mn3+(PO4) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Reddingite | (Mn2+,Fe2+)3(PO4)2 · 3H2O |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Tourmaline var. Rubellite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Schoepite | (UO2)8O2(OH)12 · 12H2O |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Stewartite | Mn2+Fe23+(PO4)2(OH)2 · 8H2O |
| O | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Triplite | Mn22+(PO4)F |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Tourmaline var. Verdelite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Tourmaline var. Watermelon Tourmaline | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| O | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| O | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| O | ⓘ Darrellhenryite | Na(Al2Li)Al6(Si6O18)(BO3)3(OH)3O |
| O | ⓘ Correianevesite | Fe2+Mn22+(PO4)2 · 3H2O |
| F | Fluorine | |
| F | ⓘ Amblygonite | LiAl(PO4)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Triplite | Mn22+(PO4)F |
| F | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| F | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dickinsonite-(KMnNa) | (KNa)(Mn2+◻)Ca(Na2Na)Mn132+Al(PO4)11(PO4)(OH)2 |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Na | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| Na | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Na | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| Na | ⓘ Darrellhenryite | Na(Al2Li)Al6(Si6O18)(BO3)3(OH)3O |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amblygonite | LiAl(PO4)F |
| Al | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | ⓘ Dickinsonite-(KMnNa) | (KNa)(Mn2+◻)Ca(Na2Na)Mn132+Al(PO4)11(PO4)(OH)2 |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| Al | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Al | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Al | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| Al | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| Al | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Al | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| Al | ⓘ Darrellhenryite | Na(Al2Li)Al6(Si6O18)(BO3)3(OH)3O |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| Si | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Si | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| Si | ⓘ Darrellhenryite | Na(Al2Li)Al6(Si6O18)(BO3)3(OH)3O |
| P | Phosphorus | |
| P | ⓘ Amblygonite | LiAl(PO4)F |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| P | ⓘ Dickinsonite-(KMnNa) | (KNa)(Mn2+◻)Ca(Na2Na)Mn132+Al(PO4)11(PO4)(OH)2 |
| P | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| P | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
| P | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Landesite | Mn2+3-xFex3+(PO4)2(OH)x · (3-x)H2O |
| P | ⓘ Lithiophilite | LiMn2+PO4 |
| P | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| P | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Montebrasite | LiAl(PO4)(OH) |
| P | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| P | ⓘ Phosphosiderite | FePO4 · 2H2O |
| P | ⓘ Purpurite | Mn3+(PO4) |
| P | ⓘ Reddingite | (Mn2+,Fe2+)3(PO4)2 · 3H2O |
| P | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| P | ⓘ Stewartite | Mn2+Fe23+(PO4)2(OH)2 · 8H2O |
| P | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| P | ⓘ Triplite | Mn22+(PO4)F |
| P | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Correianevesite | Fe2+Mn22+(PO4)2 · 3H2O |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Pyrite | FeS2 |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Dickinsonite-(KMnNa) | (KNa)(Mn2+◻)Ca(Na2Na)Mn132+Al(PO4)11(PO4)(OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| K | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | Calcium | |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| Ca | ⓘ Dickinsonite-(KMnNa) | (KNa)(Mn2+◻)Ca(Na2Na)Mn132+Al(PO4)11(PO4)(OH)2 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| Ca | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Dickinsonite-(KMnNa) | (KNa)(Mn2+◻)Ca(Na2Na)Mn132+Al(PO4)11(PO4)(OH)2 |
| Mn | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| Mn | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| Mn | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
| Mn | ⓘ Landesite | Mn2+3-xFex3+(PO4)2(OH)x · (3-x)H2O |
| Mn | ⓘ Lithiophilite | LiMn2+PO4 |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Mn | ⓘ Purpurite | Mn3+(PO4) |
| Mn | ⓘ Reddingite | (Mn2+,Fe2+)3(PO4)2 · 3H2O |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Stewartite | Mn2+Fe23+(PO4)2(OH)2 · 8H2O |
| Mn | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| Mn | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mn | ⓘ Triplite | Mn22+(PO4)F |
| Mn | ⓘ Correianevesite | Fe2+Mn22+(PO4)2 · 3H2O |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Landesite | Mn2+3-xFex3+(PO4)2(OH)x · (3-x)H2O |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| Fe | ⓘ Phosphosiderite | FePO4 · 2H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Reddingite | (Mn2+,Fe2+)3(PO4)2 · 3H2O |
| Fe | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stewartite | Mn2+Fe23+(PO4)2(OH)2 · 8H2O |
| Fe | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| Fe | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| Fe | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| Fe | ⓘ Correianevesite | Fe2+Mn22+(PO4)2 · 3H2O |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Löllingite | FeAs2 |
| Sr | Strontium | |
| Sr | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Cs | Caesium | |
| Cs | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Ba | Barium | |
| Ba | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ta | Tantalum | |
| Ta | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ-n |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| U | ⓘ Metaschoepite | (UO2)8O2(OH)12 · 10H2O |
| U | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| U | ⓘ Schoepite | (UO2)8O2(OH)12 · 12H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
Mindat Articles
Rock, Paper, Scissors by Paul GilmoreOther Regions, Features and Areas containing this locality
North America PlateTectonic Plate
- Ganderia DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Berry-Havey Quarry, Poland, Androscoggin County, Maine, USA