Torrington (Wolcottville), Litchfield County, Connecticut, USAi
| Regional Level Types | |
|---|---|
| Torrington (Wolcottville) | Municipality |
| Litchfield County | County |
| Connecticut | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
41° 48' 4'' North , 73° 7' 16'' West
Latitude & Longitude (decimal):
Type:
KΓΆppen climate type:
Mindat Locality ID:
49558
Long-form identifier:
mindat:1:2:49558:4
GUID (UUID V4):
48b48556-b4ce-4f84-94f1-b29cc793e211
Torrington is a former mill town on the upper reaches of the Naugatuck River that was initially known as Wolcottville. It was first incorporated in 1740 and was the birthplace of the state's brass industry starting around 1835. It is the largest city in Litchfield County and the birthplace of abolitionist John Brown, who's infamous 1859 Harper's Ferry raiders included John Cook, son of Haddam, Connecticut mineral collector/dealer Nathaniel Cook.
The geology of Torrington includes very complexly faulted and folded metamorphic rocks. The oldest and most resistant rocks are Late Proterozoic (Grenville age) gneisses, part of the Laurentian crust, that occupy a V-shaped area opening to the north, with the apex near downtown. The east side follows State Route 8, and the west side trending NW to Drakeville and beyond. These rocks are the southern terminus of the Berkshire Massif. Allochthonous Cambrian Manhattan and Hoosic Schists flank the Proterozoic Gneisses to the W and E, respectively. In the southwest part of town, around West Torrington, is a complex of small Ordovician intrusives including the Litchfield Norite, which contain grains of pyrrhotite, chalcopyrite and pentlandite (equivalent to a similar complex at Prospect Mountain in Litchfield), and felsic gneiss that overlap the Cameron's Line thrust fault. South of these plutons and the thrust fault is an area of Cambro-Ordovician Rowe Schist and amphibolite, and Ratlum Mountain Schist, that extends southward into NE Litchfield. These schists host many large porphyroblastic minerals such as almandine, kyanite, staurolite, albite and ilmenite. Regional, presumably Mesozoic-age, high-angle normal faults cut these metamorphic rocks. A NW-SE trending fault follows the West branch of the Naugatuck River and a NE-SW trending fault follows the Still River and state Route 8, the two faults intersecting just W of downtown and more or less topographically defining the S end of the Berkshire Massif.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities31 valid minerals.
Detailed Mineral List:
| β Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| β Albite Formula: Na(AlSi3O8) Localities: References: |
| β 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| β Anatase Formula: TiO2 Locality: South Main Street construction site, Torrington (Wolcottville), Litchfield County, Connecticut, USA Habit: tabular Colour: dark blue to dark blue-green edge-on but with blue, yellow to brownish zones face-on Description: Microcrystals in thin Alpine clefts. |
| β Annite Formula: KFe2+3(AlSi3O10)(OH)2 Locality: South Main Street construction site, Torrington (Wolcottville), Litchfield County, Connecticut, USA Colour: black |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β 'Bloodstone' Formula: SiO2 Colour: shades of red Description: Found as loose rocks in glacial till. |
| β Bornite ? Formula: Cu5FeS4 Locality: South Main Street construction site, Torrington (Wolcottville), Litchfield County, Connecticut, USA Description: Partial microcrystal aggregate in an Alpine cleft with a blue iridescent tarnish. |
| β Calcite Formula: CaCO3 Localities: References: |
| β Chalcopyrite Formula: CuFeS2 |
| β 'Chlorite Group' Localities: West Torrington nickel mines (Coe Copper Mine; Hodges Mine; Barber Mine; Torrington Nickel Mine), Torrington (Wolcottville), Litchfield County, Connecticut, USA Mountain Top Trucking quarry, Torrington (Wolcottville), Litchfield County, Connecticut, USA Soapstone quarry, Torrington (Wolcottville), Litchfield County, Connecticut, USA |
| β 'Chrysoprase' Colour: apple green Description: Found as loose rocks in glacial till. |
| β Diopside Formula: CaMgSi2O6 Localities: Description: Occurring as 2mm crystals in massive diopside. References: |
| β Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) References: |
| β 'Fergusonite' ? References: |
| β Fluorapatite Formula: Ca5(PO4)3F Localities: Description: Sharp blue crystals that were damaged upon discovery. Yellow fluorescence. References: |
| β Hematite Formula: Fe2O3 References: |
| β Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Locality: South Main Street construction site, Torrington (Wolcottville), Litchfield County, Connecticut, USA Habit: elongated tabular Colour: white Fluorescence: pale blue-white under SW UV light Description: Microcrystals arranged in spherical to fan-shaped aggregates in thin Alpine clefts. |
| β Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O Locality: South Main Street construction site, Torrington (Wolcottville), Litchfield County, Connecticut, USA Habit: coffin-shaped Colour: pale yellow-white Description: Microcrystals in thin Alpine clefts. |
| β 'Heulandite Subgroup' References: |
| β 'K Feldspar' |
| β 'K Feldspar var. Adularia' Formula: KAlSi3O8 Locality: South Main Street construction site, Torrington (Wolcottville), Litchfield County, Connecticut, USA Habit: Pseudorhombic Colour: white to pale pink Description: Microcrystals in Alpine clefts. |
| β Kyanite Formula: Al2(SiO4)O |
| β Magnetite Formula: Fe2+Fe3+2O4 |
| β Microcline Formula: K(AlSi3O8) Localities: References: |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: References: |
| β Opal Formula: SiO2 · nH2O Description: In banded rocks with agate, found loose in glacial till. |
| β Pentlandite Formula: (NixFey)Ξ£9S8 |
| β Pyrite Formula: FeS2 Localities: References: |
| β Pyrrhotite Formula: Fe1-xS |
| β Quartz Formula: SiO2 Localities: Torrington (Wolcottville), Litchfield County, Connecticut, USA Mountain Top Trucking quarry, Torrington (Wolcottville), Litchfield County, Connecticut, USA Torringford, Torrington (Wolcottville), Litchfield County, Connecticut, USA South Main Street construction site, Torrington (Wolcottville), Litchfield County, Connecticut, USA References: |
| β Quartz var. Agate |
| β Quartz var. Carnelian Description: Found as loose rocks in glacial till. |
| β Quartz var. Chalcedony Formula: SiO2 |
| β Quartz var. Sard Formula: SiO2 Colour: deep red, bluish red, and yellow Description: Found as loose rocks in glacial till. |
| β Quartz var. Sardonyx Formula: SiO2 Colour: deep red, bluish red, and yellow Description: Found as loose rocks in glacial till. |
| β Quartz var. Smoky Quartz Formula: SiO2 Localities: |
| β 'Scapolite' Localities: |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Locality: South Main Street construction site, Torrington (Wolcottville), Litchfield County, Connecticut, USA Habit: elongated prismatic Colour: black Description: Crystals to around 10 cm in pegmatites, particularly near the walls. |
| β Sphalerite Formula: ZnS Locality: South Main Street construction site, Torrington (Wolcottville), Litchfield County, Connecticut, USA Habit: complex tetrahedral Colour: orange to yellow-brown Description: Microcrystals and thin veins associated with thin Alpine clefts. |
| β Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| β 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| β 'Synchysite Group' Locality: South Main Street construction site, Torrington (Wolcottville), Litchfield County, Connecticut, USA Habit: tabular hexagonal Colour: chalky white Description: Microcrystalline aggregates in thin Alpine clefts. |
| β Szomolnokite Formula: FeSO4 · H2O |
| β Talc Formula: Mg3Si4O10(OH)2 |
| β Titanite Formula: CaTi(SiO4)O |
| β Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: Description: Sharp green blades. None terminated References: |
| β Violarite Formula: Fe2+Ni3+2S4 |
| β Wulfenite Formula: Pb(MoO4) Locality: South Main Street construction site, Torrington (Wolcottville), Litchfield County, Connecticut, USA Habit: acicular with square cross-section Colour: pale yellow Description: Microcrystals in thin Alpine clefts. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Bornite ? | 2.BA.15 | Cu5FeS4 |
| β | Pentlandite | 2.BB.15 | (NixFey)Ξ£9S8 |
| β | Sphalerite | 2.CB.05a | ZnS |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | Violarite | 2.DA.05 | Fe2+Ni3+2S4 |
| β | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| β | Hematite | 4.CB.05 | Fe2O3 |
| β | Quartz var. Smoky Quartz | 4.DA.05 | SiO2 |
| β | var. Sard | 4.DA.05 | SiO2 |
| β | var. Carnelian | 4.DA.05 | SiO2 |
| β | var. Chalcedony | 4.DA.05 | SiO2 |
| β | var. Agate | 4.DA.05 | SiO2 |
| β | var. Sardonyx | 4.DA.05 | SiO2 |
| β | 4.DA.05 | SiO2 | |
| β | Opal | 4.DA.10 | SiO2 Β· nH2O |
| β | Anatase | 4.DD.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Calcite | 5.AB.05 | CaCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Szomolnokite | 7.CB.05 | FeSO4 Β· H2O |
| β | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| β | Kyanite | 9.AF.15 | Al2(SiO4)O |
| β | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 Β· H2O |
| β | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Diopside | 9.DA.15 | CaMgSi2O6 |
| β | Tremolite | 9.DE.10 | β»Ca2Mg5(Si8O22)(OH)2 |
| β | Actinolite | 9.DE.10 | β»Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| β | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Annite | 9.EC.20 | KFe2+3(AlSi3O10)(OH)2 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 Β· 26H2O |
| Unclassified | |||
| β | 'Bloodstone' | - | SiO2 |
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| β | 'Fergusonite' ? | - | |
| β | 'K Feldspar' | - | |
| β | 'Scapolite' | - | |
| β | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| β | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Chrysoprase' | - | |
| β | 'Chlorite Group' | - | |
| β | 'Heulandite Subgroup' | - | |
| β | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] Β· nH2O |
| β | 'Synchysite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | β Annite | KFe32+(AlSi3O10)(OH)2 |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Opal | SiO2 · nH2O |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Staurolite | Fe22+Al9Si4O23(OH) |
| H | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | β Szomolnokite | FeSO4 · H2O |
| H | β Talc | Mg3Si4O10(OH)2 |
| H | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | β Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Calcite | CaCO3 |
| O | Oxygen | |
| O | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | β K Feldspar var. Adularia | KAlSi3O8 |
| O | β Albite | Na(AlSi3O8) |
| O | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | β Anatase | TiO2 |
| O | β Annite | KFe32+(AlSi3O10)(OH)2 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Calcite | CaCO3 |
| O | β Quartz var. Chalcedony | SiO2 |
| O | β Diopside | CaMgSi2O6 |
| O | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Hematite | Fe2O3 |
| O | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | β Kyanite | Al2(SiO4)O |
| O | β Magnetite | Fe2+Fe23+O4 |
| O | β Microcline | K(AlSi3O8) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Opal | SiO2 · nH2O |
| O | β Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β Staurolite | Fe22+Al9Si4O23(OH) |
| O | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | β Szomolnokite | FeSO4 · H2O |
| O | β Talc | Mg3Si4O10(OH)2 |
| O | β Titanite | CaTi(SiO4)O |
| O | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | β Wulfenite | Pb(MoO4) |
| O | β Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | β Quartz var. Sardonyx | SiO2 |
| O | β Quartz var. Sard | SiO2 |
| O | β Bloodstone | SiO2 |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β Fluorapatite | Ca5(PO4)3F |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Mg | Magnesium | |
| Mg | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | β Diopside | CaMgSi2O6 |
| Mg | β Talc | Mg3Si4O10(OH)2 |
| Mg | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Al | Aluminium | |
| Al | β K Feldspar var. Adularia | KAlSi3O8 |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | β Annite | KFe32+(AlSi3O10)(OH)2 |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | β Kyanite | Al2(SiO4)O |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Staurolite | Fe22+Al9Si4O23(OH) |
| Al | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | β Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | Silicon | |
| Si | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | β K Feldspar var. Adularia | KAlSi3O8 |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | β Annite | KFe32+(AlSi3O10)(OH)2 |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Quartz var. Chalcedony | SiO2 |
| Si | β Diopside | CaMgSi2O6 |
| Si | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | β Kyanite | Al2(SiO4)O |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Opal | SiO2 · nH2O |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β Staurolite | Fe22+Al9Si4O23(OH) |
| Si | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | β Talc | Mg3Si4O10(OH)2 |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | β Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | β Quartz var. Sardonyx | SiO2 |
| Si | β Quartz var. Sard | SiO2 |
| Si | β Bloodstone | SiO2 |
| P | Phosphorus | |
| P | β Fluorapatite | Ca5(PO4)3F |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | β Bornite | Cu5FeS4 |
| S | β Chalcopyrite | CuFeS2 |
| S | β Pentlandite | (NixFey)Ξ£9S8 |
| S | β Pyrite | FeS2 |
| S | β Pyrrhotite | Fe1-xS |
| S | β Sphalerite | ZnS |
| S | β Szomolnokite | FeSO4 · H2O |
| S | β Violarite | Fe2+Ni23+S4 |
| Cl | Chlorine | |
| Cl | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | β K Feldspar var. Adularia | KAlSi3O8 |
| K | β Annite | KFe32+(AlSi3O10)(OH)2 |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | β Calcite | CaCO3 |
| Ca | β Diopside | CaMgSi2O6 |
| Ca | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Titanite | CaTi(SiO4)O |
| Ca | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | β Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | β Anatase | TiO2 |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | β Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | β Annite | KFe32+(AlSi3O10)(OH)2 |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Bornite | Cu5FeS4 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | β Hematite | Fe2O3 |
| Fe | β Magnetite | Fe2+Fe23+O4 |
| Fe | β Pentlandite | (NixFey)Ξ£9S8 |
| Fe | β Pyrite | FeS2 |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | β Szomolnokite | FeSO4 · H2O |
| Fe | β Violarite | Fe2+Ni23+S4 |
| Ni | Nickel | |
| Ni | β Pentlandite | (NixFey)Ξ£9S8 |
| Ni | β Violarite | Fe2+Ni23+S4 |
| Cu | Copper | |
| Cu | β Bornite | Cu5FeS4 |
| Cu | β Chalcopyrite | CuFeS2 |
| Zn | Zinc | |
| Zn | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | β Sphalerite | ZnS |
| Mo | Molybdenum | |
| Mo | β Wulfenite | Pb(MoO4) |
| Pb | Lead | |
| Pb | β Wulfenite | Pb(MoO4) |
Localities in this Region
- Connecticut
- Litchfield County
- Connecticut
- Litchfield County
Other Regions, Features and Areas containing this locality
North America PlateTectonic Plate
- Laurentides DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
West Torrington nickel mines, Torrington, Litchfield County, Connecticut, USA