Magurka, Partizánska Ľupča, Liptovský Mikuláš District, Žilina Region, Slovakiai
Regional Level Types | |
---|---|
Magurka | - not defined - |
Partizánska Ľupča | Municipality |
Liptovský Mikuláš District | District |
Žilina Region | Region |
Slovakia | Country |
Magurka, Carpathian Mountains, Europe
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
48° 56' 10'' North , 19° 25' 44'' East
Latitude & Longitude (decimal):
Köppen climate type:
Nearest Settlements:
Place | Population | Distance |
---|---|---|
Demänovská Dolina | 203 (2015) | 12.0km |
Svätý Kríž | 811 (2018) | 14.8km |
Mýto pod Ďumbierom | 542 (2013) | 17.6km |
Ružomberok | 30,806 (2018) | 17.8km |
Bešeňová | 667 (2018) | 18.2km |
Mindat Locality ID:
784
Long-form identifier:
mindat:1:2:784:8
GUID (UUID V4):
94bfdc84-12d3-412b-bac4-e4297a337a80
Name(s) in local language(s):
Magurka, Partizánska Lupča, okres Liptovský Mikuláš, Žilinský Kraj, Slovenská Republika
Vein-type Au-Sb deposit, hosted in Late Paleozoic gneiss and granite.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
ⓘ Albite Formula: Na(AlSi3O8) |
ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
ⓘ Antimony Formula: Sb |
ⓘ Arsenopyrite Formula: FeAsS |
ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
ⓘ Baryte Formula: BaSO4 |
ⓘ Berthierite Formula: FeSb2S4 |
ⓘ 'Bindheimite' Formula: Pb2Sb2O6O |
ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
ⓘ Bornite Formula: Cu5FeS4 |
ⓘ Boulangerite Formula: Pb5Sb4S11 |
ⓘ Bournonite Formula: PbCuSbS3 |
ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
ⓘ Calcite Formula: CaCO3 |
ⓘ Cervantite Formula: Sb3+Sb5+O4 |
ⓘ Chalcopyrite Formula: CuFeS2 |
ⓘ Chalcostibite Formula: CuSbS2 |
ⓘ 'Chlorite Group' |
ⓘ Cinnabar Formula: HgS |
ⓘ Dolomite Formula: CaMg(CO3)2 |
ⓘ Dolomite var. Iron-bearing Dolomite Formula: Ca(Mg,Fe)(CO3)2 |
ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
ⓘ Fülöppite Formula: Pb3Sb8S15 |
ⓘ Galena Formula: PbS |
ⓘ Geocronite Formula: Pb14Sb6S23 References: |
ⓘ Gladite Formula: PbCuBi5S9 |
ⓘ Goethite Formula: α-Fe3+O(OH) |
ⓘ Gold Formula: Au |
ⓘ Hematite Formula: Fe2O3 |
ⓘ Heteromorphite Formula: Pb7Sb8S19 |
ⓘ Jamesonite Formula: Pb4FeSb6S14 |
ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
ⓘ Kermesite Formula: Sb2S2O |
ⓘ 'Limonite' |
ⓘ Magnesite Formula: MgCO3 |
ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
ⓘ Marcasite Formula: FeS2 |
ⓘ Microcline Formula: K(AlSi3O8) |
ⓘ Millerite Formula: NiS |
ⓘ Molybdenite Formula: MoS2 |
ⓘ Monazite-(Ce) Formula: Ce(PO4) |
ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
ⓘ Opal Formula: SiO2 · nH2O |
ⓘ Opal var. Opal-AN Formula: SiO2 · nH2O |
ⓘ Orthoclase Formula: K(AlSi3O8) |
ⓘ 'Psilomelane' |
ⓘ Pyrite Formula: FeS2 References: |
ⓘ Pyrrhotite Formula: Fe1-xS |
ⓘ Quartz Formula: SiO2 References: |
ⓘ Robinsonite Formula: Pb4Sb6S13 References: |
ⓘ Rouxelite Formula: Cu2HgPb23Sb27S65.5 Description: Observed in thin section |
ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ Senarmontite Formula: Sb2O3 |
ⓘ Siderite Formula: FeCO3 |
ⓘ Silver Formula: Ag |
ⓘ Sphalerite Formula: ZnS References: |
ⓘ 'Stibiconite' Formula: Sb3+Sb5+2O6(OH) |
ⓘ Stibnite Formula: Sb2S3 |
ⓘ Talc Formula: Mg3Si4O10(OH)2 |
ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
ⓘ Valentinite Formula: Sb2O3 |
ⓘ 'Wad' |
ⓘ Wurtzite Formula: (Zn,Fe)S |
ⓘ Xenotime-(Y) Formula: Y(PO4) |
ⓘ Zinkenite Formula: Pb9Sb22S42 |
ⓘ Zircon Formula: Zr(SiO4) |
List of minerals arranged by Strunz 10th Edition classification
Group 1 - Elements | |||
---|---|---|---|
ⓘ | Antimony | 1.CA.05 | Sb |
ⓘ | Gold | 1.AA.05 | Au |
ⓘ | Silver | 1.AA.05 | Ag |
Group 2 - Sulphides and Sulfosalts | |||
ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
ⓘ | Chalcostibite | 2.HA.05 | CuSbS2 |
ⓘ | Cinnabar | 2.CD.15a | HgS |
ⓘ | Fülöppite | 2.HC.10a | Pb3Sb8S15 |
ⓘ | Galena | 2.CD.10 | PbS |
ⓘ | Geocronite | 2.JB.30a | Pb14Sb6S23 |
ⓘ | Gladite | 2.HB.05a | PbCuBi5S9 |
ⓘ | Heteromorphite | 2.HC.10c | Pb7Sb8S19 |
ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
ⓘ | Marcasite | 2.EB.10a | FeS2 |
ⓘ | Millerite | 2.CC.20 | NiS |
ⓘ | Molybdenite | 2.EA.30 | MoS2 |
ⓘ | Pyrite | 2.EB.05a | FeS2 |
ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
ⓘ | Robinsonite | 2.HC.20 | Pb4Sb6S13 |
ⓘ | Rouxelite | 2.JB.25j | Cu2HgPb23Sb27S65.5 |
ⓘ | Sphalerite | 2.CB.05a | ZnS |
ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
Group 4 - Oxides and Hydroxides | |||
ⓘ | 'Bindheimite' | 4.DH.20 | Pb2Sb2O6O |
ⓘ | Cervantite | 4.DE.30 | Sb3+Sb5+O4 |
ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
ⓘ | Hematite | 4.CB.05 | Fe2O3 |
ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
ⓘ | var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
ⓘ | Quartz | 4.DA.05 | SiO2 |
ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
ⓘ | 'Stibiconite' | 4.DH.20 | Sb3+Sb5+2O6(OH) |
ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
Group 5 - Nitrates and Carbonates | |||
ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
ⓘ | Calcite | 5.AB.05 | CaCO3 |
ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
ⓘ | var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
ⓘ | Magnesite | 5.AB.05 | MgCO3 |
ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
ⓘ | Siderite | 5.AB.05 | FeCO3 |
Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
ⓘ | Baryte | 7.AD.35 | BaSO4 |
ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
Group 8 - Phosphates, Arsenates and Vanadates | |||
ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
Group 9 - Silicates | |||
ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
ⓘ | var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
Unclassified Minerals, Rocks, etc. | |||
ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
ⓘ | 'Chlorite Group' | - | |
ⓘ | 'Limonite' | - | |
ⓘ | 'Psilomelane' | - | |
ⓘ | 'Wad' | - |
List of minerals for each chemical element
H | Hydrogen | |
---|---|---|
H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
H | ⓘ Malachite | Cu2(CO3)(OH)2 |
H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
H | ⓘ Talc | Mg3Si4O10(OH)2 |
H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
H | ⓘ Goethite | α-Fe3+O(OH) |
H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
H | ⓘ Opal | SiO2 · nH2O |
B | Boron | |
B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
C | Carbon | |
C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
C | ⓘ Dolomite | CaMg(CO3)2 |
C | ⓘ Calcite | CaCO3 |
C | ⓘ Malachite | Cu2(CO3)(OH)2 |
C | ⓘ Siderite | FeCO3 |
C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
C | ⓘ Magnesite | MgCO3 |
O | Oxygen | |
O | ⓘ Hematite | Fe2O3 |
O | ⓘ Quartz | SiO2 |
O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
O | ⓘ Baryte | BaSO4 |
O | ⓘ Bindheimite | Pb2Sb2O6O |
O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
O | ⓘ Cervantite | Sb3+Sb5+O4 |
O | ⓘ Dolomite | CaMg(CO3)2 |
O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
O | ⓘ Calcite | CaCO3 |
O | ⓘ Magnetite | Fe2+Fe23+O4 |
O | ⓘ Malachite | Cu2(CO3)(OH)2 |
O | ⓘ Siderite | FeCO3 |
O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
O | ⓘ Valentinite | Sb2O3 |
O | ⓘ Talc | Mg3Si4O10(OH)2 |
O | ⓘ Senarmontite | Sb2O3 |
O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
O | ⓘ Albite | Na(AlSi3O8) |
O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
O | ⓘ Goethite | α-Fe3+O(OH) |
O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
O | ⓘ Kermesite | Sb2S2O |
O | ⓘ Magnesite | MgCO3 |
O | ⓘ Microcline | K(AlSi3O8) |
O | ⓘ Monazite-(Ce) | Ce(PO4) |
O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
O | ⓘ Orthoclase | K(AlSi3O8) |
O | ⓘ Xenotime-(Y) | Y(PO4) |
O | ⓘ Zircon | Zr(SiO4) |
O | ⓘ Opal | SiO2 · nH2O |
F | Fluorine | |
F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
Na | Sodium | |
Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Na | ⓘ Albite | Na(AlSi3O8) |
Mg | Magnesium | |
Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
Mg | ⓘ Dolomite | CaMg(CO3)2 |
Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
Mg | ⓘ Magnesite | MgCO3 |
Al | Aluminium | |
Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | ⓘ Albite | Na(AlSi3O8) |
Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
Al | ⓘ Microcline | K(AlSi3O8) |
Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Al | ⓘ Orthoclase | K(AlSi3O8) |
Si | Silicon | |
Si | ⓘ Quartz | SiO2 |
Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | ⓘ Talc | Mg3Si4O10(OH)2 |
Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
Si | ⓘ Albite | Na(AlSi3O8) |
Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
Si | ⓘ Microcline | K(AlSi3O8) |
Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Si | ⓘ Orthoclase | K(AlSi3O8) |
Si | ⓘ Zircon | Zr(SiO4) |
Si | ⓘ Opal | SiO2 · nH2O |
P | Phosphorus | |
P | ⓘ Monazite-(Ce) | Ce(PO4) |
P | ⓘ Xenotime-(Y) | Y(PO4) |
S | Sulfur | |
S | ⓘ Robinsonite | Pb4Sb6S13 |
S | ⓘ Arsenopyrite | FeAsS |
S | ⓘ Boulangerite | Pb5Sb4S11 |
S | ⓘ Bournonite | PbCuSbS3 |
S | ⓘ Chalcopyrite | CuFeS2 |
S | ⓘ Chalcostibite | CuSbS2 |
S | ⓘ Galena | PbS |
S | ⓘ Heteromorphite | Pb7Sb8S19 |
S | ⓘ Marcasite | FeS2 |
S | ⓘ Pyrite | FeS2 |
S | ⓘ Sphalerite | ZnS |
S | ⓘ Stibnite | Sb2S3 |
S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
S | ⓘ Zinkenite | Pb9Sb22S42 |
S | ⓘ Rouxelite | Cu2HgPb23Sb27S65.5 |
S | ⓘ Baryte | BaSO4 |
S | ⓘ Berthierite | FeSb2S4 |
S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
S | ⓘ Cinnabar | HgS |
S | ⓘ Fülöppite | Pb3Sb8S15 |
S | ⓘ Jamesonite | Pb4FeSb6S14 |
S | ⓘ Wurtzite | (Zn,Fe)S |
S | ⓘ Bornite | Cu5FeS4 |
S | ⓘ Gladite | PbCuBi5S9 |
S | ⓘ Kermesite | Sb2S2O |
S | ⓘ Millerite | NiS |
S | ⓘ Molybdenite | MoS2 |
S | ⓘ Pyrrhotite | Fe1-xS |
S | ⓘ Geocronite | Pb14Sb6S23 |
K | Potassium | |
K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
K | ⓘ Microcline | K(AlSi3O8) |
K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
K | ⓘ Orthoclase | K(AlSi3O8) |
Ca | Calcium | |
Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
Ca | ⓘ Dolomite | CaMg(CO3)2 |
Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Ca | ⓘ Calcite | CaCO3 |
Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
Ti | Titanium | |
Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
Fe | Iron | |
Fe | ⓘ Arsenopyrite | FeAsS |
Fe | ⓘ Chalcopyrite | CuFeS2 |
Fe | ⓘ Hematite | Fe2O3 |
Fe | ⓘ Marcasite | FeS2 |
Fe | ⓘ Pyrite | FeS2 |
Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
Fe | ⓘ Berthierite | FeSb2S4 |
Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
Fe | ⓘ Siderite | FeCO3 |
Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Fe | ⓘ Wurtzite | (Zn,Fe)S |
Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
Fe | ⓘ Bornite | Cu5FeS4 |
Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
Fe | ⓘ Goethite | α-Fe3+O(OH) |
Fe | ⓘ Pyrrhotite | Fe1-xS |
Ni | Nickel | |
Ni | ⓘ Millerite | NiS |
Cu | Copper | |
Cu | ⓘ Bournonite | PbCuSbS3 |
Cu | ⓘ Chalcopyrite | CuFeS2 |
Cu | ⓘ Chalcostibite | CuSbS2 |
Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
Cu | ⓘ Rouxelite | Cu2HgPb23Sb27S65.5 |
Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
Cu | ⓘ Bornite | Cu5FeS4 |
Cu | ⓘ Gladite | PbCuBi5S9 |
Zn | Zinc | |
Zn | ⓘ Sphalerite | ZnS |
Zn | ⓘ Wurtzite | (Zn,Fe)S |
As | Arsenic | |
As | ⓘ Arsenopyrite | FeAsS |
Y | Yttrium | |
Y | ⓘ Xenotime-(Y) | Y(PO4) |
Zr | Zirconium | |
Zr | ⓘ Zircon | Zr(SiO4) |
Mo | Molybdenum | |
Mo | ⓘ Molybdenite | MoS2 |
Ag | Silver | |
Ag | ⓘ Silver | Ag |
Sb | Antimony | |
Sb | ⓘ Robinsonite | Pb4Sb6S13 |
Sb | ⓘ Antimony | Sb |
Sb | ⓘ Boulangerite | Pb5Sb4S11 |
Sb | ⓘ Bournonite | PbCuSbS3 |
Sb | ⓘ Chalcostibite | CuSbS2 |
Sb | ⓘ Heteromorphite | Pb7Sb8S19 |
Sb | ⓘ Stibnite | Sb2S3 |
Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
Sb | ⓘ Zinkenite | Pb9Sb22S42 |
Sb | ⓘ Rouxelite | Cu2HgPb23Sb27S65.5 |
Sb | ⓘ Berthierite | FeSb2S4 |
Sb | ⓘ Bindheimite | Pb2Sb2O6O |
Sb | ⓘ Cervantite | Sb3+Sb5+O4 |
Sb | ⓘ Fülöppite | Pb3Sb8S15 |
Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
Sb | ⓘ Valentinite | Sb2O3 |
Sb | ⓘ Senarmontite | Sb2O3 |
Sb | ⓘ Kermesite | Sb2S2O |
Sb | ⓘ Geocronite | Pb14Sb6S23 |
Ba | Barium | |
Ba | ⓘ Baryte | BaSO4 |
Ce | Cerium | |
Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
Au | Gold | |
Au | ⓘ Gold | Au |
Hg | Mercury | |
Hg | ⓘ Rouxelite | Cu2HgPb23Sb27S65.5 |
Hg | ⓘ Cinnabar | HgS |
Pb | Lead | |
Pb | ⓘ Robinsonite | Pb4Sb6S13 |
Pb | ⓘ Boulangerite | Pb5Sb4S11 |
Pb | ⓘ Bournonite | PbCuSbS3 |
Pb | ⓘ Galena | PbS |
Pb | ⓘ Heteromorphite | Pb7Sb8S19 |
Pb | ⓘ Zinkenite | Pb9Sb22S42 |
Pb | ⓘ Rouxelite | Cu2HgPb23Sb27S65.5 |
Pb | ⓘ Bindheimite | Pb2Sb2O6O |
Pb | ⓘ Fülöppite | Pb3Sb8S15 |
Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
Pb | ⓘ Gladite | PbCuBi5S9 |
Pb | ⓘ Geocronite | Pb14Sb6S23 |
Bi | Bismuth | |
Bi | ⓘ Gladite | PbCuBi5S9 |
Geochronology
Mineralization age: Phanerozoic : 263.8 ± 0.8 Ma to 87 ± 4 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
Geologic Time | Rocks, Minerals and Events | |||||||||
---|---|---|---|---|---|---|---|---|---|---|
Phanerozoic | ||||||||||
Mesozoic | ||||||||||
Cretaceous | ||||||||||
Late/Upper Cretaceous |
| |||||||||
Triassic | ||||||||||
Middle Triassic |
| |||||||||
Early/Lower Triassic |
| |||||||||
Paleozoic | ||||||||||
Permian | ||||||||||
Guadalupian |
| |||||||||
Other Regions, Features and Areas containing this locality
CzechoslovakiaCountry
Eurasian PlateTectonic Plate
EuropeContinent
- Carpathian MountainsMountain Range
Slovakia
- Low TatrasMountain Range
- Low Tatras National ParkNational Park
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Magurka, Partizánska Ľupča, Liptovský Mikuláš District, Žilina Region, Slovakia