| Acanthite |  |
|---|
| Formula: | Ag2S |
| Localities: | Reported from at least 36 localities in this region. |
|
|
|
|
|
|
| Photo: Acanthite from West slope, Kreuzkogel, Kreuzkogel massif, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria |
| Actinolite |  |
|---|
| Formula: | ☐{Ca2}{(Mg,Fe2+)5}(Si8O22)(OH)2 |
| Localities: | Reported from at least 82 localities in this region. |
|
|
|
|
|
|
| Photo: © Antonio Borrelli. Actinolite from Zillertal, North Tyrol, Tyrol, Austria |
| Actinolite var: Smaragdite |  |
|---|
| Formula: | Ca2(Mg,Fe2+)5Si8O22(OH)2 |
| Localities: | Kraubath, Leoben, Styria, Austria Karlstetten, Mostviertel, Lower Austria, Austria Emerald deposit, Leckbachgraben (Leckbachrinne), Nasenkopf, Habach Valley, Hohe Tauern, Salzburg, Austria Lobminggraben, St Stefan, Kraubath, Leoben, Styria, Austria
|
|
|
|
|
|
|
| Photo: © Harjo. Smaragdite from Emerald deposit, Leckbachgraben, Nasenkopf, Habach Valley, Hohe Tauern, Salzburg, Austria |
| Adamite |  |
|---|
| Formula: | Zn2(AsO4)(OH) |
| Localities: | Reported from at least 14 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Adamite from Dürrkogel, Veitsch, Mitterdorf, Styria, Austria |
| Adamite var: Cuprian Adamite |  |
|---|
| Formula: | (Zn,Cu)2AsO4OH |
| Localities: | Reported from at least 16 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Cuprian Adamite from Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria |
| Admontite (TL) | |
|---|
| Formula: | Mg[B6O7(OH)6] · 4H2O |
| Type Locality: | Schildmauer, Admont, Ennstaler Alpen, Styria, Austria |
| Reference: | Walenta, K. (1979): Admontit, ein neues Boratmineral aus der Gipslagerstätte Schildmauer bei Admont in der Steiermark (Österreich). Tschermaks. Mineral. Petr. Mitt. 26, 69-77. (in German) ; Schweiz. Min. Petr. Mitt. 62 (1982), 177; Clark, 1993 - "Hey's Mineral Index, 3rd Edition" |
|
|
|
|
|
|
| Aegirine |  |
|---|
| Formula: | NaFe3+Si2O6 |
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
| Photo: Aegirine from Pfennigbach, Puchberg am Schneeberg, Industrieviertel, Lower Austria, Austria |
| Aegirine-augite | |
|---|
| Formula: | (Na,Ca)(Fe3+,Fe2+,Mg,Al)Si2O6 |
| Localities: | Raabs an der Thaya, Waldviertel, Lower Austria, Austria Karlstein an der Thaya, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
| 'Aeschynite' |  |
|---|
| Localities: | Reported from at least 11 localities in this region. |
|
|
|
|
|
|
|
| Photo: © Manuele Moro. Aeschynite from Oberschrammach glacier, Schrammacher, Zamser Grund, Zillertal, North Tyrol, Tyrol, Austria |
| Aeschynite-(Ce) |  |
|---|
| Formula: | (Ce,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 |
| Localities: | Leckbachscharte, Nasenkopf, Habach valley, Hohe Tauern, Salzburg, Austria Lohning quarry (Lohninger quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Kaiserer quarry (Deisl quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria ? (more information)
|
|
|
|
|
|
|
| Photo: © 2004 ROM. Aeschynite-(Ce) from Kaiserer quarry, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| Aeschynite-(Y) |  |
|---|
| Formula: | (Y,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 |
| Localities: | Reported from at least 12 localities in this region. |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Aeschynite-(Y) from Lohning quarry, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| Afwillite |  |
|---|
| Formula: | Ca3(HSiO4)2 · 2H2O |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
| Photo: © AC. Afwillite from Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
| Agardite-(Ce) | |
|---|
| Formula: | CeCu6(AsO4)3(OH)6 · 3H2O |
| Locality: | Kaltenegg, Southern District, Prinzkogel mines, Prinzkogel (Prinzenkogel), Rettenegg, Fischbacher Alpen, Styria, Austria |
|
|
|
|
|
|
|
| Agardite-(La) |  |
|---|
| Formula: | (La,Ce)Cu6(AsO4)3(OH)6 · 3H2O |
| Locality: | No. 1 adit, Äußere Wimitz, St Veit an der Glan, Gurktaler Alpen, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © 0. Agardite-(La) from No. 1 adit, Äußere Wimitz, St Veit an der Glan, Gurktaler Alpen, Carinthia, Austria |
Agardite-(Nd) | |
|---|
| Formula: | NdCu6(AsO4)3(OH)6 · 3H2O |
| Locality: | Kaltenegg, Southern District, Prinzkogel mines, Prinzkogel (Prinzenkogel), Rettenegg, Fischbacher Alpen, Styria, Austria |
|
|
|
|
|
|
|
| Aikinite | |
|---|
| Formula: | PbCuBiS3 |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
|
| Ajoite |  |
|---|
| Formula: | (K,Na)Cu7AlSi9O24(OH)6 · 3H2O |
| Localities: | Putzkammer Alp, Rinder valley (Gafluna valley), Verwall group, Montafon, Vorarlberg, Austria Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Ajoite from Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria |
| Åkermanite | |
|---|
| Formula: | Ca2Mg(Si2O7) |
| Locality: | Montanwerke Brixlegg (slag locality), Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Albite |  |
|---|
| Formula: | NaAlSi3O8 |
| Localities: | Reported from at least 337 localities in this region. |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Albite from Lohning quarry, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| Albite var: Andesine | |
|---|
| Formula: | (Na,Ca)[Al(Si,Al)Si2O8] |
| Localities: | Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria Bad Eisenkappel (Bad Eisenkappl), Karawanken, Carinthia, Austria Burgstallkogel, Lavamünd, Koralpe, Carinthia, Austria Basalt quarry, Kollnitz, St Paul im Lavanttal, Carinthia, Austria
|
|
|
|
|
|
|
|
| Albite var: Oligoclase | |
|---|
| Formula: | (Na,Ca)[Al(Si,Al)Si2O8] |
| Localities: | Reported from at least 14 localities in this region. |
|
|
|
|
|
|
|
| Albite var: Pericline |  |
|---|
| Localities: | Reported from at least 27 localities in this region. |
|
|
|
|
|
|
|
| Photo: © 2005 - S.Menig. Pericline from Nussingkogel, Matrei in Osttirol, Tauern valley, East Tyrol, Tyrol, Austria |
| 'Albite-Anorthite Series' | |
|---|
| Localities: | Reported from at least 45 localities in this region. |
|
|
|
|
|
|
|
|
| Aleksite | |
|---|
| Formula: | PbBi2Te2S2 |
| Locality: | Langenleiten, Großfragant, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria |
|
|
|
|
|
|
|
| Algodonite ? | |
|---|
| Formula: | (Cu1-xAsx) |
| Localities: | Brunngraben district, Cu deposit (Schönberg), Flatschach, Knittelfeld, Styria, Austria ? (more information) Weißenbach district, Cu deposit (Schönberg), Flatschach, Knittelfeld, Styria, Austria ? (more information)
|
|
|
|
|
|
|
|
| 'Allanite' |  |
|---|
| Localities: | Reported from at least 27 localities in this region. |
|
|
|
|
|
|
|
| Photo: © AL. Allanite from Power station, Sportgastein, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria |
| Allanite-(Ce) |  |
|---|
| Formula: | {CaCe}{Al2Fe2+}(Si2O7)(SiO4)O(OH) |
| Localities: | Reported from at least 10 localities in this region. |
|
|
|
|
|
|
| Photo: © mslama. Allanite-(Ce) from Graphite quarry, Amstall, Mühldorf, Waldviertel, Lower Austria, Austria |
| Allanite-(La) | |
|---|
| Formula: | {CaLa}{Al2Fe2+}(Si2O7)(SiO4)O(OH) |
| Locality: | Magnetite prospect, Kleinwöllmiß, Voitsberg, Köflach, Styria, Austria |
|
|
|
|
|
|
|
| 'Allemontite' | |
|---|
| Locality: | Heinrich section, Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
|
| 'Allevardite' | |
|---|
| Locality: | Weitwörth, Oberndorf, Salzburg, Austria |
|
|
|
|
|
|
|
|
| Allophane |  |
|---|
| Formula: | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Localities: | Reported from at least 39 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Allophane from Brandberg, Leoben, Styria, Austria |
| Allophane var: Cupro-Allophane | |
|---|
| Localities: | Maukenötz District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Stocker adit, Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Gratlspitz, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
|
| Almandine |  |
|---|
| Formula: | Fe2+3Al2(SiO4)3 |
| Localities: | Reported from at least 79 localities in this region. |
|
|
|
|
|
|
| Photo: © Christian Bracke. Almandine from Granatenkogel north slope, Gaisberg valley, Obergurgl, Gurgler valley, Ötz valley, North Tyrol, Tyrol, Austria |
| 'Almandine-Pyrope Series' | |
|---|
| Locality: | Mitterbachgraben, Gansbach, Dunkelsteinerwald, Dunkelstein Forest, Mostviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
|
| 'Almandine-Spessartine Series' |  |
|---|
| Localities: | Windeckberg, Miesling valley, Spitz, Wachau, Lower Austria, Austria Königsalm, Senftenberg, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
| Photo: © . Almandine-Spessartine Series from Königsalm, Senftenberg, Waldviertel, Lower Austria, Austria |
| Alstonite |  |
|---|
| Formula: | BaCa(CO3)2 |
| Locality: | Arzberg, Weiz, Styria, Austria |
|
|
|
|
|
|
| Photo: Alstonite from Arzberg, Weiz, Styria, Austria |
| Altaite | |
|---|
| Formula: | PbTe |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
|
| 'Alum Group' | |
|---|
| Formula: | XAl(SO4)2 · 12H2O |
| Locality: | Dietmannsdorf, Trieben, Liesing - Palten valley, Styria, Austria |
|
|
|
|
|
|
|
| Aluminite | |
|---|
| Formula: | Al2(SO4)(OH)4 · 7H2O |
| Localities: | Seegraben, Leoben, Styria, Austria Münzenberg, Leoben, Styria, Austria
|
|
|
|
|
|
|
|
| Aluminoceladonite (TL) | |
|---|
| Formula: | K(Mg,Fe2+)Al(Si4O10)(OH)2 |
| Type Locality: | Frohsdorf, Lanzenkirchen, Industrieviertel, Lower Austria, Austria |
| Reference: | Can. Mineral. 36, 905 |
| Localities: | Recorded from at least 1 other locality in this region. |
|
|
|
|
|
| Aluminocopiapite | |
|---|
| Formula: | Al2/3Fe3+4(SO4)6(OH)2 · 20H2O |
| Localities: | Frauenalpe south slope, Metnitz, Gurktaler Alpen, Carinthia, Austria Spitzmühle quarry, Leutschach, Styria, Austria Graphite quarry, Wollmersdorf (Zettlitz-Wollmersdorf), Drosendorf-Zissersdorf, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
| Alum-(K) | |
|---|
| Formula: | KAl(SO4)2 · 12H2O |
| Localities: | Rock salt deposit, Dürrnberg, Hallein, Salzburg, Austria Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| Alumohydrocalcite |  |
|---|
| Formula: | CaAl2(CO3)2(OH)4 · 3H2O |
| Localities: | Radlbad, Radlgraben, Gmünd, Reißeck group, Hohe Tauern, Carinthia, Austria Copper Mines (incl. Grafendorf; Monsell), Dellach, Kötschach-Mauthen, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Alumohydrocalcite from Copper Mines, Dellach, Kötschach-Mauthen, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Alunite | |
|---|
| Formula: | KAl3(SO4)2(OH)6 |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
|
| Alunogen |  |
|---|
| Formula: | Al2(SO4)3 · 17H2O |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: Alunogen from Lignite deposit, Hausheim, Wölbling, Dunkelstein Forest, Mostviertel, Lower Austria, Austria |
| 'Amber' |  |
|---|
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
|
| Photo: © . Amber from Sandstone quarries, Anthering - Muntigl area, Salzburg, Salzburg, Austria |
| 'Amber var: Jaulingite' | |
|---|
| Localities: | Lignite deposit, St Stefan, Wolfsberg, Carinthia, Austria Jauling, St Veit an der Triesting, Berndorf, Industrieviertel, Lower Austria, Austria Köflach - Voitsberg lignite deposit, Köflach, Styria, Austria Lignite deposit, Eibiswald, Wies, Koralpe, Styria, Austria
|
|
|
|
|
|
|
|
|
| 'Amber var: Kochenite' | |
|---|
| Localities: | Kochen valley, Telfs, Inn valley, North Tyrol, Tyrol, Austria Pertisau, Jenbach, Inn valley, North Tyrol, Tyrol, Austria Brandenberg, Kramsach, Inn valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
|
| 'Amber var: Rosthornite' | |
|---|
| Localities: | Sonnberg, Guttaring, Friesach - Hüttenberg area, Carinthia, Austria Lignite deposit, Eibiswald, Wies, Koralpe, Styria, Austria
|
|
|
|
|
|
|
|
|
| Ammoniojarosite |  |
|---|
| Formula: | (NH4)Fe3+3(SO4)2(OH)6 |
| Localities: | Muttlkogel, Zangtal District, Köflach - Voitsberg lignite deposit, Köflach, Styria, Austria Seegraben, Leoben, Styria, Austria
|
|
|
|
|
|
|
| Photo: © AC. Ammoniojarosite from Seegraben, Leoben, Styria, Austria |
| 'Ammonite var: Ammolite' | |
|---|
| Locality: | Kohlergraben, Lafatsch valley (Hinterau valley), Karwendel Mts, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
|
| Amphibole Supergroup |  |
|---|
| Formula: | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Localities: | Reported from at least 36 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Amphibole Supergroup from Preg, Kraubath, Leoben, Styria, Austria |
| Amphibole Supergroup var: Byssolite |  |
|---|
| Localities: | Reported from at least 24 localities in this region. |
|
|
|
|
|
|
|
| Photo: © www.mineralienkluft.at. Byssolite from Knappenwand, Knappenwand area, Untersulzbach valley, Hohe Tauern, Salzburg, Austria |
| Amstallite (TL) | |
|---|
| Formula: | CaAl(Si,Al)4O8(OH)4 · (H2O,Cl) |
| Type Locality: | Graphite quarry, Amstall, Mühldorf, Waldviertel, Lower Austria, Austria |
| Reference: | N.Jahrb.Min.,Mh.(1987), 253-262 |
|
|
|
|
|
|
| Analcime |  |
|---|
| Formula: | Na2(Al2Si4O12) · 2H2O |
| Localities: | Reported from at least 19 localities in this region. |
|
|
|
|
|
|
| Photo: © 2005 - MMI. Analcime from Steinberg, Mühldorf, Feldbach, Styria, Austria |
| Anatase |  |
|---|
| Formula: | TiO2 |
| Localities: | Reported from at least 190 localities in this region. |
|
|
|
|
|
|
| Photo: © Harjo. Anatase from Leffler source, Habach valley, Hohe Tauern, Salzburg, Austria |
| Andalusite |  |
|---|
| Formula: | Al2(SiO4)O |
| Localities: | Reported from at least 25 localities in this region. |
|
|
|
|
|
|
| Photo: Andalusite from Lüsens valley, Sellrain valley, North Tyrol, Tyrol, Austria |
| Andalusite var: Chiastolite | |
|---|
| Locality: | Leckbachgraben (Leckbachrinne), Nasenkopf, Habach valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
|
| Andersonite | |
|---|
| Formula: | Na2Ca(UO2)(CO3)3 · 6H2O |
| Locality: | Haidbachgraben (Myrthengraben; Myrtengraben; Heidbachgraben), Semmering, Industrieviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| Andradite |  |
|---|
| Formula: | Ca3Fe3+2(SiO4)3 |
| Localities: | Reported from at least 18 localities in this region. |
|
|
|
|
|
|
| Photo: © John Sobolewski. Andradite from Salzburg, Austria |
| Andradite var: Melanite |  |
|---|
| Locality: | Gösleswand (Goslerwand), Prägraten, Virgen Valley, East Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Photo: © Gerd Stefanik. Melanite from Gösleswand, Prägraten, Virgen Valley, East Tyrol, Tyrol, Austria |
| Andradite var: Topazolite | |
|---|
| Localities: | Schwarze Wand, Scharnbachgraben, Hollersbach valley, Hohe Tauern, Salzburg, Austria Gösleswand (Goslerwand), Prägraten, Virgen Valley, East Tyrol, Tyrol, Austria Totenkopf (incl. Lower Riffl glacier), Stubach valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
|
| Andrémeyerite | |
|---|
| Formula: | BaFe2+2(Si2O7) |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
| Anglesite |  |
|---|
| Formula: | PbSO4 |
| Localities: | Reported from at least 107 localities in this region. |
|
|
|
|
|
|
| Photo: Anglesite from Stefanie Mine, Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Anglesite var: Barytoanglesite | |
|---|
| Formula: | (Pb,Ba)SO4 |
| Locality: | Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
|
|
|
|
|
|
|
| Anhydrite (TL) |  |
|---|
| Formula: | CaSO4 |
| Type Locality: | Salt mine, Hall, Innsbruck, Inn valley, North Tyrol, Tyrol, Austria |
| Reference: | Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 427. |
| Localities: | Recorded from at least 51 other localities in this region. |
|
|
|
|
| Photo: © Rob Lavinsky. Anhydrite from Ischler Salzberg, Perneck, Bad Ischl, Gmunden, Upper Austria, Austria |
| Anilite | |
|---|
| Formula: | Cu7S4 |
| Locality: | Schlossberg, Krems, Voitsberg, Köflach, Styria, Austria |
|
|
|
|
|
|
|
| Ankerite (TL) |  |
|---|
| Formula: | Ca(Fe2+,Mg)(CO3)2 |
| Type Locality: | Styrian Erzberg, Eisenerz, Styria, Austria |
| Reference: | Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 215; collection Landesmuseum Joanneum - Graz; Pohl, W., and Belocky, R. (1999): Mineralium Deposita 34, 614-629. |
| Localities: | Recorded from at least 185 other localities in this region. |
|
|
|
|
| Photo: © rk. Ankerite from Styrian Erzberg, Eisenerz, Styria, Austria |
| 'Ankerite-Dolomite Series' |  |
|---|
| Localities: | Forestry road cut, Topenauer farm, Notberg, Guggenbach, Peggau, Styria, Austria Granitzer, Weizbach valley, Weiz, Styria, Austria Kohlbach Alp, Salla, Stubalpe, Styria, Austria
|
|
|
|
|
|
|
|
| Photo: © hamster@aon.at. Ankerite-Dolomite Series from Styrian Erzberg, Eisenerz, Styria, Austria |
| Annabergite |  |
|---|
| Formula: | Ni3(AsO4)2 · 8H2O |
| Localities: | Reported from at least 33 localities in this region. |
|
|
|
|
|
|
| Photo: Annabergite from Nöckelberg District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
| Annabergite var: Magnesian Annabergite |  |
|---|
| Formula: | (Ni,Mg)3(AsO4)2 · 8H2O |
| Localities: | Serpentinite quarry, Griesserhof (Gulitzen; Gullitzen), Hirt, Friesach - Hüttenberg area, Carinthia, Austria Magnesite Mine, Millstätter Alpe, Radenthein, Gurktaler Alpen, Carinthia, Austria Laaken, St Urban, Gurktaler Alpen, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Magnesian Annabergite from Serpentinite quarry, Griesserhof, Hirt, Friesach - Hüttenberg area, Carinthia, Austria |
| Annite | |
|---|
| Formula: | KFe2+3(AlSi3O10)(OH)2 |
| Locality: | Kathal Quarry, Kathal, Obdach, Judenburg, Styria, Austria |
|
|
|
|
|
|
|
| Anorthite | |
|---|
| Formula: | CaAl2Si2O8 |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
|
| Anorthite var: Bytownite | |
|---|
| Formula: | (Ca,Na)[Al(Al,Si)Si2O8] |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
|
| Anorthite var: Labradorite | |
|---|
| Formula: | (Ca,Na)[Al(Al,Si)Si2O8] |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
|
| Anorthoclase | |
|---|
| Formula: | (Na,K)AlSi3O8 |
| Localities: | Hematite Mine, Waldenstein, Koralpe, Carinthia, Austria Lavamünd, Koralpe, Carinthia, Austria Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria Hartnerbruch quarry (Hartner-Steinbruch), Schwanberg, Koralpe, Styria, Austria
|
|
|
|
|
|
|
|
| Anthophyllite |  |
|---|
| Formula: | ☐{Mg2}{Mg5}(Si8O22)(OH)2 |
| Localities: | Reported from at least 19 localities in this region. |
|
|
|
|
|
|
| Photo: © . Anthophyllite from Birileiten, Miesling valley, Spitz, Wachau, Lower Austria, Austria |
| Antigorite |  |
|---|
| Formula: | Mg3(Si2O5)(OH)4 |
| Localities: | Reported from at least 30 localities in this region. |
|
|
|
|
|
|
| Photo: Antigorite from Lobminggraben, St Stefan, Kraubath, Leoben, Styria, Austria |
| Antigorite var: Bowenite | |
|---|
| Locality: | Leckbachscharte, Nasenkopf, Habach valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
|
| Antimony | |
|---|
| Formula: | Sb |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
|
| 'Antimony Ochre' | |
|---|
| Localities: | Maltern (Möltern), Hochneukirchen-Gschaidt, Bucklige Welt, Industrieviertel, Lower Austria, Austria Wetterbauergraben, Mixnitz, Frohnleiten, Styria, Austria
|
|
|
|
|
|
|
|
|
| Antlerite |  |
|---|
| Formula: | Cu3(SO4)(OH)4 |
| Localities: | Reported from at least 15 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Antlerite from No. 1 adit, Äußere Wimitz, St Veit an der Glan, Gurktaler Alpen, Carinthia, Austria |
| 'Apatite' |  |
|---|
| Localities: | Reported from at least 283 localities in this region. |
|
|
|
|
|
|
|
| Photo: Apatite from Höllkogel, Alpl, Freßnitzgraben, Krieglach, Fischbacher Alpen, Styria, Austria |
| 'Apatite var: Carbonate-rich Apatite' | |
|---|
| Locality: | Leiterkogel, Habach valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
|
| 'Apatite var: Collophane' | |
|---|
| Locality: | Bregenzerwald, Vorarlberg, Austria |
|
|
|
|
|
|
|
|
| 'Apatite var: Phosphorite' |  |
|---|
| Localities: | Reported from at least 14 localities in this region. |
|
|
|
|
|
|
|
| Photo: Phosphorite from Weinzierlbruck, Grieskirchen, Upper Austria, Austria |
| Aphthitalite | |
|---|
| Formula: | (K,Na)3Na(SO4)2 |
| Locality: | Salt mine, Hall, Innsbruck, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| 'Apophyllite' |  |
|---|
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Photo: Apophyllite from Elfriede tunnel, Zillergrund, Zillertal, North Tyrol, Tyrol, Austria |
| Apophyllite-(KF) |  |
|---|
| Formula: | KCa4(Si8O20)(F,OH) · 8H2O |
| Localities: | Reported from at least 17 localities in this region. |
|
|
|
|
|
|
| Photo: © mslama. Apophyllite-(KF) from Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| Apophyllite-(KOH) | |
|---|
| Formula: | KCa4(Si8O20)(OH,F) · 8H2O |
| Locality: | Hocheck, Eibegggraben, St. Jakob-Breitenau, Fischbacher Alpen, Styria, Austria |
|
|
|
|
|
|
|
| Aragonite |  |
|---|
| Formula: | CaCO3 |
| Localities: | Reported from at least 258 localities in this region. |
|
|
|
|
|
|
| Photo: © O. Dziallas. Aragonite from Daniel adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
| Aragonite var: Flos Ferri |  |
|---|
| Localities: | Reported from at least 29 localities in this region. |
|
|
|
|
|
|
|
| Photo: © Peter Haas. Flos Ferri from Styrian Erzberg, Eisenerz, Styria, Austria |
| Aragonite var: Strontian Aragonite | |
|---|
| Formula: | (Ca,Sr)CO3 |
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| 'Argentiferous Gold' | |
|---|
| Locality: | Zwischenelend glacier, Schwarzhorn, Kleinelend valley, Ankogel group, Hohe Tauern, Carinthia, Austria |
|
|
|
|
|
|
|
|
| Argentojarosite | |
|---|
| Formula: | AgFe3+3(SO4)2(OH)6 |
| Locality: | Stangscharte, Innerkrems, Nock Mts, Gurktaler Alpen, Carinthia, Austria |
|
|
|
|
|
|
|
| Argentopyrite | |
|---|
| Formula: | AgFe2S3 |
| Localities: | Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria Silver mines (Knappenstube), Hochtor area, Seidlwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
| Armalcolite | |
|---|
| Formula: | (Mg,Fe2+)Ti2O5 |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
| 'Arrojadite Group' | |
|---|
| Formula: | A2 E2CaNa2+xM13R (HPO4)1-x(PO4)11W2 |
| Locality: | Faschingbauerkreuz - Reithkogel area (Gießhübler Berg; Gießhübler Holzschlag), Fischbach, Fischbacher Alpen, Styria, Austria |
|
|
|
|
|
|
|
| Arsenbrackebuschite | |
|---|
| Formula: | Pb2Fe3+(AsO4)2(OH) |
| Localities: | Wildfrauengrotte, Teschengraben, Krieglach, Fischbacher Alpen, Styria, Austria Stocker adit, Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Fuchsloch, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria
|
|
|
|
|
|
|
|
| Arsendescloizite |  |
|---|
| Formula: | PbZn(AsO4)(OH) |
| Locality: | Fuchsloch, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Arsendescloizite from Fuchsloch, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| Arsenic |  |
|---|
| Formula: | As |
| Localities: | Reported from at least 17 localities in this region. |
|
|
|
|
|
|
| Photo: © Josef Huber. Arsenic from Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Arseniosiderite |  |
|---|
| Formula: | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| Localities: | Knichte section, Lölling District, Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria Großstroheim quarry (Fuchsmeier quarry), Eferding, Upper Austria, Austria Straßegg (Straßeck), Gasen, Birkfeld, Styria, Austria Pichler adit, Silberberggraben, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria ? (more information)
|
|
|
|
|
|
|
| Photo: © 0. Arseniosiderite from Copper mine, Kohlberg, Pottschach, Ternitz, Industrieviertel, Lower Austria, Austria |
| 'Arsenobismite' | |
|---|
| Localities: | Windischkopf, Große Zirknitz valley, Zirknitz, Goldberg group, Hohe Tauern, Carinthia, Austria Tramerscharte, Große Zirknitz valley, Zirknitz, Goldberg group, Hohe Tauern, Carinthia, Austria
|
|
|
|
|
|
|
|
|
| Arsenogoyazite | |
|---|
| Formula: | SrAl3(AsO4)2(OH)5 · H2O |
| Locality: | Lucknerhaus (Neues Lucknerhaus; Lucknerhaus Ost), Ködnitz valley, Kals valley, East Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Arsenolamprite ? | |
|---|
| Formula: | As |
| Locality: | Samer, Kothgraben (Kotgraben), Kleinfeistritz, Stubalpe, Styria, Austria - erroneously reported |
|
|
|
|
|
|
|
| Arsenolite | |
|---|
| Formula: | As2O3 |
| Localities: | Reported from at least 20 localities in this region. |
|
|
|
|
|
|
|
| Arsenopyrite |  |
|---|
| Formula: | FeAsS |
| Localities: | Reported from at least 256 localities in this region. |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Arsenopyrite from Rotgülden, Murwinkel, Lungau, Salzburg, Austria |
| Arthurite | |
|---|
| Formula: | CuFe3+2(AsO4,PO4,SO4)2(OH,O)2 · 4H2O |
| Locality: | Grillenberg, Payerbach, Industrieviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| Artinite |  |
|---|
| Formula: | Mg2(CO3)(OH)2 · 3H2O |
| Localities: | Lobminggraben, St Stefan, Kraubath, Leoben, Styria, Austria Gulsen, Kraubath, Leoben, Styria, Austria Serpentinite outcrop, Eibegggraben, St. Jakob-Breitenau, Fischbacher Alpen, Styria, Austria Kraubath, Leoben, Styria, Austria
|
|
|
|
|
|
|
| Photo: © 0. Artinite from Gulsen, Kraubath, Leoben, Styria, Austria |
| 'Asbestos' |  |
|---|
| Localities: | Reported from at least 15 localities in this region. |
|
|
|
|
|
|
|
| Photo: Asbestos from Bachlenke, Defereggen valley, East Tyrol, Tyrol, Austria |
| Asbolane |  |
|---|
| Formula: | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Asbolane from Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria |
| Aschamalmite (TL) |  |
|---|
| Formula: | Pb6Bi2S9 |
| Type Locality: | Ascham Alp - southeast of, Ascham Alp - Breitfuß - Sonntagskopf area, Untersulzbach valley, Hohe Tauern, Salzburg, Austria |
| Reference: | Neues Jahrb.Min.,Mh.(1983) 433-444 |
| Localities: | Recorded from at least 8 other localities in this region. |
|
|
|
|
| Photo: © mslama. Aschamalmite from Nasenkopf, Habach valley, Hohe Tauern, Salzburg, Austria |
| 'Asphaltum' |  |
|---|
| Localities: | Reported from at least 21 localities in this region. |
|
|
|
|
|
|
|
| Photo: © neschen. Asphaltum from Farm Eichner, St. Ulrich bei Steyr, Steyr-Land, Upper Austria, Austria |
| Aspidolite | |
|---|
| Formula: | NaMg3(AlSi3O10)(OH)2 |
| Locality: | Zillertal, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Atacamite |  |
|---|
| Formula: | Cu2(OH)3Cl |
| Localities: | Haagen mine, Webing, Abtenau, Salzburg, Austria Stocker adit, Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Atacamite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Augelite |  |
|---|
| Formula: | Al2(PO4)(OH)3 |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Augelite from Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
| Augite |  |
|---|
| Formula: | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Localities: | Reported from at least 17 localities in this region. |
|
|
|
|
|
|
| Photo: © D.Preite - M.C.. Augite from Söllnkar, Krimmler Ache valley, Hohe Tauern, Salzburg, Austria |
| Augite var: Fassaite | |
|---|
| Localities: | Mitterbachgraben, Gansbach, Dunkelsteinerwald, Dunkelstein Forest, Mostviertel, Lower Austria, Austria Serpentinite outcrops, St Leonhard am Hornerwald, Waldviertel, Lower Austria, Austria Milk opal occurrence, Dürrenberg (Dürnberg), St Leonhard am Hornerwald, Waldviertel, Lower Austria, Austria Marble quarry, Twimberg, Koralpe, Carinthia, Austria ? (more information)
|
|
|
|
|
|
|
|
|
| Augite var: Titanian Augite | |
|---|
| Formula: | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Localities: | Diabase quarry, Biberg (Bieberg), Saalfelden, Salzburg, Austria Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria
|
|
|
|
|
|
|
|
| Aurichalcite |  |
|---|
| Formula: | (Zn,Cu)5(CO3)2(OH)6 |
| Localities: | Reported from at least 54 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Aurichalcite from Barbara adit, Meiselding, St Veit an der Glan, Gurktaler Alpen, Carinthia, Austria |
| Austinite | |
|---|
| Formula: | CaZn(AsO4)(OH) |
| Locality: | Slag localities, Kolm-Saigurn, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Autunite |  |
|---|
| Formula: | Ca(UO2)2(PO4)2 · 11H2O |
| Localities: | Reported from at least 22 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Autunite from Uranium occurrence, Prinzkogel, Rettenegg, Fischbacher Alpen, Styria, Austria |
| Awaruite | |
|---|
| Formula: | Ni3Fe |
| Localities: | Serpentinite quarry, Griesserhof (Gulitzen; Gullitzen), Hirt, Friesach - Hüttenberg area, Carinthia, Austria Kraubath, Leoben, Styria, Austria S35 motorway tunnel (Kirchdorf tunnel), Kirchdorf, Frohnleiten, Styria, Austria Preg, Kraubath, Leoben, Styria, Austria ? (more information)
|
|
|
|
|
|
|
|
| Axinite-(Fe) |  |
|---|
| Formula: | Ca2Fe2+Al2BSi4O15OH |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
| Photo: Axinite-(Fe) from Hocharn, Grieswies - Krumlkeeskopf area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| 'Axinite Group' |  |
|---|
| Localities: | Reported from at least 18 localities in this region. |
|
|
|
|
|
|
|
| Photo: © Gerd Stefanik. Axinite Group from Hocharn, Grieswies - Krumlkeeskopf area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| Axinite-(Mg) | |
|---|
| Formula: | Ca2MgAl2BSi4O15OH |
| Locality: | Schwallenbach, Spitz, Wachau, Lower Austria, Austria |
|
|
|
|
|
|
|
| Azurite |  |
|---|
| Formula: | Cu3(CO3)2(OH)2 |
| Localities: | Reported from at least 228 localities in this region. |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried . Azurite from Flirsch ski hut, Flirsch, Stanz valley, North Tyrol, Tyrol, Austria |
| Babingtonite |  |
|---|
| Formula: | Ca2(Fe,Mn)FeSi5O14(OH) |
| Localities: | Bodenhütte, Großer Speikkogel - Steinschneider area, Koralpe, Carinthia, Austria Seebach valley, Ankogel group, Hohe Tauern, Carinthia, Austria Krummer See (Krumpsee), St Leonhard, Pitz valley, North Tyrol, Tyrol, Austria Krennkogel, Großer Speikkogel - Steinschneider area, Koralpe, Carinthia, Austria ? (more information)
|
|
|
|
|
|
|
| Photo: © Walter Hajek. Babingtonite from Krummer See, St Leonhard, Pitz valley, North Tyrol, Tyrol, Austria |
| Baddeleyite | |
|---|
| Formula: | ZrO2 |
| Localities: | Tyrol, Austria Stubenberg Quarry, Stubenberg am See, Weiz, Styria, Austria
|
|
|
|
|
|
|
|
| Baileychlore |  |
|---|
| Formula: | (Zn,Fe,Al,Mg)6((Si,Al)4O10)(OH)8 |
| Locality: | Malaschofsky Quarry, Lichtenau im Waldviertel, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
| Photo: © mslama. Baileychlore from Malaschofsky Quarry, Lichtenau im Waldviertel, Waldviertel, Lower Austria, Austria |
| Balkanite | |
|---|
| Formula: | Cu9Ag5HgS8 |
| Localities: | Erasmus adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria Röhrerbühel (Rohrer Berg; Röhrerbichel; Rerobichl), Fieberbrunn, Kitzbühel Alps, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| Bariopharmacosiderite |  |
|---|
| Formula: | Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Bariopharmacosiderite from Ödenkar, Kreuzkogel massif, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria |
| Barroisite | |
|---|
| Formula: | ☐{CaNa}{Mg3Al2}(AlSi7O22)(OH)2 |
| Locality: | Großer Margrötzenkopf south slope, Hochtor area, Glockner group, Hohe Tauern, Carinthia, Austria |
|
|
|
|
|
|
|
| Barstowite | |
|---|
| Formula: | Pb4Cl6(CO3) · H2O |
| Locality: | Slag locality, St Gertraudi, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Baryte |  |
|---|
| Formula: | BaSO4 |
| Localities: | Reported from at least 300 localities in this region. |
|
|
|
|
|
|
| Photo: © F.Schreiber. Baryte from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Baryte var: Strontian Baryte | |
|---|
| Localities: | Färbergraben, Werfen, Salzburg, Austria Höllgraben, Pfarrwerfen, Werfen, Salzburg, Austria Zwieselbad, Annaberg, Abtenau, Salzburg, Austria
|
|
|
|
|
|
|
|
|
| Barytocalcite ? | |
|---|
| Formula: | BaCa(CO3)2 |
| Locality: | Nassereith, Imst - Nassereith District, North Tyrol, Tyrol, Austria - erroneously reported |
|
|
|
|
|
|
|
| 'Basaltic Hornblende' | |
|---|
| Locality: | Oberpullendorf, Burgenland, Austria |
|
|
|
|
|
|
|
|
| Bassanite | |
|---|
| Formula: | CaSO4 · 0.5H2O |
| Localities: | Gypsum mine (Moldan mine), Moosegg, Grubach, Golling, Salzburg, Austria Haagen mine, Webing, Abtenau, Salzburg, Austria Pöttsching, Mattersburg, Burgenland, Austria
|
|
|
|
|
|
|
|
| 'Bastnäsite' | |
|---|
| Localities: | Kaiserer quarry (Deisl quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Lohning quarry (Lohninger quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
|
| Bastnäsite-(Ce) |  |
|---|
| Formula: | (Ce,La)(CO3)F |
| Locality: | Schlossberg Quarry, Schlossberg, Gloggnitz, Industrieviertel, Lower Austria, Austria |
|
|
|
|
|
|
| Photo: © AC. Bastnäsite-(Ce) from Schlossberg Quarry, Schlossberg, Gloggnitz, Industrieviertel, Lower Austria, Austria |
| Baumhauerite |  |
|---|
| Formula: | Pb12As16S36 |
| Localities: | Gypsum mine (Moldan mine), Moosegg, Grubach, Golling, Salzburg, Austria Haringgraben, Oberort-Tragöß, Laming valley, Bruck an der Mur, Styria, Austria ? (more information)
|
|
|
|
|
|
|
| Photo: © . Baumhauerite from Gypsum mine, Moosegg, Grubach, Golling, Salzburg, Austria |
| 'Bauxite' |  |
|---|
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
|
| Photo: Bauxite from Gräser bauxite mine, Weißwasser, Reichraminger Hintergebirge, Kirchdorf an der Krems, Upper Austria, Austria |
| Bavenite |  |
|---|
| Formula: | Ca4Be2Al2Si9O26(OH)2 |
| Localities: | Reported from at least 54 localities in this region. |
|
|
|
|
|
|
| Photo: © mslama. Bavenite from Breitfuß - Großer Finagl area, Habach valley, Hohe Tauern, Salzburg, Austria |
| Bayldonite |  |
|---|
| Formula: | PbCu3(AsO4)2(OH)2 |
| Localities: | Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria Fuchsloch, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Slag localities, Kolm-Saigurn, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Adit No. 197, West slope ("Am Geyer"), Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Martin adit, Weißer Schrofen, Ringenwechsel District, Schwaz, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
| Photo: © AL. Bayldonite from Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria |
| Bazzite |  |
|---|
| Formula: | Be3Sc2(Si6O18) |
| Locality: | Gjaidtroghöhe, Große Fleiß valley, Goldberg group, Hohe Tauern, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Rob Lavinsky. Bazzite from Gjaidtroghöhe, Große Fleiß valley, Goldberg group, Hohe Tauern, Carinthia, Austria |
| Bearthite |  |
|---|
| Formula: | Ca2Al(PO4)2(OH) |
| Localities: | Rotriegel ridge, Freßnitzgraben, Krieglach, Fischbacher Alpen, Styria, Austria Ganz valley, Hönigsberg, Mürzzuschlag, Fischbacher Alpen, Styria, Austria Höllkogel, Alpl, Freßnitzgraben, Krieglach, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
| Photo: Bearthite from Rotriegel ridge, Freßnitzgraben, Krieglach, Fischbacher Alpen, Styria, Austria |
| Beaverite-(Cu) |  |
|---|
| Formula: | Pb(Fe3+,Cu)3(SO4)2(OH)6 |
| Localities: | Slag localities, Kolm-Saigurn, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Slag localities, St Martin am Silberberg, Friesach - Hüttenberg area, Carinthia, Austria Stüblbau Mine, Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria Quartz quarry, Wolfsgruben (Wolfgruben), Seiz, Liesing - Palten valley, Styria, Austria Eschach Alp (Eschachboden; Martinlager), Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria
|
|
|
|
|
|
|
| Photo: © 0. Beaverite-(Cu) from Stüblbau Mine, Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria |
| Becquerelite | |
|---|
| Formula: | Ca(UO2)6O4(OH)6 · 8H2O |
| Localities: | Anna adit, Mitterberg District, St Johann im Pongau, Salzburg, Austria Mitterberg District, St Johann im Pongau, Salzburg, Austria
|
|
|
|
|
|
|
|
| Benjaminite | |
|---|
| Formula: | (Ag,Cu)3(Bi,Pb)7S12 |
| Localities: | Waschgang Mine, Kluidscharte, Kleine Zirknitz valley, Zirknitz, Goldberg group, Hohe Tauern, Carinthia, Austria Erzwies area, Gastein valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
| Benleonardite | |
|---|
| Formula: | Ag8(Sb,As)Te2S3 |
| Localities: | Straßegg (Straßeck), Gasen, Birkfeld, Styria, Austria Schurfspitze, Rotgülden, Murwinkel, Lungau, Salzburg, Austria
|
|
|
|
|
|
|
|
| Beraunite | |
|---|
| Formula: | Fe2+Fe3+5(PO4)4(OH)5 · 4H2O |
| Localities: | Styrian Erzberg, Eisenerz, Styria, Austria Ebenlecker farm (Ebenlöcker farm), Herzogberg, Modriach, Koralpe, Styria, Austria Brandberg, Leoben, Styria, Austria
|
|
|
|
|
|
|
|
| Berthierite |  |
|---|
| Formula: | FeSb2S4 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Berthierite from Sb deposit, Leßnig, Möllbrücke, Kreuzeck group, Carinthia, Austria |
| Bertrandite |  |
|---|
| Formula: | Be4(Si2O7)(OH)2 |
| Localities: | Reported from at least 52 localities in this region. |
|
|
|
|
|
|
| Photo: © mslama. Bertrandite from Miesling valley, Spitz, Wachau, Lower Austria, Austria |
| Beryl |  |
|---|
| Formula: | Be3Al2(Si6O18) |
| Localities: | Reported from at least 86 localities in this region. |
|
|
|
|
|
|
| Photo: Beryl from Pegmatite outcrops, St Radegund, Graz, Styria, Austria |
| Beryl var: Aquamarine |  |
|---|
| Formula: | Be3Al2Si6O18 |
| Localities: | Reported from at least 58 localities in this region. |
|
|
|
|
|
|
| Photo: © Harjo. Aquamarine from Emerald deposit, Leckbachgraben, Nasenkopf, Habach Valley, Hohe Tauern, Salzburg, Austria |
| Beryl var: Emerald |  |
|---|
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
|
| Photo: © Harjo. Emerald from Emerald deposit, Leckbachgraben, Nasenkopf, Habach Valley, Hohe Tauern, Salzburg, Austria |
| Beryl var: Goshenite | |
|---|
| Locality: | Zissingdorf, Neumarkt im Mühlkreis, Freistadt, Mühlviertel, Upper Austria, Austria |
|
|
|
|
|
|
|
|
| Berzelianite | |
|---|
| Formula: | Cu2Se |
| Locality: | Selenide occurrence, Eselberg, Altenberg an der Rax, Neuberg an der Mürz, Styria, Austria |
|
|
|
|
|
|
|
| β-Uranophane |  |
|---|
| Formula: | Ca(UO2)2(HSiO4)2 · 5H2O |
| Localities: | Feldspar quarry, Laas, Fresach, Millstatt lake ridge, Carinthia, Austria Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria Pasel adit, Radhausberg, Kreuzkogel massif, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
| Photo: © Volker Betz. β-Uranophane from Pasel adit, Radhausberg, Kreuzkogel massif, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria |
| Betekhtinite | |
|---|
| Formula: | Pb2(Cu,Fe)21S15 |
| Localities: | Erasmus adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria Haagen mine, Webing, Abtenau, Salzburg, Austria
|
|
|
|
|
|
|
|
| 'Betpakdalite Group' | |
|---|
| Locality: | Alte Zeche Mine, Schwazer Eisenstein, Arzberg, Schwaz, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
|
| Beudantite |  |
|---|
| Formula: | PbFe3(AsO4)(SO4)(OH)6 |
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Beudantite from Wildfrauengrotte, Teschengraben, Krieglach, Fischbacher Alpen, Styria, Austria |
| Beyerite | |
|---|
| Formula: | Ca(BiO)2(CO3)2 |
| Localities: | Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria Upper Leckbachgraben, Leckbachgraben (Leckbachrinne), Nasenkopf, Habach valley, Hohe Tauern, Salzburg, Austria Sedl, Leckbachgraben (Leckbachrinne), Nasenkopf, Habach valley, Hohe Tauern, Salzburg, Austria Ödenkar, Kreuzkogel massif, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria Bärenbad Mine (Bärnbad Mine), Scharnbachgraben, Hollersbach valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
| Bianchite | |
|---|
| Formula: | (Zn,Fe)SO4 · 6H2O |
| Locality: | Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
|
|
|
|
|
|
|
| Bieberite | |
|---|
| Formula: | CoSO4 · 7H2O |
| Localities: | Slag localities, Kolm-Saigurn, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria
Leogang, Saalfelden, Salzburg, Austria (more information)
|
|
|
|
|
|
|
|
| 'Biotite' |  |
|---|
| Localities: | Reported from at least 115 localities in this region. |
|
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Biotite from Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
| 'Biotite var: Anomite' | |
|---|
| Localities: | Straß im Straßertale, Waldviertel, Lower Austria, Austria Kleinheinrichschlag, Albrechtsberg an der Großen Krems, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
|
| Birnessite | |
|---|
| Formula: | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Localities: | Strubberg mines (incl. Sattelberg; Strubbergsattel; Unterberg), Tennen Mts, Abtenau, Salzburg, Austria Fe deposit, Grassendorf, Tauchendorf, St Veit an der Glan, Gurktaler Alpen, Carinthia, Austria Aldrian quarry, Lieschengraben, Oberhaag, Styria, Austria
|
|
|
|
|
|
|
|
| Bismite |  |
|---|
| Formula: | Bi2O3 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
| Photo: © Simone Citon. Bismite from Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Bismuth |  |
|---|
| Formula: | Bi |
| Localities: | Reported from at least 45 localities in this region. |
|
|
|
|
|
|
| Photo: © AL. Bismuth from Arsenic mine, Lower Rotgülden lake, Rotgülden, Murwinkel, Lungau, Salzburg, Austria |
| Bismuthinite |  |
|---|
| Formula: | Bi2S3 |
| Localities: | Reported from at least 62 localities in this region. |
|
|
|
|
|
|
| Photo: © AL. Bismuthinite from Siglitz adit, Siglitz - Bockhart Gold Mining District, Siglitz - Bockhart area, Gastein valley, Hohe Tauern, Salzburg, Austria |
| 'Bismuth Ochre' | |
|---|
| Locality: | Glücksgrat, Habicht, Unterberg valley, Stubai valley, Sill valley (Wipp valley), North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
|
| Bismutite | |
|---|
| Formula: | (BiO)2CO3 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Bismutohauchecornite ? | |
|---|
| Formula: | Ni9Bi2S8 |
| Locality: | S35 motorway tunnel (Kirchdorf tunnel), Kirchdorf, Frohnleiten, Styria, Austria - erroneously reported |
|
|
|
|
|
|
|
| 'Bitumen' | |
|---|
| Locality: | Haushumpl, Södingberg, Voitsberg, Köflach, Styria, Austria |
|
|
|
|
|
|
|
|
| Bixbyite | |
|---|
| Formula: | Mn3+2O3 |
| Localities: | Goldzechkopf, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Goldzeche, Zirmsee area, Kleine Fleiß valley, Goldberg group, Hohe Tauern, Carinthia, Austria Goldzechscharte (Goldzechkopfscharte), Zirmsee area, Kleine Fleiß valley, Goldberg group, Hohe Tauern, Carinthia, Austria ? (more information)
|
|
|
|
|
|
|
|
| Bjarebyite | |
|---|
| Formula: | (Ba,Sr)(Mn2+,Fe2+,Mg)2Al2(PO4)3(OH)3 |
| Locality: | Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria |
|
|
|
|
|
|
|
| 'Blaubleibender Covellite' | |
|---|
| Localities: | Flirsch ski hut, Flirsch, Stanz valley, North Tyrol, Tyrol, Austria Glücksgrat, Habicht, Unterberg valley, Stubai valley, Sill valley (Wipp valley), North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
|
| Blödite (TL) |  |
|---|
| Formula: | Na2Mg(SO4)2 · 4H2O |
| Type Locality: | Ischler Salzberg, Perneck, Bad Ischl, Gmunden, Upper Austria, Austria |
| Reference: | Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 449; Canadian Mineralogist (1985): 23: 669. |
| Localities: | Recorded from at least 7 other localities in this region. |
|
|
|
|
| Photo: © . Blödite from Salt mine, Hallstatt, Gmunden, Upper Austria, Austria |
| Böhmite | |
|---|
| Formula: | AlO(OH) |
| Localities: | Bauxite Mine, Glanegg, Untersberg massif, Salzburg, Salzburg, Austria Salzburg shaft, Untersberg massif, Salzburg, Salzburg, Austria Marchgraben, Dreistetten, Markt Piesting, Industrieviertel, Lower Austria, Austria Gräser bauxite mine, Weißwasser, Reichraminger Hintergebirge, Kirchdorf an der Krems, Upper Austria, Austria Prefing bauxite mine, Weißwasser, Reichraminger Hintergebirge, Kirchdorf an der Krems, Upper Austria, Austria
|
|
|
|
|
|
|
|
| 'Bolivarite' | |
|---|
| Formula: | Al2(PO4)(OH)3 · 4-5H2O |
| Locality: | Brandberg, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| 'Borickyite' | |
|---|
| Formula: | (Ca,Mg)(Fe3+,Al)4(PO4,SO4,CO3)2(OH)8 · 3-7.5H2O |
| Locality: | Brandberg, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Bornite |  |
|---|
| Formula: | Cu5FeS4 |
| Localities: | Reported from at least 107 localities in this region. |
|
|
|
|
|
|
| Photo: © Franz Brandstätter & Uwe Kolitsch. Bornite from Diabase quarry, Nötsch im Gailtal, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Botallackite | |
|---|
| Formula: | Cu2(OH)3Cl |
| Locality: | Gratlspitz, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Botryogen | |
|---|
| Formula: | MgFe3+(SO4)2(OH) · 7H2O |
| Locality: | Panzendorf, Sillian, Puster valley, East Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Boulangerite |  |
|---|
| Formula: | Pb5Sb4S11 |
| Localities: | Reported from at least 37 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Boulangerite from Straßegg, Gasen, Birkfeld, Styria, Austria |
| Bournonite |  |
|---|
| Formula: | PbCuSbS3 |
| Localities: | Reported from at least 67 localities in this region. |
|
|
|
|
|
|
| Photo: © Don Volkman 02/06. Bournonite from Alte Zeche Mine, Schwazer Eisenstein, Arzberg, Schwaz, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| Bowieite | |
|---|
| Formula: | (Rh,Ir,Pt)2S3 |
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Braggite | |
|---|
| Formula: | (Pt,Pd,Ni)S |
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Brannerite |  |
|---|
| Formula: | (U4+,REE,Th,Ca)(Ti,Fe3+,Nb)2(O,OH)6 |
| Localities: | Reported from at least 22 localities in this region. |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Brannerite from Power station, Sportgastein, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria |
| 'Braun-Eisenstein' | |
|---|
| Locality: | Schwarzenegg Alp, Hüttau, Radstadt, Salzburg, Austria |
|
|
|
|
|
|
|
|
| 'Brauner Glaskopf' |  |
|---|
| Localities: | Erzkogel, Semmering, Industrieviertel, Lower Austria, Austria Zottlhof, Hafning, Wartmannstetten, Industrieviertel, Lower Austria, Austria Arzberg am Semmering, Fröschnitz valley (Fröschnitz), Steinhaus am Semmering, Spital am Semmering, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
|
| Photo: © . Brauner Glaskopf from Brandberg, Leoben, Styria, Austria |
| Braunite |  |
|---|
| Formula: | Mn2+Mn3+6(SiO4)O8 |
| Localities: | Reported from at least 11 localities in this region. |
|
|
|
|
|
|
| Photo: © Franz Brandstätter & Uwe Kolitsch. Braunite from Huteralm, Ködnitz valley, Kals valley, East Tyrol, Tyrol, Austria |
| 'Braunspat' |  |
|---|
| Localities: | Arzberg am Semmering, Fröschnitz valley (Fröschnitz), Steinhaus am Semmering, Spital am Semmering, Fischbacher Alpen, Styria, Austria Danube power station, Abwinden, Perg, Mühlviertel, Upper Austria, Austria Danube power station, Asten, Linz-Land, Upper Austria, Austria Traun river dam (Traun power plant), Pucking, Traun, Linz-Land, Upper Austria, Austria
|
|
|
|
|
|
|
|
| Photo: © neschen. Braunspat from Traun river dam, Pucking, Traun, Linz-Land, Upper Austria, Austria |
| 'Braunstein' | |
|---|
| Locality: | Mieskar (Glöcklalm; Glöcklalpe; Zaglbaueralm), Bodinggraben, Molln, Kirchdorf an der Krems, Upper Austria, Austria |
|
|
|
|
|
|
|
|
| Brazilianite |  |
|---|
| Formula: | NaAl3(PO4)2(OH)4 |
| Localities: | A10 Highway tunnel, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria Hahnenkofel, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria Hochgosch, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © hamster@aon.at. Brazilianite from Hahnenkofel, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
| Breithauptite | |
|---|
| Formula: | NiSb |
| Localities: | Kraubath, Leoben, Styria, Austria Schwemmberg (Roßbrand), Radstadt, Salzburg, Austria Zinkwand, Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria Arzberg, Weiz, Styria, Austria S35 motorway tunnel (Kirchdorf tunnel), Kirchdorf, Frohnleiten, Styria, Austria
|
|
|
|
|
|
|
|
| Brianyoungite | |
|---|
| Formula: | Zn3(CO3,SO4)(OH)4 |
| Localities: | West slope ("Am Geyer"), Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Thayabach valley, Teufenbach, Murau, Styria, Austria
|
|
|
|
|
|
|
|
| Brochantite |  |
|---|
| Formula: | Cu4(SO4)(OH)6 |
| Localities: | Reported from at least 90 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Brochantite from Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria |
| Brookite |  |
|---|
| Formula: | TiO2 |
| Localities: | Reported from at least 84 localities in this region. |
|
|
|
|
|
|
| Photo: © Chinellato Matteo. Brookite from Hopffeldboden, Hopffeld area, Obersulzbach valley, Hohe Tauern, Salzburg, Austria |
| Brownmillerite | |
|---|
| Formula: | Ca2(Al,Fe3+)2O5 |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
| Brucite |  |
|---|
| Formula: | Mg(OH)2 |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
| Photo: © . Brucite from Gulsen, Kraubath, Leoben, Styria, Austria |
| 'Brugnatellite' | |
|---|
| Formula: | Mg6Fe3+(CO3)(OH)13 · 4H2O |
| Localities: | Preg, Kraubath, Leoben, Styria, Austria Serpentinite outcrop, Eibegggraben, St. Jakob-Breitenau, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
|
| Brushite |  |
|---|
| Formula: | Ca(HPO4) · 2H2O |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Brushite from Kleinelend glacier, Kleinelend valley, Ankogel group, Hohe Tauern, Carinthia, Austria |
| Bukovskýite |  |
|---|
| Formula: | Fe3+2(AsO4)(SO4)(OH) · 9H2O |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Bukovskýite from Aloisi adit, Arsenic mine, Lanisch, Pölla valley, Hafner group, Hohe Tauern, Carinthia, Austria |
| Burangaite |  |
|---|
| Formula: | NaFe2+Al5(PO4)4(OH)6 · 2H2O |
| Localities: | Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria
Hochgosch, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria (more information)
|
|
|
|
|
|
|
| Photo: © AC. Burangaite from Millstatt lake ridge, Carinthia, Austria |
| 'Bursaite' | |
|---|
| Formula: | Pb5Bi4S11 (?) |
| Locality: | Gehr Alp - Gehrwand area, Scharnbachgraben, Hollersbach valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| 'Buserite' | |
|---|
| Formula: | Na4Mn14O27 · 21H2O |
| Locality: | Marble quarry (Bürgergilt quarry; Bürgergilde quarry), Olsa, Friesach, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
| Bustamite | |
|---|
| Formula: | CaMn2+(Si2O6) |
| Locality: | Mooser dam, Mooserboden reservoir, Kaprun valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Cacoxenite |  |
|---|
| Formula: | Fe3+24Al(PO4)17O6(OH)12 · 17H2O |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Cacoxenite from Höllkogel, Alpl, Freßnitzgraben, Krieglach, Fischbacher Alpen, Styria, Austria |
| 'Calamine' | |
|---|
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
|
|
| Calaverite | |
|---|
| Formula: | AuTe2 |
| Locality: | Anna adit, Mitterberg District, St Johann im Pongau, Salzburg, Austria |
|
|
|
|
|
|
|
| 'Calcareous Tufa' | |
|---|
| Locality: | Grossauer Quarry, Reichraming, Steyr-Land, Upper Austria, Austria |
|
|
|
|
|
|
|
|
| 'Calcioancylite' | |
|---|
| Locality: | A2 Highway tunnel, Kalcherkogel, Packsattel, Koralpe, Carinthia, Austria |
|
|
|
|
|
|
|
|
| 'Calciorhodochrosite' | |
|---|
| Locality: | Pippengraben, Lofer, Unken, Salzburg, Austria |
|
|
|
|
|
|
|
|
| Calcite |  |
|---|
| Formula: | CaCO3 |
| Localities: | Reported from at least 887 localities in this region. |
|
|
|
|
|
|
| Photo: © O. Dziallas. Calcite from Hopffeldboden, Hopffeld area, Obersulzbach valley, Hohe Tauern, Salzburg, Austria |
| Calcite var: Iceland Spar | |
|---|
| Locality: | Eibenstein an der Thaya, Raabs an der Thaya, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
|
| Calcite var: Lublinite |  |
|---|
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
|
| Photo: © Simone Citon. Lublinite from Lohning quarry, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| Calcite var: Manganoan Calcite | |
|---|
| Formula: | (Ca,Mn)CO3 |
| Localities: | Martis Mine, Ratteingraben, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria Molybdenum adit, Hotel Europe, Bad Gastein, Gastein valley, Hohe Tauern, Salzburg, Austria Felixbau Mine, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria Navis stream, Navis valley, Sill valley (Wipp valley), North Tyrol, Tyrol, Austria Schwarzenbach marble quarry (Oberpetersdorf marble quarry), Auwiesenbach valley, Sieggraben, Mattersburg, Burgenland, Austria
|
|
|
|
|
|
|
|
| Calcite var: Plumboan Calcite |  |
|---|
| Formula: | (Ca,Pb)CO3 |
| Localities: | Stefanie Mine, Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria Dirstentritt, Nassereith, Imst - Nassereith District, North Tyrol, Tyrol, Austria Alpleskopf, Nassereith, Imst - Nassereith District, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
| Photo: Plumboan Calcite from Stefanie Mine, Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Calcite var: Strontian Calcite | |
|---|
| Formula: | (Ca,Sr)CO3 |
| Locality: | Oberzeiring, Pöls valley, Niedere Tauern, Styria, Austria |
|
|
|
|
|
|
|
| Calcite var: Travertine | |
|---|
| Formula: | CaCO3 |
| Locality: | Maria Buch, Judenburg, Styria, Austria |
|
|
|
|
|
|
|
| 'Calcite Group' |  |
|---|
| Formula: | AXO3 |
| Localities: | Krahbergzinken, Schladminger Tauern, Schladming, Styria, Austria Ködnitz valley, Kals valley, East Tyrol, Tyrol, Austria Calc-silicate occurrence, Zintring, Maria Laach am Jauerling, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
| Photo: © neschen. Calcite Group from Italienerloch, Wurzeralm, Spital am Pyhrn, Kirchdorf an der Krems, Upper Austria, Austria |
| Calderónite |  |
|---|
| Formula: | Pb2Fe3+(VO4)2(OH) |
| Locality: | Nepomuk Mine, Galmeikogel, Annaberg, Mostviertel, Lower Austria, Austria |
|
|
|
|
|
|
| Photo: © AC. Calderónite from Nepomuk Mine, Galmeikogel, Annaberg, Mostviertel, Lower Austria, Austria |
| Caledonite |  |
|---|
| Formula: | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
| Photo: © AL. Caledonite from Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria |
| Callaghanite |  |
|---|
| Formula: | Cu2Mg2(CO3)(OH)6 · 2H2O |
| Localities: | Lobminggraben, St Stefan, Kraubath, Leoben, Styria, Austria Montanwerke Brixlegg (slag locality), Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
| Photo: © 0. Callaghanite from Lobminggraben, St Stefan, Kraubath, Leoben, Styria, Austria |
| Calumetite | |
|---|
| Formula: | Cu(OH,Cl)2 · 2H2O |
| Locality: | Gratlspitz, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Camerolaite |  |
|---|
| Formula: | Cu4Al2(HSbO4,SO4)(CO3)(OH)10 · 2H2O |
| Locality: | Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Franz Neuhold. Camerolaite from Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria |
| Canfieldite var: Tellurian Canfieldite | |
|---|
| Formula: | Ag8(Sn,Ge)(S,Te)6 |
| Locality: | Arsenic mine, Lower Rotgülden lake, Rotgülden, Murwinkel, Lungau, Salzburg, Austria |
|
|
|
|
|
|
|
| Cannizzarite | |
|---|
| Formula: | Pb4Bi6S13 |
| Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Cannonite | |
|---|
| Formula: | Bi2(SO4)O(OH)2 |
| Locality: | Unnamed Bi deposit, Kleinelend valley, Ankogel group, Hohe Tauern, Carinthia, Austria |
|
|
|
|
|
|
|
| Carbonatecyanotrichite |  |
|---|
| Formula: | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Localities: | Reported from at least 12 localities in this region. |
|
|
|
|
|
|
| Photo: © AL. Carbonatecyanotrichite from North face, Hoher Sonnblick, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| Carminite | |
|---|
| Formula: | PbFe3+2(AsO4)2(OH)2 |
| Localities: | Kaltenegg, Southern District, Prinzkogel mines, Prinzkogel (Prinzenkogel), Rettenegg, Fischbacher Alpen, Styria, Austria Straßegg (Straßeck), Gasen, Birkfeld, Styria, Austria Sperkerriegel, Wiesmath, Bucklige Welt, Industrieviertel, Lower Austria, Austria ? (more information)
|
|
|
|
|
|
|
|
| Carrollite | |
|---|
| Formula: | Cu(Co,Ni)2S4 |
| Localities: | Lower Glückauf adit, Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria
|
|
|
|
|
|
|
|
| Caryopilite | |
|---|
| Formula: | (Mn,Mg)3(Si2O5)(OH)4 |
| Locality: | Ködnitz valley, Kals valley, East Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Cassiterite |  |
|---|
| Formula: | SnO2 |
| Localities: | Reported from at least 23 localities in this region. |
|
|
|
|
|
|
| Photo: © Uwe Kolitsch and Franz Brandstätter. Cassiterite from Putzkammer Alp, Rinder valley, Verwall group, Montafon, Vorarlberg, Austria |
| Celadonite | |
|---|
| Formula: | K(Mg,Fe2+)Fe3+(Si4O10)(OH)2 |
| Localities: | Pippengraben, Lofer, Unken, Salzburg, Austria Glasenbach gorge, Glasenbach, Salzburg, Salzburg, Austria Sendlberg quarry, Wiestal reservoir, Hallein, Salzburg, Austria Basalt quarry, Kollnitz, St Paul im Lavanttal, Carinthia, Austria ? (more information)
|
|
|
|
|
|
|
|
| Celestine |  |
|---|
| Formula: | SrSO4 |
| Localities: | Reported from at least 57 localities in this region. |
|
|
|
|
|
|
| Photo: Celestine from Magnesite deposit, Oberdorf an der Laming, Laming valley, Bruck an der Mur, Styria, Austria |
| Celestine var: Barian Celestine |  |
|---|
| Formula: | (Sr,Ba)SO4 |
| Localities: | Gigler quarry (Tierpark quarry), Koschach, Malta valley, Hohe Tauern, Carinthia, Austria Irsa quarry (Pflüglhof quarry), Pflüglhof Inn, Koschach, Malta valley, Hohe Tauern, Carinthia, Austria Modre quarry (Svata quarry; Koschach quarry), Koschach, Malta valley, Hohe Tauern, Carinthia, Austria Pfitsch pass, Zamser Grund (Zams valley), Zillertal, North Tyrol, Tyrol, Austria Großer Greiner, Zemmgrund, Zillertal, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
| Photo: © AC. Barian Celestine from Gigler quarry, Koschach, Malta valley, Hohe Tauern, Carinthia, Austria |
| Celsian |  |
|---|
| Formula: | BaAl2Si2O8 |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Celsian from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Cerussite |  |
|---|
| Formula: | PbCO3 |
| Localities: | Reported from at least 228 localities in this region. |
|
|
|
|
|
|
| Photo: © 2001 John H. Betts. Cerussite from Silberleithe, Biberwier, Lechtaler Alpen, North Tyrol, Tyrol, Austria |
| Cervantite | |
|---|
| Formula: | Sb3+Sb5+O4 |
| Localities: | Reported from at least 10 localities in this region. |
|
|
|
|
|
|
|
| Cesàrolite | |
|---|
| Formula: | Pb(Mn4+)3O6(OH)2 |
| Locality: | Arzberg am Semmering, Fröschnitz valley (Fröschnitz), Steinhaus am Semmering, Spital am Semmering, Fischbacher Alpen, Styria, Austria |
|
|
|
|
|
|
|
| 'Chabazite' |  |
|---|
| Localities: | Reported from at least 52 localities in this region. |
|
|
|
|
|
|
|
| Photo: Chabazite from Senning gorge, Hollersbach valley, Hohe Tauern, Salzburg, Austria |
| 'Chabazite var: Phacolite' |  |
|---|
| Localities: | Quarry IV- Southern Area, Loja, Persenbeug-Gottsdorf, Waldviertel, Lower Austria, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria
|
|
|
|
|
|
|
|
| Photo: © AC. Phacolite from Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
| Chabazite-Ca |  |
|---|
| Formula: | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Chabazite-Ca from S35 motorway tunnel, Kirchdorf, Frohnleiten, Styria, Austria |
| Chabazite-K | |
|---|
| Formula: | (K2,Ca,Na2,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| Locality: | Fraßgraben quarry (Gall quarry; Modre quarry), Fraßgraben, Kamp, Koralpe, Carinthia, Austria |
|
|
|
|
|
|
|
| Chalcanthite |  |
|---|
| Formula: | CuSO4 · 5H2O |
| Localities: | Reported from at least 28 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Chalcanthite from Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria |
| Chalcoalumite |  |
|---|
| Formula: | CuAl4(SO4)(OH)12 · 3H2O |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Chalcoalumite from Breitenau Mine, Hochlantsch, St. Jakob-Breitenau, Fischbacher Alpen, Styria, Austria |
| Chalcocite |  |
|---|
| Formula: | Cu2S |
| Localities: | Reported from at least 57 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Chalcocite from Brunngraben district, Cu deposit, Flatschach, Knittelfeld, Styria, Austria |
| Chalconatronite | |
|---|
| Formula: | Na2Cu(CO3)2 · 3H2O |
| Locality: | Zunderwand, Erlacher Bock, Nock Mts, Gurktaler Alpen, Carinthia, Austria |
|
|
|
|
|
|
|
| Chalcophanite |  |
|---|
| Formula: | (Zn,Fe,Mn)Mn3O7 · 3H2O |
| Localities: | Milleiten Mine, Große Zirknitz valley, Zirknitz, Goldberg group, Hohe Tauern, Carinthia, Austria Gamskar, Hoher Göll, Golling, Salzburg, Austria Valentintörl, Podlanig, Lesach valley, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria Strabaleben (Strabeleben), Wurten, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Chalcophanite from Strabaleben, Wurten, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria |
| 'Chalcophanite Group' | |
|---|
| Locality: | Arzberg am Semmering, Fröschnitz valley (Fröschnitz), Steinhaus am Semmering, Spital am Semmering, Fischbacher Alpen, Styria, Austria |
|
|
|
|
|
|
|
|
| Chalcophyllite |  |
|---|
| Formula: | Cu18Al2(SO4)3(AsO4)3(OH)27 · 33H2O |
| Localities: | Reported from at least 19 localities in this region. |
|
|
|
|
|
|
| Photo: © T. Kennedy 2002. Chalcophyllite from Slag dumps, Walchen, Öblarn, Niedere Tauern, Styria, Austria |
| Chalcopyrite |  |
|---|
| Formula: | CuFeS2 |
| Localities: | Reported from at least 590 localities in this region. |
|
|
|
|
|
|
| Photo: Chalcopyrite from Emil adit, Mitterberg District, St Johann im Pongau, Salzburg, Austria |
| Chalcostibite |  |
|---|
| Formula: | CuSbS2 |
| Localities: | Reported from at least 12 localities in this region. |
|
|
|
|
|
|
| Photo: © . Chalcostibite from Gertraud adit, Großkogel, St Gertraudi, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| Chamosite | |
|---|
| Formula: | (Fe2+,Mg)5Al(AlSi3O10)(OH)8 |
| Localities: | Reported from at least 14 localities in this region. |
|
|
|
|
|
|
|
| Chamosite var: Bavalite | |
|---|
| Formula: | (Fe,Mg,Al)6(Si,Al)4O10(OH)8 |
| Locality: | Kamuderkeusche, Stallhofen, Moosburg, Klagenfurt, Carinthia, Austria |
|
|
|
|
|
|
|
| Chamosite var: Thuringite | |
|---|
| Formula: | (Fe,Fe,Mg,Al)6(Si,Al)4O10(O,OH)8 |
| Localities: | Zirmseekar, Zirmsee area, Kleine Fleiß valley, Goldberg group, Hohe Tauern, Carinthia, Austria Antimony mine, Stadtschlaining, Oberwart, Burgenland, Austria ? (more information)
|
|
|
|
|
|
|
|
| Chayesite |  |
|---|
| Formula: | K(Mg,Fe)4FeSi12O30 |
| Locality: | Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
|
|
|
|
|
|
| Photo: © O. Dziallas. Chayesite from Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
| Chenite |  |
|---|
| Formula: | Pb4Cu(SO4)2(OH)6 |
| Localities: | Slag dumps, Walchen, Öblarn, Niedere Tauern, Styria, Austria Slag localities, St Martin am Silberberg, Friesach - Hüttenberg area, Carinthia, Austria Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Chenite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Cheralite |  |
|---|
| Formula: | (Ca,Ce)(Th,Ce)(PO4)2 |
| Localities: | Lambachgraben quarry ("Harterbachgraben" quarry), Hadersdorf, Kindberg, Styria, Austria Windeckberg, Miesling valley, Spitz, Wachau, Lower Austria, Austria ? (more information)
|
|
|
|
|
|
|
| Photo: © . Cheralite from Lambachgraben quarry, Hadersdorf, Kindberg, Styria, Austria |
| 'Cheralite-(Ce)' ? | |
|---|
| Locality: | Stubnerkogel, Böckstein, Gastein valley, Hohe Tauern, Salzburg, Austria - erroneously reported |
|
|
|
|
|
|
|
|
| Chernovite-(Y) | |
|---|
| Formula: | Y(AsO4) |
| Localities: | Kaiserer quarry (Deisl quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Lohning quarry (Lohninger quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
| 'Chert' | |
|---|
| Locality: | Spannagel cave, Hintertux glacier, Tux valley, Zillertal, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
|
| Childrenite |  |
|---|
| Formula: | (Fe2+,Mn2+)Al(PO4)(OH)2 · H2O |
| Localities: | Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria Hahnenkofel, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © 0. Childrenite from Hahnenkofel, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
| Chlorapatite | |
|---|
| Formula: | Ca5(PO4)3Cl |
| Localities: | Höllkogel, Alpl, Freßnitzgraben, Krieglach, Fischbacher Alpen, Styria, Austria Granegg, Freßnitzgraben, Krieglach, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
|
| Chlorargyrite | |
|---|
| Formula: | AgCl |
| Localities: | Stocker adit, Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Hocheck Mine, Annaberg, Mostviertel, Lower Austria, Austria ? (more information)
|
|
|
|
|
|
|
|
| 'Chlorite Group' |  |
|---|
| Localities: | Reported from at least 373 localities in this region. |
|
|
|
|
|
|
|
| Photo: © Antonio Borrelli. Chlorite Group from Zillertal, North Tyrol, Tyrol, Austria |
| Chloritoid | |
|---|
| Formula: | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Localities: | Reported from at least 18 localities in this region. |
|
|
|
|
|
|
|
| Chondrodite | |
|---|
| Formula: | (Mg,Fe2+)5(SiO4)2(F,OH)2 |
| Locality: | Umbal falls, Islitz Alp, Umbal valley, Virgen valley, East Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Chromatite | |
|---|
| Formula: | Ca[CrO4] |
| Locality: | Stefanie Mine, Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
|
|
|
|
|
|
|
| Chromite |  |
|---|
| Formula: | Fe2+Cr3+2O4 |
| Localities: | Reported from at least 26 localities in this region. |
|
|
|
|
|
|
| Photo: Chromite from Sommergraben, Kraubath, Leoben, Styria, Austria |
| Chrysoberyl |  |
|---|
| Formula: | BeAl2O4 |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © mslama. Chrysoberyl from Miesling valley, Spitz, Wachau, Lower Austria, Austria |
| Chrysocolla |  |
|---|
| Formula: | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O (x < 1) |
| Localities: | Reported from at least 37 localities in this region. |
|
|
|
|
|
|
| Photo: Chrysocolla from Holler quarry, Badersdorf, Großpetersdorf, Burgenland, Austria |
| Chrysotile | |
|---|
| Formula: | Mg3(Si2O5)(OH)4 |
| Localities: | Reported from at least 17 localities in this region. |
|
|
|
|
|
|
|
| Chukhrovite-(Ca) |  |
|---|
| Formula: | Ca4.5Al2(SO4)F13·12H2O |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Uwe Kolitsch. Chukhrovite-(Ca) from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Chukhrovite-(Ce) | |
|---|
| Formula: | Ca3(Ce,Y)[F|SO4|(AlF6)2] · 10H2O |
| Locality: | Gamskarlgraben (incl. Lachegggraben), Grieswies, Grieswies - Krumlkeeskopf area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Churchite-(Y) | |
|---|
| Formula: | Y(PO4) · 2H2O |
| Localities: | Inselberg, Rettenegg, Fischbacher Alpen, Styria, Austria Elmleiten, Fischbach, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
|
| Cinnabar |  |
|---|
| Formula: | HgS |
| Localities: | Reported from at least 97 localities in this region. |
|
|
|
|
|
|
| Photo: © hamster@aon.at. Cinnabar from Styrian Erzberg, Eisenerz, Styria, Austria |
| Claraite |  |
|---|
| Formula: | (Cu,Zn)3(CO3)(OH)4 · 4H2O |
| Localities: | Reported from at least 16 localities in this region. |
|
|
|
|
|
|
| Photo: © Enrico Bonacina . Claraite from Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| Clausthalite | |
|---|
| Formula: | PbSe |
| Locality: | Selenide occurrence, Eselberg, Altenberg an der Rax, Neuberg an der Mürz, Styria, Austria |
|
|
|
|
|
|
|
| 'Clay' |  |
|---|
| Locality: | Lehenhof, Graschberg, Thierbach, Wildschönau, Wörgl, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Photo: © 0. Clay from Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
| Cleusonite |  |
|---|
| Formula: | (Pb,Sr)(U4+,U6+)(Fe2+,Zn)2(Ti,Fe2+,Fe3+)18(O,OH)38 |
| Localities: | A10 Highway tunnel (Katschberg tunnel), Katschberg, Rennweg, Hafner group, Hohe Tauern, Carinthia, Austria Kaiserer quarry (Deisl quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Lohning quarry (Lohninger quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Marble quarry, Atzelsdorf, Brunn an der Wild, Waldviertel, Lower Austria, Austria ? (more information)
|
|
|
|
|
|
|
| Photo: © AL. Cleusonite from Kaiserer quarry, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| Clinochlore |  |
|---|
| Formula: | (Mg,Fe2+)5Al(AlSi3O10)(OH)8 |
| Localities: | Reported from at least 104 localities in this region. |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Clinochlore from Gigler quarry, Koschach, Malta valley, Hohe Tauern, Carinthia, Austria |
| Clinochlore var: Chromian Clinochlore |  |
|---|
| Formula: | Mg5(Al,Cr)2Si3O10(OH)8 |
| Localities: | Umbal falls, Islitz Alp, Umbal valley, Virgen valley, East Tyrol, Tyrol, Austria Gulsen, Kraubath, Leoben, Styria, Austria Schiedergraben, Felben valley, Hohe Tauern, Salzburg, Austria Lobminggraben, St Stefan, Kraubath, Leoben, Styria, Austria
|
|
|
|
|
|
|
| Photo: © AC. Chromian Clinochlore from Sommergraben, Kraubath, Leoben, Styria, Austria |
| Clinochlore var: Leuchtenbergite | |
|---|
| Localities: | Reported from at least 22 localities in this region. |
|
|
|
|
|
|
|
|
| Clinochlore var: Nickeloan Clinochlore | |
|---|
| Localities: | A10 Highway tunnel, Katschberg, Schellgaden, Murwinkel, Lungau, Salzburg, Austria Ebenwald, Gmünd, Reißeck group, Hohe Tauern, Carinthia, Austria ? (more information)
|
|
|
|
|
|
|
|
|
| Clinochlore var: Pennine |  |
|---|
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
|
| Photo: © C.Boutry. Pennine from Salzburg, Austria |
| Clinochlore var: Ripidolite |  |
|---|
| Formula: | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
| Photo: © Rob Lavinsky. Ripidolite from Pfitsch pass, Zamser Grund, Zillertal, North Tyrol, Tyrol, Austria |
| Clinochlore var: Sheridanite | |
|---|
| Formula: | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| Localities: | Gruber Quarry, Unterberg, Großarl, Großarl valley, Radstädter Tauern, Salzburg, Austria Granite quarries, Gänsgraben, Limberg, Maissau, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
| Clinochrysotile |  |
|---|
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
|
| Photo: Clinochrysotile from Lobminggraben, St Stefan, Kraubath, Leoben, Styria, Austria |
| Clinoclase |  |
|---|
| Formula: | Cu3(AsO4)(OH)3 |
| Localities: | Holz Alp, Gratlspitz, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Hösljoch, Gratlspitz, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
| Photo: © AC. Clinoclase from Gratlspitz, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| Clinoenstatite | |
|---|
| Formula: | MgSiO3 |
| Locality: | Castle hill, Kapfenstein, Bad Gleichenberg, Styria, Austria |
|
|
|
|
|
|
|
| Clinohumite | |
|---|
| Formula: | (Mg,Fe2+)9(SiO4)4(F,OH)2 |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
|
| Clinohumite var: Titanclinohumite |  |
|---|
| Localities: | Laperwitzgraben, Dorf valley, Kals valley, East Tyrol, Tyrol, Austria Romariswandköpfe, Dorf valley, Kals valley, East Tyrol, Tyrol, Austria Totenkopf (incl. Lower Riffl glacier), Stubach valley, Hohe Tauern, Salzburg, Austria Brennkogel north slope, Brennkogel area, Fusch valley, Hohe Tauern, Salzburg, Austria Stubenberg Quarry, Stubenberg am See, Weiz, Styria, Austria
|
|
|
|
|
|
|
|
| Photo: Titanclinohumite from Stubenberg Quarry, Stubenberg am See, Weiz, Styria, Austria |
| 'Clinoptilolite' |  |
|---|
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
|
| Photo: © AC. Clinoptilolite from Basalt quarry, Weitendorf, Wildon, Graz, Styria, Austria |
| Clinoptilolite-Ca |  |
|---|
| Formula: | (Ca,Na,K)2-3Al3(Al,Si)2Si13O36 · 12H2O |
| Locality: | Unnamed quarry, Zintring, Maria Laach am Jauerling, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
| Photo: © Uwe Kolitsch and Franz Brandstätter. Clinoptilolite-Ca from Unnamed quarry, Zintring, Maria Laach am Jauerling, Waldviertel, Lower Austria, Austria |
| 'Clinoptilolite-Ca-Heulandite-Ca Series' |  |
|---|
| Localities: | Weinzierlbruck, Grieskirchen, Upper Austria, Austria Sand pit, Plesching, Urfahr-Umgebung, Mühlviertel, Upper Austria, Austria Rappetsederrücken, Plesching, Urfahr-Umgebung, Mühlviertel, Upper Austria, Austria Gneiss quarry, Enzenkirchen, Schärding, Upper Austria, Austria
|
|
|
|
|
|
|
|
| Photo: © neschen. Clinoptilolite-Ca-Heulandite-Ca Series from Sand pit, Plesching, Urfahr-Umgebung, Mühlviertel, Upper Austria, Austria |
| 'Clinopyroxene Subgroup' |  |
|---|
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
|
| Photo: © AC. Clinopyroxene Subgroup from Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
| 'Clinotyrolite' |  |
|---|
| Formula: | Ca2Cu9(AsO4,SO4)4(OH,O)10 · 10H2O |
| Localities: | Reported from at least 10 localities in this region. |
|
|
|
|
|
|
| Photo: © R.D.Green. Clinotyrolite from Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| Clinozoisite (TL) |  |
|---|
| Formula: | {Ca2}{Al3}(Si2O7)(SiO4)O(OH) |
| Type Locality: | Gösleswand (Goslerwand), Prägraten, Virgen Valley, East Tyrol, Tyrol, Austria |
| Reference: | E. Weinschenk: "Die Mineralvorkommen des Großvenedigerstockes in den Hohen Tauern", Zeitschr. Krist. 26, 337-508 (1896) |
| Localities: | Recorded from at least 68 other localities in this region. |
|
|
|
|
| Photo: © Rob Lavinsky. Clinozoisite from Schwarzenstein, Zemmgrund, Zillertal, North Tyrol, Tyrol, Austria |
| 'Clinozoisite-Epidote Series' |  |
|---|
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
|
| Photo: © neschen. Clinozoisite-Epidote Series from Resch quarry, Gurhof, Freistadt, Mühlviertel, Upper Austria, Austria |
| 'Coal' |  |
|---|
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
|
| Photo: © neschen. Coal from Grossauer Quarry, Reichraming, Steyr-Land, Upper Austria, Austria |
| 'Coal var: Anthracite' |  |
|---|
| Localities: | Kapinberg (Kopinberg), Thörl, Arnoldstein, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria Stangnock, Innerkrems, Nock Mts, Gurktaler Alpen, Carinthia, Austria
|
|
|
|
|
|
|
|
| Photo: © AC. Anthracite from Stangnock, Innerkrems, Nock Mts, Gurktaler Alpen, Carinthia, Austria |
| 'Coal var: Jet' | |
|---|
| Locality: | Roßleiten, Windischgarsten, Kirchdorf an der Krems, Upper Austria, Austria |
|
|
|
|
|
|
|
|
| 'Coal var: Lignite' | |
|---|
| Localities: | Coal mine, Kogel (Kogl), Ratten, Fischbacher Alpen, Styria, Austria Coal mine, St. Kathrein am Hauenstein, Ratten, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
|
|
| Coalingite | |
|---|
| Formula: | Mg10Fe3+2(OH)24[CO3] · 2H2O |
| Localities: | Preg, Kraubath, Leoben, Styria, Austria Serpentinite outcrop, Eibegggraben, St. Jakob-Breitenau, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
|
| Cobaltite | |
|---|
| Formula: | CoAsS |
| Localities: | Reported from at least 33 localities in this region. |
|
|
|
|
|
|
|
| 'Cobaltoan Arsenopyrite' | |
|---|
| Localities: | Ulpen Cu deposit (Kaunz Alp; Hochleger; Keller pass; Öxel valley), Schwaz, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Zinkwand, Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria
|
|
|
|
|
|
|
|
|
| Cobaltpentlandite | |
|---|
| Formula: | (Co,Ni,Fe)9S8 |
| Locality: | Seebichl quarry, Kraig, St Veit an der Glan, Gurktaler Alpen, Carinthia, Austria |
|
|
|
|
|
|
|
| Coffinite | |
|---|
| Formula: | (U4+,Th)(SiO4)1-x(OH)4x |
| Localities: | East section, Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria Wald tunnel, A9 Motorway tunnels, Wald am Schoberpass, Liesing - Palten valley, Styria, Austria Lehenhof, Graschberg, Thierbach, Wildschönau, Wörgl, Inn valley, North Tyrol, Tyrol, Austria ? (more information)
|
|
|
|
|
|
|
|
| Collinsite | |
|---|
| Formula: | Ca2(Mg,Fe2+)(PO4)2 · 2H2O |
| Locality: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
|
|
|
|
|
|
|
| Coloradoite | |
|---|
| Formula: | HgTe |
| Locality: | Anna adit, Mitterberg District, St Johann im Pongau, Salzburg, Austria |
|
|
|
|
|
|
|
| 'Columbite' | |
|---|
| Formula: | (Fe,Mn)(Nb,Ta)2O6 |
| Localities: | Reported from at least 21 localities in this region. |
|
|
|
|
|
|
|
| Columbite-(Fe) |  |
|---|
| Formula: | FeNb2O6 |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Columbite-(Fe) from Hopffeldboden, Hopffeld area, Obersulzbach valley, Hohe Tauern, Salzburg, Austria |
| Colusite | |
|---|
| Formula: | Cu26V2(As,Sn,Sb)6S32 |
| Locality: | Erasmus adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
|
|
|
|
|
|
|
| Conichalcite |  |
|---|
| Formula: | CaCu(AsO4)(OH) |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Conichalcite from Copper mine, Kohlberg, Pottschach, Ternitz, Industrieviertel, Lower Austria, Austria |
| 'Conichalcite-Duftite Series' | |
|---|
| Locality: | Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
|
| Connellite |  |
|---|
| Formula: | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
| Photo: © Michael C. Roarke. Connellite from Haagen mine, Webing, Abtenau, Salzburg, Austria |
| Cookeite | |
|---|
| Formula: | LiAl4(AlSi3O10)(OH)8 |
| Locality: | Flatscher Alp, Vorsterbach valley, Wörth, Rauris valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| 'Copal' |  |
|---|
| Localities: | Sandstone quarry, St Pankraz, Oberndorf, Salzburg, Austria Sandstone outcrops, Gablitz, Industrieviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
| Photo: Copal from Sandstone outcrops, Gablitz, Industrieviertel, Lower Austria, Austria |
| Copiapite | |
|---|
| Formula: | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| Localities: | Reported from at least 25 localities in this region. |
|
|
|
|
|
|
|
| Copper |  |
|---|
| Formula: | Cu |
| Localities: | Reported from at least 93 localities in this region. |
|
|
|
|
|
|
| Photo: © mslama. Copper from Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
| 'Copper Sulphides' |  |
|---|
| Localities: | Slag locality, Kothgraben (Kotgraben), Kleinfeistritz, Stubalpe, Styria, Austria Viertal Alp (Puderlehen Alp), Uttendorf, Zell am See, Kitzbühel Alps, Salzburg, Austria
|
|
|
|
|
|
|
|
| Photo: © AC. Copper Sulphides from Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria |
| Coquimbite | |
|---|
| Formula: | Fe2-xAlx(SO4)3 · 9H2O, x ~0.5 |
| Localities: | Spitzmühle quarry, Leutschach, Styria, Austria Railway tunnel, Galgenberg, Leoben, Styria, Austria
|
|
|
|
|
|
|
|
| Cordierite |  |
|---|
| Formula: | (Mg,Fe)2Al3(AlSi5O18) |
| Localities: | Reported from at least 25 localities in this region. |
|
|
|
|
|
|
| Photo: © . Cordierite from Oberpuchenau, Urfahr-Umgebung, Mühlviertel, Upper Austria, Austria |
| Corkite | |
|---|
| Formula: | PbFe3(PO4)(SO4)(OH)6 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Cornubite |  |
|---|
| Formula: | Cu5(AsO4)2(OH)4 |
| Localities: | Gratlspitz, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Prehistoric dump, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria
|
|
|
|
|
|
|
| Photo: © 0. Cornubite from Copper mine, Kohlberg, Pottschach, Ternitz, Industrieviertel, Lower Austria, Austria |
| Cornwallite | |
|---|
| Formula: | Cu5(AsO4)2(OH)4 |
| Localities: | Kaiserbründl, Gratlspitz, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria West slope ("Am Geyer"), Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Adit No. 379, Graschberg, Thierbach, Wildschönau, Wörgl, Inn valley, North Tyrol, Tyrol, Austria Graschberg, Thierbach, Wildschönau, Wörgl, Inn valley, North Tyrol, Tyrol, Austria Hofer Tratte, Hof, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| Coronadite | |
|---|
| Formula: | Pb(Mn4+6Mn3+2)O16 |
| Locality: | Ködnitz valley, Kals valley, East Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Corundum |  |
|---|
| Formula: | Al2O3 |
| Localities: | Reported from at least 21 localities in this region. |
|
|
|
|
|
|
| Photo: Corundum from Stubenberg Quarry, Stubenberg am See, Weiz, Styria, Austria |
| Corundum var: Sapphire |  |
|---|
| Formula: | Al2O3 |
| Locality: | Dürnberg, Ottensheim, Urfahr-Umgebung, Mühlviertel, Upper Austria, Austria |
|
|
|
|
|
|
| Photo: © AC. Sapphire from Dürnberg, Ottensheim, Urfahr-Umgebung, Mühlviertel, Upper Austria, Austria |
| Cosalite |  |
|---|
| Formula: | Pb2Bi2S5 |
| Localities: | Reported from at least 23 localities in this region. |
|
|
|
|
|
|
| Photo: Cosalite from Wiesbachrinne, Habach valley, Hohe Tauern, Salzburg, Austria |
| Cosalite var: Antimonian Cosalite | |
|---|
| Locality: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
|
|
|
|
|
|
|
|
| Cotunnite | |
|---|
| Formula: | PbCl2 |
| Localities: | Roter Mann, Kleine Fleiß valley, Goldberg group, Hohe Tauern, Carinthia, Austria Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria
|
|
|
|
|
|
|
|
| Covellite |  |
|---|
| Formula: | CuS |
| Localities: | Reported from at least 140 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Covellite from Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria |
| Cowlesite |  |
|---|
| Formula: | CaAl2Si3O10 · 6H2O |
| Locality: | Trandorf, Mühldorf, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
| Photo: Cowlesite from Trandorf, Mühldorf, Waldviertel, Lower Austria, Austria |
| Crandallite |  |
|---|
| Formula: | CaAl3(PO4)2(OH)5 · H2O |
| Localities: | Reported from at least 15 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Crandallite from Brandberg, Leoben, Styria, Austria |
| Crandallite var: Strontian Crandallite |  |
|---|
| Formula: | (Ca,Sr)Al3(PO4)2(OH)5 · H2O |
| Locality: | Emma adit, Ratteingraben, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © AC. Strontian Crandallite from Emma adit, Ratteingraben, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Crichtonite | |
|---|
| Formula: | (Sr,La,Ce,Y)(Ti,Fe3+,Mn)21O38 |
| Locality: | Stampfl glacier, Zamser Grund (Zams valley), Zillertal, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| 'Crichtonite Group' | |
|---|
| Formula: | AD21O38 or A{DE2G6 J12}O38 |
| Localities: | Pilot adit, Semmering basis tunnel, Dürrhof, Spital am Semmering, Fischbacher Alpen, Styria, Austria Stampfl glacier, Zamser Grund (Zams valley), Zillertal, North Tyrol, Tyrol, Austria Marble quarry, Atzelsdorf, Brunn an der Wild, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
| 'Crichtonite-Senaite Series' |  |
|---|
| Locality: | Stampfl glacier, Zamser Grund (Zams valley), Zillertal, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Photo: © Manuele Moro. Crichtonite-Senaite Series from Stampfl glacier, Zamser Grund, Zillertal, North Tyrol, Tyrol, Austria |
| Cristobalite |  |
|---|
| Formula: | SiO2 |
| Localities: | Basalt quarry, Weitendorf, Wildon, Graz, Styria, Austria Schlarbaum quarry, Klause, Bad Gleichenberg, Styria, Austria Basalt quarry, Kollnitz, St Paul im Lavanttal, Carinthia, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria
|
|
|
|
|
|
|
| Photo: © AC. Cristobalite from Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
| Crocoite | |
|---|
| Formula: | Pb(CrO4) |
| Localities: | Dirstentritt, Nassereith, Imst - Nassereith District, North Tyrol, Tyrol, Austria Alpleskopf, Nassereith, Imst - Nassereith District, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| Cronstedtite |  |
|---|
| Formula: | Fe2+2Fe3+((Si,Fe3+)2O5)(OH)4 |
| Localities: | Arsenic mine, Lower Rotgülden lake, Rotgülden, Murwinkel, Lungau, Salzburg, Austria Quarry II, Loja, Persenbeug-Gottsdorf, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Cronstedtite from Rotgülden, Murwinkel, Lungau, Salzburg, Austria |
| 'Crossite' |  |
|---|
| Localities: | Einberg, Seydegg, Abtenau, Salzburg, Austria Blue quartz occurrence, Grabenbach area, Golling, Salzburg, Austria Gypsum mine, Wienern, Bad Aussee, Styria, Austria Hallberg, Rigaus, Abtenau, Salzburg, Austria
|
|
|
|
|
|
|
|
| Photo: Crossite from Einberg, Seydegg, Abtenau, Salzburg, Austria |
| Cryptomelane |  |
|---|
| Formula: | K(Mn4+7Mn3+)O16 |
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
| Photo: © Franz Brandstätter & Uwe Kolitsch. Cryptomelane from Huteralm, Ködnitz valley, Kals valley, East Tyrol, Tyrol, Austria |
| Cubanite |  |
|---|
| Formula: | CuFe2S3 |
| Localities: | Reported from at least 17 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Cubanite from Moosschrofen, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| Cumengeite |  |
|---|
| Formula: | Pb21Cu20Cl42(OH)40 · 6H2O |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Cumengeite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Cummingtonite |  |
|---|
| Formula: | ☐{Mg2}{Mg5}(Si8O22)(OH)2 |
| Localities: | St Leonhard auf der Saualpe, Reisberg, Saualpe, Carinthia, Austria Pölling, Reisberg, Saualpe, Carinthia, Austria Basalt quarry, Kollnitz, St Paul im Lavanttal, Carinthia, Austria Arzberg, Kottaun, Geras, Waldviertel, Lower Austria, Austria Hofkirchen, Saxen, Perg, Mühlviertel, Upper Austria, Austria ? (more information)
|
|
|
|
|
|
|
| Photo: © . Cummingtonite from Arzberg, Kottaun, Geras, Waldviertel, Lower Austria, Austria |
| Cuprite |  |
|---|
| Formula: | Cu2O |
| Localities: | Reported from at least 109 localities in this region. |
|
|
|
|
|
|
| Photo: Cuprite from Slag dumps, Severinggraben, Johnsbach, Ennstaler Alpen, Styria, Austria |
| Cuprite var: Chalcotrichite |  |
|---|
| Formula: | Cu2O |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
| Photo: © . Chalcotrichite from Lechnerberg, Kaprun, Kaprun valley, Hohe Tauern, Salzburg, Austria |
| Cuprite var: Tile ore | |
|---|
| Formula: | Cu2O |
| Localities: | Gaisberg, Olsa, Friesach, Friesach - Hüttenberg area, Carinthia, Austria Maukenötz District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Fingerlos quarry (Hammerbruch), Mauterndorf, Taurach valley, Lungau, Salzburg, Austria Latschach, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria ? (more information)
|
|
|
|
|
|
|
|
| Cuprobismutite | |
|---|
| Formula: | Cu8AgBi12S24 |
| Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Cuproiridsite | |
|---|
| Formula: | (Cu,Fe)Ir2S4 |
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Cupromakopavonite (TL) | |
|---|
| Formula: | Ag3Cu8Pb4Bi19S38 |
| Type Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| Reference: | IMA website |
|
|
|
|
|
|
| Cupromakovickyite (TL) | |
|---|
| Formula: | Cu8Pb4Ag2Bi18S36 |
| Type Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| Reference: | D. Topa et al.: Can. Mineral. 40:849-869 (2002); D. Topa et al.: Can. Mineral. 41:1155-1166 (2003) |
|
|
|
|
|
|
| Cupropavonite | |
|---|
| Formula: | AgCu2PbBi5S10 |
| Locality: | Waschgang Mine, Kluidscharte, Kleine Zirknitz valley, Zirknitz, Goldberg group, Hohe Tauern, Carinthia, Austria |
|
|
|
|
|
|
|
| Cuprorhodsite | |
|---|
| Formula: | (Cu,Fe)Rh2S4 |
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Cuproroméite |  |
|---|
| Formula: | Cu2Sb2(O,OH)7 |
| Localities: | Reported from at least 17 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Cuproroméite from Feistritz Alp, Feistritz an der Gail, Arnoldstein, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Cyanotrichite |  |
|---|
| Formula: | Cu4Al2(SO4)(OH)12 · 2H2O |
| Localities: | Reported from at least 17 localities in this region. |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Cyanotrichite from North face, Hoher Sonnblick, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| 'Cyanotrichite Group' |  |
|---|
| Locality: | Quartz quarry, Wolfsgruben (Wolfgruben), Seiz, Liesing - Palten valley, Styria, Austria |
|
|
|
|
|
|
|
| Photo: © AC. Cyanotrichite Group from Quartz quarry, Wolfsgruben, Seiz, Liesing - Palten valley, Styria, Austria |
| Cyrilovite | |
|---|
| Formula: | NaFe3+3(PO4)2(OH)2 · 2H2O |
| Locality: | Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria |
|
|
|
|
|
|
|
| 'Dachiardite' | |
|---|
| Locality: | Basalt quarry, Weitendorf, Wildon, Graz, Styria, Austria |
|
|
|
|
|
|
|
|
| Dachiardite-Na |  |
|---|
| Formula: | (Na2,Ca,K2)5Al10Si38O96 · 25H2O |
| Localities: | Zeiselberg, Gundersdorf, Klagenfurt, Carinthia, Austria S6 motorway tunnel (Tanzenberg tunnel), Tanzenberg, Kapfenberg, Bruck an der Mur, Styria, Austria
|
|
|
|
|
|
|
| Photo: © C.Boutry. Dachiardite-Na from S6 motorway tunnel, Tanzenberg, Kapfenberg, Bruck an der Mur, Styria, Austria |
| Danalite | |
|---|
| Formula: | Fe2+4(Be3Si3O12)S |
| Locality: | Poschacher Quarry, Artolz (Artholz), Pfaffenschlag bei Waidhofen an der Thaya, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| Danburite |  |
|---|
| Formula: | CaB2Si2O8 |
| Localities: | Scheiblinggraben, Bad Gastein, Gastein valley, Hohe Tauern, Salzburg, Austria Danburite occurrence, Kötschach valley, Gastein valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
| Photo: © Elmar Lackner. Danburite from Danburite occurrence, Kötschach valley, Gastein valley, Hohe Tauern, Salzburg, Austria |
| Danielsite ? | |
|---|
| Formula: | (Cu,Ag)14HgS8 |
| Locality: | Röhrerbühel (Rohrer Berg; Röhrerbichel; Rerobichl), Fieberbrunn, Kitzbühel Alps, North Tyrol, Tyrol, Austria - erroneously reported |
|
|
|
|
|
|
|
| D'Ansite (TL) | |
|---|
| Formula: | Na21Mg(SO4)10Cl3 |
| Type Locality: | Salt mine, Hall, Innsbruck, Inn valley, North Tyrol, Tyrol, Austria |
| Reference: | American Mineralogist (1958), 43, 1221 |
|
|
|
|
|
|
| Dantopaite (TL) | |
|---|
| Formula: | Cu1.06Ag4.24Pb0.9Bi12.23S21.89Te0.11 |
| Type Locality: | Erzwies area, Gastein valley, Hohe Tauern, Salzburg, Austria |
| Reference: | Makovicky, E., Paar, W.H., Putz, H., Zagler, G. (2010): Dantopaite, Ag5Bi13S22, the 6P natural member of the pavonite homologous series, from Erzwies, Austria. Canadian Mineralogist, 48, 467-481. |
|
|
|
|
|
|
| Datolite |  |
|---|
| Formula: | Ca(HBSiO5) |
| Localities: | Reported from at least 15 localities in this region. |
|
|
|
|
|
|
| Photo: Datolite from Bleidächer, Obersulzbach valley, Hohe Tauern, Salzburg, Austria |
| 'Davidite' | |
|---|
| Localities: | Wustkogel, Seidlwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Kaiserer quarry (Deisl quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria ? (more information) Lohning quarry (Lohninger quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria ? (more information)
|
|
|
|
|
|
|
|
|
| Dawsonite | |
|---|
| Formula: | NaAlCO3(OH)2 |
| Localities: | Binderberg borehole, Loipersdorf, Fürstenfeld, Styria, Austria Karl-August adit, Fohnsdorf, Judenburg, Styria, Austria
|
|
|
|
|
|
|
|
| Delafossite | |
|---|
| Formula: | CuFeO2 |
| Localities: | Wilhelm adit, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria Totenkopf (incl. Lower Riffl glacier), Stubach valley, Hohe Tauern, Salzburg, Austria Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria
|
|
|
|
|
|
|
|
| Delvauxite | |
|---|
| Formula: | CaFe4(PO4,SO4)2(OH)8 · 4-6H2O not confirmed · |
| Localities: | Ebenlecker farm (Ebenlöcker farm), Herzogberg, Modriach, Koralpe, Styria, Austria Graphite quarry, Amstall, Mühldorf, Waldviertel, Lower Austria, Austria Graphite mine, Wegscheid, Mühldorf, Waldviertel, Lower Austria, Austria Brandberg, Leoben, Styria, Austria Grillenberg, Payerbach, Industrieviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
| Descloizite |  |
|---|
| Formula: | Pb(Zn,Cu)(VO4)(OH) |
| Localities: | Reported from at least 27 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Descloizite from Nepomuk Mine, Galmeikogel, Annaberg, Mostviertel, Lower Austria, Austria |
| Descloizite var: Dechenite | |
|---|
| Formula: | PbZn(VO4,AsO4)(OH) |
| Localities: | Zauchengraben, Zauchen, Hochobir, Karawanken, Carinthia, Austria Kappel, Ferlach, Karawanken, Carinthia, Austria
|
|
|
|
|
|
|
|
| Destinezite | |
|---|
| Formula: | Fe3+2(PO4)(SO4)(OH) · 6H2O |
| Locality: | Treffning, Rötzgraben, Trofaiach, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Devilline |  |
|---|
| Formula: | CaCu4(SO4)2(OH)6 · 3H2O |
| Localities: | Reported from at least 53 localities in this region. |
|
|
|
|
|
|
| Photo: © . Devilline from No. 1 adit, Äußere Wimitz, St Veit an der Glan, Gurktaler Alpen, Carinthia, Austria |
| 'Deweylite' | |
|---|
| Formula: | Mg4Si3O10 · 6H2O ? |
| Localities: | Kraubath, Leoben, Styria, Austria Ebenwald, Gmünd, Reißeck group, Hohe Tauern, Carinthia, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria
|
|
|
|
|
|
|
|
| Diaboleite |  |
|---|
| Formula: | Pb2CuCl2(OH)4 |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Diaboleite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Diadochite | |
|---|
| Formula: | Fe3+2(PO4)(SO4)(OH) · 5H2O |
| Localities: | Brandberg, Leoben, Styria, Austria Haidnerhöhe, Flattnitz, Gurktaler Alpen, Carinthia, Austria
|
|
|
|
|
|
|
|
| 'Diallage' | |
|---|
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
|
|
| Diaphorite | |
|---|
| Formula: | Ag3Pb2Sb3S8 |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
|
| Diaspore | |
|---|
| Formula: | AlO(OH) |
| Localities: | Reported from at least 12 localities in this region. |
|
|
|
|
|
|
|
| Dickite | |
|---|
| Formula: | Al2(Si2O5)(OH)4 |
| Localities: | Reported from at least 14 localities in this region. |
|
|
|
|
|
|
|
| 'Dienerite' | |
|---|
| Locality: | Radstadt, Salzburg, Austria |
|
|
|
|
|
|
|
|
| Digenite | |
|---|
| Formula: | Cu9S5 |
| Localities: | Reported from at least 31 localities in this region. |
|
|
|
|
|
|
|
| Diopside |  |
|---|
| Formula: | CaMgSi2O6 |
| Localities: | Reported from at least 75 localities in this region. |
|
|
|
|
|
|
| Photo: © 2002 Thames Valley Minerals. Diopside from Diopside rift, Ochsner-Rotkopf massif, Zemmgrund, Zillertal, North Tyrol, Tyrol, Austria |
| Diopside var: Chromian Diopside |  |
|---|
| Formula: | (Ca,Cr)MgSi2O6 |
| Localities: | Schlarbaum quarry, Klause, Bad Gleichenberg, Styria, Austria Brennkogel south slope, Hochtor area, Glockner group, Hohe Tauern, Carinthia, Austria Castle hill, Kapfenstein, Bad Gleichenberg, Styria, Austria Serpentinite quarries, Dietmannsdorf an der Wild, Brunn an der Wild, Waldviertel, Lower Austria, Austria Dunkelsteinerwald, Dunkelstein Forest, Mostviertel, Lower Austria, Austria
|
|
|
|
|
|
|
| Photo: © Erwin Löffler. Chromian Diopside from Serpentinite quarries, Dietmannsdorf an der Wild, Brunn an der Wild, Waldviertel, Lower Austria, Austria |
| 'Diopside-Hedenbergite Series' | |
|---|
| Locality: | Unnamed quarry, Zintring, Maria Laach am Jauerling, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
|
| 'Diopside-Hedenbergite Series var: Ferrosalite' | |
|---|
| Locality: | Arzberg (Atzberg; Michaeler Berg), Spitz, Wachau, Lower Austria, Austria |
|
|
|
|
|
|
|
|
| Djurleite |  |
|---|
| Formula: | Cu31S16 |
| Localities: | Reported from at least 10 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Djurleite from Ponigl quarry, Poniglgraben, Weiz, Styria, Austria |
| Dolomite |  |
|---|
| Formula: | CaMg(CO3)2 |
| Localities: | Reported from at least 323 localities in this region. |
|
|
|
|
|
|
| Photo: © 2003 John H. Betts. Dolomite from Styria, Austria |
| Dolomite var: Ferroan Dolomite | |
|---|
| Localities: | Reported from at least 20 localities in this region. |
|
|
|
|
|
|
|
|
| Dolomite var: Greinerite | |
|---|
| Locality: | Großer Greiner, Zemmgrund, Zillertal, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
|
| Dolomite var: Gurhofian | |
|---|
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
|
| Domeykite |  |
|---|
| Formula: | Cu3As |
| Localities: | Brunngraben district, Cu deposit (Schönberg), Flatschach, Knittelfeld, Styria, Austria Weißenbach district, Cu deposit (Schönberg), Flatschach, Knittelfeld, Styria, Austria
|
|
|
|
|
|
|
| Photo: © 0. Domeykite from Brunngraben district, Cu deposit, Flatschach, Knittelfeld, Styria, Austria |
| Donharrisite (TL) | |
|---|
| Formula: | Ni8Hg3S9 |
| Type Locality: | Erasmus adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
| Reference: | PAAR, W.H., CHEN, T.T., ROBERTS, A.C., CRIDDLE, A.J. & STANLEY, C.J. (1989): Donharrisite, nickel-mercury sulfide, a new mineral species from Leogang, Salzburg Province, Austria. Canadian Mineralogist 27, 257-262. |
|
|
|
|
|
|
| 'Dopplerite' | |
|---|
| Localities: | Lignite deposit, Zillingdorf, Industrieviertel, Lower Austria, Austria Köflach - Voitsberg lignite deposit, Köflach, Styria, Austria Äußere Kainisch, Bad Aussee, Styria, Austria
|
|
|
|
|
|
|
|
|
| Dravite |  |
|---|
| Formula: | Na(Mg3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Localities: | Reported from at least 36 localities in this region. |
|
|
|
|
|
|
| Photo: © Marco Barsanti. Dravite from Carinthia, Austria |
| 'Dravite-Schorl Series' | |
|---|
| Locality: | Oberhaag, Aigen im Mühlkreis, Rohrbach, Mühlviertel, Upper Austria, Austria |
|
|
|
|
|
|
|
|
| Dufrénoysite ? | |
|---|
| Formula: | Pb2As2S5 |
| Locality: | Gypsum mine (Moldan mine), Moosegg, Grubach, Golling, Salzburg, Austria - erroneously reported |
|
|
|
|
|
|
|
| Duftite |  |
|---|
| Formula: | PbCu(AsO4)(OH) |
| Localities: | Reported from at least 11 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Duftite from Fuchsloch, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| Dumontite | |
|---|
| Formula: | Pb2(UO2)3(PO4)2(OH)4 · 3H2O |
| Locality: | Ödenkar, Kreuzkogel massif, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Dumortierite |  |
|---|
| Formula: | (Al,Fe3+)7(SiO4)3(BO3)O3 |
| Localities: | Reported from at least 12 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Dumortierite from Unterkienstock, Rossatz, Rossatz-Arnsdorf, Wachau, Lower Austria, Austria |
| Dundasite |  |
|---|
| Formula: | PbAl2(CO3)2(OH)4 · H2O |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Dundasite from Emma adit, Ratteingraben, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Dypingite | |
|---|
| Formula: | Mg5(CO3)4(OH)2 · 5H2O |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Ecandrewsite | |
|---|
| Formula: | (Zn,Fe2+,Mn2+)TiO3 |
| Locality: | Silberlucken Mine, Neustadtl an der Donau, Mostviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| Eclarite (TL) |  |
|---|
| Formula: | (Cu,Fe)Pb9Bi12S28 |
| Type Locality: | Bärenbad Mine (Bärnbad Mine), Scharnbachgraben, Hollersbach valley, Hohe Tauern, Salzburg, Austria |
| Reference: | W.H. Paar, T.T. Chen, V. Kupcik, K. Hanke: TMPM 32:103-110 (1983); Niedermayr, G. et al. (2008): Neue Mineralfunde aus Österreich LVII. Carinthia II, 198./118., 223-274. |
|
|
|
|
|
| Photo: © 2007, JGW. Eclarite from Bärenbad Mine, Scharnbachgraben, Hollersbach valley, Hohe Tauern, Salzburg, Austria |
| Edenite | |
|---|
| Formula: | {Na}{Ca2}{Mg5}(AlSi7O22)(OH)2 |
| Localities: | Serpentinite quarry, Pingendorf, Drosendorf-Zissersdorf, Waldviertel, Lower Austria, Austria Lobminggraben, St Stefan, Kraubath, Leoben, Styria, Austria ? (more information)
|
|
|
|
|
|
|
|
| 'Eichbergite' | |
|---|
| Locality: | Magnesite deposit, Eichberg, Gloggnitz, Industrieviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
|
| Elbaite ? | |
|---|
| Formula: | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Localities: | Mötlas, Königswiesen, Freistadt, Mühlviertel, Upper Austria, Austria ? (more information) Königsalm, Senftenberg, Waldviertel, Lower Austria, Austria ? (more information) Graphite quarry, Amstall, Mühldorf, Waldviertel, Lower Austria, Austria ? (more information)
Wildberg, Urfahr-Umgebung, Mühlviertel, Upper Austria, Austria (more information)
|
|
|
|
|
|
|
|
| 'Ellestadite' | |
|---|
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
|
| Elyite |  |
|---|
| Formula: | Pb4Cu(SO4)O2(OH)4 · H2O |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © 2008 Jesse Crawford. Elyite from Slag localities, Kolm-Saigurn, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| Emilite (TL) |  |
|---|
| Formula: | Pb2.7Cu2.7Bi5.3S12 |
| Type Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| Reference: | Balić-Žunić T., Topa, D., and Makovicky, E. (2002) The crystal structure of emilite, Cu10.7Pb10.7Bi21.3S48, the second 45 Å derivative of the bismuthinite-aikinite solid-solution series. Canadian Mineralogist: 40: 239-245; Lapis 29(5):42 (2004); Topa, D., Paar, W. H., Balić-Žunić, T. (2006): Emilite, Cu10.72Pb10.72Bi21.28S48, the last missing link of the bismuthinite-alkinite series? Canadian Mineralogist 44, 459-464. |
|
|
|
|
|
| Photo: © 2008, JGW. Emilite from Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| Emplectite | |
|---|
| Formula: | CuBiS2 |
| Localities: | Gold Mines, Kliening, Bad St Leonhard, Saualpe, Carinthia, Austria Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria Zinkwand, Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria Iron mines, Pitten, Bucklige Welt, Industrieviertel, Lower Austria, Austria Knappenkeusche, Spital am Semmering, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
|
| Enargite | |
|---|
| Formula: | Cu3AsS4 |
| Localities: | Reported from at least 26 localities in this region. |
|
|
|
|
|
|
|
| Enstatite | |
|---|
| Formula: | MgSiO3 |
| Localities: | Reported from at least 17 localities in this region. |
|
|
|
|
|
|
|
| Enstatite var: Bronzite |  |
|---|
| Formula: | (Mg,Fe2+)2[SiO3]2 |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Bronzite from Sommergraben, Kraubath, Leoben, Styria, Austria |
| Ephesite | |
|---|
| Formula: | LiNaAl2(Al2Si2O10)(OH)2 |
| Locality: | Wolfsbach, Drosendorf-Zissersdorf, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| Epidote |  |
|---|
| Formula: | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Localities: | Reported from at least 200 localities in this region. |
|
|
|
|
|
|
| Photo: © Harjo. Epidote from Knappenwand, Knappenwand area, Untersulzbach valley, Hohe Tauern, Salzburg, Austria |
| Epidote var: Tawmawite | |
|---|
| Formula: | {Ca2}{(Al,Fe3+,Cr)3}(Si2O7)(SiO4)O(OH) |
| Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| 'Epidote Group' |  |
|---|
| Formula: | A2 M3(Si2O7)(SiO4)O(OH) |
| Localities: | Friedlkogel (Friedelkogel; Heinzlkogel), Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria Gneiss quarry, Enzenkirchen, Schärding, Upper Austria, Austria Unnamed quarry, Zintring, Maria Laach am Jauerling, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
| Photo: © AC. Epidote Group from Friedlkogel, Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria |
| Epsomite | |
|---|
| Formula: | MgSO4 · 7H2O |
| Localities: | Reported from at least 25 localities in this region. |
|
|
|
|
|
|
|
| Epsomite var: Ferroan Epsomite | |
|---|
| Formula: | (Mg,Fe2+)[SO4] · 7H2O |
| Localities: | Salt mine, Hallstatt, Gmunden, Upper Austria, Austria Rock salt deposit, Dürrnberg, Hallein, Salzburg, Austria Ischler Salzberg, Perneck, Bad Ischl, Gmunden, Upper Austria, Austria
|
|
|
|
|
|
|
|
| Eriochalcite | |
|---|
| Formula: | CuCl2 · 2H2O |
| Locality: | Breitenau Mine (Breitenau magnesite mine), Hochlantsch, St. Jakob-Breitenau, Fischbacher Alpen, Styria, Austria |
|
|
|
|
|
|
|
| 'Erionite' |  |
|---|
| Localities: | Basalt quarry, Kollnitz, St Paul im Lavanttal, Carinthia, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria
|
|
|
|
|
|
|
|
| Photo: © Germano Fretti. Erionite from Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
| Erlichmanite | |
|---|
| Formula: | OsS2 |
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Erythrite |  |
|---|
| Formula: | Co3(AsO4)2 · 8H2O |
| Localities: | Reported from at least 64 localities in this region. |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Erythrite from Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| Erythrite var: Mg-rich Erythrite | |
|---|
| Formula: | (Co,Mg)3(AsO4)2 · 8H2O |
| Locality: | Magnesite Mine, Millstätter Alpe, Radenthein, Gurktaler Alpen, Carinthia, Austria |
|
|
|
|
|
|
|
| 'Erzbergite' |  |
|---|
| Locality: | Styrian Erzberg, Eisenerz, Styria, Austria |
|
|
|
|
|
|
|
| Photo: Erzbergite from Styrian Erzberg, Eisenerz, Styria, Austria |
| Erzwiesite (TL) | |
|---|
| Formula: | Ag8Pb12Bi16S40 |
| Type Locality: | Unnamed prospect, Erzwies area, Gastein valley, Hohe Tauern, Salzburg, Austria |
| Reference: | Topa, D., Makovicky, E., Zagler, G., Putz, H. and Paar, W.H. (2013) Erzwiesite, IMA 2012-082. CNMNC Newsletter No. 15, February 2013, page 11; Mineralogical Magazine, 77, 1-12 |
|
|
|
|
|
|
| Eskimoite |  |
|---|
| Formula: | Ag7Pb10Bi15S36 |
| Localities: | Rauriser Goldberg, Kolm-Saigurn, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Erzwies area, Gastein valley, Hohe Tauern, Salzburg, Austria Milleiten Mine, Große Zirknitz valley, Zirknitz, Goldberg group, Hohe Tauern, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © Rob Lavinsky. Eskimoite from Bockhart reservoir, Siglitz - Bockhart area, Gastein valley, Hohe Tauern, Salzburg, Austria |
| Ettringite |  |
|---|
| Formula: | Ca6Al2(SO4)3(OH)12 · 26H2O |
| Localities: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria Slag locality, St Gertraudi, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Railway tunnel, Galgenberg, Leoben, Styria, Austria Quarry IV- Middle & Northern Area, Loja, Persenbeug-Gottsdorf, Waldviertel, Lower Austria, Austria Slag locality, Kothgraben (Kotgraben), Kleinfeistritz, Stubalpe, Styria, Austria
|
|
|
|
|
|
|
| Photo: © AC. Ettringite from Loja, Persenbeug-Gottsdorf, Waldviertel, Lower Austria, Austria |
| Euchroite |  |
|---|
| Formula: | Cu2(AsO4)(OH) · 3H2O |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
| Photo: © AL. Euchroite from Prehistoric dump, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
| Euclase |  |
|---|
| Formula: | BeAl(SiO4)(OH) |
| Localities: | Reported from at least 17 localities in this region. |
|
|
|
|
|
|
| Photo: © mslama. Euclase from Floitenturm northeast slope, Stillupgrund, Zillertal, North Tyrol, Tyrol, Austria |
| Eugenite | |
|---|
| Formula: | Ag11Hg2 |
| Locality: | Röhrerbühel (Rohrer Berg; Röhrerbichel; Rerobichl), Fieberbrunn, Kitzbühel Alps, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Eulytine | |
|---|
| Formula: | Bi4(SiO4)3 |
| Locality: | Wiesbachrinne, Habach valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Euxenite-(Y) |  |
|---|
| Formula: | (Y,Ca,Ce,U,Th)(Nb,Ti,Ta)2O6 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
| Photo: © D. Preite. Euxenite-(Y) from Hopffeldboden, Hopffeld area, Obersulzbach valley, Hohe Tauern, Salzburg, Austria |
| 'Evansite' | |
|---|
| Formula: | Al3(PO4)(OH)6 · 6H2O |
| Locality: | Oberlend, Lend, Schwarzach, Salzburg, Austria |
|
|
|
|
|
|
|
| 'Fahlunite' | |
|---|
| Formula: | (Mg,Fe)Al2Si3O10 · 2H2O |
| Locality: | Schwabegg, Bleiburg, Völkermarkt, Carinthia, Austria |
|
|
|
|
|
|
|
| Fairfieldite |  |
|---|
| Formula: | Ca2(Mn2+,Fe2+)(PO4)2 · 2H2O |
| Locality: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © AC. Fairfieldite from Spodumene prospect, Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
| Famatinite |  |
|---|
| Formula: | Cu3SbS4 |
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Famatinite from Maukenstadl adit, Maukenötz District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| 'Famatinite-Luzonite Series' | |
|---|
| Locality: | Maukenötz District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
|
| Fassinaite |  |
|---|
| Formula: | Pb2(S2O3)(CO3) |
| Localities: | Erasmus adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria Herren adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria Johannes adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: Fassinaite from Erasmus adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
| Fayalite |  |
|---|
| Formula: | Fe2+2SiO4 |
| Localities: | Reported from at least 12 localities in this region. |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Fayalite from Lechnerberg, Kaprun, Kaprun valley, Hohe Tauern, Salzburg, Austria |
| Felbertalite (TL) |  |
|---|
| Formula: | Cu2Pb6Bi8S19 |
| Type Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| Reference: | Topa, D., Makovicky, E., Criddle, A. J., Paar, W. H., Balić-Žunić, T. (2001): Felbertalite, Cu2Pb6Bi8S19, a new mineral species from Felbertal, Salzburg Province, Austria. European Journal of Mineralogy 13, 961-972; Kolitsch, U. (2009): 1585) Gustavit und andere Pb-Bi-Sulfosalze vom Westfeld des Scheelitbergbaues Felbertal, Salzburg. P. 207 in: Niedermayr, G. et al. (2009): Neue Mineralfunde aus Österreich LVIII. Carinthia II, 199/119, 189-236. |
| Localities: | Recorded from at least 1 other locality in this region. |
|
|
|
|
| Photo: © Thomas Witzke. Felbertalite from Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| 'Feldspar Group' |  |
|---|
| Localities: | Reported from at least 53 localities in this region. |
|
|
|
|
|
|
|
| Photo: © ReMi. Feldspar Group from Stubenberg Quarry, Stubenberg am See, Weiz, Styria, Austria |
| Felsőbányaite |  |
|---|
| Formula: | Al4(SO4)(OH)10 · 4H2O |
| Localities: | Hematite Mine, Waldenstein, Koralpe, Carinthia, Austria Graphite quarry, Amstall, Mühldorf, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
| Photo: © Erwin Löffler. Felsőbányaite from Graphite quarry, Amstall, Mühldorf, Waldviertel, Lower Austria, Austria |
| Ferberite |  |
|---|
| Formula: | FeWO4 |
| Localities: | Hoher Steig, Mallnock, Nock Mts, Gurktaler Alpen, Carinthia, Austria Gold Mines, Radhausberg, Kreuzkogel massif, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria Rote Burg, Mallnock, Nock Mts, Gurktaler Alpen, Carinthia, Austria Kleefelderkopf, Obersulzbach valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
| Photo: © AC. Ferberite from Mallnock, Nock Mts, Gurktaler Alpen, Carinthia, Austria |
| Fergusonite-(Y) |  |
|---|
| Formula: | YNbO4 |
| Localities: | Hopffeldboden, Hopffeld area, Obersulzbach valley, Hohe Tauern, Salzburg, Austria Oberschrammach glacier, Schrammacher, Zamser Grund (Zams valley), Zillertal, North Tyrol, Tyrol, Austria Schrammach ridge, Schrammacher, Zamser Grund (Zams valley), Zillertal, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
| Photo: © GiovanniFraccaro. Fergusonite-(Y) from Hopffeldboden, Hopffeld area, Obersulzbach valley, Hohe Tauern, Salzburg, Austria |
| 'Ferrierite' |  |
|---|
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Photo: © 2008 Jesse Crawford. Ferrierite from S6 motorway tunnel, Tanzenberg, Kapfenberg, Bruck an der Mur, Styria, Austria |
| Ferrierite-Mg |  |
|---|
| Formula: | (Mg,Na2,K2,Ca)3-5Mg[Al5-7Si27.5-31O72] · 18H2O |
| Localities: | Basalt quarry, Weitendorf, Wildon, Graz, Styria, Austria Knappenberg, Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria Haider quarry, Radl pass, Eibiswald, Wies, Koralpe, Styria, Austria
|
|
|
|
|
|
|
| Photo: © Elmar Lackner. Ferrierite-Mg from Basalt quarry, Weitendorf, Wildon, Graz, Styria, Austria |
| Ferrihydrite | |
|---|
| Formula: | Fe3+5O3(OH)9 |
| Locality: | Stocker adit, Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Ferrimolybdite | |
|---|
| Formula: | Fe2(MoO4)3 · nH2O |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
|
| Ferrisicklerite | |
|---|
| Formula: | Li1-x(Fe3+xFe2+1-x)PO4 |
| Locality: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
|
|
|
|
|
|
|
| Ferrisymplesite | |
|---|
| Formula: | Fe3+3(AsO4)2(OH)3 · 5H2O |
| Locality: | Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
| Ferro-Actinolite | |
|---|
| Formula: | ☐{Ca2}{Fe2+5}(Si8O22)(OH)2 |
| Localities: | Arzberg, Kottaun, Geras, Waldviertel, Lower Austria, Austria Putzkammer Alp, Rinder valley (Gafluna valley), Verwall group, Montafon, Vorarlberg, Austria
|
|
|
|
|
|
|
|
| 'Ferro-Actinolite-Tremolite Series var: Nephrite' | |
|---|
| Locality: | Zederhaus, Zederhaus valley, Lungau, Salzburg, Austria |
|
|
|
|
|
|
|
|
| Ferrohexahydrite | |
|---|
| Formula: | FeSO4 · 6H2O |
| Locality: | Diabase quarry, Biberg (Bieberg), Saalfelden, Salzburg, Austria |
|
|
|
|
|
|
|
| Ferro-hornblende | |
|---|
| Formula: | ☐{Ca2}{Fe2+4Al}(AlSi7O22)(OH)2 |
| Localities: | Railway tunnel, Galgenberg, Leoben, Styria, Austria Arzberg, Kottaun, Geras, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
| Ferro-katophorite | |
|---|
| Formula: | {Na}{CaNa}{Fe2+4Al}[(AlSi7)O22](OH)2 |
| Locality: | Karlstein an der Thaya, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| Ferrorhodsite | |
|---|
| Formula: | (Fe,Cu)(Rh,Ir,Pt)2S4 |
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Ferrosilite | |
|---|
| Formula: | FeSiO3 |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
| Fersmite | |
|---|
| Formula: | (Ca,Y)(Nb,Ta,Ti)2(O,OH)6 |
| Locality: | Stoffhütte, St Oswald, Deutschlandsberg, Koralpe, Styria, Austria |
|
|
|
|
|
|
|
| Fibroferrite | |
|---|
| Formula: | Fe3+(SO4)(OH) · 5H2O |
| Localities: | Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Sternspitze, Zanaischg (Zaneischg), Pölla valley, Hafner group, Hohe Tauern, Carinthia, Austria Raidlgraben ("Radelgraben"), Fritzbach valley, Pöham, Werfen, Salzburg, Austria
|
|
|
|
|
|
|
|
| Fiedlerite |  |
|---|
| Formula: | Pb3FCl4(OH) · H2O |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Schreiber Fritz. Fiedlerite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| 'Flint' | |
|---|
| Locality: | Loiwein, Lichtenau im Waldviertel, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
|
| 'Florencite' | |
|---|
| Localities: | Bartholomäberg, Montafon, Vorarlberg, Austria Lippnik Feldspar quarry, Lieser ravine, Spittal, Millstatt lake ridge, Carinthia, Austria
|
|
|
|
|
|
|
|
|
| Florencite-(Ce) | |
|---|
| Formula: | CeAl3(PO4)2(OH)6 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Florencite-(La) | |
|---|
| Formula: | LaAl3(PO4)2(OH)6 |
| Locality: | Ganz valley, Hönigsberg, Mürzzuschlag, Fischbacher Alpen, Styria, Austria |
|
|
|
|
|
|
|
| Fluorapatite |  |
|---|
| Formula: | Ca5(PO4)3F |
| Localities: | Reported from at least 65 localities in this region. |
|
|
|
|
|
|
| Photo: © www.mineralienkluft.at. Fluorapatite from Kar Alp area, Habach valley, Hohe Tauern, Salzburg, Austria |
| Fluorapatite var: Carbonate-rich Fluorapatite |  |
|---|
| Formula: | Ca5(PO4,CO3)3(F,O) |
| Localities: | Reported from at least 37 localities in this region. |
|
|
|
|
|
|
| Photo: © Dan & Diana Weinrich Minerals. Carbonate-rich Fluorapatite from Leiterkogel, Habach valley, Hohe Tauern, Salzburg, Austria |
| Fluorapatite var: Staffelite | |
|---|
| Locality: | Bregenzerwald, Vorarlberg, Austria |
|
|
|
|
|
|
|
|
| Fluorite |  |
|---|
| Formula: | CaF2 |
| Localities: | Reported from at least 254 localities in this region. |
|
|
|
|
|
|
| Photo: © Peter Haas. Fluorite from Weißeck area, Murwinkel, Lungau, Salzburg, Austria |
| Fluoro-edenite |  |
|---|
| Formula: | {Na}{Ca2}{Mg5}(AlSi7O22)(F,OH)2 |
| Locality: | Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
|
|
|
|
|
|
| Photo: Fluoro-edenite from Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
| Fluoro-richterite | |
|---|
| Formula: | {Na}{CaNa}{Mg5}(Si8O22)(F,OH)2 |
| Locality: | Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
|
|
|
|
|
|
|
| Forsterite |  |
|---|
| Formula: | Mg2SiO4 |
| Localities: | Reported from at least 18 localities in this region. |
|
|
|
|
|
|
| Photo: Forsterite from Totenkopf, Stubach valley, Hohe Tauern, Salzburg, Austria |
| Fougèrite | |
|---|
| Formula: | Fe2+4Fe3+2(OH)12[CO3]·3H2O |
| Locality: | Slag localities, St Martin am Silberberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
| Fourmarierite | |
|---|
| Formula: | Pb(UO2)4O3(OH)4 · 4H2O |
| Locality: | Anna adit, Mitterberg District, St Johann im Pongau, Salzburg, Austria |
|
|
|
|
|
|
|
| Fraipontite |  |
|---|
| Formula: | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Locality: | Stefanie Mine, Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
|
|
|
|
|
|
| Photo: Fraipontite from Stefanie Mine, Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Franklinite | |
|---|
| Formula: | Zn2+Fe3+2O4 |
| Locality: | Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria |
|
|
|
|
|
|
|
| Freibergite |  |
|---|
| Formula: | Ag6[Cu4Fe2]Sb4S13-x |
| Localities: | Reported from at least 28 localities in this region. |
|
|
|
|
|
|
| Photo: Freibergite from Rotenstein, Komperdell, Serfaus, Pfunds, Inn valley, North Tyrol, Tyrol, Austria |
| Friedelite |  |
|---|
| Formula: | (Mn,Fe)8Si6O15(OH,Cl)10 |
| Localities: | Navis stream, Navis valley, Sill valley (Wipp valley), North Tyrol, Tyrol, Austria Friedlkogel (Friedelkogel; Heinzlkogel), Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria Kaskogel (Kaskögerl), Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria Ködnitz valley, Kals valley, East Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
| Photo: © Franz Bernhard. Friedelite from Friedlkogel, Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria |
| Friedrichite (TL) | |
|---|
| Formula: | Pb5Cu5Bi7S18 |
| Type Locality: | Sedl, Leckbachgraben (Leckbachrinne), Nasenkopf, Habach valley, Hohe Tauern, Salzburg, Austria |
| Reference: | Can.Min.(1978) 16, 127-130 |
| Localities: | Recorded from at least 2 other localities in this region. |
|
|
|
|
|
| Furutobeite | |
|---|
| Formula: | (Cu,Ag)6PbS4 |
| Locality: | Erasmus adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
|
|
|
|
|
|
|
| 'Gadolinite' | |
|---|
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
|
| Gadolinite-(Ce) |  |
|---|
| Formula: | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Localities: | Emerald deposit, Leckbachgraben (Leckbachrinne), Nasenkopf, Habach Valley, Hohe Tauern, Salzburg, Austria Municipal quarry (Dick quarry), Böckstein, Gastein valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
| Photo: © mslama. Gadolinite-(Ce) from Municipal quarry, Böckstein, Gastein valley, Hohe Tauern, Salzburg, Austria |
| 'Gadolinite-Datolite Group' | |
|---|
| Locality: | Power station, Sportgastein, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
|
| Gadolinite-(Y) |  |
|---|
| Formula: | Y2Fe2+Be2Si2O10 |
| Localities: | Municipal quarry (Dick quarry), Böckstein, Gastein valley, Hohe Tauern, Salzburg, Austria Moos, Böckstein, Gastein valley, Hohe Tauern, Salzburg, Austria Abichl Alp - Beryller area, Untersulzbach valley, Hohe Tauern, Salzburg, Austria Oberschrammach glacier, Schrammacher, Zamser Grund (Zams valley), Zillertal, North Tyrol, Tyrol, Austria Abichl Alp, Abichl Alp - Beryller area, Untersulzbach valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
| Photo: © mslama. Gadolinite-(Y) from Abichl Alp - Beryller area, Untersulzbach valley, Hohe Tauern, Salzburg, Austria |
| 'Gagates' | |
|---|
| Localities: | Sandlgraben, Weißwasser, Steyr-Land, Upper Austria, Austria Bad Ischl, Gmunden, Upper Austria, Austria Sendlberg quarry, Wiestal reservoir, Hallein, Salzburg, Austria
|
|
|
|
|
|
|
|
|
| Gahnite |  |
|---|
| Formula: | ZnAl2O4 |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Gahnite from Rotbachlspitze, Pfitsch pass, Zamser Grund, Zillertal, North Tyrol, Tyrol, Austria |
| Galena |  |
|---|
| Formula: | PbS |
| Localities: | Reported from at least 527 localities in this region. |
|
|
|
|
|
|
| Photo: © Peter Haas. Galena from Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Galena var: Argentiferous Galena | |
|---|
| Localities: | Reported from at least 22 localities in this region. |
|
|
|
|
|
|
|
|
| Galenobismutite |  |
|---|
| Formula: | PbBi2S4 |
| Localities: | Reported from at least 14 localities in this region. |
|
|
|
|
|
|
| Photo: © Antonio Borrelli. Galenobismutite from Ödenkar, Kreuzkogel massif, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria |
| Galgenbergite-(Ce) (TL) |  |
|---|
| Formula: | Ca(Ce,La,Nd)2(CO3)4 · H2O |
| Type Locality: | Railway tunnel, Galgenberg, Leoben, Styria, Austria |
| Reference: | Hollerer, C.E. (1998): Ca(REE)2(CO3)4·H2O, a new mineral from Steiermark, Austria. Mitteilungen der Österreichschen Mineralogischen Gesellschaft (1998) 143, 200-201. |
|
|
|
|
|
| Photo: Galgenbergite-(Ce) from Railway tunnel, Galgenberg, Leoben, Styria, Austria |
| 'Garnet' |  |
|---|
| Formula: | X3Z2(SiO4)3 |
| Localities: | Reported from at least 87 localities in this region. |
|
|
|
|
|
|
| Photo: © www.mineralienkluft.at. Garnet from Miesling valley, Spitz, Wachau, Lower Austria, Austria |
| 'Garnet Structural Group' |  |
|---|
| Formula: | X3Z2(TO4)3 |
| Localities: | Reported from at least 24 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Garnet Structural Group from Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
| Gearksutite |  |
|---|
| Formula: | Ca[Al(F,OH)5(H2O)] |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Gearksutite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Gehlenite | |
|---|
| Formula: | Ca2Al(AlSiO7) |
| Localities: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria
|
|
|
|
|
|
|
|
| Geikielite |  |
|---|
| Formula: | MgTiO3 |
| Locality: | Stubenberg Quarry, Stubenberg am See, Weiz, Styria, Austria |
|
|
|
|
|
|
| Photo: © 0. Geikielite from Stubenberg Quarry, Stubenberg am See, Weiz, Styria, Austria |
| 'Genèvéite' | |
|---|
| Formula: | (Cu,Zn)9(AsO4)2(OH)12 · 2H2O |
| Locality: | Tyrol, Austria |
|
|
|
|
|
|
|
| Geocronite |  |
|---|
| Formula: | Pb14(Sb,As)6S23 |
| Localities: | Gold Mines, Radhausberg, Kreuzkogel massif, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria Lead mines, Obernberg am Brenner, Obernberg valley, Sill valley (Wipp valley), North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Geocronite from Lead mines, Obernberg am Brenner, Obernberg valley, Sill valley, North Tyrol, Tyrol, Austria |
| Gersdorffite (TL) |  |
|---|
| Formula: | NiAsS |
| Type Locality: | Zinkwand, Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria |
| Reference: | A. Strasser: Die Minerale Salzburgs (1989); Kolitsch, U. & Brandstätter, F. (2008); Pribitzer, F. (1956): Die Minerallagerstätte Zinkwand bei Schladming in Steiermark (Österreich). Aufschluss, 7 (3), 59-63. |
| Localities: | Recorded from at least 36 other localities in this region. |
|
|
|
|
| Photo: © hamster@aon.at. Gersdorffite from Zinkwand, Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria |
| Gersdorffite var: Antimonian Gersdorffite |  |
|---|
| Formula: | Ni(As,Sb)S |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Antimonian Gersdorffite from Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Gibbsite | |
|---|
| Formula: | Al(OH)3 |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
|
| Giessenite | |
|---|
| Formula: | Pb27Cu2(Bi,Sb)19S57 |
| Localities: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria Goldzeche, Zirmsee area, Kleine Fleiß valley, Goldberg group, Hohe Tauern, Carinthia, Austria Gold mine, Kölnbreinspitze - Lausnock area, Malta valley, Hohe Tauern, Carinthia, Austria Kölnbreinkar, Kölnbreinspitze - Lausnock area, Malta valley, Hohe Tauern, Carinthia, Austria
|
|
|
|
|
|
|
|
| 'Gismondine' |  |
|---|
| Localities: | Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria Serpentinite quarry, Pingendorf, Drosendorf-Zissersdorf, Waldviertel, Lower Austria, Austria Trandorf, Mühldorf, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
| Photo: © DM 06. Gismondine from Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria |
| Gismondine-Ca | |
|---|
| Formula: | CaAl2Si2O8 · 4H2O |
| Locality: | S35 motorway tunnel (Kirchdorf tunnel), Kirchdorf, Frohnleiten, Styria, Austria |
|
|
|
|
|
|
|
| Gladite | |
|---|
| Formula: | PbCuBi5S9 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| 'Glaskopf' |  |
|---|
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
|
| Photo: © 0. Glaskopf from Buchwald, Waldbach, Birkfeld, Styria, Austria |
| 'Glass' | |
|---|
| Locality: | Köfels, Umhausen, Ötz valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
|
| Glauberite |  |
|---|
| Formula: | Na2Ca(SO4)2 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
| Photo: © Jakub Jirásek. Glauberite from Rock salt deposit, Dürrnberg, Hallein, Salzburg, Austria |
| Glaucocerinite | |
|---|
| Formula: | (Zn1-xAlx)(OH)2(SO4)x/2 · nH2O |
| Locality: | Viehhofen, Kitzbühel Alps, Salzburg, Austria |
|
|
|
|
|
|
|
| Glaucodot | |
|---|
| Formula: | (Co0.50Fe0.50)AsS |
| Localities: | Blauwand adit, Knappenwand area, Untersulzbach valley, Hohe Tauern, Salzburg, Austria Glückauf Mine, Ulpen Cu deposit (Kaunz Alp; Hochleger; Keller pass; Öxel valley), Schwaz, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Hochfeld Mine, Untersulzbach valley, Hohe Tauern, Salzburg, Austria Plangeross-Mandarfen (Plangeroß-Mandarfen), Pitz valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| Glauconite | |
|---|
| Formula: | (K,Na)(Fe3+,Al,Mg)2((Si,Al)4O10)(OH)2 |
| Localities: | Reported from at least 11 localities in this region. |
|
|
|
|
|
|
|
| Glaucophane | |
|---|
| Formula: | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Glaukosphaerite |  |
|---|
| Formula: | (Cu,Ni)2(CO3)(OH)2 |
| Localities: | Stocker adit, Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Flirsch ski hut, Flirsch, Stanz valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
| Photo: © Walter Hajek. Glaukosphaerite from Flirsch ski hut, Flirsch, Stanz valley, North Tyrol, Tyrol, Austria |
| Goethite |  |
|---|
| Formula: | α-Fe3+O(OH) |
| Localities: | Reported from at least 179 localities in this region. |
|
|
|
|
|
|
| Photo: Goethite from Rigausbach valley, Seydegg, Abtenau, Salzburg, Austria |
| Gold |  |
|---|
| Formula: | Au |
| Localities: | Reported from at least 179 localities in this region. |
|
|
|
|
|
|
| Photo: © . Gold from Waschgang Mine, Kluidscharte, Kleine Zirknitz valley, Zirknitz, Goldberg group, Hohe Tauern, Carinthia, Austria |
| Gold var: Electrum |  |
|---|
| Formula: | (Au, Ag) |
| Localities: | Reported from at least 11 localities in this region. |
|
|
|
|
|
|
| Photo: © mslama. Electrum from Rauriser Goldberg, Kolm-Saigurn, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| 'Gold Amalgam' |  |
|---|
| Locality: | Anna adit, Mitterberg District, St Johann im Pongau, Salzburg, Austria |
|
|
|
|
|
|
|
| Photo: © . Gold Amalgam from Anna adit, Mitterberg District, St Johann im Pongau, Salzburg, Austria |
| Gonnardite |  |
|---|
| Formula: | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Localities: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria Steinberg, Mühldorf, Feldbach, Styria, Austria
|
|
|
|
|
|
|
| Photo: © DM 06. Gonnardite from Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
| Gorceixite | |
|---|
| Formula: | BaAl3(PO4)2(OH)5 · H2O |
| Localities: | Inselberg, Rettenegg, Fischbacher Alpen, Styria, Austria Lippnik Feldspar quarry, Lieser ravine, Spittal, Millstatt lake ridge, Carinthia, Austria Elmleiten, Fischbach, Fischbacher Alpen, Styria, Austria Faschingbauerkreuz - Reithkogel area (Gießhübler Berg; Gießhübler Holzschlag), Fischbach, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
|
| Görgeyite (TL) | |
|---|
| Formula: | K2Ca5(SO4)6 · H2O |
| Type Locality: | Ischler Salzberg, Perneck, Bad Ischl, Gmunden, Upper Austria, Austria |
| Reference: | N.Jahrb.Min.,Mh.(1953), 35-44 |
|
|
|
|
|
|
| Gormanite |  |
|---|
| Formula: | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| Localities: | Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria Hahnenkofel, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © Antonio Borrelli. Gormanite from Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
| Gortdrumite |  |
|---|
| Formula: | (Cu,Fe)6Hg2S5 |
| Locality: | Neuschurf adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
|
|
|
|
|
|
| Photo: © AL. Gortdrumite from Neuschurf adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
| Goslarite | |
|---|
| Formula: | ZnSO4 · 7H2O |
| Localities: | Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria Schwarzwand, Hüttschlag, Großarl valley, Radstädter Tauern, Salzburg, Austria Brenntal, Mühlbach im Pinzgau, Mittersill, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
| Goyazite |  |
|---|
| Formula: | SrAl3(PO4)2(OH)5 · H2O |
| Localities: | Reported from at least 12 localities in this region. |
|
|
|
|
|
|
| Photo: Goyazite from Höllkogel, Alpl, Freßnitzgraben, Krieglach, Fischbacher Alpen, Styria, Austria |
| Graftonite | |
|---|
| Formula: | (Fe2+,Mn2+,Ca)3(PO4)2 |
| Locality: | Windeckberg, Miesling valley, Spitz, Wachau, Lower Austria, Austria |
|
|
|
|
|
|
|
| 'Graphic Granite' | |
|---|
| Localities: | Neumarkt im Mühlkreis area, Freistadt, Mühlviertel, Upper Austria, Austria Pfenningberg, Steyregg, Urfahr-Umgebung, Mühlviertel, Upper Austria, Austria Kastendorf, Freistadt, Mühlviertel, Upper Austria, Austria Friesenegg, Linz-Land, Upper Austria, Austria
|
|
|
|
|
|
|
|
|
| Graphite |  |
|---|
| Formula: | C |
| Localities: | Reported from at least 121 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Graphite from Graphite mine, Kaisersberg, Leoben, Styria, Austria |
| Greenockite |  |
|---|
| Formula: | CdS |
| Localities: | Reported from at least 56 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Greenockite from Lead mine, Graschnitzgraben, St. Marein, Fischbacher Alpen, Styria, Austria |
| Greifensteinite | |
|---|
| Formula: | Ca2Fe2+5Be4(PO4)6(OH)4 · 6H2O |
| Locality: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
|
|
|
|
|
|
|
| Grossular |  |
|---|
| Formula: | Ca3Al2(SiO4)3 |
| Localities: | Reported from at least 39 localities in this region. |
|
|
|
|
|
|
| Photo: © 2002 John H. Betts. Grossular from Pfitsch pass, Zamser Grund, Zillertal, North Tyrol, Tyrol, Austria |
| Grossular var: Hessonite |  |
|---|
| Localities: | Reported from at least 18 localities in this region. |
|
|
|
|
|
|
|
| Photo: Hessonite from Ochsenriegel, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
| Grossular var: Hibschite | |
|---|
| Formula: | Ca3Al2(SiO4)3-x(OH)4x |
| Locality: | Serpentinite quarry, Pingendorf, Drosendorf-Zissersdorf, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| Groutite | |
|---|
| Formula: | Mn3+O(OH) |
| Locality: | Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
|
|
|
|
|
|
|
| Grunerite | |
|---|
| Formula: | ☐{Fe2+2}{Fe2+5}(Si8O22)(OH)2 |
| Locality: | Kamuderkeusche, Stallhofen, Moosburg, Klagenfurt, Carinthia, Austria |
|
|
|
|
|
|
|
| Gudmundite | |
|---|
| Formula: | FeSbS |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| 'Gummite' | |
|---|
| Locality: | St Leonhard auf der Saualpe, Reisberg, Saualpe, Carinthia, Austria |
|
|
|
|
|
|
|
|
| Gustavite |  |
|---|
| Formula: | Ag3Pb5Bi11S24 |
| Localities: | Reported from at least 17 localities in this region. |
|
|
|
|
|
|
| Photo: © AL. Gustavite from Arsenic mine, Lower Rotgülden lake, Rotgülden, Murwinkel, Lungau, Salzburg, Austria |
| 'Gustavite-Lillianite Series' |  |
|---|
| Localities: | Erzwies area, Gastein valley, Hohe Tauern, Salzburg, Austria Wastlkar, Petereck, Malta valley, Hafner group, Hohe Tauern, Carinthia, Austria
|
|
|
|
|
|
|
|
| Photo: © 2009, JGW. Gustavite-Lillianite Series from Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| Gypsum |  |
|---|
| Formula: | CaSO4 · 2H2O |
| Localities: | Reported from at least 289 localities in this region. |
|
|
|
|
|
|
| Photo: © 2005 - S.Menig. Gypsum from Hallstatt, Gmunden, Upper Austria, Austria |
| Gypsum var: Alabaster | |
|---|
| Localities: | Grünau, Gastern, Waldviertel, Lower Austria, Austria Haidbachgraben (Myrthengraben; Myrtengraben; Heidbachgraben), Semmering, Industrieviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
|
| Gypsum var: Selenite |  |
|---|
| Localities: | Reported from at least 20 localities in this region. |
|
|
|
|
|
|
|
| Photo: © Rob Lavinsky. Selenite from Ebensee, Gmunden, Upper Austria, Austria |
| Haiweeite |  |
|---|
| Formula: | Ca(UO2)2[Si5O12(OH)2] · 4.5H2O |
| Locality: | Pasel adit, Radhausberg, Kreuzkogel massif, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Haiweeite from Pasel adit, Radhausberg, Kreuzkogel massif, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria |
| Halite |  |
|---|
| Formula: | NaCl |
| Localities: | Reported from at least 14 localities in this region. |
|
|
|
|
|
|
| Photo: © . Halite from Salt mine, Hallstatt, Gmunden, Upper Austria, Austria |
| 'Halloysite' |  |
|---|
| Formula: | Al2(Si2O5)(OH)4 |
| Localities: | Reported from at least 10 localities in this region. |
|
|
|
|
|
|
| Photo: Halloysite from Waldkirchen an der Thaya, Waldviertel, Lower Austria, Austria |
| 'Halloysite var: Cuprian Halloysite' | |
|---|
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
|
| Halloysite-10Å |  |
|---|
| Formula: | Al2Si2O5(OH)4 · 2H2O |
| Locality: | Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Halloysite-10Å from Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria |
| Halotrichite |  |
|---|
| Formula: | FeAl2(SO4)4 · 22H2O |
| Localities: | Reported from at least 11 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Halotrichite from Spitzmühle quarry, Leutschach, Styria, Austria |
| Hammarite |  |
|---|
| Formula: | Pb2Cu2Bi4S9 |
| Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
| Photo: © Simone Citon. Hammarite from Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| Hannebachite |  |
|---|
| Formula: | CaSO3 · H2O |
| Localities: | Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © . Hannebachite from Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria |
| Harmotome |  |
|---|
| Formula: | (Ba0.5,Ca0.5,K,Na)5[Al5Si11O32] · 12H2O |
| Localities: | Reported from at least 20 localities in this region. |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Harmotome from Seebachplaike, Seebach valley, Obersulzbach valley, Hohe Tauern, Salzburg, Austria |
| 'Hartine' | |
|---|
| Locality: | Lignite mines, Hart, Enzenreith, Industrieviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
|
| Hartite (TL) |  |
|---|
| Formula: | C20H34 |
| Type Locality: | Lignite mines, Hart, Enzenreith, Industrieviertel, Lower Austria, Austria |
| Reference: | W. v. Haidinger: Pogg. Ann. 54 (1841) |
| Localities: | Recorded from at least 3 other localities in this region. |
|
|
|
|
| Photo: © AC. Hartite from Köflach - Voitsberg lignite deposit, Köflach, Styria, Austria |
| Hastingsite | |
|---|
| Formula: | {Na}{Ca2}{Fe2+4Fe3+}(Al2Si6O22)(OH)2 |
| Locality: | Knappenwand area, Untersulzbach valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Hausmannite | |
|---|
| Formula: | MnMn2O4 |
| Localities: | Valentintörl, Podlanig, Lesach valley, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria Schmieding glacier, Kaprun valley, Hohe Tauern, Salzburg, Austria Mooser dam, Mooserboden reservoir, Kaprun valley, Hohe Tauern, Salzburg, Austria Lower Ferschbach Alp, Ferschbach valley, Fellern, Stubach valley, Hohe Tauern, Salzburg, Austria Radiolarite outcrop (incl. Gfererloch), Fuchs Alp - Fuchs lake area (incl. Schwarz Alp; Schwarz lake; Kohlsberg Alp), Taurach valley, Lungau, Salzburg, Austria
|
|
|
|
|
|
|
|
| Haüyne |  |
|---|
| Formula: | (Na,Ca)4-8(Al6Si6(O,S)24)(SO4,Cl)1-2 |
| Localities: | Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria
|
|
|
|
|
|
|
| Photo: © AC. Haüyne from Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
| Hawleyite | |
|---|
| Formula: | CdS |
| Localities: | Putzkammer Alp, Rinder valley (Gafluna valley), Verwall group, Montafon, Vorarlberg, Austria Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria
|
|
|
|
|
|
|
|
| Heazlewoodite | |
|---|
| Formula: | Ni3S2 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Hedenbergite | |
|---|
| Formula: | CaFe2+Si2O6 |
| Localities: | Reported from at least 10 localities in this region. |
|
|
|
|
|
|
|
| Hedleyite | |
|---|
| Formula: | Bi7Te3 |
| Locality: | Pyrrhotite prospect, Ebriach, Bad Eisenkappel (Bad Eisenkappl), Karawanken, Carinthia, Austria |
|
|
|
|
|
|
|
| Helvine |  |
|---|
| Formula: | Mn2+4(Be3Si3O12)S |
| Localities: | Doppelbachgraben (Tobelbachgraben), Maiersch, Gars am Kamp, Waldviertel, Lower Austria, Austria Kaskogel (Kaskögerl), Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria Oberschrammach glacier, Schrammacher, Zamser Grund (Zams valley), Zillertal, North Tyrol, Tyrol, Austria Friedlkogel (Friedelkogel; Heinzlkogel), Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria
|
|
|
|
|
|
|
| Photo: © AC. Helvine from Friedlkogel, Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria |
| Hematite |  |
|---|
| Formula: | Fe2O3 |
| Localities: | Reported from at least 318 localities in this region. |
|
|
|
|
|
|
| Photo: © mk. Hematite from Lohning quarry, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| Hematite var: Iron Rose |  |
|---|
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Photo: Iron Rose from Schlegeis tunnel, Zemmgrund, Zillertal, North Tyrol, Tyrol, Austria |
| Hematite var: Martite | |
|---|
| Locality: | Sieggrabener Kogel (Sieggrabner Kogel), Sieggraben, Mattersburg, Burgenland, Austria |
|
|
|
|
|
|
|
|
| Hematite var: Specularite | |
|---|
| Localities: | Reported from at least 22 localities in this region. |
|
|
|
|
|
|
|
|
| Hemimorphite |  |
|---|
| Formula: | Zn4Si2O7(OH)2 · H2O |
| Localities: | Reported from at least 90 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Hemimorphite from Rudnik, Petschnitzen, Faak lake area, Villach, Carinthia, Austria |
| Hercynite | |
|---|
| Formula: | Fe2+Al2O4 |
| Localities: | Dunkelsteinerwald, Dunkelstein Forest, Mostviertel, Lower Austria, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria Luftenberg, St Georgen an der Gusen, Perg, Mühlviertel, Upper Austria, Austria
|
|
|
|
|
|
|
|
| Hercynite var: Picotite | |
|---|
| Formula: | (Fe,Mg)(Al,Cr)2O4 |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
|
| Herderite ? | |
|---|
| Formula: | CaBePO4(F,OH) |
| Locality: | Luftenberg, St Georgen an der Gusen, Perg, Mühlviertel, Upper Austria, Austria - erroneously reported |
|
|
|
|
|
|
|
| 'Herschelite' | |
|---|
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
|
| Hessite | |
|---|
| Formula: | Ag2Te |
| Localities: | Reported from at least 16 localities in this region. |
|
|
|
|
|
|
|
| Heteromorphite | |
|---|
| Formula: | Pb7Sb8S19 |
| Localities: | Mitterberg District, St Johann im Pongau, Salzburg, Austria Wölch, Frantschach-St Gertraud, Carinthia, Austria ? (more information)
|
|
|
|
|
|
|
|
| Heterosite |  |
|---|
| Formula: | (Fe3+,Mn3+)PO4 |
| Localities: | Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Heterosite from Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
| 'Heulandite' |  |
|---|
| Localities: | Reported from at least 69 localities in this region. |
|
|
|
|
|
|
|
| Photo: © . Heulandite from Irsa quarry, Pflüglhof Inn, Koschach, Malta valley, Hohe Tauern, Carinthia, Austria |
| Heulandite-Ca | |
|---|
| Formula: | (Ca,Na)2-3Al3(Al,Si)2Si13O36 · 12H2O |
| Localities: | Rath quarry, Marhof, Stainz, Koralpe, Styria, Austria Lower Gsall valley, Vergötschen, Feichten, Kauns valley, North Tyrol, Tyrol, Austria Quarry IV- Southern Area, Loja, Persenbeug-Gottsdorf, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
| Hexahydrite |  |
|---|
| Formula: | MgSO4 · 6H2O |
| Localities: | Reported from at least 11 localities in this region. |
|
|
|
|
|
|
| Photo: © 2010 Jesse Crawford. Hexahydrite from Breitenbuchen, Oberbuchach, Kirchbach, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Heyite | |
|---|
| Formula: | Pb5Fe2+2(VO4)2O4 |
| Locality: | Nepomuk Mine, Galmeikogel, Annaberg, Mostviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| Heyrovskýite |  |
|---|
| Formula: | Pb10AgBi5S18 |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Heyrovskýite from Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| Hinsdalite | |
|---|
| Formula: | PbAl3(PO4)(SO4)(OH)6 |
| Localities: | No. 1 adit, Äußere Wimitz, St Veit an der Glan, Gurktaler Alpen, Carinthia, Austria Kaltenegg, Southern District, Prinzkogel mines, Prinzkogel (Prinzenkogel), Rettenegg, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
|
| 'Hinsdalite-Plumbogummite Series' | |
|---|
| Locality: | Stüblbau Mine, Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria |
|
|
|
|
|
|
|
|
| Hocartite | |
|---|
| Formula: | Ag2(Fe2+,Zn)SnS4 |
| Localities: | Niedermüller Alp, Kreuzeck area, Kreuzeck group, Carinthia, Austria Plattach, Kreuzeck area, Kreuzeck group, Carinthia, Austria
|
|
|
|
|
|
|
|
| Hodrušite |  |
|---|
| Formula: | Cu8Bi12S22 |
| Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
| Photo: © mslama. Hodrušite from Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| Hollandite |  |
|---|
| Formula: | Ba(Mn4+6Mn3+2)O16 |
| Localities: | Ködnitz valley, Kals valley, East Tyrol, Tyrol, Austria Magnetite deposit, Sonntagsberg, St Veit an der Glan, Gurktaler Alpen, Carinthia, Austria Marble quarry (Bürgergilt quarry; Bürgergilde quarry), Olsa, Friesach, Friesach - Hüttenberg area, Carinthia, Austria Holler quarry, Badersdorf, Großpetersdorf, Burgenland, Austria Huteralm (Hutteralm), Ködnitz valley, Kals valley, East Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
| Photo: © Franz Brandstätter & Uwe Kolitsch. Hollandite from Huteralm, Ködnitz valley, Kals valley, East Tyrol, Tyrol, Austria |
| Hollingworthite | |
|---|
| Formula: | (Rh,Pt,Pd)AsS |
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Holmquistite |  |
|---|
| Formula: | ☐{Li2}{Mg3Al2}(Si8O22)(OH)2 |
| Localities: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria Lug-ins-Land, Spittal, Millstatt lake ridge, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Holmquistite from Spodumene prospect, Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
| 'Hornblende' |  |
|---|
| Localities: | Reported from at least 72 localities in this region. |
|
|
|
|
|
|
|
| Photo: © 2003 John H. Betts. Hornblende from Gösleswand, Prägraten, Virgen Valley, East Tyrol, Tyrol, Austria |
| 'Hornblende var: Hornblende-asbestos' |  |
|---|
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
|
| Photo: © AC. Hornblende-asbestos from Diabase quarry, Ebriachgraben, Ebriach, Bad Eisenkappel, Karawanken, Carinthia, Austria |
| Hörnesite |  |
|---|
| Formula: | Mg3(AsO4)2 · 8H2O |
| Localities: | Reported from at least 11 localities in this region. |
|
|
|
|
|
|
| Photo: © AL. Hörnesite from Prehistoric dump, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
| 'Hornstein' | |
|---|
| Localities: | Kaintaleck Mine (Kaintalegg Mine; Hohenburg deposit), Magnesite deposit, Oberdorf an der Laming, Laming valley, Bruck an der Mur, Styria, Austria Gusenscharte, Stockenboi, Paternion, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria
|
|
|
|
|
|
|
|
|
| Hübnerite | |
|---|
| Formula: | MnWO4 |
| Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| 'Hullite' | |
|---|
| Locality: | Basalt quarry, Weitendorf, Wildon, Graz, Styria, Austria |
|
|
|
|
|
|
|
|
| Humboldtine |  |
|---|
| Formula: | Fe2+(C2O4) · 2H2O |
| Locality: | Lechnerberg (slag locality), Kaprun, Kaprun valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
| Photo: © Harald Schillhammer. Humboldtine from Lechnerberg, Kaprun, Kaprun valley, Hohe Tauern, Salzburg, Austria |
| Humite ? | |
|---|
| Formula: | (Mg,Fe2+)7(SiO4)3(F,OH)2 |
| Locality: | Lamprechtsberg, Ettendorf, Koralpe, Carinthia, Austria - erroneously reported |
|
|
|
|
|
|
|
| Huntite |  |
|---|
| Formula: | CaMg3(CO3)4 |
| Localities: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria Hengl Quarry, Eibenstein an der Thaya, Raabs an der Thaya, Waldviertel, Lower Austria, Austria Amstall, Mühldorf, Waldviertel, Lower Austria, Austria Graphite deposit, Dürnberg, Dunkelsteinerwald, Dunkelstein Forest, Mostviertel, Lower Austria, Austria
|
|
|
|
|
|
|
| Photo: © . Huntite from Graphite quarry, Amstall, Mühldorf, Waldviertel, Lower Austria, Austria |
| Hydrobiotite | |
|---|
| Formula: | K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O |
| Locality: | Niedere Barm, Alpenrose Inn, Zemmgrund, Zillertal, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Hydrocalumite | |
|---|
| Formula: | Ca8Al4(OH)12(Cl,CO3,OH)2-x · 4H2O |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
| Hydrocerussite |  |
|---|
| Formula: | Pb3(CO3)2(OH)2 |
| Localities: | Reported from at least 12 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Hydrocerussite from Kaltenegg, Southern District, Prinzkogel mines, Prinzkogel, Rettenegg, Fischbacher Alpen, Styria, Austria |
| Hydrohalite (TL) | |
|---|
| Formula: | NaCl · 2H2O |
| Type Locality: | Rock salt deposit, Dürrnberg, Hallein, Salzburg, Austria |
| Description: | constituent of low temperature precipitates in brine ducts |
| Reference: | Hausmann (1847); C. Hintze: Handbuch der Mineralogie, Vol. 1, p. 2231 (1911); Dana, 7th ed. (1944), v.2, 15. Acta Cryst. B30 (1974), 2363. |
|
|
|
|
|
| Hydromagnesite |  |
|---|
| Formula: | Mg5(CO3)4(OH)2 · 4H2O |
| Localities: | Reported from at least 14 localities in this region. |
|
|
|
|
|
|
| Photo: © Thomas Witzke. Hydromagnesite from Lobminggraben, St Stefan, Kraubath, Leoben, Styria, Austria |
| 'Hydromuscovite' | |
|---|
| Localities: | Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria Luftenberg, St Georgen an der Gusen, Perg, Mühlviertel, Upper Austria, Austria
|
|
|
|
|
|
|
|
|
| Hydroniumjarosite | |
|---|
| Formula: | (H3O)Fe3+3(SO4)2(OH)6 |
| Localities: | Cu deposit, Lading, Saualpe, Carinthia, Austria Magnesite deposit, Sattlerkogel, Veitsch, Mitterdorf, Styria, Austria
|
|
|
|
|
|
|
|
| Hydrotalcite |  |
|---|
| Formula: | Mg6Al2(OH)16[CO3] · 4H2O |
| Localities: | Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria Gulsen, Kraubath, Leoben, Styria, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria
|
|
|
|
|
|
|
| Photo: © Elmar Lackner. Hydrotalcite from Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria |
| Hydrotungstite | |
|---|
| Formula: | WO3 · 2H2O |
| Locality: | Magnesite mine, Tux (Lanersbach; Lannersbach), Tux valley, Zillertal, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Hydroxylapatite |  |
|---|
| Formula: | Ca5(PO4)3(OH) |
| Localities: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria Höllkogel, Alpl, Freßnitzgraben, Krieglach, Fischbacher Alpen, Styria, Austria Holler quarry, Badersdorf, Großpetersdorf, Burgenland, Austria Freßnitzkogel, Freßnitzgraben, Krieglach, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
| Photo: © AC. Hydroxylapatite from Spodumene prospect, Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
| Hydroxylapatite var: Carbonate-rich Hydroxylapatite | |
|---|
| Formula: | Ca5(PO4,CO3)3(OH,O) |
| Localities: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria Bregenzerwald, Vorarlberg, Austria
|
|
|
|
|
|
|
|
| Hydroxylherderite |  |
|---|
| Formula: | CaBe(PO4)(OH,F) |
| Localities: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria Luftenberg, St Georgen an der Gusen, Perg, Mühlviertel, Upper Austria, Austria
|
|
|
|
|
|
|
| Photo: © mslama. Hydroxylherderite from Luftenberg, St Georgen an der Gusen, Perg, Mühlviertel, Upper Austria, Austria |
| 'Hydroxylpyromorphite' | |
|---|
| Formula: | Pb5(PO4)3(OH) |
| Locality: | Radhausberg, Kreuzkogel massif, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Hydrozincite (TL) |  |
|---|
| Formula: | Zn5(CO3)2(OH)6 |
| Type Locality: | Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Reference: | Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 248; Canadian Mineralogist (1965), 8, 385; G. Niedermayr, I. Praetzel: Mineralien Kärntens, 1995 |
| Localities: | Recorded from at least 103 other localities in this region. |
|
|
|
|
| Photo: Hydrozincite from Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| 'Hypersthene' | |
|---|
| Formula: | (Mg,Fe)SiO3 |
| Localities: | Kraubath, Leoben, Styria, Austria Granulite quarry (Wanko gravel works), Meidling, Paudorf, Dunkelstein Forest, Mostviertel, Lower Austria, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria
|
|
|
|
|
|
|
|
| Ice |  |
|---|
| Formula: | H2O |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
| Photo: Ice from Steyr, Upper Austria, Austria |
| Idaite | |
|---|
| Formula: | Cu5FeS6 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| 'Iddingsite' |  |
|---|
| Formula: | MgO · Fe2O3 · 3SiO2·4H2O |
| Localities: | Kapfensteiner Kogel, Kapfenstein, Bad Gleichenberg, Styria, Austria Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria
|
|
|
|
|
|
|
| Photo: © AC. Iddingsite from Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
| Ikunolite | |
|---|
| Formula: | Bi4(S,Se)3 |
| Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Illite | |
|---|
| Formula: | K0.65Al2.0[ ][Al0.65Si3.35O10](OH)2 |
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
|
| Ilmenite |  |
|---|
| Formula: | Fe2+TiO3 |
| Localities: | Reported from at least 145 localities in this region. |
|
|
|
|
|
|
| Photo: © . Ilmenite from Kaiserer quarry, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| 'Ilsemannite' (TL) |  |
|---|
| Formula: | Mo3O8 · nH2O |
| Type Locality: | Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Reference: | Am Min 36 (1951), 609; G. Niedermayr, I. Praetzel: Mineralien Kärntens, 1995 |
| Localities: | Recorded from at least 4 other localities in this region. |
|
|
|
|
| Photo: © . Ilsemannite from Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Ilvaite | |
|---|
| Formula: | CaFe2+2Fe3+(Si2O7)O(OH) |
| Localities: | Umbal falls, Islitz Alp, Umbal valley, Virgen valley, East Tyrol, Tyrol, Austria Kulmbach, Freienberg, Stubenberg am See, Weiz, Styria, Austria ? (more information)
|
|
|
|
|
|
|
|
| Imiterite | |
|---|
| Formula: | Ag2HgS2 |
| Locality: | Ruden, Asten valley, Goldberg group, Hohe Tauern, Carinthia, Austria |
|
|
|
|
|
|
|
| Indialite | |
|---|
| Formula: | Mg2Al3(AlSi5O18) |
| Locality: | Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
|
|
|
|
|
|
|
| Irarsite | |
|---|
| Formula: | (Ir,Ru,Rh,Pt)AsS |
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Iron |  |
|---|
| Formula: | Fe |
| Localities: | Gaisberg, Molln, Kirchdorf an der Krems, Upper Austria, Austria Buchberg, Kirchdorf an der Krems, Upper Austria, Austria Losenstein, Steyr-Land, Upper Austria, Austria Zwischenbrücken, Slag localities, Steyr, Upper Austria, Austria
|
|
|
|
|
|
|
| Photo: © neschen. Iron from Zwischenbrücken, Slag localities, Steyr, Upper Austria, Austria |
| 'Iscorite' ? | |
|---|
| Formula: | Fe2+5Fe3+2SiO10 |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria - erroneously reported |
|
|
|
|
|
|
|
| Isocubanite ? | |
|---|
| Formula: | CuFe2S3 |
| Locality: | Boden, Platz, Kauns valley, North Tyrol, Tyrol, Austria - erroneously reported |
|
|
|
|
|
|
|
| Isokite | |
|---|
| Formula: | CaMg(PO4)F |
| Localities: | Höllgraben, Pfarrwerfen, Werfen, Salzburg, Austria Wengergraben, Pfarrwerfen, Werfen, Salzburg, Austria Rettenbachgraben (Schlaminggraben), Pfarrwerfen, Werfen, Salzburg, Austria
|
|
|
|
|
|
|
|
| Ixiolite var: Wolframoixiolite | |
|---|
| Formula: | (Nb,W,Ta,Fe,Mn,Nb)2O4 |
| Locality: | Maigen, Weinzierl am Walde, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| 'Ixolite' | |
|---|
| Localities: | Lignite deposit, St Stefan, Wolfsberg, Carinthia, Austria Lignite mines, Hart, Enzenreith, Industrieviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
|
| Izoklakeite | |
|---|
| Formula: | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Localities: | Goldzeche, Zirmsee area, Kleine Fleiß valley, Goldberg group, Hohe Tauern, Carinthia, Austria Gold mine, Kölnbreinspitze - Lausnock area, Malta valley, Hohe Tauern, Carinthia, Austria Kölnbreinkar, Kölnbreinspitze - Lausnock area, Malta valley, Hohe Tauern, Carinthia, Austria
|
|
|
|
|
|
|
|
| Jacobsite |  |
|---|
| Formula: | Mn2+Fe3+2O4 |
| Localities: | Mooser dam, Mooserboden reservoir, Kaprun valley, Hohe Tauern, Salzburg, Austria Ködnitz valley, Kals valley, East Tyrol, Tyrol, Austria Radiolarite outcrop (incl. Gfererloch), Fuchs Alp - Fuchs lake area (incl. Schwarz Alp; Schwarz lake; Kohlsberg Alp), Taurach valley, Lungau, Salzburg, Austria Friedlkogel (Friedelkogel; Heinzlkogel), Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria
|
|
|
|
|
|
|
| Photo: © AC. Jacobsite from Friedlkogel, Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria |
| Jahnsite-(CaMnMg) | |
|---|
| Formula: | {Ca}{Mn2+}{(Mg,Fe2+)2}{Fe3+2}(PO4)4(OH)2 · 8H2O |
| Locality: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
|
|
|
|
|
|
|
| Jamesonite |  |
|---|
| Formula: | Pb4FeSb6S14 |
| Localities: | Reported from at least 31 localities in this region. |
|
|
|
|
|
|
| Photo: © . Jamesonite from Diabase quarry, Biberg, Saalfelden, Salzburg, Austria |
| Jarosite |  |
|---|
| Formula: | KFe3+ 3(SO4)2(OH)6 |
| Localities: | Reported from at least 71 localities in this region. |
|
|
|
|
|
|
| Photo: © . Jarosite from Brandberg, Leoben, Styria, Austria |
| 'Jarosite-Natrojarosite Series' | |
|---|
| Locality: | Kanzel (incl. Brennesselloch; Vogelberg cave), Dürnstein, Wachau, Lower Austria, Austria |
|
|
|
|
|
|
|
|
| Jordanite |  |
|---|
| Formula: | Pb14(As,Sb)6S23 |
| Localities: | Gold Mines, Radhausberg, Kreuzkogel massif, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria Gypsum mine (Moldan mine), Moosegg, Grubach, Golling, Salzburg, Austria Zwieselbad, Annaberg, Abtenau, Salzburg, Austria Haidbachgraben (Myrthengraben; Myrtengraben; Heidbachgraben), Semmering, Industrieviertel, Lower Austria, Austria
|
|
|
|
|
|
|
| Photo: © . Jordanite from Zwieselbad, Annaberg, Abtenau, Salzburg, Austria |
| Jordisite | |
|---|
| Formula: | MoS2 |
| Locality: | Rudolf Mine (Rudolf Shaft), Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
|
|
|
|
|
|
|
| 'Joséite' | |
|---|
| Formula: | Bi4TeS2 |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
|
| 'Joséite-B' | |
|---|
| Formula: | Bi4Te2S |
| Locality: | Arsenic mine, Lower Rotgülden lake, Rotgülden, Murwinkel, Lungau, Salzburg, Austria |
|
|
|
|
|
|
|
| Junoite ? | |
|---|
| Formula: | Cu2Pb3Bi8(S,Se)16 |
| Locality: | Wurten tunnel, Wurten, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria - erroneously reported |
|
|
|
|
|
|
|
| Junoite var: Se-free Junoite | |
|---|
| Formula: | Cu2Pb3Bi8(S)16 |
| Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Kaersutite ? | |
|---|
| Formula: | {Na}{Ca2}{Mg3AlTi}(Al2Si6O22)O2 |
| Locality: | Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria - erroneously reported |
|
|
|
|
|
|
|
| Kahlerite (TL) |  |
|---|
| Formula: | Fe(UO2)2(AsO4)2 · 12H2O |
| Type Locality: | Knichte section, Lölling District, Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Reference: | H. Meixner: Der Karinthin 23:277-280 (1953) |
| Localities: | Recorded from at least 1 other locality in this region. |
|
|
|
|
| Photo: © AC. Kahlerite from Knichte section, Lölling District, Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Kainite | |
|---|
| Formula: | KMg(SO4)Cl · 3H2O |
| Locality: | Ischler Salzberg, Perneck, Bad Ischl, Gmunden, Upper Austria, Austria |
|
|
|
|
|
|
|
| Kainosite-(Y) |  |
|---|
| Formula: | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| Localities: | Hopffeldgraben (Hopffeld gorge), Hopffeld area, Obersulzbach valley, Hohe Tauern, Salzburg, Austria Oberer Hackenkopf, Seebach valley, Obersulzbach valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
| Photo: © D. Preite. Kainosite-(Y) from Hopffeldgraben, Hopffeld area, Obersulzbach valley, Hohe Tauern, Salzburg, Austria |
| Kalsilite | |
|---|
| Formula: | KAlSiO4 |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
| Kambaldaite | |
|---|
| Formula: | NaNi4(CO3)3(OH)3 · 3H2O |
| Localities: | Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Silberberg adit, Unterstein, Reith, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| Kaňkite |  |
|---|
| Formula: | FeAsO4 · 3.5H2O |
| Localities: | Straßegg (Straßeck), Gasen, Birkfeld, Styria, Austria Gold Mines, Kliening, Bad St Leonhard, Saualpe, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Kaňkite from Gold Mines, Kliening, Bad St Leonhard, Saualpe, Carinthia, Austria |
| Kaolinite |  |
|---|
| Formula: | Al2(Si2O5)(OH)4 |
| Localities: | Reported from at least 40 localities in this region. |
|
|
|
|
|
|
| Photo: © neschen. Kaolinite from Luftenberg, St Georgen an der Gusen, Perg, Mühlviertel, Upper Austria, Austria |
| Karlite (TL) |  |
|---|
| Formula: | Mg7(BO3)3(OH,Cl)5 |
| Type Locality: | Furtschaglkar, Schlegeis valley (Schlegeisgrund), Zillertal, North Tyrol, Tyrol, Austria |
| Reference: | G. Franz, D. Ackermann, E. Koch: Amer. Mineral. 66:872-877 (1981) |
|
|
|
|
|
| Photo: © 2008, JGW. Karlite from Furtschaglkar, Schlegeis valley, Zillertal, North Tyrol, Tyrol, Austria |
| Kashinite | |
|---|
| Formula: | (Ir,Rh)2S3 |
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Kasolite | |
|---|
| Formula: | Pb(UO2)[SiO4] · H2O |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Keithconnite | |
|---|
| Formula: | Pd3-xTe (x = 0.14 - 0.43) |
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| 'Kelyphite' | |
|---|
| Localities: | Gurhof castle, Gansbach, Dunkelsteinerwald, Dunkelstein Forest, Mostviertel, Lower Austria, Austria Dürnsteiner Waldhütten, Dürnstein, Wachau, Lower Austria, Austria Karlstetten, Mostviertel, Lower Austria, Austria Mitterbachgraben, Gansbach, Dunkelsteinerwald, Dunkelstein Forest, Mostviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
|
| 'Keramohalite' | |
|---|
| Localities: | Teichen Mine, Langteichengraben (Lange Teichen), Kalwang, Liesing - Palten valley, Styria, Austria Abfaltersbach, Puster valley, East Tyrol, Tyrol, Austria Villgraten valley, Puster valley, East Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
|
| Kermesite | |
|---|
| Formula: | Sb2S2O |
| Localities: | Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria Mixnitz, Frohnleiten, Styria, Austria Antimony mine, Stadtschlaining, Oberwart, Burgenland, Austria Wetterbauergraben, Mixnitz, Frohnleiten, Styria, Austria
|
|
|
|
|
|
|
|
| Kesterite | |
|---|
| Formula: | Cu2(Zn,Fe)SnS4 |
| Localities: | Haagen mine, Webing, Abtenau, Salzburg, Austria Haidbachgraben (Myrthengraben; Myrtengraben; Heidbachgraben), Semmering, Industrieviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
| 'K Feldspar' | |
|---|
| Localities: | Reported from at least 22 localities in this region. |
|
|
|
|
|
|
|
|
| 'K Feldspar var: Adularia' |  |
|---|
| Formula: | KAlSi3O8 |
| Localities: | Reported from at least 284 localities in this region. |
|
|
|
|
|
|
| Photo: © Gerd Stefanik. Adularia from Arzbachgraben, Felben valley, Hohe Tauern, Salzburg, Austria |
| Khaidarkanite |  |
|---|
| Formula: | Na0.34Cu4Al3(OH)14F3 · 2H2O |
| Locality: | North face, Hoher Sonnblick, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Khaidarkanite from Rauris valley, Hohe Tauern, Salzburg, Austria |
| Kieserite | |
|---|
| Formula: | MgSO4 · H2O |
| Localities: | Rock salt deposit, Dürrnberg, Hallein, Salzburg, Austria Salt mine, Hallstatt, Gmunden, Upper Austria, Austria Salt mine, Altaussee, Bad Aussee, Styria, Austria
|
|
|
|
|
|
|
|
| Kintoreite | |
|---|
| Formula: | PbFe3+3(PO4)2(OH,H2O)6 |
| Localities: | Ödenkar, Kreuzkogel massif, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria Höllkogel, Alpl, Freßnitzgraben, Krieglach, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
|
| Kipushite | |
|---|
| Formula: | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| Locality: | Stocker adit, Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Kirschsteinite |  |
|---|
| Formula: | CaFe2+SiO4 |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Uwe Kolitsch. Kirschsteinite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| 'Klaprothite (of Petersen)' | |
|---|
| Locality: | Gold Mines, Kliening, Bad St Leonhard, Saualpe, Carinthia, Austria |
|
|
|
|
|
|
|
|
| Klöchite (TL) |  |
|---|
| Formula: | (□Na)KFe2+2Zn3(Si12O30) |
| Type Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
| Reference: | IMA website - Proposals approved in February 2008 |
|
|
|
|
|
| Photo: © OT. Ljøstad. Klöchite from Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
Kobeite-(Y) | |
|---|
| Formula: | (Y,Zr)2(Ti,Fe3+)2(O,OH)7 |
| Locality: | Schlossberg Quarry, Schlossberg, Gloggnitz, Industrieviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| 'Köflachite' | |
|---|
| Locality: | Maria Lankowitz, Köflach - Voitsberg lignite deposit, Köflach, Styria, Austria |
|
|
|
|
|
|
|
|
| Kolbeckite |  |
|---|
| Formula: | ScPO4 · 2H2O |
| Locality: | Schlarbaum quarry, Klause, Bad Gleichenberg, Styria, Austria |
|
|
|
|
|
|
| Photo: © Vincent Bourgoin. Kolbeckite from Schlarbaum quarry, Klause, Bad Gleichenberg, Styria, Austria |
| Koninckite |  |
|---|
| Formula: | Fe3+PO4 · 3H2O |
| Localities: | Breitenbuchen, Oberbuchach, Kirchbach, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria Wieseggrinne (Stinkrinne), Leutachkopf - Stocker Alp area, Untersulzbach valley, Hohe Tauern, Salzburg, Austria Gratzer Alp, Würmlach, Dellach, Kötschach-Mauthen, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © O. Dziallas. Koninckite from Breitenbuchen, Oberbuchach, Kirchbach, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Köttigite | |
|---|
| Formula: | Zn3(AsO4)2 · 8H2O |
| Localities: | Slag localities, Kolm-Saigurn, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Windbach valley, Habach valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
| Koutekite | |
|---|
| Formula: | Cu5As2 |
| Locality: | Slag locality, St Gertraudi, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Kröhnkite | |
|---|
| Formula: | Na2Cu(SO4)2 · 2H2O |
| Locality: | Slag dumps, Walchen, Öblarn, Niedere Tauern, Styria, Austria |
|
|
|
|
|
|
|
| Krupkaite |  |
|---|
| Formula: | PbCuBi3S6 |
| Localities: | Reported from at least 10 localities in this region. |
|
|
|
|
|
|
| Photo: © Richard Bayerl. Krupkaite from Sedl, Leckbachgraben, Nasenkopf, Habach valley, Hohe Tauern, Salzburg, Austria |
| Ktenasite | |
|---|
| Formula: | Zn(Cu,Zn)4(SO4)2(OH)6 · 6H2O |
| Locality: | Gratlspitz, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Kulanite |  |
|---|
| Formula: | Ba(Fe2+,Mn2+,Mg)2(Al,Fe3+)2(PO4)3(OH)3 |
| Locality: | Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © AC. Kulanite from Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria |
| Kupčíkite (TL) | |
|---|
| Formula: | Cu3.4Fe0.6Bi5S10 |
| Type Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| Reference: | D. Topa et al.: Can. Mineral. 40:849-869 (2002); D. Topa et al.: Can. Mineral. 41:1155-1166 (2003) |
|
|
|
|
|
|
| 'Kupferpecherz' | |
|---|
| Localities: | Quartz quarry, Wolfsgruben (Wolfgruben), Seiz, Liesing - Palten valley, Styria, Austria Zeiritzkampel, Wald am Schoberpass, Liesing - Palten valley, Styria, Austria Mosinggraben, Miesling valley, Spitz, Wachau, Lower Austria, Austria Dürrkogel, Veitsch, Mitterdorf, Styria, Austria Magnesite deposit, Sattlerkogel, Veitsch, Mitterdorf, Styria, Austria
|
|
|
|
|
|
|
|
|
| Kutnohorite |  |
|---|
| Formula: | Ca(Mn,Mg,Fe)(CO3)2 |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Kutnohorite from Friedlkogel, Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria |
| Kyanite |  |
|---|
| Formula: | Al2(SiO4)O |
| Localities: | Reported from at least 86 localities in this region. |
|
|
|
|
|
|
| Photo: © Franz Bernhard. Kyanite from Gablergraben, Klosterkogel, Admont, Ennstaler Alpen, Styria, Austria |
| Kyrgyzstanite |  |
|---|
| Formula: | ZnAl4(SO4)(OH)12·3H2O |
| Locality: | Feistritzwald (Feistritz valley), Northern District, Prinzkogel mines, Prinzkogel (Prinzenkogel), Rettenegg, Fischbacher Alpen, Styria, Austria |
|
|
|
|
|
|
| Photo: © AC. Kyrgyzstanite from Feistritzwald, Northern District, Prinzkogel mines, Prinzkogel, Rettenegg, Fischbacher Alpen, Styria, Austria |
| Laihunite |  |
|---|
| Formula: | Fe2+Fe3+2(SiO4)2 |
| Locality: | Lechnerberg (slag locality), Kaprun, Kaprun valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Laihunite from Lechnerberg, Kaprun, Kaprun valley, Hohe Tauern, Salzburg, Austria |
| Lanarkite |  |
|---|
| Formula: | Pb2(SO4)O |
| Localities: | Slag dumps, Walchen, Öblarn, Niedere Tauern, Styria, Austria Silberleithe (Silberleithen; Silberleiten), Biberwier, Lechtaler Alpen, North Tyrol, Tyrol, Austria Slag localities, Kolm-Saigurn, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria St Veit, Nassereith, Imst - Nassereith District, North Tyrol, Tyrol, Austria Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Lanarkite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Langbeinite | |
|---|
| Formula: | K2Mg2(SO4)3 |
| Localities: | Salt mine, Hall, Innsbruck, Inn valley, North Tyrol, Tyrol, Austria Salt mine, Hallstatt, Gmunden, Upper Austria, Austria Ischler Salzberg, Perneck, Bad Ischl, Gmunden, Upper Austria, Austria Salt mine, Altaussee, Bad Aussee, Styria, Austria
|
|
|
|
|
|
|
|
| Langite |  |
|---|
| Formula: | Cu4(SO4)(OH)6 · 2H2O |
| Localities: | Reported from at least 47 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Langite from Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria |
| Lansfordite |  |
|---|
| Formula: | MgCO3 · 5H2O |
| Localities: | Gulsen, Kraubath, Leoben, Styria, Austria Mitterberg, Kraubath, Leoben, Styria, Austria Dachstein mammoth cave, Obertraun, Hallstatt, Gmunden, Upper Austria, Austria Sommergraben, Kraubath, Leoben, Styria, Austria Lobminggraben, St Stefan, Kraubath, Leoben, Styria, Austria ? (more information)
|
|
|
|
|
|
|
| Photo: © AC. Lansfordite from Sommergraben, Kraubath, Leoben, Styria, Austria |
| Lanthanite-(La) |  |
|---|
| Formula: | (La,Ce)2(CO3)3 · 8H2O |
| Locality: | A2 Highway tunnel, Falkenberg, Kreuzbergl massif, Klagenfurt, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © AC. Lanthanite-(La) from A2 Highway tunnel, Falkenberg, Kreuzbergl massif, Klagenfurt, Carinthia, Austria |
| Larnite | |
|---|
| Formula: | Ca2SiO4 |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
| Laumontite |  |
|---|
| Formula: | CaAl2Si4O12 · 4H2O |
| Localities: | Reported from at least 81 localities in this region. |
|
|
|
|
|
|
| Photo: Laumontite from Prehnite Island, Kratzenberg, Habach valley, Hohe Tauern, Salzburg, Austria |
| Laurionite |  |
|---|
| Formula: | PbCl(OH) |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Schreiber Fritz. Laurionite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Laurite | |
|---|
| Formula: | RuS2 |
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Lautenthalite | |
|---|
| Formula: | PbCu4(SO4)2(OH)6 · 3H2O |
| Locality: | Slag dumps, Walchen, Öblarn, Niedere Tauern, Styria, Austria |
|
|
|
|
|
|
|
| Lautite ? | |
|---|
| Formula: | CuAsS |
| Localities: | Cu deposit (Schönberg), Flatschach, Knittelfeld, Styria, Austria ? (more information) Weißenbach district, Cu deposit (Schönberg), Flatschach, Knittelfeld, Styria, Austria ? (more information)
|
|
|
|
|
|
|
|
| Lavendulan | |
|---|
| Formula: | NaCaCu5(AsO4)4Cl · 5H2O |
| Locality: | Vogelhalt District, Vogel Alp, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
|
|
|
|
|
|
|
| Lawsonite | |
|---|
| Formula: | CaAl2(Si2O7)(OH)2 · H2O |
| Locality: | Untere Pfandlscharte, Brennkogel area, Fusch valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Lazulite (TL) |  |
|---|
| Formula: | (Mg,Fe2+)Al2(PO4)2(OH)2 |
| Type Locality: | Freßnitzgraben, Krieglach, Fischbacher Alpen, Styria, Austria |
| Habit: | masses |
| Colour: | blue |
| Description: | see specific locality entries! |
| Reference: | Rammelsberg Pogg. lxiv, 260 |
| Localities: | Recorded from at least 47 other localities in this region. |
|
| Photo: Lazulite from Höllgraben, Pfarrwerfen, Werfen, Salzburg, Austria |
| Lead | |
|---|
| Formula: | Pb |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
|
| Leadhillite |  |
|---|
| Formula: | Pb4(CO3)2(SO4)(OH)2 |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © AL. Leadhillite from Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria |
| 'Lead-parkerite' ? | |
|---|
| Formula: | Ni3Pb2S2 |
| Locality: | S35 motorway tunnel (Kirchdorf tunnel), Kirchdorf, Frohnleiten, Styria, Austria - erroneously reported |
|
|
|
|
|
|
|
| 'Lechatelierite' | |
|---|
| Formula: | SiO2 |
| Localities: | Köfels, Umhausen, Ötz valley, North Tyrol, Tyrol, Austria Brennkogel area, Fusch valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
| 'Lechatelierite var: Fulgurite' | |
|---|
| Locality: | Brennkogel south slope, Hochtor area, Glockner group, Hohe Tauern, Carinthia, Austria |
|
|
|
|
|
|
|
|
| Leightonite | |
|---|
| Formula: | K2Ca2Cu(SO4)4 · 2H2O |
| Locality: | Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
Leiteite | |
|---|
| Formula: | Zn(As2O4) |
| Locality: | Slag dumps, Walchen, Öblarn, Niedere Tauern, Styria, Austria |
|
|
|
|
|
|
|
| 'Leobenite' | |
|---|
| Formula: | Hydrated Ca-Fe phosphate |
| Locality: | Brandberg, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Leogangite (TL) |  |
|---|
| Formula: | Cu10(AsO4)4(SO4)(OH)6 · 8H2O |
| Type Locality: | Magnesite mine, Inschlag Alp, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
| Reference: | C.L. Lengauer, G. Giester, E. Kirchner: Mineralogy and Petrology 81:187-201 (2004) |
| Localities: | Recorded from at least 9 other localities in this region. |
|
|
|
|
| Photo: © Christian Rewitzer. Leogangite from Vogelhalt District, Vogel Alp, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
| Leonite ? | |
|---|
| Formula: | K2Mg(SO4)2 · 4H2O |
| Locality: | Salt mine, Hallstatt, Gmunden, Upper Austria, Austria - erroneously reported |
|
|
|
|
|
|
|
| Lepidocrocite |  |
|---|
| Formula: | γ-Fe3+O(OH) |
| Localities: | Reported from at least 47 localities in this region. |
|
|
|
|
|
|
| Photo: Lepidocrocite from Styrian Erzberg, Eisenerz, Styria, Austria |
| Lepidolite | |
|---|
| Locality: | Maigen, Weinzierl am Walde, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
|
| Leucite |  |
|---|
| Formula: | K(AlSi2O6) |
| Localities: | Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria
|
|
|
|
|
|
|
| Photo: © ReMi. Leucite from Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria |
| 'Leucophyllite (of Starkl)' | |
|---|
| Localities: | Anna chapel, Wiesmath, Bucklige Welt, Industrieviertel, Lower Austria, Austria Ofenbach, Lanzenkirchen, Industrieviertel, Lower Austria, Austria Kleiner Pestingbach valley, Aspang-Markt, Bucklige Welt, Industrieviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
|
| 'Leucoxene' | |
|---|
| Localities: | Diabase quarry, Biberg (Bieberg), Saalfelden, Salzburg, Austria Sulphide deposit, Bernstein, Oberwart, Burgenland, Austria Bohnkogel, Altenberg an der Rax, Neuberg an der Mürz, Styria, Austria Plattach, Kreuzeck area, Kreuzeck group, Carinthia, Austria Wappensteinhammer mine (Wappenstein-Hammer), Thörl, Bruck an der Mur, Styria, Austria
|
|
|
|
|
|
|
|
|
| Liebigite |  |
|---|
| Formula: | Ca2(UO2)(CO3)3 · 11H2O |
| Localities: | Spa canteen, Bad Gastein, Gastein valley, Hohe Tauern, Salzburg, Austria Kölnbrein dam, Malta valley, Hohe Tauern, Carinthia, Austria Tauern railway tunnel, Anlauf valley, Gastein valley, Hohe Tauern, Salzburg, Austria Bockhart adit, Siglitz - Bockhart Gold Mining District, Siglitz - Bockhart area, Gastein valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
| Photo: © AC. Liebigite from Kölnbrein dam, Malta valley, Hohe Tauern, Carinthia, Austria |
| Lillianite |  |
|---|
| Formula: | Pb3-2xAgxBi2+xS6 |
| Localities: | Reported from at least 12 localities in this region. |
|
|
|
|
|
|
| Photo: © mslama. Lillianite from Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| Lillianite var: Argentian Lillianite | |
|---|
| Formula: | (Pb,Ag)3Bi2S6 |
| Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| 'Limonite' |  |
|---|
| Formula: | FeO(OH) · nH2O |
| Localities: | Reported from at least 315 localities in this region. |
|
|
|
|
|
|
| Photo: © ReMi. Limonite from Christandl quarry, Peunt, Naintschgraben, Anger, Weiz, Styria, Austria |
| 'Limonite var: Bean Ore' | |
|---|
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
|
| 'Limonite var: Stilpnosiderite' | |
|---|
| Localities: | Loben, Bad St Leonhard, Packalpe, Carinthia, Austria Röhrerbühel (Rohrer Berg; Röhrerbichel; Rerobichl), Fieberbrunn, Kitzbühel Alps, North Tyrol, Tyrol, Austria Piller lake, Fieberbrunn, Kitzbühel Alps, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
|
| Linarite |  |
|---|
| Formula: | PbCu(SO4)(OH)2 |
| Localities: | Reported from at least 53 localities in this region. |
|
|
|
|
|
|
| Photo: © AL. Linarite from North face, Hoher Sonnblick, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| Lindackerite | |
|---|
| Formula: | CuCu4(AsO4)2(HAsO4)2 · 8-9H2O |
| Locality: | Slag localities, Kolm-Saigurn, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Lindbergite | |
|---|
| Formula: | Mn2+(C2O4) · 2H2O |
| Locality: | Kaltenegg, Southern District, Prinzkogel mines, Prinzkogel (Prinzenkogel), Rettenegg, Fischbacher Alpen, Styria, Austria |
|
|
|
|
|
|
|
| Lindströmite | |
|---|
| Formula: | Pb3Cu3Bi7S15 |
| Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Linnaeite | |
|---|
| Formula: | Co2+Co3+2S4 |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
|
| 'Linnaeite Group' |  |
|---|
| Locality: | Feistereck (Finstereck), Gollrad, Mariazell, Styria, Austria |
|
|
|
|
|
|
|
| Photo: © AC. Linnaeite Group from Kaskogel, Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria |
| Litharge |  |
|---|
| Formula: | PbO |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
| Photo: © D. L.. Litharge from Slag dumps, Walchen, Öblarn, Niedere Tauern, Styria, Austria |
| Lithiophilite | |
|---|
| Formula: | LiMn2+PO4 |
| Localities: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria Windeckberg, Miesling valley, Spitz, Wachau, Lower Austria, Austria
|
|
|
|
|
|
|
|
| Lithiophorite |  |
|---|
| Formula: | (Al,Li)MnO2(OH)2 |
| Localities: | Elmleiten, Fischbach, Fischbacher Alpen, Styria, Austria Rehgartlkreuz, Hafning, Wartmannstetten, Industrieviertel, Lower Austria, Austria
|
|
|
|
|
|
|
| Photo: Lithiophorite from Elmleiten, Fischbach, Fischbacher Alpen, Styria, Austria |
| 'Lithomarge' | |
|---|
| Locality: | Quarry I, Loja, Persenbeug-Gottsdorf, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
|
| Lizardite | |
|---|
| Formula: | Mg3(Si2O5)(OH)4 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Löllingite (TL) |  |
|---|
| Formula: | FeAs2 |
| Type Locality: | Wolfbau Mine, Lölling District, Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Reference: | G. Niedermayr, I. Praetzel: Mineralien Kärntens (1995) |
| Localities: | Recorded from at least 17 other localities in this region. |
|
|
|
|
| Photo: © Paul Bongaerts. Löllingite from Lölling District, Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Loseyite ? | |
|---|
| Formula: | (Zn,Mn2+)7(CO3)2(OH)10 |
| Localities: | Max Mine, Kreuth, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria ? (more information) Lafatsch valley (Hinterau valley), Karwendel Mts, North Tyrol, Tyrol, Austria ? (more information) Vomper Loch (Brantlrinne), Karwendel Mts, North Tyrol, Tyrol, Austria ? (more information)
|
|
|
|
|
|
|
|
| Loveringite ? |  |
|---|
| Formula: | (Ca,Ce)(Ti,Fe,Cr,Mg)21O38 |
| Locality: | Lohning quarry (Lohninger quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria - erroneously reported |
|
|
|
|
|
|
| Photo: © hamster@aon.at. Loveringite from Lohning quarry, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| Löweite (TL) | |
|---|
| Formula: | Na12Mg7(SO4)13 · 15H2O |
| Type Locality: | Ischler Salzberg, Perneck, Bad Ischl, Gmunden, Upper Austria, Austria |
| Reference: | Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 447; R. Exel: Die Mineralien und Erzlagerstätten Österreichs (1993) |
| Localities: | Recorded from at least 5 other localities in this region. |
|
|
|
|
|
| Luddenite ? | |
|---|
| Formula: | Cu2Pb2Si5O14 · 4H2O |
| Locality: | Greinerrinne, Nasenkopf, Habach valley, Hohe Tauern, Salzburg, Austria - erroneously reported |
|
|
|
|
|
|
|
| Ludjibaite |  |
|---|
| Formula: | Cu5(PO4)2(OH)4 |
| Locality: | Quartzite quarry (Tanzer quarry), Falkenstein, Fischbach, Fischbacher Alpen, Styria, Austria |
|
|
|
|
|
|
| Photo: © GK. Ludjibaite from Quartzite quarry, Falkenstein, Fischbach, Fischbacher Alpen, Styria, Austria |
| Ludlamite |  |
|---|
| Formula: | (Fe,Mn,Mg)3(PO4)2 · 4H2O |
| Localities: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © H.Schillhammer. Ludlamite from Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
| Ludlockite | |
|---|
| Formula: | PbFe3+4As3+10O22 |
| Locality: | Gold Mines, Kliening, Bad St Leonhard, Saualpe, Carinthia, Austria |
|
|
|
|
|
|
|
| Ludwigite | |
|---|
| Formula: | Mg2Fe3+(BO3)O2 |
| Locality: | Furtschaglkar, Schlegeis valley (Schlegeisgrund), Zillertal, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| 'Lumachelle' |  |
|---|
| Localities: | St Oswald adit, Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria Gschniergraben (Lafatsch pass), Lafatsch valley (Hinterau valley), Karwendel Mts, North Tyrol, Tyrol, Austria Stefanie Mine, Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria Zauchengraben, Zauchen, Hochobir, Karawanken, Carinthia, Austria
|
|
|
|
|
|
|
|
| Photo: © Josef Huber. Lumachelle from Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Luzonite | |
|---|
| Formula: | Cu3AsS4 |
| Localities: | Reported from at least 10 localities in this region. |
|
|
|
|
|
|
|
| Mackinawite | |
|---|
| Formula: | (Fe,Ni)9S8 |
| Localities: | Reported from at least 15 localities in this region. |
|
|
|
|
|
|
|
| Maghemite | |
|---|
| Formula: | Fe3+2O3 |
| Localities: | Salzburg shaft, Untersberg massif, Salzburg, Salzburg, Austria Glücksgrat, Habicht, Unterberg valley, Stubai valley, Sill valley (Wipp valley), North Tyrol, Tyrol, Austria Bärenbach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria ? (more information)
|
|
|
|
|
|
|
|
| Magnesio-arfvedsonite var: Anophorite | |
|---|
| Locality: | Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
|
| Magnesiochromite |  |
|---|
| Formula: | Mg(Cr,Al,Fe)2O4 |
| Localities: | Kraubath, Leoben, Styria, Austria Slag locality, St Gertraudi, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Breitenau Mine (Breitenau magnesite mine), Hochlantsch, St. Jakob-Breitenau, Fischbacher Alpen, Styria, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria Montanwerke Brixlegg (slag locality), Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
| Photo: © AC. Magnesiochromite from Breitenau Mine, Hochlantsch, St. Jakob-Breitenau, Fischbacher Alpen, Styria, Austria |
| Magnesiocopiapite | |
|---|
| Formula: | MgFe3+4(SO4)6(OH)2 · 20H2O |
| Locality: | Graphite quarry, Wollmersdorf (Zettlitz-Wollmersdorf), Drosendorf-Zissersdorf, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| 'Magnesio-ferri-fluoro-hornblende ' | |
|---|
| Formula: | ☐{Ca2}{Mg4Fe3+}(AlSi7O22)F2 |
| Locality: | Spittal, Millstatt lake ridge, Carinthia, Austria |
|
|
|
|
|
|
|
| Magnesioferrite |  |
|---|
| Formula: | MgFe3+2O4 |
| Localities: | Spittal, Millstatt lake ridge, Carinthia, Austria S35 motorway tunnel (Kirchdorf tunnel), Kirchdorf, Frohnleiten, Styria, Austria Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria
|
|
|
|
|
|
|
| Photo: © AC. Magnesioferrite from Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
| Magnesio-hornblende | |
|---|
| Formula: | ☐{Ca2}{Mg4Al}(AlSi7O22)(OH)2 |
| Localities: | Mitterbachgraben, Gansbach, Dunkelsteinerwald, Dunkelstein Forest, Mostviertel, Lower Austria, Austria Schwarzenberg quarry, Katsch an der Mur, Murau, Styria, Austria Putzkammer Alp, Rinder valley (Gafluna valley), Verwall group, Montafon, Vorarlberg, Austria Hengl Quarry, Eibenstein an der Thaya, Raabs an der Thaya, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
| Magnesio-riebeckite |  |
|---|
| Formula: | ◻{Na2}{Mg3Fe3+2}(Si8O22)(OH)2 |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © 2005 - MMI. Magnesio-riebeckite from Grabenbach area, Golling, Salzburg, Austria |
| Magnesiotaaffeite-2N’2S | |
|---|
| Formula: | Mg3Al8BeO16 |
| Locality: | Stubenberg Quarry, Stubenberg am See, Weiz, Styria, Austria |
|
|
|
|
|
|
|
| Magnesiotaaffeite-6N’3S |  |
|---|
| Formula: | Mg2BeAl6O12 |
| Locality: | Stubenberg Quarry, Stubenberg am See, Weiz, Styria, Austria |
|
|
|
|
|
|
| Photo: © Franz Bernhard. Magnesiotaaffeite-6N’3S from Stubenberg Quarry, Stubenberg am See, Weiz, Styria, Austria |
| Magnesite |  |
|---|
| Formula: | MgCO3 |
| Localities: | Reported from at least 100 localities in this region. |
|
|
|
|
|
|
| Photo: © 2001 John H. Betts. Magnesite from Kaswassergraben, Großreifling, Hieflau, Styria, Austria |
| Magnesite var: Breunnerite |  |
|---|
| Formula: | (Mg,Fe)CO3 |
| Localities: | Reported from at least 35 localities in this region. |
|
|
|
|
|
|
| Photo: © Christian Bracke. Breunnerite from Zillertal, North Tyrol, Tyrol, Austria |
| Magnesite var: Ferroan Magnesite | |
|---|
| Formula: | (Mg,Fe)CO3 |
| Localities: | Styrian Erzberg, Eisenerz, Styria, Austria Eulersberg, Hüttau, Radstadt, Salzburg, Austria
|
|
|
|
|
|
|
|
| Magnesite var: Gelmagnesite |  |
|---|
| Localities: | Gulsen, Kraubath, Leoben, Styria, Austria Preg, Kraubath, Leoben, Styria, Austria Mitterbachgraben, Gansbach, Dunkelsteinerwald, Dunkelstein Forest, Mostviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
| Photo: Gelmagnesite from Gulsen, Kraubath, Leoben, Styria, Austria |
| Magnesite var: Mesitine Spar |  |
|---|
| Formula: | (Mg,Fe)CO3 |
| Localities: | Reported from at least 27 localities in this region. |
|
|
|
|
|
|
| Photo: Mesitine Spar from Mitterberg District, St Johann im Pongau, Salzburg, Austria |
| 'Magnesite-Siderite Series' | |
|---|
| Localities: | Emil adit, Mitterberg District, St Johann im Pongau, Salzburg, Austria Erzwies Mines, Erzwies area, Gastein valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
|
| Magnetite |  |
|---|
| Formula: | Fe2+Fe3+2O4 |
| Localities: | Reported from at least 252 localities in this region. |
|
|
|
|
|
|
| Photo: Magnetite from Rumpersdorf, Stadtschlaining, Oberwart, Burgenland, Austria |
| Magnetite var: Titaniferous Magnetite | |
|---|
| Formula: | Fe2+(Fe3+,Ti)2O4 |
| Localities: | Michelgraben, Thumersbach, Zell am See, Kitzbühel Alps, Salzburg, Austria Grüneckkogel, Amerbach valley, Felben valley, Hohe Tauern, Salzburg, Austria Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria Pfeifenberger Alp, Sticklerhütte, Murwinkel, Lungau, Salzburg, Austria Diabase quarry, Biberg (Bieberg), Saalfelden, Salzburg, Austria
|
|
|
|
|
|
|
|
| Makovickyite (TL) | |
|---|
| Formula: | Ag1.5Bi5.5S9 |
| Type Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| Reference: | Zak, L., J. Fryda, W.G. Mumme, and W.H. Paar (1994) Makovickyite, Ag1.5Bi5.5S9. from Baita Bihorului, Romania: the 4P natural mineral member of the pavonite series. Neues Jahrbuch für Mineralogie, Abhandlungen: 168: 147-169; [MinRec 27:304]; Topa, D., Makovicky, E., Balić-Žunić, T. (2008): What is the reason of the doubled unit-cell volumes of copper–lead-rich pavonite homologues? The crystal structures of cupromakovickyite and makovickyite. Canadian Mineralogist, 46, 515-523. |
|
|
|
|
|
|
| Malachite |  |
|---|
| Formula: | Cu2(CO3)(OH)2 |
| Localities: | Reported from at least 441 localities in this region. |
|
|
|
|
|
|
| Photo: © Yaiba Sakaguchi. Malachite from Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| Mallestigite (TL) |  |
|---|
| Formula: | Pb3Sb5+(SO4)(AsO4)(OH)6 · 3H2O |
| Type Locality: | Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria |
| Reference: | Puttner, M. (1996): New minerals from the Neufinkenstein-Grabanz mine, Mallestiger Mittagskogel (western Karawanken, Carinthia, Austria). Aufschluss 47, 186-192. (in German); I. Sima et al.: Mitt. Öster. Miner. Ges. 143:225-227 (1998) |
| Localities: | Recorded from at least 1 other locality in this region. |
|
|
|
|
| Photo: © Stephan Wolfsried. Mallestigite from Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria |
| 'Manganese Oxides' | |
|---|
| Localities: | Reported from at least 20 localities in this region. |
|
|
|
|
|
|
|
|
| 'Manganese Oxides var: Manganese Dendrites' |  |
|---|
| Localities: | Holler quarry, Badersdorf, Großpetersdorf, Burgenland, Austria Gleissen quarry, Yspertal, Waldviertel, Lower Austria, Austria "In der Gleisen" Quarry, Nöchling, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
| Photo: © neschen. Manganese Dendrites from "In der Gleisen" Quarry, Nöchling, Waldviertel, Lower Austria, Austria |
| Manganite | |
|---|
| Formula: | Mn3+O(OH) |
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
|
| Manganocummingtonite | |
|---|
| Formula: | ☐{Mn2+2}{Mg5}(Si8O22)(OH)2 |
| Localities: | Reih Alp, Glashütten, Deutschlandsberg, Koralpe, Styria, Austria Pogatetz, Untersoboth, Soboth, Koralpe, Styria, Austria Magnetite prospect, Kleinwöllmiß, Voitsberg, Köflach, Styria, Austria Mn deposit, Dürnstein, Neumarkt, Styria, Austria
|
|
|
|
|
|
|
|
| 'Manganogel' | |
|---|
| Formula: | ~MnO2 · nH2O |
| Localities: | Johanniskogel, Flattnitz, Gurktaler Alpen, Carinthia, Austria Knappenwand, Knappenwand area, Untersulzbach valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
| Manganogrunerite |  |
|---|
| Formula: | ☐{Mn2+2}{Fe2+5}(Si8O22)(OH)2 |
| Localities: | Pyrophanite locality, Moschitzberg, St Salvator, Friesach - Hüttenberg area, Carinthia, Austria Kasperlekogel, Prössinggraben (Pressinggraben), Koralpe, Carinthia, Austria Mn deposit, Dürnstein, Neumarkt, Styria, Austria Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria ? (more information)
|
|
|
|
|
|
|
| Photo: Manganogrunerite from Mn deposit, Dürnstein, Neumarkt, Styria, Austria |
| 'Manganomelane' | |
|---|
| Locality: | Magnesite mine, Weißenstein, Hochfilzen, Kitzbühel Alps, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
|
| Marcasite |  |
|---|
| Formula: | FeS2 |
| Localities: | Reported from at least 163 localities in this region. |
|
|
|
|
|
|
| Photo: © . Marcasite from A2 Highway tunnel, Haberberg, St Kollmann, Griffen, Völkermarkt, Carinthia, Austria |
| Margarite (TL) |  |
|---|
| Formula: | CaAl2(Al2Si2O10)(OH)2 |
| Type Locality: | Großer Greiner, Zemmgrund, Zillertal, North Tyrol, Tyrol, Austria |
| Description: | Hintze (Vol. 2, 1897) gives Sterzing (Vipiteno), South Tyrol as the TL for margarite and refers to Mohs (1820). In fact, Mohs described the mineral, but did not provide an analysis. According to Zepharovich (1873), Greiner Mt has to be regarded as the TL, based on the data provided by Senger. |
| Reference: | W. Senger: "Oryctographie der Gefürsteten Grafschaft Tirols", Wagner (Innsbruck), 1821, pp. 32-33 |
| Localities: | Recorded from at least 6 other localities in this region. |
|
|
|
| Photo: Margarite from Stubenberg Quarry, Stubenberg am See, Weiz, Styria, Austria |
| Margarite var: Beryllian Margarite | |
|---|
| Localities: | Emerald deposit, Leckbachgraben (Leckbachrinne), Nasenkopf, Habach Valley, Hohe Tauern, Salzburg, Austria Leckbachscharte, Nasenkopf, Habach valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
|
| 'Margarodite' |  |
|---|
| Localities: | Großer Greiner, Zemmgrund, Zillertal, North Tyrol, Tyrol, Austria Talggenkopf, Zemmgrund, Zillertal, North Tyrol, Tyrol, Austria Lovitz Alp, Pfitsch pass, Zamser Grund (Zams valley), Zillertal, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| Photo: © Charles Creekmur. Margarodite from Lovitz Alp, Pfitsch pass, Zamser Grund, Zillertal, North Tyrol, Tyrol, Austria |
| Marialite | |
|---|
| Formula: | Na4Al3Si9O24Cl |
| Locality: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
|
|
|
|
|
|
|
| Massicot | |
|---|
| Formula: | PbO |
| Localities: | Slag dumps, Walchen, Öblarn, Niedere Tauern, Styria, Austria Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria
|
|
|
|
|
|
|
|
| Matildite | |
|---|
| Formula: | AgBiS2 |
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
|
| Matioliite | |
|---|
| Formula: | NaMgAl5(PO4)4(OH)6 · 2H2O |
| Locality: | Hochgosch, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
|
|
|
|
|
|
|
| Matlockite |  |
|---|
| Formula: | PbFCl |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Matlockite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Maucherite |  |
|---|
| Formula: | Ni11As8 |
| Localities: | Serpentinite quarry, Griesserhof (Gulitzen; Gullitzen), Hirt, Friesach - Hüttenberg area, Carinthia, Austria Mitterberg District, St Johann im Pongau, Salzburg, Austria Zinkwand, Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria S35 motorway tunnel (Kaltenbach tunnel), Zlatten, Frohnleiten, Styria, Austria S35 motorway tunnel (Kirchdorf tunnel), Kirchdorf, Frohnleiten, Styria, Austria
|
|
|
|
|
|
|
| Photo: © AC. Maucherite from S35 motorway tunnel, Kirchdorf, Frohnleiten, Styria, Austria |
| Mawbyite ? | |
|---|
| Formula: | Pb(Fe3+,Zn)2(AsO4)2 · 2(OH,H2O) |
| Locality: | Sperkerriegel, Wiesmath, Bucklige Welt, Industrieviertel, Lower Austria, Austria - erroneously reported |
|
|
|
|
|
|
|
| Mawsonite | |
|---|
| Formula: | Cu6Fe2SnS8 |
| Localities: | Waschgang Mine, Kluidscharte, Kleine Zirknitz valley, Zirknitz, Goldberg group, Hohe Tauern, Carinthia, Austria Erasmus adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria Vogelhalt District, Vogel Alp, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria Glücksgrat, Habicht, Unterberg valley, Stubai valley, Sill valley (Wipp valley), North Tyrol, Tyrol, Austria Trattenbach, Bucklige Welt, Industrieviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
| Mayenite | |
|---|
| Formula: | Ca12Al14O33 |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
| Mcguinnessite |  |
|---|
| Formula: | (Mg,Cu)2(CO3)(OH)2 |
| Localities: | Lobminggraben, St Stefan, Kraubath, Leoben, Styria, Austria Gulsen, Kraubath, Leoben, Styria, Austria Preg, Kraubath, Leoben, Styria, Austria Sommergraben, Kraubath, Leoben, Styria, Austria Wurten glacier, Wurten, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © Crystal Vine. Mcguinnessite from Kraubath, Leoben, Styria, Austria |
| Mckinstryite | |
|---|
| Formula: | Ag5-xCu3+xS4 |
| Locality: | Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
|
|
|
|
|
|
|
| Meionite |  |
|---|
| Formula: | Ca4Al6Si6O24CO3 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Meionite from Hartnerbruch quarry, Schwanberg, Koralpe, Styria, Austria |
| Meixnerite (TL) | |
|---|
| Formula: | Mg6Al2(OH)16(OH)2 · 4H2O |
| Type Locality: | "In der Gleisen" Quarry, Nöchling, Waldviertel, Lower Austria, Austria |
| Reference: | Tschermaks Min.Petr.Mitt.(1975) 22, 79-87 |
|
|
|
|
|
|
| Melanterite |  |
|---|
| Formula: | FeSO4 · 7H2O |
| Localities: | Reported from at least 42 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Melanterite from Langer prospect, Kreuzeck group, Carinthia, Austria |
| Melanterite var: Cuprian Melanterite | |
|---|
| Formula: | (Fe,Cu)SO4 · 7H2O |
| Localities: | Schendleck (Schendlegg), Großau, Reichenau an der Rax, Industrieviertel, Lower Austria, Austria Knappenberg, Hirschwang an der Rax, Reichenau an der Rax, Industrieviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
| 'Melilite' | |
|---|
| Localities: | Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria Steinberg, Mühldorf, Feldbach, Styria, Austria
|
|
|
|
|
|
|
|
|
| Mellite | |
|---|
| Formula: | Al2[C6(COO)6] · 16H2O |
| Locality: | Lanz - Stelzling area, Laas, Kötschach-Mauthen, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
|
|
|
|
|
|
|
| 'Melnikovite' | |
|---|
| Localities: | Lafarge-Perlmooser Quarry (Lafarge Quarry), Mannersdorf am Leithagebirge, Industrieviertel, Lower Austria, Austria Rhomberg quarry, Unterklien, Hohenems, Dornbirn, Vorarlberg, Austria
|
|
|
|
|
|
|
|
|
| Melonite | |
|---|
| Formula: | NiTe2 |
| Localities: | Stüblbau Mine, Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria A10 Highway tunnel, Katschberg, Schellgaden, Murwinkel, Lungau, Salzburg, Austria Knappenlöcher, Zanaischg (Zaneischg), Pölla valley, Hafner group, Hohe Tauern, Carinthia, Austria Millionenloch, Malta, Malta valley, Hohe Tauern, Carinthia, Austria Silberloch, Malta, Malta valley, Hohe Tauern, Carinthia, Austria
|
|
|
|
|
|
|
|
| Meneghinite |  |
|---|
| Formula: | Pb13CuSb7S24 |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
| Photo: © . Meneghinite from Wald tunnel, A9 Motorway tunnels, Wald am Schoberpass, Liesing - Palten valley, Styria, Austria |
| Mercury |  |
|---|
| Formula: | Hg |
| Localities: | Reported from at least 17 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Mercury from Mercury mine, Glatschach, Dellach im Drautal, Kreuzeck group, Carinthia, Austria |
| Merrihueite |  |
|---|
| Formula: | (K,Na)2(Fe,Mg)5Si12O30 |
| Localities: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria ? (more information)
|
|
|
|
|
|
|
| Photo: © 2007, JGW. Merrihueite from Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
| Mertieite-II | |
|---|
| Formula: | Pd8(Sb,As)3 |
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Mesolite | |
|---|
| Formula: | Na2Ca2Si9Al6O30 · 8H2O |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Messelite | |
|---|
| Formula: | Ca2(Fe2+,Mn2+)(PO4)2 · 2H2O |
| Locality: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
|
|
|
|
|
|
|
| Meta-autunite | |
|---|
| Formula: | Ca(UO2)2(PO4)2 · 6-8H2O |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
|
| Metacinnabar |  |
|---|
| Formula: | HgS |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
| Photo: © Elmar Lackner. Metacinnabar from Magnesite mine, Inschlag Alp, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
| 'Metahalloysite' | |
|---|
| Locality: | Trandorf, Mühldorf, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
|
| Metakahlerite | |
|---|
| Formula: | Fe2+(UO2)2(AsO4)2 · 8H2O |
| Locality: | Knichte section, Lölling District, Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
| Metastibnite |  |
|---|
| Formula: | Sb2S3 |
| Localities: | Reported from at least 14 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Metastibnite from Guggenbichl, Siflitz, Western Goldeck group, Lind im Drautal, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Metatorbernite |  |
|---|
| Formula: | Cu(UO2)2(PO4)2 · 8H2O |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © ReMi. Metatorbernite from Pegmatite outcrops, St Radegund, Graz, Styria, Austria |
| Metatyuyamunite | |
|---|
| Formula: | Ca(UO2)2(VO4)2 · 3-5H2O |
| Locality: | Weißwasser, Reichraminger Hintergebirge, Kirchdorf an der Krems, Upper Austria, Austria |
|
|
|
|
|
|
|
| Metauranocircite | |
|---|
| Formula: | Ba(UO2)2(PO4)2 · 7H2O |
| Localities: | Pegmatite outcrops (Schöcklkreuz; Schöckelkreuz; Rabnitzberg; Schöcklbartl; Schöckelbartl), St Radegund, Graz, Styria, Austria Eichberg, Unterlembach, Großdietmanns, Waldviertel, Lower Austria, Austria Uranium occurrence, Prinzkogel (Prinzenkogel), Rettenegg, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
|
| Metauranopilite | |
|---|
| Formula: | (UO2)6(SO4)(OH)10 · 5H2O |
| Locality: | Pegmatite outcrops (Schöcklkreuz; Schöckelkreuz; Rabnitzberg; Schöcklbartl; Schöckelbartl), St Radegund, Graz, Styria, Austria |
|
|
|
|
|
|
|
| Metavariscite | |
|---|
| Formula: | AlPO4 · 2H2O |
| Locality: | Trandorf, Mühldorf, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| Metavoltine | |
|---|
| Formula: | Na6K2FeFe6(SO4)12O2 · 18H2O |
| Localities: | Graphite quarry, Wollmersdorf (Zettlitz-Wollmersdorf), Drosendorf-Zissersdorf, Waldviertel, Lower Austria, Austria Graphite quarry, Amstall, Mühldorf, Waldviertel, Lower Austria, Austria Spitzmühle quarry, Leutschach, Styria, Austria
|
|
|
|
|
|
|
|
| Metazeunerite |  |
|---|
| Formula: | Cu(UO2)2(AsO4)2 · 8H2O |
| Localities: | Weißwasser, Reichraminger Hintergebirge, Kirchdorf an der Krems, Upper Austria, Austria Flirsch ski hut, Flirsch, Stanz valley, North Tyrol, Tyrol, Austria Lehenhof, Graschberg, Thierbach, Wildschönau, Wörgl, Inn valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Metazeunerite from Flirsch ski hut, Flirsch, Stanz valley, North Tyrol, Tyrol, Austria |
| Miargyrite | |
|---|
| Formula: | AgSbS2 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| 'Mica Group' |  |
|---|
| Localities: | Reported from at least 25 localities in this region. |
|
|
|
|
|
|
|
| Photo: © Christian Bracke. Mica Group from Zillertal, North Tyrol, Tyrol, Austria |
| Microcline |  |
|---|
| Formula: | KAlSi3O8 |
| Localities: | Reported from at least 36 localities in this region. |
|
|
|
|
|
|
| Photo: © neschen. Microcline from Ottenstein reservoir, Zwettl-Niederösterreich, Waldviertel, Lower Austria, Austria |
| Microcline var: Amazonite |  |
|---|
| Localities: | Amazonite occurrence, pegmatite outcrops, Pack, Packalpe, Styria, Austria Gradischkogel, St Vinzenz, Koralpe, Carinthia, Austria
|
|
|
|
|
|
|
|
| Photo: © AC. Amazonite from Amazonite occurrence, pegmatite outcrops, Pack, Packalpe, Styria, Austria |
| Microlite Group | |
|---|
| Localities: | Granite quarry, Markogel, Villach, Carinthia, Austria Lamprechtsberg, Ettendorf, Koralpe, Carinthia, Austria Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria
|
|
|
|
|
|
|
|
|
| Microlite Group var: Uranmicrolite (of Hogarth 1977) | |
|---|
| Localities: | Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria Lippnik Feldspar quarry, Lieser ravine, Spittal, Millstatt lake ridge, Carinthia, Austria
|
|
|
|
|
|
|
|
|
| Milarite |  |
|---|
| Formula: | K2Ca4Al2Be4Si24O60 · H2O |
| Localities: | Reported from at least 33 localities in this region. |
|
|
|
|
|
|
| Photo: © mslama. Milarite from Widy quarry, Gebharts, Schrems, Waldviertel, Lower Austria, Austria |
| Millerite |  |
|---|
| Formula: | NiS |
| Localities: | Reported from at least 38 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Millerite from Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
| Millisite |  |
|---|
| Formula: | (Na,K)CaAl6(PO4)4(OH)9 · 3H2O |
| Localities: | Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria ? (more information)
|
|
|
|
|
|
|
| Photo: © AC. Millisite from Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
| Mimetite |  |
|---|
| Formula: | Pb5(AsO4)3Cl |
| Localities: | Reported from at least 44 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Mimetite from Annaberg, Mostviertel, Lower Austria, Austria |
| Minium | |
|---|
| Formula: | Pb3O4 |
| Localities: | A10 Highway tunnel, Kroislerwand, Kellerberg, Paternion, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria Slag localities, Kolm-Saigurn, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Silberleithe (Silberleithen; Silberleiten), Biberwier, Lechtaler Alpen, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| Mirabilite | |
|---|
| Formula: | Na2SO4 · 10H2O |
| Localities: | Reported from at least 12 localities in this region. |
|
|
|
|
|
|
|
Mixite | |
|---|
| Formula: | BiCu6(AsO4)3(OH)6 · 3H2O |
| Locality: | No. 1 adit, Äußere Wimitz, St Veit an der Glan, Gurktaler Alpen, Carinthia, Austria |
|
|
|
|
|
|
|
| Molybdenite |  |
|---|
| Formula: | MoS2 |
| Localities: | Reported from at least 86 localities in this region. |
|
|
|
|
|
|
| Photo: © . Molybdenite from Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| 'Monazite' |  |
|---|
| Localities: | Reported from at least 72 localities in this region. |
|
|
|
|
|
|
|
| Photo: © Harjo. Monazite from Leffler source, Habach valley, Hohe Tauern, Salzburg, Austria |
| Monazite-(Ce) |  |
|---|
| Formula: | (Ce,La,Nd,Th)(PO4) |
| Localities: | Reported from at least 34 localities in this region. |
|
|
|
|
|
|
| Photo: © . Monazite-(Ce) from Lohning quarry, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| 'Monazite Group' | |
|---|
| Formula: | MTO4, where M = REE, Th, Ca, Bi; T = P, As |
| Locality: | Luftenberg, St Georgen an der Gusen, Perg, Mühlviertel, Upper Austria, Austria |
|
|
|
|
|
|
|
| Monazite-(La) | |
|---|
| Formula: | (La,Ce,Nd)(PO4) |
| Locality: | Magnetite prospect, Kleinwöllmiß, Voitsberg, Köflach, Styria, Austria |
|
|
|
|
|
|
|
| Monohydrocalcite |  |
|---|
| Formula: | CaCO3 · H2O |
| Localities: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria Montanwerke Brixlegg (slag locality), Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Topitza, Globasnitz, Karawanken, Carinthia, Austria ? (more information)
|
|
|
|
|
|
|
| Photo: © Harald Schillhammer. Monohydrocalcite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| 'Montanite' |  |
|---|
| Formula: | Bi2(TeO6) · 2H2O |
| Localities: | Gold Mines, Alteck, Wurten, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria Arnoldhöhe, Ankogel area, Ankogel group, Hohe Tauern, Carinthia, Austria Wurten, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © O. Dziallas. Montanite from Gold Mines, Alteck, Wurten, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria |
| Montebrasite |  |
|---|
| Formula: | LiAl(PO4)(OH) |
| Localities: | Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria Hahnenkofel, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Montebrasite from Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
| Montetrisaite |  |
|---|
| Formula: | Cu6(SO4)(OH)10 · 2H2O |
| Locality: | Putzkammer Alp, Rinder valley (Gafluna valley), Verwall group, Montafon, Vorarlberg, Austria |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Montetrisaite from Putzkammer Alp, Rinder valley, Verwall group, Montafon, Vorarlberg, Austria |
| Montgomeryite |  |
|---|
| Formula: | Ca4MgAl4(PO4)6(OH)4 · 12H2O |
| Locality: | Brandberg, Leoben, Styria, Austria |
|
|
|
|
|
|
| Photo: © AC. Montgomeryite from Brandberg, Leoben, Styria, Austria |
| Monticellite ? | |
|---|
| Formula: | CaMgSiO4 |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria - erroneously reported |
|
|
|
|
|
|
|
| Montmorillonite |  |
|---|
| Formula: | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Localities: | Reported from at least 25 localities in this region. |
|
|
|
|
|
|
| Photo: Montmorillonite from Aldrian quarry, Lieschengraben, Oberhaag, Styria, Austria |
| 'Moonstone' |  |
|---|
| Localities: | Mörchnerkar, Mörchner area, Zemmgrund, Zillertal, North Tyrol, Tyrol, Austria Urfahr, Linz, Upper Austria, Austria Radlgraben, Spitz, Wachau, Lower Austria, Austria Floitengrund, Zillertal, North Tyrol, Tyrol, Austria Blocherleitengraben, Miesling valley, Spitz, Wachau, Lower Austria, Austria
|
|
|
|
|
|
|
|
| Photo: © . Moonstone from Amazonite occurrence, pegmatite outcrops, Pack, Packalpe, Styria, Austria |
| Mordenite |  |
|---|
| Formula: | (Na2,Ca,K2)Al2Si10O24 · 7H2O |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © . Mordenite from S6 motorway tunnel, Tanzenberg, Kapfenberg, Bruck an der Mur, Styria, Austria |
| Morenosite |  |
|---|
| Formula: | NiSO4 · 7H2O |
| Localities: | Mitterberg District, St Johann im Pongau, Salzburg, Austria Nöckelberg District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria Ebenwald, Gmünd, Reißeck group, Hohe Tauern, Carinthia, Austria Serpentinite quarry, Griesserhof (Gulitzen; Gullitzen), Hirt, Friesach - Hüttenberg area, Carinthia, Austria ? (more information)
|
|
|
|
|
|
|
| Photo: Morenosite from Mitterberg District, St Johann im Pongau, Salzburg, Austria |
| Moschellandsbergite | |
|---|
| Formula: | Ag2Hg3 |
| Localities: | Erasmus adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria Christoph adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria
|
|
|
|
|
|
|
|
| Mottramite |  |
|---|
| Formula: | PbCu(VO4)(OH) |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Mottramite from Stüblbau Mine, Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria |
| 'Motukoreaite' |  |
|---|
| Formula: | Mg6Al3(OH)18[Na(H2O)6][SO4]2 · 6H2O |
| Locality: | Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria |
|
|
|
|
|
|
| Photo: © Thomas Witzke. Motukoreaite from Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria |
| 'Mountain Leather' | |
|---|
| Localities: | Totenkopf (incl. Lower Riffl glacier), Stubach valley, Hohe Tauern, Salzburg, Austria Magnesite quarry, Arzbach (Arzbachleiten), Neuberg an der Mürz, Styria, Austria Innerer Knorrkogel - Schlaten glacier area, Gschlöss valley, Tauern valley, East Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
|
| Mullite |  |
|---|
| Formula: | Al4+2xSi2-2xO10-x |
| Localities: | Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria
|
|
|
|
|
|
|
| Photo: © AC. Mullite from Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
| Munakataite |  |
|---|
| Formula: | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Locality: | Quartz quarry, Wolfsgruben (Wolfgruben), Seiz, Liesing - Palten valley, Styria, Austria |
|
|
|
|
|
|
| Photo: © AC. Munakataite from Quartz quarry, Wolfsgruben, Seiz, Liesing - Palten valley, Styria, Austria |
| Muscovite |  |
|---|
| Formula: | KAl2(AlSi3O10)(OH)2 |
| Localities: | Reported from at least 237 localities in this region. |
|
|
|
|
|
|
| Photo: © Tamás Ungvári 2005. Muscovite from Fischbacher Alpen, Styria, Austria |
| Muscovite var: Alurgite | |
|---|
| Formula: | K2(Mg,Al)4-5(Al,Si)8O20(OH)4 |
| Localities: | Radiolarite outcrop (incl. Gfererloch), Fuchs Alp - Fuchs lake area (incl. Schwarz Alp; Schwarz lake; Kohlsberg Alp), Taurach valley, Lungau, Salzburg, Austria Ködnitz valley, Kals valley, East Tyrol, Tyrol, Austria Huteralm (Hutteralm), Ködnitz valley, Kals valley, East Tyrol, Tyrol, Austria Timmelbach valley, Prägraten, Virgen valley, East Tyrol, Tyrol, Austria Blauspitze (Blauspitz), Kals valley, East Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| Muscovite var: Barian Muscovite | |
|---|
| Formula: | (K,Ba)(Al,Mg)2(AlSi3O10)(OH)2 |
| Locality: | Emerald deposit, Leckbachgraben (Leckbachrinne), Nasenkopf, Habach Valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Muscovite var: Fuchsite |  |
|---|
| Formula: | K(Al,Cr)3Si3O10(OH)2 |
| Localities: | Reported from at least 45 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Fuchsite from Mesenaten, Wallackhaus, Hochtor area, Glockner group, Hohe Tauern, Carinthia, Austria |
| Muscovite var: Sericite |  |
|---|
| Localities: | Reported from at least 32 localities in this region. |
|
|
|
|
|
|
|
| Photo: © neschen. Sericite from Heidlbrunn quarry, Schlägl, Rohrbach, Mühlviertel, Upper Austria, Austria |
| Muscovite var: Vanadian Muscovite |  |
|---|
| Locality: | Graphite quarry, Amstall, Mühldorf, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| Photo: © neschen. Vanadian Muscovite from Graphite quarry, Amstall, Mühldorf, Waldviertel, Lower Austria, Austria |
| Nacrite | |
|---|
| Formula: | Al2(Si2O5)(OH)4 |
| Localities: | A10 Highway tunnel (Katschberg tunnel), Katschberg, Rennweg, Hafner group, Hohe Tauern, Carinthia, Austria A10 Highway tunnel, Katschberg, Schellgaden, Murwinkel, Lungau, Salzburg, Austria
|
|
|
|
|
|
|
|
| Nadorite |  |
|---|
| Formula: | PbSbClO2 |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © F. Schreiber. Nadorite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Nagyágite | |
|---|
| Formula: | Pb5Au(Te,Sb)4S5-8 |
| Locality: | Stüblbau Mine, Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria |
|
|
|
|
|
|
|
| Nakauriite |  |
|---|
| Formula: | Cu8(SO4)4(CO3)(OH)6 · 48H2O |
| Localities: | Lobminggraben, St Stefan, Kraubath, Leoben, Styria, Austria Gulsen, Kraubath, Leoben, Styria, Austria
|
|
|
|
|
|
|
| Photo: © Elmar Lackner. Nakauriite from Lobminggraben, St Stefan, Kraubath, Leoben, Styria, Austria |
| Namuwite |  |
|---|
| Formula: | (Zn,Cu)4(SO4)(OH)6 · 4H2O |
| Localities: | Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria Meiselding, St Veit an der Glan, Gurktaler Alpen, Carinthia, Austria Gratlspitz, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Prehistoric dump, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria
|
|
|
|
|
|
|
| Photo: © AC. Namuwite from Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria |
| Natrite | |
|---|
| Formula: | Na2CO3 |
| Localities: | Ebriachgraben (Ebriach gorge), Ebriach, Bad Eisenkappel (Bad Eisenkappl), Karawanken, Carinthia, Austria Salzburg shaft, Untersberg massif, Salzburg, Salzburg, Austria Rock salt deposit, Dürrnberg, Hallein, Salzburg, Austria Salt mine, Hallstatt, Gmunden, Upper Austria, Austria
|
|
|
|
|
|
|
|
| Natrodufrénite | |
|---|
| Formula: | NaFe2+Fe3+5(PO4)4(OH)6.2H2O |
| Locality: | Eichberg, Unterlembach, Großdietmanns, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| Natrojarosite |  |
|---|
| Formula: | NaFe3(SO4)2(OH)6 |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © . Natrojarosite from Graphite quarry, Amstall, Mühldorf, Waldviertel, Lower Austria, Austria |
| Natrolite |  |
|---|
| Formula: | Na2Al2Si3O10 · 2H2O |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Natrolite from Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
| Nepheline | |
|---|
| Formula: | (Na,K)AlSiO4 |
| Localities: | Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria Steinberg, Mühldorf, Feldbach, Styria, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria
|
|
|
|
|
|
|
|
| Népouite |  |
|---|
| Formula: | (Ni,Mg)3(Si2O5)(OH)4 |
| Localities: | Radlbad, Radlgraben, Gmünd, Reißeck group, Hohe Tauern, Carinthia, Austria Ebenwald, Gmünd, Reißeck group, Hohe Tauern, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Népouite from Ebenwald, Gmünd, Reißeck group, Hohe Tauern, Carinthia, Austria |
| Nesquehonite |  |
|---|
| Formula: | MgCO3 · 3H2O |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Nesquehonite from Sommergraben, Kraubath, Leoben, Styria, Austria |
| Newberyite | |
|---|
| Formula: | Mg(HPO4) · 3H2O |
| Localities: | Stüblbau Mine, Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria Roßblei Mine (Rossblei Mine), Eschach Alp (Eschachboden; Martinlager), Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria
|
|
|
|
|
|
|
|
| Nickel | |
|---|
| Formula: | Ni |
| Locality: | S35 motorway tunnel (Kirchdorf tunnel), Kirchdorf, Frohnleiten, Styria, Austria |
|
|
|
|
|
|
|
| Nickelhexahydrite | |
|---|
| Formula: | (Ni,Mg,Fe)SO4 · 6H2O |
| Localities: | Kleinkogel, St Gertraudi, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Diopside rift (Schwarzenstein Alp), Ochsner-Rotkopf massif, Zemmgrund, Zillertal, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| Nickeline |  |
|---|
| Formula: | NiAs |
| Localities: | Reported from at least 16 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Nickeline from Vetternspitzen, Knappen lakes, Giglach valley, Schladminger Tauern, Schladming, Styria, Austria |
| Nickelskutterudite |  |
|---|
| Formula: | NiAs2-3 |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Nickelskutterudite from Zinkwand, Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria |
| Nitrobarite |  |
|---|
| Formula: | Ba(NO3)2 |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Elmar Lackner 2009. Nitrobarite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Nontronite | |
|---|
| Formula: | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Localities: | Reported from at least 10 localities in this region. |
|
|
|
|
|
|
|
| Nordstrandite |  |
|---|
| Formula: | Al(OH)3 |
| Localities: | Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria Grieswies-Schwarzkopf (Grieswies-Schwarzkogel), Grieswies - Krumlkeeskopf area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Knappenlöcher, Zanaischg (Zaneischg), Pölla valley, Hafner group, Hohe Tauern, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © Elmar Lackner. Nordstrandite from Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria |
| Nosean | |
|---|
| Formula: | Na8(Al6Si6O24)(SO4) |
| Locality: | Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria |
|
|
|
|
|
|
|
| Nováčekite-I | |
|---|
| Formula: | Mg(UO2)2(AsO4)2 · 12H2O |
| Localities: | Micaschist outcrops, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Kaiserer quarry (Deisl quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Lohning quarry (Lohninger quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Wustkogel, Seidlwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
| Nsutite | |
|---|
| Formula: | (Mn4+,Mn2+)(O,OH)2 |
| Locality: | Marble quarry (Bürgergilt quarry; Bürgergilde quarry), Olsa, Friesach, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
| Nukundamite | |
|---|
| Formula: | (Cu,Fe)4S4 |
| Localities: | Erasmus adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria Schurfspitze, Rotgülden, Murwinkel, Lungau, Salzburg, Austria
|
|
|
|
|
|
|
|
| Offretite | |
|---|
| Formula: | KCaMgAl5Si13O36 · 16H2O or near |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
| Okenite |  |
|---|
| Formula: | CaSi2O5 · 2H2O |
| Localities: | S35 motorway tunnel (Kirchdorf tunnel), Kirchdorf, Frohnleiten, Styria, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria
|
|
|
|
|
|
|
| Photo: © AC. Okenite from Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
| Olenite |  |
|---|
| Formula: | Na(Al3)Al6(Si6O18)(BO3)3O3(OH) |
| Localities: | Maigen, Weinzierl am Walde, Waldviertel, Lower Austria, Austria Pegmatite outcrops, Eibenstein an der Thaya, Raabs an der Thaya, Waldviertel, Lower Austria, Austria Stoffhütte, St Oswald, Deutschlandsberg, Koralpe, Styria, Austria Gneiss quarry, Ebersdorf (Lehen-Ebersdorf), Leiben, Waldviertel, Lower Austria, Austria Graphite quarry, Amstall, Mühldorf, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
| Photo: © hamster@aon.at. Olenite from Graphite quarry, Amstall, Mühldorf, Waldviertel, Lower Austria, Austria |
| Olivenite |  |
|---|
| Formula: | Cu2(AsO4)(OH) |
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Olivenite from Copper mine, Kohlberg, Pottschach, Ternitz, Industrieviertel, Lower Austria, Austria |
| Olivenite var: Leucochalcite | |
|---|
| Locality: | Gratlspitz, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
|
| 'Olivine' |  |
|---|
| Formula: | (Mg,Fe2+)2SiO4 |
| Localities: | Reported from at least 28 localities in this region. |
|
|
|
|
|
|
| Photo: © Alfred Passath. Olivine from Auersberg, Gniebing-Weißenbach, Feldbach, Styria, Austria |
| 'Olivine var: Pilite' | |
|---|
| Locality: | Loiser Berg, Langenlois, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
|
| Omphacite |  |
|---|
| Formula: | (Ca,Na)(Mg,Al)Si2O6 |
| Localities: | Reported from at least 11 localities in this region. |
|
|
|
|
|
|
| Photo: © . Omphacite from Prickler Halt, Ladinger Spitze - Speikkogel area, Saualpe, Carinthia, Austria |
| Opal |  |
|---|
| Formula: | SiO2 · nH2O |
| Localities: | Reported from at least 35 localities in this region. |
|
|
|
|
|
|
| Photo: Opal from Waldkirchen an der Thaya, Waldviertel, Lower Austria, Austria |
| Opal var: Diatomite | |
|---|
| Localities: | Diatomite pit, Parisdorf, Ravelsbach, Weinviertel, Lower Austria, Austria Diatomite pit, Oberdürnbach, Maissau, Waldviertel, Lower Austria, Austria Diatomite pit, Limberg, Maissau, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
|
| Opal var: Fire Opal | |
|---|
| Localities: | Trass pit, Gossendorf, Bad Gleichenberg, Styria, Austria Schlarbaum quarry, Klause, Bad Gleichenberg, Styria, Austria
|
|
|
|
|
|
|
|
|
| Opal var: Forcherite |  |
|---|
| Locality: | Holzbrücken mill, Ingering valley, Knittelfeld, Styria, Austria |
|
|
|
|
|
|
|
| Photo: © 0. Forcherite from Holzbrücken mill, Ingering valley, Knittelfeld, Styria, Austria |
| Opal var: Milk Opal | |
|---|
| Localities: | Trass pit, Gossendorf, Bad Gleichenberg, Styria, Austria Schlarbaum quarry, Klause, Bad Gleichenberg, Styria, Austria Trandorf, Mühldorf, Waldviertel, Lower Austria, Austria Milk opal occurrence, Dürrenberg (Dürnberg), St Leonhard am Hornerwald, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
|
| Opal var: Moss Opal | |
|---|
| Locality: | Waldkirchen an der Thaya, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
|
| Opal var: Opal-AN |  |
|---|
| Formula: | SiO2 · nH2O |
| Localities: | Reported from at least 36 localities in this region. |
|
|
|
|
|
|
| Photo: Opal-AN from Holler quarry, Badersdorf, Großpetersdorf, Burgenland, Austria |
| Opal var: Opal-CT | |
|---|
| Formula: | SiO2 · nH2O |
| Localities: | Schwarzenberg quarry, Katsch an der Mur, Murau, Styria, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria Marble quarry, Atzelsdorf, Brunn an der Wild, Waldviertel, Lower Austria, Austria Kaintaleck Mine (Kaintalegg Mine; Hohenburg deposit), Magnesite deposit, Oberdorf an der Laming, Laming valley, Bruck an der Mur, Styria, Austria
|
|
|
|
|
|
|
|
| Orpiment |  |
|---|
| Formula: | As2S3 |
| Localities: | Reported from at least 19 localities in this region. |
|
|
|
|
|
|
| Photo: Orpiment from Dielengraben, Stein, Dellach im Drautal, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Orthoclase | |
|---|
| Formula: | KAlSi3O8 |
| Localities: | Reported from at least 17 localities in this region. |
|
|
|
|
|
|
|
| 'Orthopyroxene Subgroup' |  |
|---|
| Localities: | Mitterbachgraben, Gansbach, Dunkelsteinerwald, Dunkelstein Forest, Mostviertel, Lower Austria, Austria Marble quarries (incl. Renz Quarry; Bundesheer Quarry), Winkl, Röhrenbach, Waldviertel, Lower Austria, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria
|
|
|
|
|
|
|
|
| Photo: Orthopyroxene Subgroup from Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
| Orthoserpierite | |
|---|
| Formula: | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Localities: | Gratlspitz, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Martin adit, Weißer Schrofen, Ringenwechsel District, Schwaz, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Stocker adit, Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| Osarizawaite |  |
|---|
| Formula: | Pb(Al,Cu)3(SO4)2(OH)6 |
| Locality: | Stüblbau Mine, Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria |
|
|
|
|
|
|
| Photo: © 0. Osarizawaite from Stüblbau Mine, Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria |
| Osumilite |  |
|---|
| Formula: | (K,Na)(Fe2+,Mg)2(Al,Fe3+)3(Si,Al)12O30 |
| Locality: | Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
|
|
|
|
|
|
| Photo: © AC. Osumilite from Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
| Ourayite | |
|---|
| Formula: | Ag3Pb4Bi5S13 |
| Locality: | Erzwies area, Gastein valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Owyheeite |  |
|---|
| Formula: | Ag3+xPb10-2xSb11+xS28, -0.13 < x > +0.20 |
| Localities: | Plattach, Kreuzeck area, Kreuzeck group, Carinthia, Austria Grakofel, Rottenstein valley, Steinfeld, Kreuzeck group, Carinthia, Austria Niedermüller Alp, Kreuzeck area, Kreuzeck group, Carinthia, Austria Goldgrubenscharte, Kleines Kreuzeck, Kreuzeck group, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Owyheeite from Goldgrubenscharte, Kleines Kreuzeck, Kreuzeck group, Carinthia, Austria |
| Oxyplumboroméite |  |
|---|
| Formula: | Pb2Sb2O6O |
| Localities: | Reported from at least 39 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Oxyplumboroméite from Brandberg, Leoben, Styria, Austria |
| 'Oxy-rossmanite' | |
|---|
| Formula: | ☐(LiAl2)Al6(Si6O18)(BO3)3(OH)3O |
| Locality: | Pegmatite outcrops, Eibenstein an der Thaya, Raabs an der Thaya, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| 'Ozocerite' | |
|---|
| Locality: | Gresten-Land, Mostviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
|
| Paarite (TL) | |
|---|
| Formula: | Pb1.7Cu1.7Bi6.3S12 |
| Type Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| Reference: | Topa, D., Makovicky, E., and Balić-Žunić, T. (2004): Mineralogical data on salzburgite and paarite, two new members of the bismuthinite–aikinite series. Canadian Mineralogist 43, 909-917; Lapis 29(5):42 (2004) |
|
|
|
|
|
|
| Palmierite |  |
|---|
| Formula: | (K,Na)2Pb(SO4)2 |
| Locality: | No. 1 adit, Äußere Wimitz, St Veit an der Glan, Gurktaler Alpen, Carinthia, Austria |
|
|
|
|
|
|
| Photo: Palmierite from Äußere Wimitz, St Veit an der Glan, Gurktaler Alpen, Carinthia, Austria |
| Palygorskite |  |
|---|
| Formula: | (Mg,Al)5(Si,Al)8O20(OH)2 · 8H2O |
| Localities: | Reported from at least 25 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Palygorskite from Kreuth, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Paracoquimbite | |
|---|
| Formula: | Fe2(SO4)3 · 9H2O |
| Locality: | Graphite quarry, Wollmersdorf (Zettlitz-Wollmersdorf), Drosendorf-Zissersdorf, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| Paracostibite | |
|---|
| Formula: | CoSbS |
| Locality: | Greinerrinne, Nasenkopf, Habach valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Paragonite | |
|---|
| Formula: | NaAl2(AlSi3O10)(OH)2 |
| Localities: | Reported from at least 12 localities in this region. |
|
|
|
|
|
|
|
| Paralaurionite |  |
|---|
| Formula: | PbCl(OH) |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © F. Schreiber. Paralaurionite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Paranatrolite | |
|---|
| Formula: | Na2Al2Si3O10 · 3H2O |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
| Pararammelsbergite | |
|---|
| Formula: | NiAs2 |
| Localities: | Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria Seekar, Obertauern, Radstädter Tauern, Salzburg, Austria Zinkwand, Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria
|
|
|
|
|
|
|
|
| Pararealgar | |
|---|
| Formula: | As4S4 |
| Localities: | Modre quarry, Dragonerfels, Rammersdorf, Völkermarkt, Carinthia, Austria Ringenwechsel District, Schwaz, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Forestry road cut, Graschnitzgraben, St. Marein, Fischbacher Alpen, Styria, Austria Graschnitzgraben, St. Marein, Fischbacher Alpen, Styria, Austria Stelzing, Lölling, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria
|
|
|
|
|
|
|
|
| Parasymplesite |  |
|---|
| Formula: | Fe2+3(AsO4)2 · 8H2O |
| Localities: | Reported from at least 11 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Parasymplesite from Straßegg, Gasen, Birkfeld, Styria, Austria |
| Paratacamite | |
|---|
| Formula: | Cu3(Cu,Zn)(OH)6Cl2 |
| Locality: | Hengl Quarry, Eibenstein an der Thaya, Raabs an der Thaya, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| Pargasite | |
|---|
| Formula: | {Na}{Ca2}{Mg4Al}(Al2Si6O22)(OH)2 |
| Localities: | Reported from at least 10 localities in this region. |
|
|
|
|
|
|
|
| Pargasite var: Carinthine | |
|---|
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
|
|
| Parkerite | |
|---|
| Formula: | Ni3Bi2S2 |
| Localities: | Zinkwand, Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria S35 motorway tunnel (Kirchdorf tunnel), Kirchdorf, Frohnleiten, Styria, Austria ? (more information)
|
|
|
|
|
|
|
|
| Parnauite |  |
|---|
| Formula: | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| Localities: | Reported from at least 16 localities in this region. |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Parnauite from Flirsch ski hut, Flirsch, Stanz valley, North Tyrol, Tyrol, Austria |
| Parsonsite |  |
|---|
| Formula: | Pb2(UO2)(PO4)2 · 2H2O |
| Locality: | Ödenkar, Kreuzkogel massif, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
| Photo: © 0. Parsonsite from Kreuzkogel, Kreuzkogel massif, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria |
| Pavonite |  |
|---|
| Formula: | (Ag,Cu)(Bi,Pb)3S5 |
| Localities: | Arsenic mine, Lower Rotgülden lake, Rotgülden, Murwinkel, Lungau, Salzburg, Austria Waschgang Mine, Kluidscharte, Kleine Zirknitz valley, Zirknitz, Goldberg group, Hohe Tauern, Carinthia, Austria Erzwies area, Gastein valley, Hohe Tauern, Salzburg, Austria Schurfspitze, Rotgülden, Murwinkel, Lungau, Salzburg, Austria
|
|
|
|
|
|
|
| Photo: © AC. Pavonite from Schurfspitze, Rotgülden, Murwinkel, Lungau, Salzburg, Austria |
| Pearceite | |
|---|
| Formula: | [(Ag,Cu)6(As,Sb)2S7][Ag9CuS4] |
| Localities: | Annaberg, Mostviertel, Lower Austria, Austria Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Silberberg adit, Unterstein, Reith, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| Pekoite | |
|---|
| Formula: | PbCuBi11(S,Se)18 |
| Localities: | Gold Mines, Alteck, Wurten, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria Waschgang Mine, Kluidscharte, Kleine Zirknitz valley, Zirknitz, Goldberg group, Hohe Tauern, Carinthia, Austria Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria Strabaleben (Strabeleben), Wurten, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria
|
|
|
|
|
|
|
|
| Penfieldite |  |
|---|
| Formula: | Pb2Cl3(OH) |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © F. Schreiber. Penfieldite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Pennantite |  |
|---|
| Formula: | Mn2+5Al(AlSi3O10)(OH)8 |
| Locality: | Friedlkogel (Friedelkogel; Heinzlkogel), Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria |
|
|
|
|
|
|
| Photo: © AC. Pennantite from Friedlkogel, Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria |
| Pentahydrite | |
|---|
| Formula: | MgSO4 · 5H2O |
| Localities: | Gadaunern ravine, Bad Hofgastein, Gastein valley, Hohe Tauern, Salzburg, Austria Salt mine, Hall, Innsbruck, Inn valley, North Tyrol, Tyrol, Austria Salt mine, Hallstatt, Gmunden, Upper Austria, Austria
|
|
|
|
|
|
|
|
| Pentlandite |  |
|---|
| Formula: | (Fe,Ni)9S8 |
| Localities: | Reported from at least 25 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Pentlandite from Lobminggraben, St Stefan, Kraubath, Leoben, Styria, Austria |
| Perhamite |  |
|---|
| Formula: | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| Localities: | Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Perhamite from Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
| Periclase | |
|---|
| Formula: | MgO |
| Localities: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria Peridotite outcrop, Auwiesenbach valley, Sieggraben, Mattersburg, Burgenland, Austria
|
|
|
|
|
|
|
|
| Perovskite |  |
|---|
| Formula: | CaTiO3 |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
| Photo: Perovskite from Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria |
| 'Perthite' | |
|---|
| Locality: | Granulite quarry (Wanko gravel works), Meidling, Paudorf, Dunkelstein Forest, Mostviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
|
| 'Petrified Wood' |  |
|---|
| Localities: | Reported from at least 16 localities in this region. |
|
|
|
|
|
|
|
| Photo: © neschen. Petrified Wood from Innviertel, Upper Austria, Austria |
| Petrovicite | |
|---|
| Formula: | Cu3HgPbBiSe5 |
| Locality: | Selenide occurrence, Eselberg, Altenberg an der Rax, Neuberg an der Mürz, Styria, Austria |
|
|
|
|
|
|
|
| Pharmacolite | |
|---|
| Formula: | Ca(HAsO4) · 2H2O |
| Localities: | Slag localities, Kolm-Saigurn, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Zinkwand, Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria Siglitz adit (Imhof-Unterbau adit; Imhof adit), Siglitz - Bockhart Gold Mining District, Siglitz - Bockhart area, Gastein valley, Hohe Tauern, Salzburg, Austria ? (more information) Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria ? (more information)
|
|
|
|
|
|
|
|
| Pharmacosiderite |  |
|---|
| Formula: | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| Localities: | Reported from at least 19 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Pharmacosiderite from Straßegg, Gasen, Birkfeld, Styria, Austria |
| Phaunouxite | |
|---|
| Formula: | Ca3(AsO4)2 · 11H2O |
| Locality: | Zinkwand, Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria |
|
|
|
|
|
|
|
| Phenakite |  |
|---|
| Formula: | Be2SiO4 |
| Localities: | Reported from at least 43 localities in this region. |
|
|
|
|
|
|
| Photo: © mslama. Phenakite from Municipal quarry, Böckstein, Gastein valley, Hohe Tauern, Salzburg, Austria |
| 'Phengite' | |
|---|
| Localities: | Reported from at least 11 localities in this region. |
|
|
|
|
|
|
|
|
| 'Phengite var: Mariposite' | |
|---|
| Formula: | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| Locality: | Brennkogel north slope, Brennkogel area, Fusch valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Philipsbornite | |
|---|
| Formula: | PbAl3(AsO4)2(OH)5 · H2O |
| Locality: | Sperkerriegel, Wiesmath, Bucklige Welt, Industrieviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| Philipsburgite | |
|---|
| Formula: | (Cu,Zn)6(AsO4,PO4)2(OH)6 · H2O |
| Localities: | Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria Gratlspitz, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Martin adit, Weißer Schrofen, Ringenwechsel District, Schwaz, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| 'Phillipsite' |  |
|---|
| Localities: | Reported from at least 11 localities in this region. |
|
|
|
|
|
|
|
| Photo: © Volker Betz. Phillipsite from Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
| Phillipsite-Ca | |
|---|
| Formula: | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32 . 12H2O |
| Localities: | Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria
|
|
|
|
|
|
|
|
| Phillipsite-K | |
|---|
| Formula: | (K,Na,Ca0.5,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Localities: | Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria
|
|
|
|
|
|
|
|
| Phlogopite |  |
|---|
| Formula: | KMg3(AlSi3O10)(OH,F)2 |
| Localities: | Reported from at least 39 localities in this region. |
|
|
|
|
|
|
| Photo: Phlogopite from Loja, Persenbeug-Gottsdorf, Waldviertel, Lower Austria, Austria |
| Phoenicochroite | |
|---|
| Formula: | Pb2(CrO4)O |
| Locality: | Montanwerke Brixlegg (slag locality), Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Phosgenite |  |
|---|
| Formula: | Pb2CO3Cl2 |
| Localities: | Slag localities, Kolm-Saigurn, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria Erasmus adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria Slag locality, Oberzeiring, Pöls valley, Niedere Tauern, Styria, Austria
|
|
|
|
|
|
|
| Photo: © 0. Phosgenite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Phosphorrösslerite (TL) |  |
|---|
| Formula: | Mg(HPO4) · 7H2O |
| Type Locality: | Stüblbau Mine, Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria |
| Reference: | Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 714; Auer, C. (1995) Lapis: 20(11): 11-20. |
| Localities: | Recorded from at least 2 other localities in this region. |
|
|
|
|
| Photo: © 0. Phosphorrösslerite from Stüblbau Mine, Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria |
| Phosphosiderite | |
|---|
| Formula: | FePO4 · 2H2O |
| Locality: | Ebenlecker farm (Ebenlöcker farm), Herzogberg, Modriach, Koralpe, Styria, Austria |
|
|
|
|
|
|
|
| Phurcalite |  |
|---|
| Formula: | Ca2(UO2)3(PO4)2O2 · 7H2O |
| Locality: | Feldspar quarry, Laas, Fresach, Millstatt lake ridge, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © AC. Phurcalite from Feldspar quarry, Laas, Fresach, Millstatt lake ridge, Carinthia, Austria |
| Pickeringite |  |
|---|
| Formula: | MgAl2(SO4)4 · 22H2O |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Pickeringite from Oppenberg, Niedere Tauern, Styria, Austria |
| Pickeringite var: Ferropickeringite | |
|---|
| Locality: | Dientnergraben, Eschenau, Lend, Schwarzach, Salzburg, Austria |
|
|
|
|
|
|
|
|
| Picromerite | |
|---|
| Formula: | K2Mg(SO4)2 · 6H2O |
| Localities: | Salt mine, Hall, Innsbruck, Inn valley, North Tyrol, Tyrol, Austria Salt mine, Hallstatt, Gmunden, Upper Austria, Austria Ischler Salzberg, Perneck, Bad Ischl, Gmunden, Upper Austria, Austria
|
|
|
|
|
|
|
|
| Picropharmacolite |  |
|---|
| Formula: | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Localities: | Moschgraben, Stelzing, Lölling, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria Marble quarry, Stelzing, Lölling, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Picropharmacolite from Stubenriegel, Lanisch, Pölla valley, Hafner group, Hohe Tauern, Carinthia, Austria |
| Piemontite | |
|---|
| Formula: | {Ca2}{Al2Mn3+}(Si2O7)(SiO4)O(OH) |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
|
| 'Pinite' | |
|---|
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
|
|
| 'Pinolite' |  |
|---|
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
|
| Photo: © . Pinolite from Magnesite deposit, Sunk, Hohentauern, Niedere Tauern, Styria, Austria |
| 'Pisolite' |  |
|---|
| Localities: | Basalt quarry, Weitendorf, Wildon, Graz, Styria, Austria Maria Buch, Judenburg, Styria, Austria
|
|
|
|
|
|
|
|
| Photo: © 2005 - MMI. Pisolite from Basalt quarry, Weitendorf, Wildon, Graz, Styria, Austria |
| 'Pitticite' | |
|---|
| Formula: | (Fe, SO4, AsO4, H2O) ? |
| Localities: | Reported from at least 18 localities in this region. |
|
|
|
|
|
|
|
| Plagionite | |
|---|
| Formula: | Pb5Sb8S17 |
| Locality: | Loben, Bad St Leonhard, Packalpe, Carinthia, Austria |
|
|
|
|
|
|
|
| Platarsite | |
|---|
| Formula: | (Pt,Rh,Ru)AsS |
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Platinum | |
|---|
| Formula: | Pt |
| Locality: | Gold mine, Fundkofel, Zwickenberg, Oberdrauburg, Kreuzeck group, Carinthia, Austria |
|
|
|
|
|
|
|
| Plattnerite |  |
|---|
| Formula: | PbO2 |
| Localities: | Möchling Alp District, Hochobir, Karawanken, Carinthia, Austria Slag localities, Kolm-Saigurn, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
| Photo: © AC. Plattnerite from Möchling Alp District, Hochobir, Karawanken, Carinthia, Austria |
| 'Plessite' | |
|---|
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
|
| Plombièrite | |
|---|
| Formula: | Ca5(HSi3O9)2 · 7H2O |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
| Plumbogummite | |
|---|
| Formula: | PbAl3(PO4)2(OH)5 · H2O |
| Localities: | Liebenau, Freistadt, Mühlviertel, Upper Austria, Austria Höllkogel, Alpl, Freßnitzgraben, Krieglach, Fischbacher Alpen, Styria, Austria Lead mine, Graschnitzgraben, St. Marein, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
|
| Plumbojarosite |  |
|---|
| Formula: | Pb0.5Fe3+3(SO4)2(OH)6 |
| Localities: | Reported from at least 12 localities in this region. |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Plumbojarosite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Plumbonacrite | |
|---|
| Formula: | Pb5O(OH)2(CO3)3 |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
| 'Plumosite' | |
|---|
| Localities: | Gaisberg adit, Gaisberg, Olsa, Friesach, Friesach - Hüttenberg area, Carinthia, Austria Nikolsdorf, Lienz, East Tyrol, Tyrol, Austria Antimony mines, Rabantberg, Oberdrauburg, Kreuzeck group, Carinthia, Austria
|
|
|
|
|
|
|
|
|
| Polybasite | |
|---|
| Formula: | [(Ag,Cu)6(Sb,As)2S7][Ag9CuS4] |
| Localities: | Reported from at least 23 localities in this region. |
|
|
|
|
|
|
|
| Polycrase-(Y) |  |
|---|
| Formula: | (Y,U)(Ti,Nb)2O6 |
| Localities: | Hopffeldboden, Hopffeld area, Obersulzbach valley, Hohe Tauern, Salzburg, Austria Beryller - south of ("Beryller"), Abichl Alp - Beryller area, Untersulzbach valley, Hohe Tauern, Salzburg, Austria ? (more information)
|
|
|
|
|
|
|
| Photo: © Chinellato Matteo. Polycrase-(Y) from Hopffeldboden, Hopffeld area, Obersulzbach valley, Hohe Tauern, Salzburg, Austria |
| Polydymite | |
|---|
| Formula: | Ni2+Ni3+2S4 |
| Localities: | Erasmus adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria Vogelhalt District, Vogel Alp, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria Nöckelberg District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria
|
|
|
|
|
|
|
|
| Polyhalite (TL) |  |
|---|
| Formula: | K2Ca2Mg(SO4)4 · 2H2O |
| Type Locality: | Ischler Salzberg, Perneck, Bad Ischl, Gmunden, Upper Austria, Austria |
| Reference: | R. Exel: Die Mineralien und Erzlagerstätten Österreichs (1993) |
| Localities: | Recorded from at least 6 other localities in this region. |
|
|
|
|
| Photo: © Jakub Jirásek. Polyhalite from Salt mine, Hallstatt, Gmunden, Upper Austria, Austria |
| Posnjakite |  |
|---|
| Formula: | Cu4(SO4)(OH)6 · H2O |
| Localities: | Reported from at least 41 localities in this region. |
|
|
|
|
|
|
| Photo: © 2008 Jesse Crawford. Posnjakite from Finkenstein, Karawanken, Carinthia, Austria |
| Potarite | |
|---|
| Formula: | PdHg |
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Povondraite ? | |
|---|
| Formula: | NaFe3+3(Mg2Fe3+4)(Si6O18)(BO3)3(OH)3O |
| Locality: | Knödelhütte, Pegmatite outcrops, Pack, Packalpe, Styria, Austria - erroneously reported |
|
|
|
|
|
|
|
| Powellite |  |
|---|
| Formula: | Ca(MoO4) |
| Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
| Photo: © AC. Powellite from Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| 'Pregrattite' | |
|---|
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
|
| Prehnite |  |
|---|
| Formula: | Ca2Al2Si3O10(OH)2 |
| Localities: | Reported from at least 129 localities in this region. |
|
|
|
|
|
|
| Photo: © Rob Lavinsky. Prehnite from Hocharn, Grieswies - Krumlkeeskopf area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| Preisingerite | |
|---|
| Formula: | Bi3(AsO4)2O(OH) |
| Localities: | Kliening brook, Wiesenau, Bad St Leonhard, Saualpe, Carinthia, Austria Ödenkar, Kreuzkogel massif, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
| Pretulite (TL) |  |
|---|
| Formula: | Sc(PO4) |
| Type Locality: | Höllkogel, Alpl, Freßnitzgraben, Krieglach, Fischbacher Alpen, Styria, Austria |
| Habit: | ditetragonal-dipyramidal crystals up to 2 mm long |
| Colour: | lith pink, light orange, orange, dark orange |
| Description: | The original description of the species was based on up to 0.2 mm large grains (see reference below). However, up to 2 mm large pretulite crystals occur at Höllkogel, but this is not published yet. Pretulite occurs at every lazulite occurence in Krieglach and Mürzzuschlag (e.g. Freßnitzkogel, Wegscheidkreuz, Granegg, Fürstenbauer, Ganztal), but the large crystals are confined to Höllkogel until now. |
| Reference: | Bernhard, F. et al. (1998) |
| Localities: | Recorded from at least 8 other localities in this region. |
|
| Photo: © 0. Pretulite from Höllkogel, Alpl, Freßnitzgraben, Krieglach, Fischbacher Alpen, Styria, Austria |
| 'Prochlorite' | |
|---|
| Localities: | Reported from at least 15 localities in this region. |
|
|
|
|
|
|
|
|
| 'Protopartzite' | |
|---|
| Formula: | (Sb, Cu, Fe, As) |
| Localities: | Magnesite deposit, Sattlerkogel, Veitsch, Mitterdorf, Styria, Austria Fingerlos quarry (Hammerbruch), Mauterndorf, Taurach valley, Lungau, Salzburg, Austria ? (more information) Fuchs Alp, Fuchs Alp - Fuchs lake area (incl. Schwarz Alp; Schwarz lake; Kohlsberg Alp), Taurach valley, Lungau, Salzburg, Austria ? (more information)
|
|
|
|
|
|
|
|
| Proudite var: Se-free Proudite | |
|---|
| Formula: | CuPb7.5Bi9.33(S)22 |
| Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Proustite |  |
|---|
| Formula: | Ag3AsS3 |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Proustite from St Anna Mine, Annaberg, Mostviertel, Lower Austria, Austria |
| Pseudoboleite |  |
|---|
| Formula: | Pb31Cu24Cl62(OH)48 |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Pseudoboleite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Pseudobrookite |  |
|---|
| Formula: | Fe2TiO5 |
| Localities: | Basalt quarry, Weitendorf, Wildon, Graz, Styria, Austria Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria Dorf glacier, Dorferbach valley, Prägraten, Virgen valley, East Tyrol, Tyrol, Austria ? (more information)
|
|
|
|
|
|
|
| Photo: © Mesics Gábor. Pseudobrookite from Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
| Pseudomalachite |  |
|---|
| Formula: | Cu5(PO4)2(OH)4 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
| Photo: © . Pseudomalachite from Copper mine, Kohlberg, Pottschach, Ternitz, Industrieviertel, Lower Austria, Austria |
| Pseudorutile | |
|---|
| Formula: | Fe2Ti3O9 |
| Locality: | Serles north slope, Fulpmes, Stubai valley, Sill valley (Wipp valley), North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Pseudosinhalite |  |
|---|
| Formula: | Mg2Al3(BO3)2(OH)O3 |
| Locality: | Stubenberg Quarry, Stubenberg am See, Weiz, Styria, Austria |
|
|
|
|
|
|
| Photo: © Franz Bernhard. Pseudosinhalite from Stubenberg Quarry, Stubenberg am See, Weiz, Styria, Austria |
| 'Psilomelane' | |
|---|
| Localities: | Reported from at least 21 localities in this region. |
|
|
|
|
|
|
|
|
| 'Pumice' | |
|---|
| Locality: | Köfels, Umhausen, Ötz valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
|
| 'Pumpellyite' | |
|---|
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
|
|
| Pumpellyite-(Al) |  |
|---|
| Formula: | Ca2(Al,Fe2+,Mg)Al2(Si2O7)(SiO4)(OH,O)2 · H2O |
| Locality: | Maria-Luise quarry, Plöcking, Rohrbach, Mühlviertel, Upper Austria, Austria |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Pumpellyite-(Al) from Maria-Luise quarry, Plöcking, Rohrbach, Mühlviertel, Upper Austria, Austria |
| Pumpellyite-(Fe2+) | |
|---|
| Formula: | Ca2Fe2+Al2(Si2O7)(SiO4)(OH)2 · H2O |
| Localities: | Rami Alp (Ramihalt), Ladinger Spitze - Speikkogel area, Saualpe, Carinthia, Austria Irregger Schwaig, Ladinger Spitze - Speikkogel area, Saualpe, Carinthia, Austria Lippnik Feldspar quarry, Lieser ravine, Spittal, Millstatt lake ridge, Carinthia, Austria
|
|
|
|
|
|
|
|
| Pumpellyite-(Mg) | |
|---|
| Formula: | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| Localities: | Engelkar, Giglach lakes, Giglach valley, Schladminger Tauern, Schladming, Styria, Austria Hirschstetten gravel pit, 22nd district (Donaustadt), Vienna, Austria
|
|
|
|
|
|
|
|
| Purpurite | |
|---|
| Formula: | (Mn3+,Fe3+)PO4 |
| Locality: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
|
|
|
|
|
|
|
| Pyrargyrite |  |
|---|
| Formula: | Ag3SbS3 |
| Localities: | Reported from at least 35 localities in this region. |
|
|
|
|
|
|
| Photo: © Peter Haas. Pyrargyrite from Matzenköpfl, Reith, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| Pyrite |  |
|---|
| Formula: | FeS2 |
| Localities: | Reported from at least 941 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Pyrite from Arsenic mine, Lower Rotgülden lake, Rotgülden, Murwinkel, Lungau, Salzburg, Austria |
| Pyrite var: Bravoite | |
|---|
| Formula: | (Fe,Ni)S2 |
| Localities: | Reported from at least 21 localities in this region. |
|
|
|
|
|
|
|
| Pyroaurite |  |
|---|
| Formula: | Mg6Fe3+2(OH)16[CO3] · 4H2O |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Pyroaurite from Gulsen, Kraubath, Leoben, Styria, Austria |
| Pyroaurite-2H | |
|---|
| Formula: | Mg6Fe3+2(CO3)(OH)16 · 4H2O |
| Locality: | Quarry IV- Middle & Northern Area, Loja, Persenbeug-Gottsdorf, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| 'Pyrobitumen' | |
|---|
| Locality: | Diabase quarry (Jakomini quarry), Nötsch im Gailtal, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
|
|
|
|
|
|
|
|
| 'Pyrobitumen var: Thucholite' | |
|---|
| Locality: | Anna adit, Mitterberg District, St Johann im Pongau, Salzburg, Austria |
|
|
|
|
|
|
|
|
| Pyrochlore Group | |
|---|
| Formula: | A2Nb2(O,OH)6Z |
| Localities: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria Granite quarry, Markogel, Villach, Carinthia, Austria
|
|
|
|
|
|
|
|
| Pyrolusite |  |
|---|
| Formula: | MnO2 |
| Localities: | Reported from at least 48 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Pyrolusite from Teltschen-Rötelstein, Bad Mitterndorf, Bad Aussee, Styria, Austria |
| Pyromorphite |  |
|---|
| Formula: | Pb5(PO4)3Cl |
| Localities: | Reported from at least 33 localities in this region. |
|
|
|
|
|
|
| Photo: © ReMi. Pyromorphite from Hofer quarry, Stubenberg am See, Weiz, Styria, Austria |
| Pyrope |  |
|---|
| Formula: | Mg3Al2(SiO4)3 |
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
| Photo: © neschen. Pyrope from Gneiss quarry, Ebersdorf, Leiben, Waldviertel, Lower Austria, Austria |
| Pyrophanite | |
|---|
| Formula: | Mn2+TiO3 |
| Localities: | Pyrophanite locality, Moschitzberg, St Salvator, Friesach - Hüttenberg area, Carinthia, Austria Mn deposit, Dürnstein, Neumarkt, Styria, Austria Magnetite prospect, Kleinwöllmiß, Voitsberg, Köflach, Styria, Austria Spessartine occurrence, Langteichengraben (Lange Teichen), Kalwang, Liesing - Palten valley, Styria, Austria Reih Alp, Glashütten, Deutschlandsberg, Koralpe, Styria, Austria
|
|
|
|
|
|
|
|
| Pyrophyllite | |
|---|
| Formula: | Al2(Si4O10)(OH)2 |
| Localities: | Reported from at least 15 localities in this region. |
|
|
|
|
|
|
|
| Pyrophyllite var: Chrome-Pyrophyllite |  |
|---|
| Locality: | Mitterberg District, St Johann im Pongau, Salzburg, Austria |
|
|
|
|
|
|
|
| Photo: Chrome-Pyrophyllite from Mitterberg District, St Johann im Pongau, Salzburg, Austria |
| Pyrostilpnite | |
|---|
| Formula: | Ag3SbS3 |
| Locality: | Arsenic mine, Lower Rotgülden lake, Rotgülden, Murwinkel, Lungau, Salzburg, Austria |
|
|
|
|
|
|
|
| 'Pyroxene Group' | |
|---|
| Localities: | Arzberg, Kottaun, Geras, Waldviertel, Lower Austria, Austria Migmatite quarry, Wernstein am Inn, Schärding, Upper Austria, Austria Glücksgrat, Habicht, Unterberg valley, Stubai valley, Sill valley (Wipp valley), North Tyrol, Tyrol, Austria Hartnerbruch quarry (Hartner-Steinbruch), Schwanberg, Koralpe, Styria, Austria
|
|
|
|
|
|
|
|
|
| Pyroxmangite |  |
|---|
| Formula: | MnSiO3 |
| Localities: | Reported from at least 15 localities in this region. |
|
|
|
|
|
|
| Photo: © Franz Bernhard. Pyroxmangite from Plankogel, Knappenberg, Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Pyrrhotite |  |
|---|
| Formula: | Fe1-xS (x = 0 to 0.17) |
| Localities: | Reported from at least 270 localities in this region. |
|
|
|
|
|
|
| Photo: © mslama. Pyrrhotite from Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| Pyrrhotite var: Nickeloan Pyrrhotite | |
|---|
| Locality: | Stubach valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
|
| Quartz |  |
|---|
| Formula: | SiO2 |
| Localities: | Reported from at least 839 localities in this region. |
|
|
|
|
|
|
| Photo: © Harjo. Quartz from Leffler source, Habach valley, Hohe Tauern, Salzburg, Austria |
| Quartz var: Agate |  |
|---|
| Formula: | SiO2 |
| Localities: | Reported from at least 12 localities in this region. |
|
|
|
|
|
|
| Photo: © . Agate from Peuerbach, Grieskirchen, Upper Austria, Austria |
| Quartz var: Amethyst |  |
|---|
| Formula: | SiO2 |
| Localities: | Reported from at least 58 localities in this region. |
|
|
|
|
|
|
| Photo: © Martin Gruell. Amethyst from Mörchnerkar, Mörchner area, Zemmgrund, Zillertal, North Tyrol, Tyrol, Austria |
| Quartz var: Aventurine | |
|---|
| Locality: | Mariazell, Styria, Austria |
|
|
|
|
|
|
|
|
| Quartz var: Blue Quartz |  |
|---|
| Localities: | Blue quartz occurrence, Grabenbach area, Golling, Salzburg, Austria Gypsum mine, Wienern, Bad Aussee, Styria, Austria Haagen mine, Webing, Abtenau, Salzburg, Austria Einberg, Seydegg, Abtenau, Salzburg, Austria
|
|
|
|
|
|
|
|
| Photo: © alfredo petrov. Blue Quartz from Blue quartz occurrence, Grabenbach area, Golling, Salzburg, Austria |
| Quartz var: Capped Quartz | |
|---|
| Localities: | Konradhöhe north slope, Dösenbach valley, Ankogel group, Hohe Tauern, Carinthia, Austria Hohe Fürlegg (Hoch Fürleg), Stubach valley, Hohe Tauern, Salzburg, Austria Emerald deposit, Leckbachgraben (Leckbachrinne), Nasenkopf, Habach Valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
|
| Quartz var: Carnelian | |
|---|
| Localities: | Bärental, Feistritz im Rosental, Karawanken, Carinthia, Austria Fe deposit, Waidisch, Ferlach, Karawanken, Carinthia, Austria Grillkogel, Mantrach, Leutschach, Styria, Austria
|
|
|
|
|
|
|
|
|
| Quartz var: Chalcedony |  |
|---|
| Localities: | Reported from at least 59 localities in this region. |
|
|
|
|
|
|
|
| Photo: © ReMi. Chalcedony from Basalt quarry, Weitendorf, Wildon, Graz, Styria, Austria |
| Quartz var: Citrine |  |
|---|
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
|
| Photo: Citrine from North face, Hoher Sonnblick, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| Quartz var: Eisenkiesel |  |
|---|
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Photo: © neschen. Eisenkiesel from Huttererhöß, Hinterstoder, Kirchdorf an der Krems, Upper Austria, Austria |
| Quartz var: Jasper |  |
|---|
| Localities: | Reported from at least 22 localities in this region. |
|
|
|
|
|
|
|
| Photo: © neschen. Jasper from Horn, Waldviertel, Lower Austria, Austria |
| Quartz var: Landscape Agate |  |
|---|
| Locality: | Innviertel, Upper Austria, Austria |
|
|
|
|
|
|
|
| Photo: © neschen. Landscape Agate from Innviertel, Upper Austria, Austria |
| Quartz var: Milky Quartz |  |
|---|
| Localities: | Reported from at least 22 localities in this region. |
|
|
|
|
|
|
|
| Photo: © neschen. Milky Quartz from Appenau, Leonfelden, Urfahr-Umgebung, Mühlviertel, Upper Austria, Austria |
| Quartz var: Oil Quartz | |
|---|
| Localities: | Tyrol, Austria Rhomberg quarry, Unterklien, Hohenems, Dornbirn, Vorarlberg, Austria Bach, Elbigenalp, Lech valley, Lechtaler Alpen, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
|
| Quartz var: Prase |  |
|---|
| Localities: | Plattenkogel north slope, Anlauf valley, Gastein valley, Hohe Tauern, Salzburg, Austria Lüsens valley (Lisens valley; Lüsens alp; Lisens alp), Sellrain valley, North Tyrol, Tyrol, Austria Zillertal, North Tyrol, Tyrol, Austria Dösenbach valley, Ankogel group, Hohe Tauern, Carinthia, Austria Timmelbach valley, Prägraten, Virgen valley, East Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| Photo: Prase from Dösenbach valley, Ankogel group, Hohe Tauern, Carinthia, Austria |
| Quartz var: Pseudocubic Quartz | |
|---|
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
|
|
| Quartz var: Rock Crystal |  |
|---|
| Localities: | Reported from at least 390 localities in this region. |
|
|
|
|
|
|
|
| Photo: © Martin Gruell. Rock Crystal from Diepalgraben, Zederhaus, Zederhaus valley, Lungau, Salzburg, Austria |
| Quartz var: Rose Quartz |  |
|---|
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
|
| Photo: © neschen. Rose Quartz from Kopfing im Innkreis, Schärding, Upper Austria, Austria |
| Quartz var: Rutilated Quartz |  |
|---|
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
|
| Photo: Rutilated Quartz from Jausenscharten, Hocharn, Große Fleiß valley, Goldberg group, Hohe Tauern, Carinthia, Austria |
| Quartz var: Sceptre Quartz |  |
|---|
| Localities: | Reported from at least 12 localities in this region. |
|
|
|
|
|
|
|
| Photo: © Christian Bracke. Sceptre Quartz from Böse Nase, Göriach, Mühldorf, Reißeck group, Hohe Tauern, Carinthia, Austria |
| Quartz var: Smoky Quartz |  |
|---|
| Formula: | SiO2 |
| Localities: | Reported from at least 165 localities in this region. |
|
|
|
|
|
|
| Photo: Smoky Quartz from Rauris valley, Hohe Tauern, Salzburg, Austria |
| 'Quartz-beta' | |
|---|
| Formula: | SiO2 |
| Localities: | Irschen, Oberdrauburg, Kreuzeck group, Carinthia, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria
|
|
|
|
|
|
|
|
| 'Radentheinite' |  |
|---|
| Locality: | Magnesite Mine, Millstätter Alpe, Radenthein, Gurktaler Alpen, Carinthia, Austria |
|
|
|
|
|
|
|
| Photo: Radentheinite from Radenthein, Gurktaler Alpen, Carinthia, Austria |
| Rammelsbergite |  |
|---|
| Formula: | NiAs2 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Rammelsbergite from Greinig adit, Gaisberg, Olsa, Friesach, Friesach - Hüttenberg area, Carinthia, Austria |
| Ramsbeckite |  |
|---|
| Formula: | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| Localities: | Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria Slag dumps, Walchen, Öblarn, Niedere Tauern, Styria, Austria Meiselding, St Veit an der Glan, Gurktaler Alpen, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Ramsbeckite from Meiselding, St Veit an der Glan, Gurktaler Alpen, Carinthia, Austria |
| Ranciéite |  |
|---|
| Formula: | (Ca,Mn)Mn4O9 · 3H2O |
| Localities: | Reported from at least 20 localities in this region. |
|
|
|
|
|
|
| Photo: © . Ranciéite from Marble quarry, Olsa, Friesach, Friesach - Hüttenberg area, Carinthia, Austria |
| Rauenthalite | |
|---|
| Formula: | Ca3(AsO4)2 · 10H2O |
| Locality: | Zinkwand, Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria |
|
|
|
|
|
|
|
| Realgar |  |
|---|
| Formula: | As4S4 |
| Localities: | Reported from at least 30 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Realgar from Forestry road cut, Graschnitzgraben, St. Marein, Fischbacher Alpen, Styria, Austria |
| Rectorite | |
|---|
| Formula: | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| Locality: | Weitwörth, Oberndorf, Salzburg, Austria |
|
|
|
|
|
|
|
| Redgillite |  |
|---|
| Formula: | Cu6(SO4)(OH)10 · H2O |
| Locality: | Putzkammer Alp, Rinder valley (Gafluna valley), Verwall group, Montafon, Vorarlberg, Austria |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Redgillite from Putzkammer Alp, Rinder valley, Verwall group, Montafon, Vorarlberg, Austria |
| Renierite | |
|---|
| Formula: | (Cu,Zn)11(Ge,As)2Fe4S16 |
| Localities: | Erasmus adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria Nöckelberg District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria Kraubath, Leoben, Styria, Austria
|
|
|
|
|
|
|
|
| Retgersite |  |
|---|
| Formula: | NiSO4 · 6H2O |
| Localities: | Mitterberg District, St Johann im Pongau, Salzburg, Austria Maukenötz District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Breitenau Mine (Breitenau magnesite mine), Hochlantsch, St. Jakob-Breitenau, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
| Photo: Retgersite from Mitterberg District, St Johann im Pongau, Salzburg, Austria |
| 'Retinite' | |
|---|
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
|
|
| Rhodesite |  |
|---|
| Formula: | KHCa2Si8O19 · 5H2O |
| Localities: | Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria Steinberg, Mühldorf, Feldbach, Styria, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria
|
|
|
|
|
|
|
| Photo: © Elmar Lackner. Rhodesite from Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria |
| Rhodochrosite |  |
|---|
| Formula: | MnCO3 |
| Localities: | Reported from at least 37 localities in this region. |
|
|
|
|
|
|
| Photo: © Franz Bernhard. Rhodochrosite from Kaskogel, Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria |
| Rhodonite |  |
|---|
| Formula: | MnSiO3 |
| Localities: | Reported from at least 32 localities in this region. |
|
|
|
|
|
|
| Photo: © Jakub Jirásek. Rhodonite from Kaskogel, Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria |
| Rhomboclase | |
|---|
| Formula: | (H5O2)Fe3+(SO4)2 · 2H2O |
| Locality: | Spitzmühle quarry, Leutschach, Styria, Austria |
|
|
|
|
|
|
|
| Rhönite |  |
|---|
| Formula: | Ca2(Mg,Fe2+,Fe3+,Ti)6[O2|(Si,Al)6O18] |
| Locality: | Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
|
|
|
|
|
|
| Photo: © AC. Rhönite from Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
| Richelsdorfite |  |
|---|
| Formula: | Ca2Cu5Sb(AsO4)4(OH)6Cl · 6H2O |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
| Photo: Richelsdorfite from Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| Richterite | |
|---|
| Formula: | {Na}{CaNa}{Mg5}(Si8O22)(OH)2 |
| Locality: | Raabs an der Thaya, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| Riebeckite |  |
|---|
| Formula: | ◻[Na2][Fe2+3Fe3+2]Si8O22(OH)2 |
| Locality: | Schlossberg Quarry, Schlossberg, Gloggnitz, Industrieviertel, Lower Austria, Austria |
|
|
|
|
|
|
| Photo: © 0. Riebeckite from Schlossberg Quarry, Schlossberg, Gloggnitz, Industrieviertel, Lower Austria, Austria |
| Riebeckite Group var: Crocidolite |  |
|---|
| Localities: | Pfennigbach, Puchberg am Schneeberg, Industrieviertel, Lower Austria, Austria Gypsum mine, Wienern, Bad Aussee, Styria, Austria Dalaas, Kloster valley, Vorarlberg, Austria Grubbach, Seydegg, Abtenau, Salzburg, Austria ? (more information)
|
|
|
|
|
|
|
|
| Photo: © AC. Crocidolite from Gypsum mine, Wienern, Bad Aussee, Styria, Austria |
| Riversideite ? | |
|---|
| Formula: | Ca5(HSi3O9)2 · 2H2O |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria - erroneously reported |
|
|
|
|
|
|
|
| Robinsonite | |
|---|
| Formula: | Pb4Sb6S13 |
| Locality: | Königsalm, Senftenberg, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| Rockbridgeite |  |
|---|
| Formula: | Fe2+Fe3+4(PO4)3(OH)5 |
| Localities: | Ebenlecker farm (Ebenlöcker farm), Herzogberg, Modriach, Koralpe, Styria, Austria Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Rockbridgeite from Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
| Roedderite |  |
|---|
| Formula: | (Na,K)2(Mg,Fe)5Si12O30 |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
| Photo: Roedderite from Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
| 'Rohwand' | |
|---|
| Localities: | Rotsohl (Rotsohlalm; Rothsohl; Rabenstein), Gollrad, Mariazell, Styria, Austria Scheiklalm (Scheicklalm), Aschbach, Gollrad, Mariazell, Styria, Austria Postlgraben (Postelgraben; Postlwald; Lärchgraben), Gollrad, Mariazell, Styria, Austria Schottenkogel, Gollrad, Mariazell, Styria, Austria
|
|
|
|
|
|
|
|
|
| Romanèchite | |
|---|
| Formula: | (Ba,H2O)2Mn5O10 |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
|
| 'Roméite Group' | |
|---|
| Localities: | Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Radiolarite outcrop (incl. Gfererloch), Fuchs Alp - Fuchs lake area (incl. Schwarz Alp; Schwarz lake; Kohlsberg Alp), Taurach valley, Lungau, Salzburg, Austria
|
|
|
|
|
|
|
|
|
| 'Roméite Group var: Stetefeldtite' | |
|---|
| Formula: | Ag2Sb2(O,OH)7 |
| Locality: | Stocker adit, Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| 'Roméite Group var: Stibiconite' | |
|---|
| Localities: | Reported from at least 25 localities in this region. |
|
|
|
|
|
|
|
|
| Römerite | |
|---|
| Formula: | Fe2+Fe3+2(SO4)4 · 14H2O |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Rosasite |  |
|---|
| Formula: | (Cu,Zn)2(CO3)(OH)2 |
| Localities: | Reported from at least 23 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Rosasite from Marienbau, Raudner, Stiwoll, Graz, Styria, Austria |
| Roscherite |  |
|---|
| Formula: | Ca2Mn2+5Be4(PO4)6(OH)4 · 6H2O |
| Locality: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © mslama. Roscherite from Spodumene prospect, Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
| Rösslerite | |
|---|
| Formula: | Mg(HAsO4) · 7H2O |
| Locality: | Marble quarry, Stelzing, Lölling, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
| Rouaite |  |
|---|
| Formula: | Cu2(NO3)(OH)3 |
| Localities: | Slag localities, St Martin am Silberberg, Friesach - Hüttenberg area, Carinthia, Austria Montanwerke Brixlegg (slag locality), Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Rouaite from Slag localities, St Martin am Silberberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Rozenite |  |
|---|
| Formula: | FeSO4 · 4H2O |
| Localities: | Reported from at least 19 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Rozenite from Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
| Ruarsite | |
|---|
| Formula: | (Ru,Os)AsS |
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Rutherfordine | |
|---|
| Formula: | (UO2)CO3 |
| Locality: | A2 Highway tunnel, Übelskogel, Waldenstein, Koralpe, Carinthia, Austria |
|
|
|
|
|
|
|
| Rutile |  |
|---|
| Formula: | TiO2 |
| Localities: | Reported from at least 346 localities in this region. |
|
|
|
|
|
|
| Photo: © Chinellato Matteo. Rutile from Upper Riffl glacier, Stubach valley, Hohe Tauern, Salzburg, Austria |
| Rutile var: Ilmenorutile |  |
|---|
| Formula: | Fex(Nb,Ta)2x · 4Ti1-xO2 |
| Localities: | Gupper quarry, Wildbachgraben, Deutschlandsberg, Koralpe, Styria, Austria Luftenberg, St Georgen an der Gusen, Perg, Mühlviertel, Upper Austria, Austria
|
|
|
|
|
|
|
| Photo: © . Ilmenorutile from Luftenberg, St Georgen an der Gusen, Perg, Mühlviertel, Upper Austria, Austria |
| Rutile var: Nigrine | |
|---|
| Localities: | Rotbachlspitze (Rote Wand), Pfitsch pass, Zamser Grund (Zams valley), Zillertal, North Tyrol, Tyrol, Austria Schwarzes Hörndl, Obersulzbach valley, Hohe Tauern, Salzburg, Austria Angerer Alp, Obergurgl, Gurgler valley, Ötz valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
|
| Rutile var: Niobian Rutile | |
|---|
| Formula: | (Ti,Nb)O2 |
| Localities: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria Gupper quarry, Wildbachgraben, Deutschlandsberg, Koralpe, Styria, Austria
|
|
|
|
|
|
|
|
| Rutile var: Sagenite (of Saussure) |  |
|---|
| Localities: | Hochwurten reservoir, Wurten, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria Kaiserer quarry (Deisl quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Leistriedel, Kruml glacier, Krumlbach valley, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
| Photo: © Rob Lavinsky. Sagenite (of Saussure) from Krumlbach valley, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| 'Rutile Group' | |
|---|
| Formula: | M4+O2 |
| Locality: | Hartnerbruch quarry (Hartner-Steinbruch), Schwanberg, Koralpe, Styria, Austria |
|
|
|
|
|
|
|
| Sabelliite |  |
|---|
| Formula: | (Cu,Zn)2Zn(AsO4,SbO4)(OH)3 |
| Locality: | Weißer Schrofen, Ringenwechsel District, Schwaz, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Sabelliite from Weißer Schrofen, Ringenwechsel District, Schwaz, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| Safflorite | |
|---|
| Formula: | CoAs2 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| 'Sagenite' |  |
|---|
| Localities: | Reported from at least 12 localities in this region. |
|
|
|
|
|
|
|
| Photo: © Chinellato Matteo. Sagenite from Plattenkogel south slope, Ankogel area, Ankogel group, Hohe Tauern, Carinthia, Austria |
| Salammoniac | |
|---|
| Formula: | NH4Cl |
| Localities: | Muttlkogel, Zangtal District, Köflach - Voitsberg lignite deposit, Köflach, Styria, Austria Salt mine, Hall, Innsbruck, Inn valley, North Tyrol, Tyrol, Austria Seegraben, Leoben, Styria, Austria Münzenberg, Leoben, Styria, Austria
|
|
|
|
|
|
|
|
| Saléeite | |
|---|
| Formula: | Mg(UO2)2(PO4)2 · 10H2O |
| Locality: | Albert adit, Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
| Salzburgite (TL) |  |
|---|
| Formula: | Pb1.6Cu1.6Bi6.4S12 |
| Type Locality: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| Reference: | Topa, D., Makovicky, E., and Balić-Žunić, T. (2004): Mineralogical data on salzburgite and paarite, two new members of the bismuthinite–aikinite series. Canadian Mineralogist 43, 909-917; Lapis 29(5):42 (2004) |
|
|
|
|
|
| Photo: © AC. Salzburgite from Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria |
| Samarskite-(Y) |  |
|---|
| Formula: | (Y,Fe3+,Fe2+,U,Th,Ca)2(Nb,Ta)2O8 |
| Localities: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria Mitterreit, Aigen im Mühlkreis, Rohrbach, Mühlviertel, Upper Austria, Austria Mitterreit, Schlägl, Rohrbach, Mühlviertel, Upper Austria, Austria Floriani quarry (Haider quarry), Pulgarn, Steyregg, Urfahr-Umgebung, Mühlviertel, Upper Austria, Austria Meitschenhof, Pregarten, Freistadt, Mühlviertel, Upper Austria, Austria ? (more information)
|
|
|
|
|
|
|
| Photo: © neschen. Samarskite-(Y) from Meitschenhof, Pregarten, Freistadt, Mühlviertel, Upper Austria, Austria |
| Sampleite |  |
|---|
| Formula: | NaCaCu5(PO4)4Cl · 5H2O |
| Localities: | Haagen mine, Webing, Abtenau, Salzburg, Austria Hochfeld Mine, Untersulzbach valley, Hohe Tauern, Salzburg, Austria Hartenstein castle, Maigen, Weinzierl am Walde, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
| Photo: © AC. Sampleite from Haagen mine, Webing, Abtenau, Salzburg, Austria |
| Sanidine |  |
|---|
| Formula: | KAlSi3O8 |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Sanidine from Schlarbaum quarry, Klause, Bad Gleichenberg, Styria, Austria |
| Saponite | |
|---|
| Formula: | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Saponite var: Bowlingite | |
|---|
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
|
| Saponite var: Cuprian Saponite | |
|---|
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
|
| Sapphirine | |
|---|
| Formula: | (Mg,Fe)4-xAl4+x[Al4+xSi2-xO18]O2 |
| Locality: | Mitterbachgraben, Gansbach, Dunkelsteinerwald, Dunkelstein Forest, Mostviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
| Sarcopside |  |
|---|
| Formula: | (Fe2+,Mn2+,Mg)3(PO4)2 |
| Locality: | Oberhaag, Aigen im Mühlkreis, Rohrbach, Mühlviertel, Upper Austria, Austria |
|
|
|
|
|
|
| Photo: © neschen. Sarcopside from Oberhaag, Aigen im Mühlkreis, Rohrbach, Mühlviertel, Upper Austria, Austria |
| Sarkinite | |
|---|
| Formula: | Mn2+2(AsO4)(OH) |
| Locality: | Ködnitz valley, Kals valley, East Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Sasaite |  |
|---|
| Formula: | (Al,Fe3+)14(PO4)11(SO4)(OH)7 · 83H2O |
| Locality: | Breitenau Mine (Breitenau magnesite mine), Hochlantsch, St. Jakob-Breitenau, Fischbacher Alpen, Styria, Austria |
|
|
|
|
|
|
| Photo: © Antonio Borrelli. Sasaite from Breitenau Mine, Hochlantsch, St. Jakob-Breitenau, Fischbacher Alpen, Styria, Austria |
| 'Saussurite' | |
|---|
| Localities: | Eclogite outcrops, Sulz valley, Ötz valley, North Tyrol, Tyrol, Austria Ultrabasite outcrops, Wildschönau, Wörgl, Inn valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
|
| 'Scapolite' |  |
|---|
| Localities: | Reported from at least 35 localities in this region. |
|
|
|
|
|
|
|
| Photo: © . Scapolite from Graphite mine, Wegscheid, Mühldorf, Waldviertel, Lower Austria, Austria |
| 'Schalenblende' |  |
|---|
| Localities: | Antoni Mine (Antoni Shaft), Kreuth, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria Max Mine, Kreuth, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria Stefanie Mine, Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria Lafatsch valley (Hinterau valley), Karwendel Mts, North Tyrol, Tyrol, Austria Vomper Loch (Brantlrinne), Karwendel Mts, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| Photo: © P Blümner. Schalenblende from Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Schallerite | |
|---|
| Formula: | (Mn,Fe)16Si12As3O36(OH)17 |
| Locality: | Ködnitz valley, Kals valley, East Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| 'Scharizerite' | |
|---|
| Locality: | Drachenhöhle, Mixnitz, Frohnleiten, Styria, Austria |
|
|
|
|
|
|
|
|
| Scheelite |  |
|---|
| Formula: | Ca(WO4) |
| Localities: | Reported from at least 121 localities in this region. |
|
|
|
|
|
|
| Photo: © Rob Lavinsky. Scheelite from Plattenkogel north slope, Anlauf valley, Gastein valley, Hohe Tauern, Salzburg, Austria |
| Scheelite var: Molybdoscheelite | |
|---|
| Locality: | Emerald deposit, Leckbachgraben (Leckbachrinne), Nasenkopf, Habach Valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
|
| Schorl |  |
|---|
| Formula: | Na(Fe2+3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Localities: | Reported from at least 108 localities in this region. |
|
|
|
|
|
|
| Photo: © mslama. Schorl from Gneiss quarry, Ebersdorf, Leiben, Waldviertel, Lower Austria, Austria |
| 'Schraufite' | |
|---|
| Formula: | C11H16O2 |
| Localities: | Sandstone outcrops, Gablitz, Industrieviertel, Lower Austria, Austria Kritzendorf, Klosterneuburg, Wienerwald, Lower Austria, Austria
|
|
|
|
|
|
|
|
| Schröckingerite | |
|---|
| Formula: | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| 'Schrötterite' |  |
|---|
| Localities: | Tollinggraben (Tollingerberg), St Peter-Freienstein, Leoben, Styria, Austria Brandberg, Leoben, Styria, Austria
|
|
|
|
|
|
|
|
| Photo: © 0. Schrötterite from Brandberg, Leoben, Styria, Austria |
| Schulenbergite |  |
|---|
| Formula: | (Cu,Zn)7(SO4,CO3)2(OH)10 · 3H2O |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Schulenbergite from No. 1 adit, Äußere Wimitz, St Veit an der Glan, Gurktaler Alpen, Carinthia, Austria |
| Schultenite |  |
|---|
| Formula: | Pb(HAsO4) |
| Localities: | Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria Straßegg (Straßeck), Gasen, Birkfeld, Styria, Austria
|
|
|
|
|
|
|
| Photo: © AL. Schultenite from Neufinkenstein-Grabanz District, Mallestiger Mittagskogel, Finkenstein, Karawanken, Carinthia, Austria |
| 'Schwarzer Glaskopf' |  |
|---|
| Localities: | Theißenegg, Twimberg, Koralpe, Carinthia, Austria Zosen, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria
|
|
|
|
|
|
|
|
| Photo: © AC. Schwarzer Glaskopf from Zosen, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Scolecite |  |
|---|
| Formula: | CaAl2Si3O10 · 3H2O |
| Localities: | Reported from at least 35 localities in this region. |
|
|
|
|
|
|
| Photo: Scolecite from Modre quarry, Koschach, Malta valley, Hohe Tauern, Carinthia, Austria |
| Scorodite |  |
|---|
| Formula: | FeAsO4 · 2H2O |
| Localities: | Reported from at least 53 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Scorodite from Straßegg, Gasen, Birkfeld, Styria, Austria |
| Scorzalite | |
|---|
| Formula: | Fe2+Al2(PO4)2(OH)2 |
| Locality: | Hahnenkofel, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
|
|
|
|
|
|
|
| Segnitite |  |
|---|
| Formula: | PbFe3+3(AsO4)2(OH,H2O)6 |
| Localities: | Straßegg (Straßeck), Gasen, Birkfeld, Styria, Austria Sperkerriegel, Wiesmath, Bucklige Welt, Industrieviertel, Lower Austria, Austria Höllkogel, Alpl, Freßnitzgraben, Krieglach, Fischbacher Alpen, Styria, Austria Wildfrauengrotte, Teschengraben, Krieglach, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
| Photo: © 0. Segnitite from Wildfrauengrotte, Teschengraben, Krieglach, Fischbacher Alpen, Styria, Austria |
| Sekaninaite | |
|---|
| Formula: | (Fe,Mg)2Al3(AlSi5O18) |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
| Seligmannite | |
|---|
| Formula: | PbCuAsS3 |
| Localities: | Gypsum mine (Moldan mine), Moosegg, Grubach, Golling, Salzburg, Austria Haidbachgraben (Myrthengraben; Myrtengraben; Heidbachgraben), Semmering, Industrieviertel, Lower Austria, Austria
Modre quarry, Dragonerfels, Rammersdorf, Völkermarkt, Carinthia, Austria (more information)
|
|
|
|
|
|
|
|
| Semseyite | |
|---|
| Formula: | Pb9Sb8S21 |
| Locality: | Lead mines, Obernberg am Brenner, Obernberg valley, Sill valley (Wipp valley), North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Senaite | |
|---|
| Formula: | Pb(Ti,Fe,Mn)21O38 |
| Locality: | Prahmleiten adit (Pramleiten; Brandleiten), Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria |
|
|
|
|
|
|
|
| Sénarmontite |  |
|---|
| Formula: | Sb2O3 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Sénarmontite from Sb deposit, Leßnig, Möllbrücke, Kreuzeck group, Carinthia, Austria |
| Sepiolite |  |
|---|
| Formula: | Mg4(Si6O15)(OH)2 · 6H2O |
| Localities: | Reported from at least 14 localities in this region. |
|
|
|
|
|
|
| Photo: Sepiolite from Radenthein, Gurktaler Alpen, Carinthia, Austria |
| 'Serpentine Group' | |
|---|
| Formula: | D2[Si2O5](OH)4 + or - nH2O |
| Localities: | Reported from at least 16 localities in this region. |
|
|
|
|
|
|
|
| 'Serpentine Group var: Bastite' | |
|---|
| Localities: | Kirchbühel, Rothengrub, Willendorf, Industrieviertel, Lower Austria, Austria Biratalwand (Pyratalwand), Dürnstein, Wachau, Lower Austria, Austria
|
|
|
|
|
|
|
|
|
| Serpierite |  |
|---|
| Formula: | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Localities: | Reported from at least 18 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Serpierite from Lead mine, Graschnitzgraben, St. Marein, Fischbacher Alpen, Styria, Austria |
| Shandite ? | |
|---|
| Formula: | Ni3Pb2S2 |
| Locality: | S35 motorway tunnel (Kirchdorf tunnel), Kirchdorf, Frohnleiten, Styria, Austria - erroneously reported |
|
|
|
|
|
|
|
| Shattuckite | |
|---|
| Formula: | Cu5(Si2O6)2(OH)2 |
| Localities: | Göttliche Vorsehung adit, Copper mine, Großfragant, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria Copper mine, Großfragant, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria
|
|
|
|
|
|
|
|
| Shulamitite | |
|---|
| Formula: | Ca3TiFe3+AlO8 |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
| 'Shungite' | |
|---|
| Localities: | Mitterberg District, St Johann im Pongau, Salzburg, Austria Ottner Alp (Traholz), Brixen im Thale, Kitzbühel Alps, North Tyrol, Tyrol, Austria Hackbrettl, Enzingerboden, Stubach valley, Hohe Tauern, Salzburg, Austria ? (more information) U deposit, Eiblgraben, Hochfilzen, Kitzbühel Alps, North Tyrol, Tyrol, Austria ? (more information) Dietmannsdorf, Trieben, Liesing - Palten valley, Styria, Austria ? (more information)
|
|
|
|
|
|
|
|
|
| Siderite |  |
|---|
| Formula: | FeCO3 |
| Localities: | Reported from at least 276 localities in this region. |
|
|
|
|
|
|
| Photo: Siderite from Styrian Erzberg, Eisenerz, Styria, Austria |
| Siderite var: Ca-rich Siderite | |
|---|
| Formula: | (Fe,Ca)CO3 |
| Locality: | Radstadt, Salzburg, Austria |
|
|
|
|
|
|
|
| Siderite var: Mg-rich Siderite | |
|---|
| Formula: | (Fe,Mg)CO3 |
| Localities: | Pointner, Fürbach valley, Vorderkleinarl, Kleinarl valley, Radstädter Tauern, Salzburg, Austria Digrub (Diegrub), Annaberg, Abtenau, Salzburg, Austria Gwehenberg (Quehenberg), Annaberg, Abtenau, Salzburg, Austria
|
|
|
|
|
|
|
|
| Siderite var: Pistomesite | |
|---|
| Formula: | (Fe,Mg)CO3 |
| Localities: | Reported from at least 11 localities in this region. |
|
|
|
|
|
|
|
| Siderite var: Sideroplesite | |
|---|
| Formula: | (Fe,Mg)CO3 |
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
|
| Siderite var: Sphärosiderite | |
|---|
| Localities: | Coal deposit, Lobniggraben, Bad Eisenkappel (Bad Eisenkappl), Karawanken, Carinthia, Austria Lignite deposit, Schiefling, Wörth Lake, Klagenfurt, Carinthia, Austria Lilienfeld prospect, Lilienfeld, Mostviertel, Lower Austria, Austria Hainfeld, Mostviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
|
| 'Siderogel' | |
|---|
| Formula: | ~FeO(OH) · nH2O |
| Localities: | Quartzite quarry (Tanzer quarry), Falkenstein, Fischbach, Fischbacher Alpen, Styria, Austria Knappenwand, Knappenwand area, Untersulzbach valley, Hohe Tauern, Salzburg, Austria Slag dumps, Severinggraben, Johnsbach, Ennstaler Alpen, Styria, Austria
|
|
|
|
|
|
|
|
| Sideronatrite | |
|---|
| Formula: | Na2Fe(SO4)2(OH) · 3H2O |
| Locality: | Thermal water spa, Bad Gastein, Gastein valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Siderotil | |
|---|
| Formula: | FeSO4 · 5H2O |
| Localities: | Cu deposit, Lading, Saualpe, Carinthia, Austria Kothgraben (Kotgraben), Kleinfeistritz, Stubalpe, Styria, Austria Maukenötz District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Samer, Kothgraben (Kotgraben), Kleinfeistritz, Stubalpe, Styria, Austria
|
|
|
|
|
|
|
|
| Sidpietersite |  |
|---|
| Formula: | Pb4(S2O3)O2(OH)2 |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Sidpietersite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Siegenite | |
|---|
| Formula: | CoNi2S4 -NiCo2S4 |
| Localities: | Reported from at least 10 localities in this region. |
|
|
|
|
|
|
|
| Sillimanite |  |
|---|
| Formula: | Al2(SiO4)O |
| Localities: | Reported from at least 28 localities in this region. |
|
|
|
|
|
|
| Photo: © neschen. Sillimanite from Dürnberg, Ottensheim, Urfahr-Umgebung, Mühlviertel, Upper Austria, Austria |
| Silver |  |
|---|
| Formula: | Ag |
| Localities: | Reported from at least 61 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Silver from Kaltenegg, Southern District, Prinzkogel mines, Prinzkogel, Rettenegg, Fischbacher Alpen, Styria, Austria |
| Silver var: Amalgam | |
|---|
| Formula: | (Ag,Hg) |
| Localities: | Bartholomäberg, Montafon, Vorarlberg, Austria Kristbergsattel, Silbertal, Silber valley, Montafon, Vorarlberg, Austria
|
|
|
|
|
|
|
|
| Silver var: Kongsbergite | |
|---|
| Formula: | (Ag,Hg) |
| Localities: | Erasmus adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria Christoph adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria Vogelhalt District, Vogel Alp, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria
|
|
|
|
|
|
|
|
| Silver var: Küstelite | |
|---|
| Locality: | Arsenic mine, Lower Rotgülden lake, Rotgülden, Murwinkel, Lungau, Salzburg, Austria |
|
|
|
|
|
|
|
|
| Skutterudite |  |
|---|
| Formula: | (Co,Fe,Ni)As2-3 |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © Franz Brandstätter & Uwe Kolitsch. Skutterudite from Schnabelkar, Zinkwand, Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria |
| Slavíkite |  |
|---|
| Formula: | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 99H2O |
| Localities: | Magnesite deposit, Sunk, Hohentauern, Niedere Tauern, Styria, Austria Sternspitze, Zanaischg (Zaneischg), Pölla valley, Hafner group, Hohe Tauern, Carinthia, Austria Raidlgraben ("Radelgraben"), Fritzbach valley, Pöham, Werfen, Salzburg, Austria Limestone quarries, Weißenegg, Wildon, Graz, Styria, Austria Graphite quarry, Amstall, Mühldorf, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
| Photo: © AC. Slavíkite from Magnesite deposit, Sunk, Hohentauern, Niedere Tauern, Styria, Austria |
| 'Smectite Group' | |
|---|
| Formula: | A0.3D2-3[T4O10]Z2 · nH2O |
| Localities: | Ebenwald, Gmünd, Reißeck group, Hohe Tauern, Carinthia, Austria Serpentinite quarry, Pingendorf, Drosendorf-Zissersdorf, Waldviertel, Lower Austria, Austria Power station, Sportgastein, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria Quarry I, Loja, Persenbeug-Gottsdorf, Waldviertel, Lower Austria, Austria Parschlug mine, Parschlug, Bruck an der Mur, Styria, Austria
|
|
|
|
|
|
|
|
| Smithsonite |  |
|---|
| Formula: | ZnCO3 |
| Localities: | Reported from at least 99 localities in this region. |
|
|
|
|
|
|
| Photo: Smithsonite from Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Sodalite | |
|---|
| Formula: | Na8(Al6Si6O24)Cl2 |
| Localities: | Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria
|
|
|
|
|
|
|
|
| Sonolite |  |
|---|
| Formula: | Mn2+9(SiO4)4(OH,F)2 |
| Localities: | Friedlkogel (Friedelkogel; Heinzlkogel), Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria Kaskogel (Kaskögerl), Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria
|
|
|
|
|
|
|
| Photo: Sonolite from Friedlkogel, Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria |
| Souzalite |  |
|---|
| Formula: | (Mg,Fe2+)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| Locality: | Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © AC. Souzalite from Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
| Spangolite |  |
|---|
| Formula: | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
| Photo: © AL. Spangolite from North face, Hoher Sonnblick, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| 'Speiskobalt' | |
|---|
| Locality: | Zinkwand, Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria |
|
|
|
|
|
|
|
|
| Sperrylite | |
|---|
| Formula: | PtAs2 |
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Spessartine |  |
|---|
| Formula: | Mn2+3Al2(SiO4)3 |
| Localities: | Reported from at least 32 localities in this region. |
|
|
|
|
|
|
| Photo: © Franz Bernhard. Spessartine from Spessartine occurrence, Langteichengraben, Kalwang, Liesing - Palten valley, Styria, Austria |
| Sphalerite |  |
|---|
| Formula: | ZnS |
| Localities: | Reported from at least 408 localities in this region. |
|
|
|
|
|
|
| Photo: © . Sphalerite from Silberberg prospect, Großstübing, Peggau, Styria, Austria |
| Sphalerite var: Marmatite | |
|---|
| Formula: | (Zn,Fe)S |
| Localities: | Magnesite Mine, Millstätter Alpe, Radenthein, Gurktaler Alpen, Carinthia, Austria Kösting, Himmelberg, Gurktaler Alpen, Carinthia, Austria Pörtschach, Wörth Lake, Klagenfurt, Carinthia, Austria Gradenmoos, Graden valley, Schober group, Carinthia, Austria Pb-Zn deposit, St Christoph am Arlberg, Stanz valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| Spinel |  |
|---|
| Formula: | MgAl2O4 |
| Localities: | Reported from at least 20 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Spinel from Loja, Persenbeug-Gottsdorf, Waldviertel, Lower Austria, Austria |
| Spinel var: Chromspinel | |
|---|
| Formula: | Mg(Al,Cr3+)2O4 |
| Locality: | Breitenau Mine (Breitenau magnesite mine), Hochlantsch, St. Jakob-Breitenau, Fischbacher Alpen, Styria, Austria |
|
|
|
|
|
|
|
| Spinel var: Pleonaste | |
|---|
| Localities: | Münichreith, Kottes-Purk, Waldviertel, Lower Austria, Austria Mitterbachgraben, Gansbach, Dunkelsteinerwald, Dunkelstein Forest, Mostviertel, Lower Austria, Austria Luftenberg, St Georgen an der Gusen, Perg, Mühlviertel, Upper Austria, Austria ? (more information)
|
|
|
|
|
|
|
|
|
| Spionkopite | |
|---|
| Formula: | Cu39S28 |
| Localities: | Schlossberg, Krems, Voitsberg, Köflach, Styria, Austria Castle Hill, Graz, Styria, Austria
|
|
|
|
|
|
|
|
| Spodumene |  |
|---|
| Formula: | LiAlSi2O6 |
| Localities: | Reported from at least 16 localities in this region. |
|
|
|
|
|
|
| Photo: © . Spodumene from Pegmatite outcrops, St Radegund, Graz, Styria, Austria |
| Srebrodolskite |  |
|---|
| Formula: | Ca2Fe3+2O5 |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
| Photo: © Franz Brandstätter & Uwe Kolitsch. Srebrodolskite from Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
| Stanfieldite | |
|---|
| Formula: | Ca7Ca2Mg9(PO4)12 |
| Locality: | Prehistoric ritual immolation site (slag locality), Goldbichl, Igls, Innsbruck, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Stannite | |
|---|
| Formula: | Cu2(Fe,Zn)SnS4 |
| Localities: | Reported from at least 10 localities in this region. |
|
|
|
|
|
|
|
Stannoidite | |
|---|
| Formula: | Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| Locality: | Glücksgrat, Habicht, Unterberg valley, Stubai valley, Sill valley (Wipp valley), North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Starkeyite | |
|---|
| Formula: | MgSO4 · 4H2O |
| Locality: | Schildmauer, Admont, Ennstaler Alpen, Styria, Austria |
|
|
|
|
|
|
|
| Staurolite |  |
|---|
| Formula: | (Fe2+,Mg,Zn)1.5-2Al9(SiO4)4O6(OH,O)2 |
| Localities: | Reported from at least 35 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Staurolite from Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Stellerite |  |
|---|
| Formula: | Ca[Al2Si7O18] · 7H2O |
| Localities: | Reported from at least 10 localities in this region. |
|
|
|
|
|
|
| Photo: Stellerite from Power station, Sportgastein, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria |
| Stephanite | |
|---|
| Formula: | Ag5SbS4 |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
|
| Sternbergite | |
|---|
| Formula: | AgFe2S3 |
| Locality: | Preisdorf forest, Kolbnitz, Reißeck group, Hohe Tauern, Carinthia, Austria |
|
|
|
|
|
|
|
| 'Stevensite' |  |
|---|
| Formula: | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Locality: | Kleinheinrichschlag, Albrechtsberg an der Großen Krems, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
| Photo: Stevensite from Kleinheinrichschlag, Albrechtsberg an der Großen Krems, Waldviertel, Lower Austria, Austria |
| Stibarsen |  |
|---|
| Formula: | AsSb |
| Localities: | Albert adit, Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria Heinrich section, Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria Zinkwand, Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Stibarsen from Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Stibioclaudetite |  |
|---|
| Formula: | AsSbO3 |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Harald Schillhammer. Stibioclaudetite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| 'Stibioenargite' | |
|---|
| Formula: | Cu3(Sb,As)S4 |
| Locality: | Burgstall, Schwaz, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Stibiopalladinite | |
|---|
| Formula: | Pd5Sb2 |
| Locality: | Kraubath, Leoben, Styria, Austria |
|
|
|
|
|
|
|
| Stibnite |  |
|---|
| Formula: | Sb2S3 |
| Localities: | Reported from at least 56 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Stibnite from Antimony mine, Stadtschlaining, Oberwart, Burgenland, Austria |
| Stichtite | |
|---|
| Formula: | Mg6Cr2(OH)16[CO3] · 4H2O |
| Locality: | S35 motorway tunnel (Kirchdorf tunnel), Kirchdorf, Frohnleiten, Styria, Austria |
|
|
|
|
|
|
|
| 'Stilbite' |  |
|---|
| Localities: | Reported from at least 104 localities in this region. |
|
|
|
|
|
|
|
| Photo: © Harjo. Stilbite from Moar Alp, Habach valley, Hohe Tauern, Salzburg, Austria |
| Stilbite-Ca | |
|---|
| Formula: | NaCa4[Al9Si27O72] · nH2O |
| Localities: | Kreuzbach, Soboth, Koralpe, Styria, Austria S35 motorway tunnel (Kirchdorf tunnel), Kirchdorf, Frohnleiten, Styria, Austria Kaltenbachalm, Sölk pass, Sölk valley, Gröbming, Niedere Tauern, Styria, Austria Verpeil valley, Feichten, Kauns valley, North Tyrol, Tyrol, Austria Lower Gsall valley, Vergötschen, Feichten, Kauns valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| Stilpnomelane | |
|---|
| Formula: | (K,Ca,Na)(Fe2+,Mg,Al,Fe3+)8(Si,Al)12(O,OH)36 · nH2O |
| Localities: | Reported from at least 12 localities in this region. |
|
|
|
|
|
|
|
| Stolzite |  |
|---|
| Formula: | Pb(WO4) |
| Localities: | Stüblbau Mine, Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria Slag localities, Kolm-Saigurn, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Schulterbau Mine, Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria
Prahmleiten adit (Pramleiten; Brandleiten), Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria (more information)
|
|
|
|
|
|
|
| Photo: © 0. Stolzite from Stüblbau Mine, Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria |
| Stranskiite | |
|---|
| Formula: | Zn2Cu(AsO4)2 |
| Locality: | Maukenötz District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Strashimirite |  |
|---|
| Formula: | Cu8(AsO4)4(OH)4 · 5H2O |
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Strashimirite from Neuschurf adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
| Strengite | |
|---|
| Formula: | FePO4 · 2H2O |
| Localities: | Ebenlecker farm (Ebenlöcker farm), Herzogberg, Modriach, Koralpe, Styria, Austria Ganz valley, Hönigsberg, Mürzzuschlag, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
|
| Stromeyerite | |
|---|
| Formula: | AgCuS |
| Locality: | Erasmus adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
|
|
|
|
|
|
|
| Strontianite |  |
|---|
| Formula: | SrCO3 |
| Localities: | Reported from at least 67 localities in this region. |
|
|
|
|
|
|
| Photo: © fabreminerals.com. Strontianite from Magnesite deposit, Oberdorf an der Laming, Laming valley, Bruck an der Mur, Styria, Austria |
| Strontianite var: Emmonite |  |
|---|
| Formula: | (Sr,Ca)CO3 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
| Photo: © M Arliguie. Emmonite from Großkogel, St Gertraudi, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| Strontiodresserite |  |
|---|
| Formula: | (Sr,Ca)Al2(CO3)2(OH)4 · H2O |
| Locality: | Dielengraben, Stein, Dellach im Drautal, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Yaiba Sakaguchi. Strontiodresserite from Dielengraben, Stein, Dellach im Drautal, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Strunzite | |
|---|
| Formula: | Mn2+Fe3+2(PO4)2(OH)2 · 6H2O |
| Locality: | Ebenlecker farm (Ebenlöcker farm), Herzogberg, Modriach, Koralpe, Styria, Austria |
|
|
|
|
|
|
|
| Struvite-(K) (TL) | |
|---|
| Formula: | KMg(PO4)·6H2O |
| Type Locality: | Roßblei Mine (Rossblei Mine), Eschach Alp (Eschachboden; Martinlager), Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria |
| Reference: | Postl, W., Walter, F., Ettinger K.. &. Bojar, H.-P. (2000): Erster Nachweis des Kalium-Analogons MgK(PO4).6H2O von Struvit, und der kristallinen Phase Mg2KH(PO4)2.15H2O aus dem ehemaligen Bleibergbau Rossblei, Eschachalm, Schladminger Tauern, Steiermark, Österreich. Joannea Min., 1, 45-52; Roth, Ph. (2007): Minerals first discovered in Switzerland and minerals named after Swiss individuals. Philippe Roth, Ed., Zurich, 239 pp.; S. Graeser, W. Postl, H. Bojar, P. Berlepsch, T. Armbruster, T. Raber, K. Ettinger & F. Walter (2008): Struvite-(K), KMgPO4.6H2O, the potassium equivalent of struvite - a new mineral. European Journal of Mineralogy 20, 629-633. |
|
|
|
|
|
|
| Studtite | |
|---|
| Formula: | [(UO2)(O2)(H2O)2] · H2O |
| Localities: | Anna adit, Mitterberg District, St Johann im Pongau, Salzburg, Austria Mitterberg District, St Johann im Pongau, Salzburg, Austria
|
|
|
|
|
|
|
|
| Stützite | |
|---|
| Formula: | Ag5-xTe3, x = 0.24-0.36 |
| Locality: | Hochfeld Mine, Untersulzbach valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Sulphur |  |
|---|
| Formula: | S8 |
| Localities: | Reported from at least 126 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Sulphur from Schiefer adit, Fladung District, Hochobir, Karawanken, Carinthia, Austria |
| Susannite |  |
|---|
| Formula: | Pb4(CO3)2(SO4)(OH)2 |
| Localities: | Arzberg am Semmering, Fröschnitz valley (Fröschnitz), Steinhaus am Semmering, Spital am Semmering, Fischbacher Alpen, Styria, Austria Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Susannite from Arzberg am Semmering, Fröschnitz valley, Steinhaus am Semmering, Spital am Semmering, Fischbacher Alpen, Styria, Austria |
| Sussexite |  |
|---|
| Formula: | Mn2+BO2(OH) |
| Locality: | Friedlkogel (Friedelkogel; Heinzlkogel), Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria |
|
|
|
|
|
|
| Photo: © Franz Bernhard. Sussexite from Friedlkogel, Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria |
| Svanbergite | |
|---|
| Formula: | SrAl3(PO4)(SO4)(OH)6 |
| Localities: | Frauenkammer, Fischbach, Fischbacher Alpen, Styria, Austria Inselberg, Rettenegg, Fischbacher Alpen, Styria, Austria Faschingbauerkreuz - Reithkogel area (Gießhübler Berg; Gießhübler Holzschlag), Fischbach, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
|
| Sylvanite | |
|---|
| Formula: | (Au,Ag)2Te4 |
| Localities: | Schulterbau Mine, Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria Knappenlöcher, Zanaischg (Zaneischg), Pölla valley, Hafner group, Hohe Tauern, Carinthia, Austria Dornbach, Malta, Malta valley, Hohe Tauern, Carinthia, Austria Stüblbau Mine, Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria ? (more information)
|
|
|
|
|
|
|
|
| Sylvite | |
|---|
| Formula: | KCl |
| Localities: | Thermal water spa, Bad Gastein, Gastein valley, Hohe Tauern, Salzburg, Austria Salt mine, Hallstatt, Gmunden, Upper Austria, Austria Haagen mine, Webing, Abtenau, Salzburg, Austria ? (more information) Haagen quarry, Webing, Abtenau, Salzburg, Austria ? (more information)
|
|
|
|
|
|
|
|
| Symplesite |  |
|---|
| Formula: | Fe2+3(AsO4)2 · 8H2O |
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Symplesite from Wastlkar, Kölnbreinspitze - Lausnock area, Malta valley, Hohe Tauern, Carinthia, Austria |
| 'Synchysite' |  |
|---|
| Localities: | Reported from at least 14 localities in this region. |
|
|
|
|
|
|
|
| Photo: © AL. Synchysite from Power station, Sportgastein, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria |
| Synchysite-(Ce) |  |
|---|
| Formula: | Ca(Ce,La)(CO3)2F |
| Localities: | Reported from at least 15 localities in this region. |
|
|
|
|
|
|
| Photo: © D.Preite. Synchysite-(Ce) from Hopffeldboden, Hopffeld area, Obersulzbach valley, Hohe Tauern, Salzburg, Austria |
| 'Synchysite Group' |  |
|---|
| Locality: | Gotelinde tunnel (Kolm-Saigurn-Naßfeld water tunnel), Siglitz - Bockhart area, Gastein valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Photo: © . Synchysite Group from Power station, Sportgastein, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria |
| Synchysite-(Y) | |
|---|
| Formula: | Ca(Y,Ce)(CO3)2F |
| Localities: | Moos, Böckstein, Gastein valley, Hohe Tauern, Salzburg, Austria Kaiserer quarry (Deisl quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria ? (more information) Lohning quarry (Lohninger quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria ? (more information)
|
|
|
|
|
|
|
|
| Syngenite | |
|---|
| Formula: | K2Ca(SO4)2 · H2O |
| Locality: | Salt mine, Hallstatt, Gmunden, Upper Austria, Austria |
|
|
|
|
|
|
|
| Szmikite | |
|---|
| Formula: | MnSO4 · H2O |
| Locality: | St Lorenzen, Eibiswald, Wies, Koralpe, Styria, Austria |
|
|
|
|
|
|
|
| Szomolnokite |  |
|---|
| Formula: | FeSO4 · H2O |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
| Photo: © . Szomolnokite from Granite quarries, Gänsgraben, Limberg, Maissau, Waldviertel, Lower Austria, Austria |
| Tacharanite | |
|---|
| Formula: | Ca12Al2Si18O51 · 18H2O |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
| Tachyhydrite | |
|---|
| Formula: | CaMg2Cl6 · 12H2O |
| Locality: | Rock salt deposit, Dürrnberg, Hallein, Salzburg, Austria |
|
|
|
|
|
|
|
| Takanelite | |
|---|
| Formula: | (Mn,Ca)Mn4O9 · H2O |
| Locality: | Aldrian quarry, Lieschengraben, Oberhaag, Styria, Austria |
|
|
|
|
|
|
|
| Talc |  |
|---|
| Formula: | Mg3(Si4O10)(OH)2 |
| Localities: | Reported from at least 102 localities in this region. |
|
|
|
|
|
|
| Photo: Talc from Talggenkopf, Zemmgrund, Zillertal, North Tyrol, Tyrol, Austria |
| Talc var: Steatite | |
|---|
| Formula: | Mg3(Si4O10)(OH)2 |
| Localities: | Bärental, Feistritz im Rosental, Karawanken, Carinthia, Austria Hintereichberg, Eichberg, Gloggnitz, Industrieviertel, Lower Austria, Austria Magnesite deposit, Eichberg, Gloggnitz, Industrieviertel, Lower Austria, Austria Brennkogel north slope, Brennkogel area, Fusch valley, Hohe Tauern, Salzburg, Austria Klausengrube, Radlgraben, Gmünd, Reißeck group, Hohe Tauern, Carinthia, Austria
|
|
|
|
|
|
|
|
| Talmessite | |
|---|
| Formula: | Ca2Mg(AsO4)2 · 2H2O |
| Locality: | Hirschentor, Klippitztörl road cuts, Stelzing, Lölling, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
| Tangeite | |
|---|
| Formula: | CaCu(VO4)(OH) |
| Locality: | Dullinger quarry (Quarry No. 21), Limestone quarries, Adnet, Hallein, Salzburg, Austria |
|
|
|
|
|
|
|
| 'Tantalite' | |
|---|
| Formula: | (Fe,Mn)(Ta,Nb)2O6 |
| Localities: | Zissingdorf, Neumarkt im Mühlkreis, Freistadt, Mühlviertel, Upper Austria, Austria Mötlas, Königswiesen, Freistadt, Mühlviertel, Upper Austria, Austria Kaiserer quarry (Deisl quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Königswiesen area, Königswiesen, Freistadt, Mühlviertel, Upper Austria, Austria
|
|
|
|
|
|
|
|
| Tantalite-(Fe) | |
|---|
| Formula: | FeTa2O6 |
| Localities: | Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria Lippnik Feldspar quarry, Lieser ravine, Spittal, Millstatt lake ridge, Carinthia, Austria
|
|
|
|
|
|
|
|
| Tanteuxenite-(Y) | |
|---|
| Formula: | (Y,Ce,Ca)(Ta,Nb,Ti)2(O,OH)6 |
| Locality: | Hopffeldboden, Hopffeld area, Obersulzbach valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Tapiolite-(Fe) | |
|---|
| Formula: | (Fe,Mn)(Ta,Nb)2O6 |
| Localities: | Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria Lippnik Feldspar quarry, Lieser ravine, Spittal, Millstatt lake ridge, Carinthia, Austria
|
|
|
|
|
|
|
|
| 'Tektite var: Moldavite' | |
|---|
| Localities: | Eggenburg, Waldviertel, Lower Austria, Austria Mahrersdorf, Altenburg, Waldviertel, Lower Austria, Austria Gravel pit, Altenburg, Waldviertel, Lower Austria, Austria Radessen, Ludweis-Aigen, Waldviertel, Lower Austria, Austria Straning, Straning-Grafenberg, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
|
|
| Tellurium | |
|---|
| Formula: | Te |
| Localities: | Wieseggrinne (Stinkrinne), Leutachkopf - Stocker Alp area, Untersulzbach valley, Hohe Tauern, Salzburg, Austria Stüblbau Mine, Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria ? (more information)
|
|
|
|
|
|
|
|
| Tennantite |  |
|---|
| Formula: | Cu6[Cu4(Fe,Zn)2]As4S13 |
| Localities: | Reported from at least 85 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Tennantite from Prenterwinkelgraben, Bärndorf, Rottenmann, Liesing - Palten valley, Styria, Austria |
| 'Tennantite-Tetrahedrite Series' |  |
|---|
| Localities: | Reported from at least 98 localities in this region. |
|
|
|
|
|
|
|
| Photo: © AC. Tennantite-Tetrahedrite Series from Arsenic mine, Lower Rotgülden lake, Rotgülden, Murwinkel, Lungau, Salzburg, Austria |
| Tenorite |  |
|---|
| Formula: | CuO |
| Localities: | Reported from at least 28 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Tenorite from Daniel adit, Schwarzleo District, Schwarzleograben, Hütten, Leogang, Saalfelden, Salzburg, Austria |
| Tephroite |  |
|---|
| Formula: | Mn2+2SiO4 |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Tephroite from Kaskogel, Kaiblinggraben, Kleinveitsch, Veitsch, Mitterdorf, Styria, Austria |
| Terlinguaite | |
|---|
| Formula: | (Hg+2)0.5Hg2+ClO |
| Locality: | Stocker adit, Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Tetradymite |  |
|---|
| Formula: | Bi2Te2S |
| Localities: | Reported from at least 30 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Tetradymite from Wurten glacier, Wurten, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria |
| Tetraferriannite | |
|---|
| Formula: | KFe2+3((Fe3+,Al)Si3O10)(OH)2 |
| Localities: | Marble quarry, Gummern, Afritz Mts, Villach, Carinthia, Austria Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria ? (more information)
|
|
|
|
|
|
|
|
| Tetrahedrite |  |
|---|
| Formula: | Cu6[Cu4(Fe,Zn)2]Sb4S13 |
| Localities: | Reported from at least 143 localities in this region. |
|
|
|
|
|
|
| Photo: Tetrahedrite from Magnesite deposit, Sattlerkogel, Veitsch, Mitterdorf, Styria, Austria |
| Tetrahedrite var: Argentian Tetrahedrite |  |
|---|
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
|
| Photo: © Peter Haas. Argentian Tetrahedrite from Alte Zeche Mine, Schwazer Eisenstein, Arzberg, Schwaz, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| Tetrahedrite var: Bismuthian Tetrahedrite |  |
|---|
| Formula: | Cu12(Sb,Bi)4S13 |
| Localities: | Alte Zeche Mine, Schwazer Eisenstein, Arzberg, Schwaz, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Zinkwand, Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria
|
|
|
|
|
|
|
| Photo: © 2005 - MMI. Bismuthian Tetrahedrite from Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria |
| Tetrahedrite var: Mercurian Tetrahedrite |  |
|---|
| Formula: | (Cu,Hg)12Sb4S13 |
| Localities: | Reported from at least 11 localities in this region. |
|
|
|
|
|
|
| Photo: © 2001 John H. Betts. Mercurian Tetrahedrite from Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| Tetrahedrite var: Zincian Tetrahedrite | |
|---|
| Formula: | Cu10Zn2Sb4S13 |
| Locality: | Fingerlos quarry (Hammerbruch), Mauterndorf, Taurach valley, Lungau, Salzburg, Austria |
|
|
|
|
|
|
|
| Thaumasite |  |
|---|
| Formula: | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Localities: | Mully adit (Muli adit), Copper mine, Großfragant, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria Railway tunnel, Galgenberg, Leoben, Styria, Austria Copper mine, Großfragant, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Thaumasite from Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
| Theisite |  |
|---|
| Formula: | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| Localities: | Reported from at least 23 localities in this region. |
|
|
|
|
|
|
| Photo: © O. Dziallas. Theisite from Kleinkogel, St Gertraudi, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| Thenardite | |
|---|
| Formula: | Na2SO4 |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
|
| Thermonatrite | |
|---|
| Formula: | Na2CO3 · H2O |
| Locality: | Gratlspitz, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
'Thomsonite' | |
|---|
| Locality: | Quarry IV- Southern Area, Loja, Persenbeug-Gottsdorf, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
|
|
| Thomsonite-Ca |  |
|---|
| Formula: | NaCa2[Al5Si5O20] · 6H2O |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © AC. Thomsonite-Ca from Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
| Thorianite |  |
|---|
| Formula: | ThO2 |
| Locality: | Schmoll Quarry, Bernhards, Kottes-Purk, Waldviertel, Lower Austria, Austria |
|
|
|
|
|
|
| Photo: © Franz Brandstätter & Uwe Kolitsch. Thorianite from Schmoll Quarry, Bernhards, Kottes-Purk, Waldviertel, Lower Austria, Austria |
| Thorite |  |
|---|
| Formula: | (Th,U)SiO4 |
| Localities: | Kaiserer quarry (Deisl quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Lohning quarry (Lohninger quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Hopffeldboden, Hopffeld area, Obersulzbach valley, Hohe Tauern, Salzburg, Austria Bären valley, Pletzen, Seckauer Tauern (Seckauer Alpen), Styria, Austria Schmoll Quarry, Bernhards, Kottes-Purk, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
| Photo: © AL. Thorite from Kaiserer quarry, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| Thorite var: Uranothorite | |
|---|
| Formula: | (Th,U)SiO4 |
| Localities: | Kaiserer quarry (Deisl quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Lohning quarry (Lohninger quarry), Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Wustkogel, Seidlwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
| Thortveitite | |
|---|
| Formula: | (Sc,Y)2Si2O7 |
| Locality: | Hopffeldboden, Hopffeld area, Obersulzbach valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| 'Thrombolite' | |
|---|
| Localities: | Magnesite deposit, Sattlerkogel, Veitsch, Mitterdorf, Styria, Austria Haider quarry, Wald am Schoberpass, Liesing - Palten valley, Styria, Austria Wetterbauersattel, Mixnitz, Frohnleiten, Styria, Austria
|
|
|
|
|
|
|
|
|
| Tiragalloite | |
|---|
| Formula: | Mn2+4(HAsSi3O13) |
| Locality: | Ködnitz valley, Kals valley, East Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Titanite |  |
|---|
| Formula: | CaTi(SiO4)O |
| Localities: | Reported from at least 330 localities in this region. |
|
|
|
|
|
|
| Photo: © D. Preite. Titanite from Felben, Felben valley, Hohe Tauern, Salzburg, Austria |
| Tobermorite |  |
|---|
| Formula: | Ca4+x(H2-2xSi6O17) · 5H2O |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
| Photo: © AC. Tobermorite from Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
| Tochilinite |  |
|---|
| Formula: | Fe2+5-6(Mg,Fe2+)5S6(OH)10 |
| Localities: | Loja, Persenbeug-Gottsdorf, Waldviertel, Lower Austria, Austria S35 motorway tunnel (Kirchdorf tunnel), Kirchdorf, Frohnleiten, Styria, Austria Quarry I, Loja, Persenbeug-Gottsdorf, Waldviertel, Lower Austria, Austria Quarry IV- Middle & Northern Area, Loja, Persenbeug-Gottsdorf, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
| Photo: © AC. Tochilinite from Loja, Persenbeug-Gottsdorf, Waldviertel, Lower Austria, Austria |
| Todorokite |  |
|---|
| Formula: | (Ca,K,Na,Mg,Ba,Mn)(Mn,Mg,Al)6O12 · 3H2O |
| Localities: | Reported from at least 39 localities in this region. |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Todorokite from Graschberg, Thierbach, Wildschönau, Wörgl, Inn valley, North Tyrol, Tyrol, Austria |
| Tooeleite |  |
|---|
| Formula: | Fe3+6(As3+O3)4(SO4)(OH)4 · 4H2O |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Tooeleite from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Topaz |  |
|---|
| Formula: | Al2(SiO4)(F,OH)2 |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © . Topaz from Leutachkopf - Stocker Alp area, Untersulzbach valley, Hohe Tauern, Salzburg, Austria |
| Topaz var: Pyknite | |
|---|
| Locality: | Quartz quarries, Herzogberg, Modriach, Koralpe, Styria, Austria |
|
|
|
|
|
|
|
|
| Torbernite |  |
|---|
| Formula: | Cu(UO2)2(PO4)2 · 12H2O |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
| Photo: © . Torbernite from Hochgölk, Krieglach, Fischbacher Alpen, Styria, Austria |
| 'Tourmaline' |  |
|---|
| Formula: | A(D3)G6(T6O18)(BO3)3X3Z |
| Localities: | Reported from at least 153 localities in this region. |
|
|
|
|
|
|
| Photo: Tourmaline from Furtschaglkar, Schlegeis valley, Zillertal, North Tyrol, Tyrol, Austria |
| 'Tourmaline var: Indicolite' | |
|---|
| Localities: | Sonntagskopf, Ascham Alp - Breitfuß - Sonntagskopf area, Untersulzbach valley, Hohe Tauern, Salzburg, Austria A10 Highway tunnel, Oswaldiberg, Afritz Mts, Villach, Carinthia, Austria ? (more information) Jungfernsprung, Landskron castle, Landskron, Villach, Carinthia, Austria ? (more information) Marble quarry, Gummern, Afritz Mts, Villach, Carinthia, Austria ? (more information)
|
|
|
|
|
|
|
|
|
| 'Tourmaline var: Rubellite' | |
|---|
| Localities: | Maigen, Weinzierl am Walde, Waldviertel, Lower Austria, Austria Blocherleitengraben, Miesling valley, Spitz, Wachau, Lower Austria, Austria
|
|
|
|
|
|
|
|
|
| Trattnerite (TL) |  |
|---|
| Formula: | □(Fe3+,Mg,Fe2+)2(Mg,Fe2+,Fe3+)3(Si12O30) |
| Type Locality: | Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria |
| Reference: | W. Postl et al.: European Journal of Mineralogy 16(2):375-380 (2004) |
|
|
|
|
|
| Photo: © 0. Trattnerite from Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria |
| Tremolite |  |
|---|
| Formula: | ☐{Ca2}{Mg5}(Si8O22)(OH)2 |
| Localities: | Reported from at least 79 localities in this region. |
|
|
|
|
|
|
| Photo: © mslama. Tremolite from Graphite quarry, Amstall, Mühldorf, Waldviertel, Lower Austria, Austria |
| Tridymite |  |
|---|
| Formula: | SiO2 |
| Localities: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria Schlarbaum quarry, Klause, Bad Gleichenberg, Styria, Austria Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria ? (more information)
|
|
|
|
|
|
|
| Photo: © AC. Tridymite from Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria |
| 'Trinkerite' | |
|---|
| Localities: | Bösenberg, Gams, Hieflau, Styria, Austria Wildalpen, Salza valley, Styria, Austria
|
|
|
|
|
|
|
|
|
| Triphylite |  |
|---|
| Formula: | LiFe2+PO4 |
| Localities: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria Windeckberg, Miesling valley, Spitz, Wachau, Lower Austria, Austria Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Triphylite from Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
| Triplite |  |
|---|
| Formula: | (Mn2+,Fe2+)2(PO4)(F,OH) |
| Localities: | Poschacher Quarry, Artolz (Artholz), Pfaffenschlag bei Waidhofen an der Thaya, Waldviertel, Lower Austria, Austria Windeckberg, Miesling valley, Spitz, Wachau, Lower Austria, Austria Katzensilbergrube, Unterweißenbach, Königswiesen, Freistadt, Mühlviertel, Upper Austria, Austria Königswiesen area, Königswiesen, Freistadt, Mühlviertel, Upper Austria, Austria
|
|
|
|
|
|
|
| Photo: © AC. Triplite from Windeckberg, Miesling valley, Spitz, Wachau, Lower Austria, Austria |
| Tripuhyite | |
|---|
| Formula: | Fe3+Sb5+O4 |
| Locality: | Maukenötz District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Troilite ? | |
|---|
| Formula: | FeS |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria - erroneously reported |
|
|
|
|
|
|
|
| Tsumoite | |
|---|
| Formula: | BiTe |
| Localities: | Gold Mines, Alteck, Wurten, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria Strabaleben (Strabeleben), Wurten, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria
|
|
|
|
|
|
|
|
| Tungstenite | |
|---|
| Formula: | WS2 |
| Localities: | Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria Magnesite mine, Tux (Lanersbach; Lannersbach), Tux valley, Zillertal, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| 'Tunnerite (of Cornu)' | |
|---|
| Locality: | Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
|
|
|
|
|
|
|
|
| Turquoise |  |
|---|
| Formula: | Cu(Al,Fe3+)6(PO4)4(OH)8 · 4H2O |
| Localities: | Gratlspitz, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Amstall, Mühldorf, Waldviertel, Lower Austria, Austria Stocker adit, Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
| Photo: © mslama. Turquoise from Graphite quarry, Amstall, Mühldorf, Waldviertel, Lower Austria, Austria |
| Tyrolite (TL) |  |
|---|
| Formula: | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Type Locality: | Falkenstein, Falkenstein District, Schwaz, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| Reference: | Haidinger, W. v. (1845) Handbuch der Bestimmenden Mineralogie, Vienna (1845); Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 926. |
| Localities: | Recorded from at least 49 other localities in this region. |
|
|
|
|
| Photo: © D. Preite - M.C.. Tyrolite from Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
| 'Tyrolite-1M' | |
|---|
| Locality: | Falkenstein, Falkenstein District, Schwaz, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
|
| 'Tyrolite-2M' | |
|---|
| Locality: | Falkenstein, Falkenstein District, Schwaz, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
|
| 'U153 (of Schnorrer)' | |
|---|
| Formula: | Ca, Cl, O |
| Locality: | Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Ullmannite | |
|---|
| Formula: | NiSbS |
| Localities: | Reported from at least 17 localities in this region. |
|
|
|
|
|
|
|
| Ulvöspinel ? | |
|---|
| Formula: | Fe2TiO4 |
| Locality: | Ferschbach valley, Fellern, Stubach valley, Hohe Tauern, Salzburg, Austria - erroneously reported |
|
|
|
|
|
|
|
| 'UM1976-05-BO:HMgNaSU' | |
|---|
| Formula: | Na, Mg, U, B, S, O, H |
| Locality: | Schildmauer, Admont, Ennstaler Alpen, Styria, Austria |
|
|
|
|
|
|
|
| 'UM1976-06-BO-HMgNaSU' | |
|---|
| Formula: | Na, Mg, U, B, S, O, H |
| Locality: | Schildmauer, Admont, Ennstaler Alpen, Styria, Austria |
|
|
|
|
|
|
|
| 'UM1976-07-BO-HMgNaSU ' | |
|---|
| Formula: | Na, Mg, U, B, S, O, H |
| Locality: | Schildmauer, Admont, Ennstaler Alpen, Styria, Austria |
|
|
|
|
|
|
|
| Umangite | |
|---|
| Formula: | Cu3Se2 |
| Locality: | Selenide occurrence, Eselberg, Altenberg an der Rax, Neuberg an der Mürz, Styria, Austria |
|
|
|
|
|
|
|
| 'Unnamed (Ag-Au Amalgam)' | |
|---|
| Formula: | Ag2Au3Hg |
| Locality: | Mitterberg District, St Johann im Pongau, Salzburg, Austria |
|
|
|
|
|
|
|
| 'Unnamed (Arseniosiderite-related mineral)' | |
|---|
| Formula: | Ca, Fe, As, O, H |
| Locality: | Großstroheim quarry (Fuchsmeier quarry), Eferding, Upper Austria, Austria |
|
|
|
|
|
|
|
| 'Unnamed (Ba-Ca Carbonate)' |  |
|---|
| Formula: | Ba, Ca, C, O, H |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Unnamed (Ba-Ca Carbonate) from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| 'Unnamed (Ba-K-Fe Sulphide)' | |
|---|
| Formula: | Ba-K-Fe-S |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
| 'Unnamed (Ba-Sb Silicate-Sulphate-Hydroxide-Hydrate)' | |
|---|
| Formula: | Ba3Sb5+[(Si,S)O3(OH)]2(OH,O)6 · 3H2O |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
| 'Unnamed (Ba Sulphite)' ? | |
|---|
| Formula: | BaSO3 |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria - erroneously reported |
|
|
|
|
|
|
|
| 'Unnamed (Ba Thiosulphate Monohydrate)' |  |
|---|
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Unnamed (Ba Thiosulphate Monohydrate) from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| 'Unnamed (Cu-Sb Oxyde-Chloride)' | |
|---|
| Formula: | CuSb2O3Cl |
| Locality: | Montanwerke Brixlegg (slag locality), Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| 'Unnamed (Cu-S-Si-O-H)' |  |
|---|
| Formula: | Cu-S-Si-O-H |
| Locality: | Lechnerberg (slag locality), Kaprun, Kaprun valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
| Photo: © Harald Schillhammer. Unnamed (Cu-S-Si-O-H) from Lechnerberg, Kaprun, Kaprun valley, Hohe Tauern, Salzburg, Austria |
| 'Unnamed (Cu-Zn Arsenate Carbonate)' ? | |
|---|
| Formula: | {Cu,Zn,(AsO4),(CO3)} |
| Localities: | Gertraud adit, Großkogel (Reither Kogel), St Gertraudi, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria ? (more information) Hofer Tratte, Hof, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria ? (more information)
|
|
|
|
|
|
|
|
| 'Unnamed (Cu-Zn Arsenate-Sulphate)' |  |
|---|
| Formula: | Cu, Zn, As, S, O, H |
| Locality: | Ottner Alp (Traholz), Brixen im Thale, Kitzbühel Alps, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Unnamed (Cu-Zn Arsenate-Sulphate) from Ottner Alp, Brixen im Thale, Kitzbühel Alps, North Tyrol, Tyrol, Austria |
| 'Unnamed (Dimorph of Devilline)' |  |
|---|
| Formula: | CaCu4(SO4)2(OH)6 · 3H2O |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Unnamed (Dimorph of Devilline) from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| 'Unnamed (K-Mg Phosphate Hydrate)' | |
|---|
| Formula: | KMg2H(PO4)2 · 15H2O |
| Locality: | Roßblei Mine (Rossblei Mine), Eschach Alp (Eschachboden; Martinlager), Obertalbach valley, Schladminger Tauern, Schladming, Styria, Austria |
|
|
|
|
|
|
|
| 'Unnamed (Orthorhombic dimorph of Barstowite)' |  |
|---|
| Formula: | Pb4CO3Cl6 · H2O |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Unnamed (Orthorhombic dimorph of Barstowite) from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| 'Unnamed (Pb-Al Hydroxide-Chloride)' | |
|---|
| Formula: | Pb15.5(Al,Fe)(OH)17Cl17 |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
| 'Unnamed (Pb-Bi Telluride Sulphide II)' | |
|---|
| Formula: | Pb3Bi4Te4S5 |
| Locality: | Langenleiten, Großfragant, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria |
|
|
|
|
|
|
|
| 'Unnamed (Pb-Bi Telluride Sulphide III)' | |
|---|
| Formula: | Pb5Bi4Te4S7 |
| Locality: | Langenleiten, Großfragant, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria |
|
|
|
|
|
|
|
| 'Unnamed (Pb-Bi Telluride Sulphide IV)' | |
|---|
| Formula: | Pb6Bi4Te4S8 |
| Locality: | Langenleiten, Großfragant, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria |
|
|
|
|
|
|
|
| 'Unnamed (Pb-Fe Chloride Hydroxide Hydrate)' |  |
|---|
| Formula: | Pb2Fe3+Cl3(OH)4·H2O |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Unnamed (Pb-Fe Chloride Hydroxide Hydrate) from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| 'Unnamed (Pb-Fe-Cl-S(?)-O-H Phase)' |  |
|---|
| Formula: | Pb-Fe-Cl-S(?)-O-H |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Unnamed (Pb-Fe-Cl-S(?)-O-H Phase) from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| 'Unnamed (Pb Hydroxide Nitrate Chloride)' | |
|---|
| Formula: | Pb8O3(OH)5(NO3)4Cl |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
| 'Unnamed (Tetragonal Dimorph of Nadorite)' |  |
|---|
| Formula: | PbSbO2Cl |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Uwe Kolitsch and Franz Brandstätter. Unnamed (Tetragonal Dimorph of Nadorite) from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| 'Unnamed (Tetragonal Pb Oxide Hydrate)' |  |
|---|
| Formula: | Pb3O2(OH)2 |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Unnamed (Tetragonal Pb Oxide Hydrate) from Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| 'Unnamed (Uric Acid Dihydrate)' | |
|---|
| Formula: | C5H4N4O3 · 2H2O |
| Localities: | Power station, Sportgastein, Naßfeld valley, Gastein valley, Hohe Tauern, Salzburg, Austria Hüttwinklache, Kolm-Saigurn, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
| 'Unnamed (Zn-analogue of Humboldtine)' | |
|---|
| Formula: | Zn(C2O4) · 2H2O |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
| Uralolite |  |
|---|
| Formula: | Ca2Be4(PO4)3(OH)3 · 5H2O |
| Locality: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © 0. Uralolite from Spodumene prospect, Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
| Uraninite |  |
|---|
| Formula: | UO2 |
| Localities: | Reported from at least 24 localities in this region. |
|
|
|
|
|
|
| Photo: © . Uraninite from Anna adit, Mitterberg District, St Johann im Pongau, Salzburg, Austria |
| Uraninite var: Pitchblende | |
|---|
| Formula: | UO2 |
| Localities: | Reported from at least 20 localities in this region. |
|
|
|
|
|
|
|
| 'Uranium Mica' | |
|---|
| Locality: | Schwagbauer (Schwoagbauer), Osterwitz, Deutschlandsberg, Koralpe, Styria, Austria |
|
|
|
|
|
|
|
|
| Uranocircite |  |
|---|
| Formula: | Ba(UO2)2(PO4)2 · 10H2O |
| Localities: | Uranium occurrence, Prinzkogel (Prinzenkogel), Rettenegg, Fischbacher Alpen, Styria, Austria Eichberg, Unterlembach, Großdietmanns, Waldviertel, Lower Austria, Austria
|
|
|
|
|
|
|
| Photo: © hamster@aon.at. Uranocircite from Eichberg, Unterlembach, Großdietmanns, Waldviertel, Lower Austria, Austria |
| 'Uranocker' | |
|---|
| Locality: | Talc mine, Rabenwald, Anger, Weiz, Styria, Austria |
|
|
|
|
|
|
|
|
| Uranophane |  |
|---|
| Formula: | Ca(UO2)2[HSiO4]2 · 5H2O |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
| Photo: © AL. Uranophane from Kaiserer quarry, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
| Uranopilite | |
|---|
| Formula: | (UO2)6(SO4)O2(OH)6 · 14H2O |
| Locality: | Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
| Uranospinite | |
|---|
| Formula: | Ca(UO2)(AsO4)2 · 10H2O |
| Localities: | Anna adit, Mitterberg District, St Johann im Pongau, Salzburg, Austria Mitterberg District, St Johann im Pongau, Salzburg, Austria
|
|
|
|
|
|
|
|
| 'Uranpyrochlore (of Hogarth 1977)' | |
|---|
| Formula: | (U,Ca,Ce)2(Nb,Ta)2O6(OH,F) |
| Locality: | Mellach - Unteraich area, Straßburg, Gurk valley, Gurktaler Alpen, Carinthia, Austria |
|
|
|
|
|
|
|
| Uricite | |
|---|
| Formula: | C5H4N4O3 |
| Localities: | Loja, Persenbeug-Gottsdorf, Waldviertel, Lower Austria, Austria Basalt quarry, Pauliberg, Kobersdorf, Oberpullendorf, Burgenland, Austria
|
|
|
|
|
|
|
|
| Uvarovite | |
|---|
| Formula: | Ca3Cr2(SiO4)3 |
| Localities: | Umbal falls, Islitz Alp, Umbal valley, Virgen valley, East Tyrol, Tyrol, Austria Gulsen, Kraubath, Leoben, Styria, Austria
|
|
|
|
|
|
|
|
| 'Uvite' | |
|---|
| Formula: | Ca(Mg3)MgAl5(Si6O18)(BO3)3(OH)3(F/OH) |
| Localities: | Reported from at least 11 localities in this region. |
|
|
|
|
|
|
|
| Vaesite | |
|---|
| Formula: | NiS2 |
| Localities: | Gertraud adit, Großkogel (Reither Kogel), St Gertraudi, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria A10 Highway tunnel (Tauern tunnel), Radstädter Tauern, Salzburg, Austria ? (more information)
|
|
|
|
|
|
|
|
| Valentinite |  |
|---|
| Formula: | Sb2O3 |
| Localities: | Reported from at least 24 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Valentinite from Main section, Hüttenberger Erzberg, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
| Valleriite | |
|---|
| Formula: | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Localities: | Reported from at least 10 localities in this region. |
|
|
|
|
|
|
|
| Vanadinite |  |
|---|
| Formula: | Pb5(VO4)3Cl |
| Localities: | Reported from at least 21 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Vanadinite from Upper Schäffler Alp, Schäffler Alp District, Zauchen, Hochobir, Karawanken, Carinthia, Austria |
| Vandendriesscheite | |
|---|
| Formula: | PbU7O22 · 12H2O |
| Locality: | Micaschist outcrops, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Vanthoffite | |
|---|
| Formula: | Na6Mg(SO4)4 |
| Localities: | Salt mine, Hall, Innsbruck, Inn valley, North Tyrol, Tyrol, Austria Rock salt deposit, Dürrnberg, Hallein, Salzburg, Austria Ischler Salzberg, Perneck, Bad Ischl, Gmunden, Upper Austria, Austria
|
|
|
|
|
|
|
|
| Variscite | |
|---|
| Formula: | AlPO4 · 2H2O |
| Localities: | Trandorf, Mühldorf, Waldviertel, Lower Austria, Austria Brandberg, Leoben, Styria, Austria Mixnitz, Frohnleiten, Styria, Austria
|
|
|
|
|
|
|
|
| 'Varlamoffite' ? | |
|---|
| Formula: | (Sn,Fe)(O,OH)2 |
| Locality: | Luftenberg, St Georgen an der Gusen, Perg, Mühlviertel, Upper Austria, Austria - erroneously reported |
|
|
|
|
|
|
|
| Vashegyite | |
|---|
| Formula: | Al11(PO4)9(OH)6 · 38H2O |
| Localities: | Magnetite deposit, Sonntagsberg, St Veit an der Glan, Gurktaler Alpen, Carinthia, Austria Breitenau Mine (Breitenau magnesite mine), Hochlantsch, St. Jakob-Breitenau, Fischbacher Alpen, Styria, Austria Reih Alp, Glashütten, Deutschlandsberg, Koralpe, Styria, Austria Forestry road cut, Übelbach, Peggau, Styria, Austria
|
|
|
|
|
|
|
|
Vaterite | |
|---|
| Formula: | CaCO3 |
| Locality: | Hopffeldboden, Hopffeld area, Obersulzbach valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Vauquelinite | |
|---|
| Formula: | Pb2Cu(CrO4)(PO4)(OH) |
| Locality: | Fe deposit, Grassendorf, Tauchendorf, St Veit an der Glan, Gurktaler Alpen, Carinthia, Austria |
|
|
|
|
|
|
|
| Vermiculite | |
|---|
| Formula: | (Mg,Fe,Al)3((Al,Si)4O10)(OH)2 · 4H2O |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
|
| Vertumnite | |
|---|
| Formula: | Ca4Al4Si4O6(OH)24 · 3H2O |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
| Vesuvianite |  |
|---|
| Formula: | (Ca,Na,☐)19(Al,Mg,Fe3+)13(☐,B,Al,Fe3+)5(Si2O7)4(SiO4)10(OH,F,O)10 |
| Localities: | Reported from at least 29 localities in this region. |
|
|
|
|
|
|
| Photo: © Gerd Stefanik. Vesuvianite from Ochsner-Rotkopf massif, Zemmgrund, Zillertal, North Tyrol, Tyrol, Austria |
| Vikingite |  |
|---|
| Formula: | Ag5Pb8Bi13S30 |
| Localities: | Erzwies area, Gastein valley, Hohe Tauern, Salzburg, Austria Siglitz adit (Imhof-Unterbau adit; Imhof adit), Siglitz - Bockhart Gold Mining District, Siglitz - Bockhart area, Gastein valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
| Photo: © Fritz Schreiber. Vikingite from Siglitz adit, Siglitz - Bockhart Gold Mining District, Siglitz - Bockhart area, Gastein valley, Hohe Tauern, Salzburg, Austria |
| Violarite | |
|---|
| Formula: | Fe2+Ni3+2S4 |
| Localities: | Serpentinite quarry, Griesserhof (Gulitzen; Gullitzen), Hirt, Friesach - Hüttenberg area, Carinthia, Austria Totenkopf (incl. Lower Riffl glacier), Stubach valley, Hohe Tauern, Salzburg, Austria Gumpachkreuz, Dorferbach valley, Prägraten, Virgen valley, East Tyrol, Tyrol, Austria Breitenau Mine (Breitenau magnesite mine), Hochlantsch, St. Jakob-Breitenau, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
|
| Vivianite |  |
|---|
| Formula: | Fe2+3(PO4)2 · 8H2O |
| Localities: | Reported from at least 42 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Vivianite from Muttlkogel, Zangtal District, Köflach - Voitsberg lignite deposit, Köflach, Styria, Austria |
| Volborthite | |
|---|
| Formula: | Cu3(V2O7)(OH)2 · 2H2O |
| Localities: | Slag localities, Kolm-Saigurn, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria Diabase quarry (Jakomini quarry), Nötsch im Gailtal, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria
|
|
|
|
|
|
|
|
| Voltaite | |
|---|
| Formula: | K2Fe2+5Fe3+3Al(SO4)12 · 18H2O |
| Localities: | Zangtal District, Köflach - Voitsberg lignite deposit, Köflach, Styria, Austria Spitzmühle quarry, Leutschach, Styria, Austria
|
|
|
|
|
|
|
|
| Vonsenite |  |
|---|
| Formula: | Fe2+2Fe3+(BO3)O2 |
| Locality: | Lechnerberg (slag locality), Kaprun, Kaprun valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
| Photo: © Harald Schillhammer. Vonsenite from Lechnerberg, Kaprun, Kaprun valley, Hohe Tauern, Salzburg, Austria |
| 'Wad' |  |
|---|
| Localities: | Reported from at least 55 localities in this region. |
|
|
|
|
|
|
|
| Photo: © AC. Wad from Thomas adit, Gaisberg, Olsa, Friesach, Friesach - Hüttenberg area, Carinthia, Austria |
| 'Wad var: Cobaltian Wad' | |
|---|
| Localities: | Maukenötz District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Stocker adit, Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Fuchsloch, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Diepolz, Wartmannstetten, Industrieviertel, Lower Austria, Austria ? (more information) Ramplach, Wartmannstetten, Industrieviertel, Lower Austria, Austria ? (more information)
|
|
|
|
|
|
|
|
|
| Wagnerite (TL) |  |
|---|
| Formula: | (Mg,Fe2+)2(PO4)F |
| Type Locality: | Höllgraben, Pfarrwerfen, Werfen, Salzburg, Austria |
| Habit: | Tabular-prismatic crystals to several cms |
| Colour: | Brownish white |
| Description: | Occurs in quartz veins cutting clay schists. |
| Reference: | Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 847; Canadian Mineralogist (1992): 30: 1161. |
| Localities: | Recorded from at least 8 other localities in this region. |
|
| Photo: © Peter Haas. Wagnerite from Höllgraben, Pfarrwerfen, Werfen, Salzburg, Austria |
| Wardite |  |
|---|
| Formula: | NaAl3(PO4)2(OH)4 · 2H2O |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © . Wardite from Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria |
| Watkinsonite | |
|---|
| Formula: | Cu2PbBi4(Se,S,Te)8 |
| Locality: | Selenide occurrence, Eselberg, Altenberg an der Rax, Neuberg an der Mürz, Styria, Austria |
|
|
|
|
|
|
|
| Weeksite | |
|---|
| Formula: | K2(UO2)2(Si2O5)3 · 4H2O |
| Locality: | Feldspar quarry, Laas, Fresach, Millstatt lake ridge, Carinthia, Austria |
|
|
|
|
|
|
|
| Weinebeneite (TL) |  |
|---|
| Formula: | CaBe3(PO4)2(OH)2 · 4H2O |
| Type Locality: | Spodumene prospect (Brandrücken exploration adit), Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
| Reference: | F. Walter (1992) Eur. Journ. Mineral. 4, 1275-1283 |
|
|
|
|
|
| Photo: © Thomas Witzke. Weinebeneite from Spodumene prospect, Brandrücken, Moschkogel - Weinebene area, Koralpe, Carinthia, Austria |
| 'Wellsite' |  |
|---|
| Formula: | (Ba,Ca,K2)Al2Si6O16 · 6H2O |
| Localities: | Basalt quarry, Kollnitz, St Paul im Lavanttal, Carinthia, Austria Loja, Persenbeug-Gottsdorf, Waldviertel, Lower Austria, Austria Tobaj, Güssing, Burgenland, Austria
|
|
|
|
|
|
|
| Photo: © AC. Wellsite from Loja, Persenbeug-Gottsdorf, Waldviertel, Lower Austria, Austria |
| Wherryite | |
|---|
| Formula: | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| Locality: | Slag localities, Kolm-Saigurn, Alteck - Hoher Sonnblick area, Hüttwinkl valley, Rauris valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| Whewellite | |
|---|
| Formula: | Ca(C2O4) · H2O |
| Locality: | Graukogel, Habach valley, Hohe Tauern, Salzburg, Austria |
|
|
|
|
|
|
|
| 'Whiteite' | |
|---|
| Locality: | Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria |
|
|
|
|
|
|
|
|
| Whiteite-(CaFeMg) |  |
|---|
| Formula: | {Ca}{(Fe2+,Mn2+)}{Mg2}{Al2}(PO4)4(OH)2 · 8H2O |
| Locality: | Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
|
|
|
|
|
|
| Photo: © AC. Whiteite-(CaFeMg) from Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
| Whiteite-(CaMnMg) | |
|---|
| Formula: | {Ca}{Mn2+}{Mg2}{Al2}(PO4)4(OH)2 · 8H2O |
| Locality: | Hahnenkofel, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
|
|
|
|
|
|
|
| Whitlockite |  |
|---|
| Formula: | Ca9Mg(PO4)6(HPO4) |
| Localities: | Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Whitlockite from Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
| Willemite | |
|---|
| Formula: | Zn2SiO4 |
| Localities: | Seealpe District, Hochobir, Karawanken, Carinthia, Austria Montanwerke Brixlegg (slag locality), Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Möchling Alp District, Hochobir, Karawanken, Carinthia, Austria
|
|
|
|
|
|
|
|
| Willhendersonite | |
|---|
| Formula: | KCa[Al3Si3O12] · 5H2O |
| Locality: | Stradner Kogel, Wilhelmsdorf, Bad Gleichenberg, Styria, Austria |
|
|
|
|
|
|
|
| Witherite |  |
|---|
| Formula: | BaCO3 |
| Localities: | Reported from at least 14 localities in this region. |
|
|
|
|
|
|
| Photo: © 0. Witherite from Steinbauer Mine, Neuberg an der Mürz, Styria, Austria |
| Wittichenite | |
|---|
| Formula: | Cu3BiS3 |
| Localities: | Gold Mines, Kliening, Bad St Leonhard, Saualpe, Carinthia, Austria Ausschlag-Zöbern, Aspang-Markt, Bucklige Welt, Industrieviertel, Lower Austria, Austria Glücksgrat, Habicht, Unterberg valley, Stubai valley, Sill valley (Wipp valley), North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| 'Wolframite' | |
|---|
| Formula: | (Fe2+)WO4 to (Mn2+)WO4 |
| Localities: | Magnesite mine, Tux (Lanersbach; Lannersbach), Tux valley, Zillertal, North Tyrol, Tyrol, Austria Western ore field, Scheelite deposit, Felben valley, Hohe Tauern, Salzburg, Austria Stüblbau Mine, Gold mines, Schellgaden, Murwinkel, Lungau, Salzburg, Austria
|
|
|
|
|
|
|
|
| Wollastonite |  |
|---|
| Formula: | CaSiO3 |
| Localities: | Reported from at least 10 localities in this region. |
|
|
|
|
|
|
| Photo: Wollastonite from Stubenberg Quarry, Stubenberg am See, Weiz, Styria, Austria |
| Woodhouseite | |
|---|
| Formula: | CaAl3(PO4)(SO4)(OH)6 |
| Localities: | Kyanite-Quartzite outcrops, Leutachkopf - Stocker Alp area, Untersulzbach valley, Hohe Tauern, Salzburg, Austria Kleiner Finagl west slope, Untersulzbach valley, Hohe Tauern, Salzburg, Austria
|
|
|
|
|
|
|
|
| Woodruffite | |
|---|
| Formula: | Zn(Mn4+,Mn3+)5O10·3½H2O |
| Localities: | Franz Josef Mine, Heiligengeist, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria Putzkammer Alp, Rinder valley (Gafluna valley), Verwall group, Montafon, Vorarlberg, Austria
|
|
|
|
|
|
|
|
| Woodwardite | |
|---|
| Formula: | Cu1-xAlx(OH)2[SO4]x/2 · nH2O |
| Localities: | Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria Viehhofen, Kitzbühel Alps, Salzburg, Austria Gratlspitz, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria
|
|
|
|
|
|
|
|
| Wroewolfeite |  |
|---|
| Formula: | Cu4(SO4)(OH)6 · 2H2O |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
| Photo: © Harald Schillhammer. Wroewolfeite from Lechnerberg, Kaprun, Kaprun valley, Hohe Tauern, Salzburg, Austria |
| Wulfenite (TL) |  |
|---|
| Formula: | Pb(MoO4) |
| Type Locality: | Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Habit: | tabular with (001) and (110) as the predominant faces very common, also prismatic and bipyramidal, to several cm |
| Colour: | colourless, pale yellow, lemon-yellow, honey-yellow, orange, red, yellowish green, grey, black |
| Description: | Occurrences of wulfenite were first noted at both Bleiberg and the Nepomuk mine near Annaberg, Lower Austria (Born, 1772). The characterization of the mineral however (crystallography: Wulfen, 1785, chemistry: Klaproth, 1792) was carried out on material from Bleiberg. |
| Reference: | Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 1084; G. Niedermayr, I. Praetzel: Mineralien Kärntens, 1995. |
| Localities: | Recorded from at least 109 other localities in this region. |
|
| Photo: Wulfenite from Stefanie Mine, Bad Bleiberg, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
| Wulfenite var: Calcian Wulfenite | |
|---|
| Locality: | Max Mine, Kreuth, Bleiberg District, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria |
|
|
|
|
|
|
|
|
| Wurtzite | |
|---|
| Formula: | (Zn,Fe)S |
| Localities: | Reported from at least 16 localities in this region. |
|
|
|
|
|
|
|
| Wüstite | |
|---|
| Formula: | FeO |
| Locality: | Slag localities, Waitschach, Hüttenberg, Friesach - Hüttenberg area, Carinthia, Austria |
|
|
|
|
|
|
|
| Xenotime-(Y) |  |
|---|
| Formula: | Y(PO4) |
| Localities: | Reported from at least 54 localities in this region. |
|
|
|
|
|
|
| Photo: © Chinellato Matteo. Xenotime-(Y) from Hopffeldboden, Hopffeld area, Obersulzbach valley, Hohe Tauern, Salzburg, Austria |
| Xilingolite |  |
|---|
| Formula: | Pb3Bi2S6 |
| Localities: | Abichl Alp, Abichl Alp - Beryller area, Untersulzbach valley, Hohe Tauern, Salzburg, Austria Sandfeldkopf, Wurten, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © Andreas Dau. Xilingolite from Abichl Alp, Abichl Alp - Beryller area, Untersulzbach valley, Hohe Tauern, Salzburg, Austria |
| Yarrowite | |
|---|
| Formula: | Cu9S8 |
| Localities: | Schlossberg, Krems, Voitsberg, Köflach, Styria, Austria Castle Hill, Graz, Styria, Austria
|
|
|
|
|
|
|
|
| Yecoraite |  |
|---|
| Formula: | Fe3+3Bi5(Te6+O4)2(Te4+O3)O9 · 9H2O |
| Localities: | Duisburger Hütte, Wurten, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria Wurten glacier, Wurten, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © AC. Yecoraite from Wurten glacier, Wurten, Innerfragant, Goldberg group, Hohe Tauern, Carinthia, Austria |
| Ye'elimite | |
|---|
| Formula: | Ca4Al6(SO4)O12 |
| Locality: | Basalt quarry, Klöch, Bad Radkersburg, Styria, Austria |
|
|
|
|
|
|
|
| Yukonite | |
|---|
| Formula: | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| Locality: | Stocker adit, Silberberg, Geyer - Silberberg District, Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| Zálesíite |  |
|---|
| Formula: | (Ca,Y)Cu6(AsO4)2(HAsO4,AsO4)(OH)6 · 3H2O |
| Localities: | Railway tunnel, Unterwald, Wald am Schoberpass, Liesing - Palten valley, Styria, Austria Altenberg, Pöllan, Paternion, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria Quartzite quarry (Tanzer quarry), Falkenstein, Fischbach, Fischbacher Alpen, Styria, Austria
|
|
|
|
|
|
|
| Photo: © 0. Zálesíite from Copper mine, Kohlberg, Pottschach, Ternitz, Industrieviertel, Lower Austria, Austria |
| Zanazziite |  |
|---|
| Formula: | Ca2Mg5Be4(PO4)6(OH)4 · 6H2O |
| Localities: | Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria Feldspar quarry, Wolfsberg, Spittal, Millstatt lake ridge, Carinthia, Austria
|
|
|
|
|
|
|
| Photo: © mslama. Zanazziite from Laggerhof, Millstatt lake, Spittal, Millstatt lake ridge, Carinthia, Austria |
| Zapatalite | |
|---|
| Formula: | Cu3Al4(PO4)3(OH)9 · 4H2O |
| Locality: | Brixlegg - Rattenberg, Brixlegg - Schwaz area, Inn valley, North Tyrol, Tyrol, Austria |
|
|
|
|
|
|
|
| 'Zaratite' | |
|---|
| Formula: | Ni3(CO3)(OH)4 · 4H2O |
| Localities: | Serpentinite quarry, Griesserhof (Gulitzen; Gullitzen), Hirt, Friesach - Hüttenberg area, Carinthia, Austria Gulsen, Kraubath, Leoben, Styria, Austria Stubach valley, Hohe Tauern, Salzburg, Austria Preg, Kraubath, Leoben, Styria, Austria ? (more information)
|
|
|
|
|
|
|
|
| 'Zeiringite' |  |
|---|
| Localities: | Oberzeiring, Pöls valley, Niedere Tauern, Styria, Austria Egger Alp, Möderndorf, Hermagor, Gailtaler Alpen & Karnische Alpen, Carinthia, Austria
|
|
|
|
|
|
|
|
| Photo: © Peter Kohorst. Zeiringite from Oberzeiring, Pöls valley, Niedere Tauern, Styria, Austria |
| Zeophyllite | |
|---|
| Formula: | Ca4Si3O8(OH,F)4 · 2H2O |
| Locality: | Steinberg, Mühldorf, Feldbach, Styria, Austria |
|
|
|
|
|
|
|
| Zeunerite | |
|---|
| Formula: | Cu(UO2)2(AsO4)2 · 12H2O |
| Localities: | Anna adit, Mitterberg District, St Johann im Pongau, Salzburg, Austria Mitterberg District, St Johann im Pongau, Salzburg, Austria |