Okanogan County, Washington, USAi
| Regional Level Types | |
|---|---|
| Okanogan County | County |
| Washington | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Mindat Locality ID:
17538
Long-form identifier:
mindat:1:2:17538:9
GUID (UUID V4):
4017688c-870c-46ef-9afb-e9bb1dd87607
Other Languages:
French:
comté d'Okanogan, Washington, États-Unis
German:
Okanogan County, Washington, Vereinigte Staaten
Italian:
contea di Okanogan, Washington, Stati Uniti d'America
Russian:
Оканоган, Вашингтон, Соединённые Штаты Америки
Simplified Chinese:
奧卡諾根縣, 华盛顿州, 美国
Spanish:
Condado de Okanogan, Washington, Estados Unidos
Albanian:
Okanogan County, Uashington, Shtetet e Bashkuara të Amerikës
Arabic:
مقاطعة أوكانوغان, واشنطن, الولايات المتحدة
Basque:
Okanogan konderria , Washington
Bavarian:
Okanogan County, Washington, Vaoanigte Stootn
Bishnupriya Manipuri:
ওকানোগান কাউন্টি, ৱাশিংটন, তিলপারাষ্ট্র
Bulgarian:
Оканоган, Вашингтон, Съединени американски щати
Cebuano:
Okanogan County, Washington
Czech:
Okanogan County, Washington, Spojené státy americké
Dutch:
Okanogan County, Washington, Verenigde Staten
Esperanto:
Kantono Okanogan, Vaŝingtonio
Estonian:
Okanogani maakond, Washingtoni osariik, Ameerika Ühendriigid
Farsi/Persian:
شهرستان اوکانوگان، واشینگتن, واشینگتن, ایالات متحده آمریکا
Georgian:
ოკანოგანის ოლქი, ვაშინგტონის შტატი, ამერიკის შეერთებული შტატები
Hebrew:
מחוז אוקאנוגאן, וושינגטון, ארצות הברית
Hungarian:
Okanogan megye, Washington, Amerikai Egyesült Államok
Japanese:
オウカノガン郡, ワシントン州, アメリカ合衆国
Low Saxon/Low German:
Okanogan County, Washington, USA
Min Dong Chinese:
Okanogan Gông, Washington
Minnan / Hokkien-Taiwanese:
Okanogan Kūn
Norwegian:
Okanogan County, Washington, USA
Polish:
Hrabstwo Okanogan, Waszyngton, Stany Zjednoczone
Portuguese:
Condado de Okanogan, Washington, Estados Unidos
Romanian:
Comitatul Okanogan, Washington, Statele Unite ale Americii
Sardinian:
contea de Okanogan, Washington, Istados Unidos de Amèrica
Serbian:
Okanogan County, Вашингтон, Сједињене Америчке Државе
Serbo-Croatian:
Okanogan County, Washington, Sjedinjene Američke Države
Swedish:
Okanogan County, Washington, USA
Traditional Chinese:
奧卡諾根縣, 華盛頓州, 美國
Turkish:
Okanogan, Washington, Amerika Birleşik Devletleri
Ukrainian:
Оканоґан, Вашингтон, Сполучені Штати Америки
Urdu:
اوکاناگن کاؤنٹی، واشنگٹن, ریاست واشنگٹن, ریاستہائے متحدہ امریکا
Vietnamese:
Quận Okanogan, Washington, Chủng Quốc Hoa Kỳ
Waray:
Condado han Okanogan, Washington, Estados Unidos
Western Punjabi:
اوکانوگن کاؤنٹی, واشنگٹن, امریکہ
Note: The mining districts of this county are poorly defined, but are mainly based off of Landes (1902) and Lasmanis (1990)
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities174 valid minerals. 4 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Localities: Reported from at least 19 localities in this region. Description: small crystals in quartz vugs References: |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Aegirine Formula: NaFe3+Si2O6 Localities: Habit: needles and bluntly terminated prisms Colour: green to black |
| ⓘ Aenigmatite Formula: Na4[Fe2+10Ti2]O4[Si12O36] Habit: tiny grains Description: Occurs in the satellite dikes derived from the Golden Horn Granite
|
| ⓘ Agardite-(Y) Formula: YCu6(AsO4)3(OH)6 · 3H2O Habit: asicular crystals Colour: greenish blue Description: only a few specimens have been found. They are from a small pegmatite and formed from secondary sulfide alteration. |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Washington Pass, Golden Horn Batholith, Okanogan County, Washington, USA Topaz Mountain, Chewuch Mining District, Okanogan County, Washington, USA Windy Peak, Chewuch Mining District, Okanogan County, Washington, USA Buckhorn Mine, Southwest Zone and Gold Bowl (Crown Jewel) Zone, Buckhorn Mountain, Myer Creek Mining District, Okanogan County, Washington, USA Kelsey Prospect, Oroville Mining District, Okanogan County, Washington, USA Habit: tabular euhedral twinned crystals to 1" in diameter Colour: pinkish, white |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) Habit: square tabular crystals Colour: black |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: Colour: red |
| ⓘ Anatase Formula: TiO2 Colour: dark grey to black Description: Found in one area
|
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Localities: Dutch John Prospect, Methow Mining District, Okanogan County, Washington, USA Buckhorn Mine, Southwest Zone and Gold Bowl (Crown Jewel) Zone, Buckhorn Mountain, Myer Creek Mining District, Okanogan County, Washington, USA Ellenham Mtn area, Nighthawk Mining District, Okanogan County, Washington, USA Kruger Mountain, Oroville Mining District, Okanogan County, Washington, USA Habit: dodecahedral crystals to 7/8" in diameter Colour: Red Brown to Olive Green |
| ⓘ Andradite var. Melanite Formula: Ca3(Fe3+,Ti)2(SiO4)3 Localities: Habit: crystals to 4mm Colour: black |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O Localities: Habit: crusts Colour: bright green References: |
| ⓘ Annite Formula: KFe2+3(AlSi3O10)(OH)2 |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 Localities: |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: |
| ⓘ Arfvedsonite Formula: [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 Localities: Habit: large prisms to 6cm; rock forming masses Colour: Black |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 26 localities in this region. |
| ⓘ Astrophyllite Formula: K2NaFe2+7Ti2Si8O26(OH)4F Habit: hairlike groups, broad single blades, and radial groups to 1.5" long Colour: Bronze |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Localities: |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Reported from at least 17 localities in this region. Habit: crusts Colour: bright blue References: |
| ⓘ Baryte Formula: BaSO4 Localities: References: |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F |
| ✪ Bastnäsite-(Ce) Formula: Ce(CO3)F Habit: hexagonal tablets and prisms Colour: pink, red, reddish-orange Description: crystals are uncommon and often are Bastnäsite-(Ce)/Synchysite intergrowths |
| ⓘ 'Bastnäsite Group' Formula: M(CO3)X where M = REE, Th and X = F or OH |
| ⓘ Beryl ? Formula: Be3Al2(Si6O18) Colour: Varity aquamarine Description: 2 crystals reported to have been found |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Biotite var. Oxybiotite' |
| ⓘ Bismuth Formula: Bi |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 20 localities in this region. References: |
| ⓘ Boulangerite Formula: Pb5Sb4S11 |
| ⓘ Brannockite Formula: K◻2Sn2Li3[Si12O30] Description: Zr-, Ti-, Hf-, Fe+Al- and Na- substitution. |
| ⓘ Bromargyrite Formula: AgBr Localities: References: |
| ⓘ Burkeite Formula: Na6(CO3)(SO4)2 References: |
| ⓘ Calaverite Formula: AuTe2 |
| ⓘ Calciocatapleiite Formula: CaZr(Si3O9) · 2H2O Habit: thin Disc like crystals to 2mm across Colour: milky white |
| ⓘ Calciohilairite (TL) Formula: CaZr[SiO3]3 · 3H2O Localities: Habit: blocky teragonal prisms Colour: bluish to chalky white |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 45 localities in this region. Habit: scalenohedral crystals, hexagonal prisms Colour: colorless to white |
| ⓘ Cerussite Formula: PbCO3 Localities: |
| ⓘ Chabazite-Ca Formula: (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O Habit: large crusts Colour: pale blue |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 10 localities in this region. |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 149 localities in this region. Habit: small sharp crystals |
| ⓘ Chamosite Formula: (Fe2+)5Al(Si,Al)4O10(OH,O)8 Habit: druses and hexagonal prisms Colour: green to golden Brown |
| ⓘ Chevkinite-(Ce) Formula: Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 Habit: rounded to flattened prisms Colour: black Description: this list encompasses several different environments of the Golden Horn Batholith at Washington Pass |
| ⓘ 'Chevkinite Group' |
| ⓘ Chlorargyrite Formula: AgCl Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Chlorite Group' Localities: Copper World Extension Mine, Palmer Mountain Mining District, Okanogan County, Washington, USA Kelsey Prospect, Oroville Mining District, Okanogan County, Washington, USA Monterey Prospect, Buckhorn Mountain, Myer Creek Mining District, Okanogan County, Washington, USA Washington Pass, Golden Horn Batholith, Okanogan County, Washington, USA Mazama Porphyry, Mazama Mining District, Okanogan County, Washington, USA |
| ⓘ Chondrodite Formula: Mg5(SiO4)2F2 Habit: anhedral grains |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 Localities: Reported from at least 9 localities in this region. |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: Washington Pass, Golden Horn Batholith, Okanogan County, Washington, USA Kelsey Prospect, Oroville Mining District, Okanogan County, Washington, USA Jones Prospect, Chewuch Mining District, Okanogan County, Washington, USA Ohio Prospect, Oroville Mining District, Okanogan County, Washington, USA Mazama Porphyry, Mazama Mining District, Okanogan County, Washington, USA Description: this list encompasses several different environments of the Golden Horn Batholith at Washington Pass References: |
| ⓘ Cinnabar Formula: HgS |
| ⓘ Clinochlore ? Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Chromium-bearing Clinochlore ? Formula: Mg5(Al,Cr)2Si3O10(OH)8 |
| ⓘ Clinofergusonite-(Y) Formula: YNbO4 Habit: blocky to prismatic crystals Colour: tan to brown Description: Found in the border granite of Liberty Bell |
| ⓘ 'Clinoptilolite Subgroup' Formula: M3-6(Si30Al6)O72 · 20H2O |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Copper Formula: Cu Localities: |
| ⓘ Coquandite (TL) Formula: Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) Type Locality: |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) Habit: knots of anhedral cordierite Description: in schist |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Corundum var. Ruby Formula: Al2O3 |
| ⓘ Corundum var. Sapphire Formula: Al2O3 |
| ⓘ Covellite Formula: CuS |
| ⓘ Cuprite Formula: Cu2O Localities: |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: Reported from at least 7 localities in this region. |
| ⓘ Dolomite Formula: CaMg(CO3)2 Habit: granular masses Colour: white to pink |
| ⓘ Elpidite Formula: Na2ZrSi6O15 · 3H2O |
| ⓘ Elpidite var. Calcium-bearing Elpidite Formula: (Na,Ca)2ZrSi6O15 · 3H2O |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 28 localities in this region. Description: this list encompasses several different environments of the Golden Horn Batholith at Washington Pass References: |
| ⓘ Epsomite Formula: MgSO4 · 7H2O Localities: Kruger Mountain, Oroville Mining District, Okanogan County, Washington, USA Poison Lake, Okanogan County, Washington, USA Bitter Lake, Oroville Mining District, Okanogan County, Washington, USA Okanogan County, Washington, USA Wannacut Lake, Wannacut Lake Mining District, Okanogan County, Washington, USA |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O Localities: Habit: crusts Colour: pink References: |
| ⓘ Euxenite-(Y) Formula: (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 Localities: Habit: crude prisms to 2mm Colour: Brownish yellow Description: These crystals contain fluorine and are not metamict. |
| ⓘ Fayalite Formula: Fe2+2SiO4 |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ 'Feldspar Group' |
| ⓘ 'Fergusonite' |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O |
| ⓘ Ferro-hornblende Formula: ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ Ferro-richterite Formula: {Na}{CaNa}{Fe2+5}(Si8O22)(OH)2 |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 14 localities in this region. Habit: massive; granular; octahedral crystals to 1mm Colour: purple, yellowish purple, Pink Description: purple octehedra to 1mm, crudely crystalized pink specimens are found in the biotite granite |
| ⓘ ' Formula: (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F Locality: Washington Pass, Golden Horn Batholith, Okanogan County, Washington, USA - erroneously reported |
| ⓘ 'Gadolinite' Localities: References: |
| ⓘ Gadolinite-(Ce) Formula: (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| ⓘ Gadolinite-(Y) Formula: Y2Fe2+Be2Si2O10 Habit: squarish and diamond shaped prisms Colour: clear to white |
| ⓘ 'Gagarinite' |
| ⓘ Gagarinite-(Y) Formula: NaCaYF6 Habit: elongated Prisms Colour: colorless, white to pale pink |
| ⓘ Galena Formula: PbS Localities: Reported from at least 93 localities in this region. References: |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag Localities: |
| ⓘ Galenobismutite Formula: PbBi2S4 |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 17 localities in this region. |
| ⓘ 'Garnierite' |
| ⓘ Gaylussite Formula: Na2Ca(CO3)2 · 5H2O References: |
| ⓘ Genthelvite Formula: Be3Zn4(SiO4)3S |
| ⓘ Glaucodot Formula: (Co0.50Fe0.50)AsS |
| ⓘ Goethite Formula: α-Fe3+O(OH) Localities: Habit: pseudomorphs Colour: brown to black Description: Commonly found as pseudomorphs after arfedsonite and siderite. One Cavity that produced pseudomorphs after Zektzerite has been found. |
| ⓘ Gold Formula: Au Localities: Reported from at least 61 localities in this region. |
| ⓘ Graphite Formula: C Localities: |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: |
| ⓘ Gypsum var. Selenite Formula: CaSO4 · 2H2O |
| ⓘ Halite Formula: NaCl References: |
| ⓘ Hastingsite Formula: NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 Localities: Ellenham Mtn area, Nighthawk Mining District, Okanogan County, Washington, USA Kruger Mountain, Oroville Mining District, Okanogan County, Washington, USA Salmon Creek Area, Conconully Mining District, Okanogan County, Washington, USA Washington Pass, Golden Horn Batholith, Okanogan County, Washington, USA |
| ⓘ Hastingsite var. Alkali-ferrohastingsite Formula: {Na}{Ca2}{Fe2+4Fe3+}(Al2Si6O22)(OH)2 |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 |
| ⓘ Hedleyite Formula: Bi7Te3 |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 10 localities in this region. Habit: tabular hexagonal Colour: silvery black |
| ⓘ Hematite var. Specularite Formula: Fe2O3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Hessite Formula: Ag2Te Localities: References: |
| ⓘ Hexahydrite Formula: MgSO4 · 6H2O Localities: |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Hübnerite Formula: MnWO4 Localities: |
| ⓘ Hydromagnesite Formula: Mg5(CO3)4(OH)2 · 4H2O Localities: References: |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: References: |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 |
| ⓘ 'Joséite' Formula: Bi4TeS2 |
| ⓘ Kainosite-(Y) Formula: Ca2(Y,Ce)2(Si4O12)(CO3) · H2O Localities: Habit: prismatic crystals with wedge shaped terminations Colour: white Description: this list encompasses several different environments of the Golden Horn Batholith at Washington Pass |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ 'K Feldspar' |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ 'Limonite' Localities: Reported from at least 23 localities in this region. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Löllingite Formula: FeAs2 Habit: blebs and crude crystals Colour: metalic silvery white |
| ⓘ Magnesite Formula: MgCO3 Localities: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 29 localities in this region. Habit: cubes and octehedra to less then 1mm Colour: black |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 37 localities in this region. Habit: asicular needles and rounded blebs Colour: green |
| ⓘ 'Manganese Oxides' Localities: Home Run Prospect, Nespelem Mining District, Okanogan County, Washington, USA Modoc Prospect, Nespelem Mining District, Okanogan County, Washington, USA Goodenuf Prospect, Nespelem Mining District, Okanogan County, Washington, USA Moneymaker Prospect, Park City Mining District, Okanogan County, Washington, USA Bonanza Claim, Park City Mining District, Okanogan County, Washington, USA |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Meionite Formula: Ca4Al6Si6O24CO3 Localities: |
| ⓘ 'Mica Group' Localities: Reported from at least 9 localities in this region. |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Habit: blocky crsytals Colour: white to green |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Mirabilite Formula: Na2SO4 · 10H2O |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 34 localities in this region. References: |
| ⓘ Molybdite Formula: MoO3 Localities: |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) Habit: tabular crystals Colour: orange to brown |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Mordenite Formula: (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 16 localities in this region. |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 Localities: |
| ⓘ Muscovite var. Mariposite Formula: K(Al,Cr)2(Al,Si)4O10(OH)2 Localities: |
| ⓘ Muscovite var. Phengite Formula: KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 Localities: |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Natron Formula: Na2CO3 · 10H2O References: |
| ⓘ Nepheline Formula: Na3K(Al4Si4O16) Localities: |
| ⓘ Okanoganite-(Y) (TL) Formula: (Na,Ca)3(Y,Ce)12Si6B2O27F14 Localities: Habit: tetrahedra Colour: white to reddish orange |
| ⓘ Omphacite Formula: (NaaCabFe2+cMgd)(AleFe3+fFe2+gMgh)Si2O6 |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Opal var. Hyalite Formula: SiO2 · nH2O Description: Thin crusts, with bright green fluorescence under SW UV, on microcline crystals. |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 Localities: |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Petzite Formula: Ag3AuTe2 |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O Habit: crusts Description: Found as an alteration product on lollingite |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Platinum Formula: Pt Localities: |
| ⓘ Polylithionite Formula: KLi2Al(Si4O10)(F,OH)2 Habit: rounded platey crystals to crystaline aggregates. Colour: colorless to silvery white |
| ⓘ Powellite Formula: Ca(MoO4) Localities: |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Proustite Formula: Ag3AsS3 Localities: |
| ⓘ Pyrargyrite Formula: Ag3SbS3 Localities: Reported from at least 11 localities in this region. References: |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 175 localities in this region. References: |
| ⓘ 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z |
| ⓘ 'Pyrochlore Supergroup' Formula: A2-mD2X6-wZ1-n |
| ⓘ Pyrolusite Formula: Mn4+O2 Localities: |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 31 localities in this region. |
| ⓘ Pyrrhotite var. Nickel-bearing Pyrrhotite Formula: (Fe,Ni)7S8 |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 183 localities in this region. |
| ⓘ Quartz var. Chalcedony Formula: SiO2 Localities: |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Rutilated Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Localities: |
| ⓘ Rhodochrosite Formula: MnCO3 Localities: |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] Localities: |
| ⓘ Riebeckite Formula: ◻[Na2][Fe2+3Fe3+2]Si8O22(OH)2 |
| ⓘ Rutile Formula: TiO2 Localities: References: |
| ⓘ Sanidine Formula: K(AlSi3O8) Localities: |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Reported from at least 30 localities in this region. |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scolecite Formula: CaAl2Si3O10 · 3H2O |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O Localities: Habit: crusts Description: Found as crusts on altered lollingite crystals |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: Reported from at least 8 localities in this region. References: |
| ⓘ Siderite Formula: FeCO3 Localities: Habit: rhombohedral Colour: honey to red brown |
| ⓘ Silver Formula: Ag Localities: Reported from at least 10 localities in this region. |
| ⓘ Sogdianite Formula: K◻2Zr2Li3[Si12O30] Habit: massive Colour: purple-pink Description: intergrowths with zektzeite
|
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 73 localities in this region. References: |
| ⓘ Sphalerite var. Marmatite Formula: (Zn,Fe)S |
| ⓘ Spinel Formula: MgAl2O4 Localities: |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| ⓘ Stephanite Formula: Ag5SbS4 Localities: Reported from at least 14 localities in this region. |
| ⓘ 'Stibiconite' Formula: Sb3+Sb5+2O6(OH) Localities: |
| ⓘ Stibnite Formula: Sb2S3 Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ Stromeyerite Formula: AgCuS Localities: |
| ⓘ Stützite ? Formula: Ag5-xTe3, x = 0.24-0.36 |
| ⓘ Sulphur Formula: S8 Localities: References: |
| ⓘ Sylvanite ? Formula: AgAuTe4 |
| ⓘ 'Synchysite' Formula: Ca(Ce/Nd/Y/REE)(CO3)2F |
| ⓘ Synchysite-(Ce) Formula: CaCe(CO3)2F |
| ⓘ 'Synchysite Group' |
| ⓘ Synchysite-(Y) Formula: CaY(CO3)2F |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: Reported from at least 29 localities in this region. |
| ⓘ Thalénite-(Y) Formula: Y3Si3O10F |
| ⓘ Thénardite Formula: Na2SO4 References: |
| ⓘ Thermonatrite Formula: Na2CO3 · H2O References: |
| ⓘ Thorianite Formula: ThO2 |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: Habit: wedge shaped Colour: colorless to smokey gray, red-brown to Orange |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: |
| ⓘ Trona Formula: Na3H(CO3)2 · 2H2O References: |
| ⓘ Tungstite Formula: WO3 · H2O Localities: |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O Localities: Description: Associated with limonite pseudos after siderite, on quartz. |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 Localities: Controller and Red Bird Prospect, Nespelem Mining District, Okanogan County, Washington, USA Great Western Mine, Nespelem Mining District, Okanogan County, Washington, USA Hidden Treasure and Ramsey Prospect, Nespelem Mining District, Okanogan County, Washington, USA Rebecca Prospect, Nespelem Mining District, Okanogan County, Washington, USA Evening Prospect, Nespelem Mining District, Okanogan County, Washington, USA |
| ⓘ 'Wolframite Group' |
| ⓘ Wollastonite Formula: Ca3(Si3O9) Localities: |
| ⓘ Wulfenite Formula: Pb(MoO4) Habit: rounded stick like crystals Description: found only a few cavities in one pegmatite. |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Yarrowite Formula: Cu9S8 |
| ⓘ Zaratite Formula: Ni3(CO3)(OH)4 · 4H2O ? |
| ✪ Zektzerite (TL) Formula: LiNaZrSi6O15 Type Locality: Habit: pseudohexagonal to tabular orthorombic crsytals Colour: colorless, white, pink, orange-tan |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Habit: tetragonal prisms, bipyrmidal crystals. Colour: grey-green, yellow to orange-red |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: Buckhorn Mine, Southwest Zone and Gold Bowl (Crown Jewel) Zone, Buckhorn Mountain, Myer Creek Mining District, Okanogan County, Washington, USA Tunk Creek, Okanogan County, Washington, USA Roosevelt Mine, Buckhorn Mountain, Myer Creek Mining District, Okanogan County, Washington, USA ? (more information) References: |
| ⓘ Zoisite var. Thulite Formula: {Ca2}{Al,Mn3+3}(Si2O7)(SiO4)O(OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Platinum | 1.AF.10 | Pt |
| ⓘ | Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Stützite ? | 2.BA.65 | Ag5-xTe3, x = 0.24-0.36 |
| ⓘ | Petzite | 2.BA.75 | Ag3AuTe2 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Yarrowite | 2.CA.05d | Cu9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | var. Marmatite | 2.CB.05a | (Zn,Fe)S |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | var. Nickel-bearing Pyrrhotite | 2.CC.10 | (Fe,Ni)7S8 |
| ⓘ | Galena var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | 2.CD.10 | PbS | |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | 'Joséite' | 2.DC.05 | Bi4TeS2 |
| ⓘ | Hedleyite | 2.DC.05 | Bi7Te3 |
| ⓘ | Sylvanite ? | 2.EA.05 | AgAuTe4 |
| ⓘ | Calaverite | 2.EA.10 | AuTe2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Stephanite | 2.GB.10 | Ag5SbS4 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Galenobismutite | 2.JC.25e | PbBi2S4 |
| Group 3 - Halides | |||
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Bromargyrite | 3.AA.15 | AgBr |
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Gagarinite-(Y) | 3.AB.35 | NaCaYF6 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Corundum var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | Hematite var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Corundum var. Ruby | 4.CB.05 | Al2O3 |
| ⓘ | 4.CB.05 | Al2O3 | |
| ⓘ | Quartz var. Rutilated Quartz | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | var. Hyalite | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Euxenite-(Y) | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ | Clinofergusonite-(Y) | 4.DG.10 | YNbO4 |
| ⓘ | 'Fluorplumbopyrochlore' ? | 4.DH.15 | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| ⓘ | 'Stibiconite' | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Thorianite | 4.DL.05 | ThO2 |
| ⓘ | Molybdite | 4.E0.10 | MoO3 |
| ⓘ | Tungstite | 4.FJ.10 | WO3 · H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| ⓘ | Synchysite-(Y) | 5.BD.20c | CaY(CO3)2F |
| ⓘ | Thermonatrite | 5.CB.05 | Na2CO3 · H2O |
| ⓘ | Natron | 5.CB.10 | Na2CO3 · 10H2O |
| ⓘ | Trona | 5.CB.15 | Na3H(CO3)2 · 2H2O |
| ⓘ | Gaylussite | 5.CB.35 | Na2Ca(CO3)2 · 5H2O |
| ⓘ | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ | Zaratite | 5.DA.15 | Ni3(CO3)(OH)4 · 4H2O ? |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Thénardite | 7.AD.25 | Na2SO4 |
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Burkeite | 7.BD.25 | Na6(CO3)(SO4)2 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Hexahydrite | 7.CB.25 | MgSO4 · 6H2O |
| ⓘ | Epsomite | 7.CB.40 | MgSO4 · 7H2O |
| ⓘ | Mirabilite | 7.CD.10 | Na2SO4 · 10H2O |
| ⓘ | Gypsum var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | 7.CD.40 | CaSO4 · 2H2O | |
| ⓘ | Coquandite (TL) | 7.DE.35 | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Agardite-(Y) | 8.DL.15 | YCu6(AsO4)3(OH)6 · 3H2O |
| Group 9 - Silicates | |||
| ⓘ | Fayalite | 9.AC.05 | Fe2+2SiO4 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | var. Melanite | 9.AD.25 | Ca3(Fe3+,Ti)2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Gadolinite-(Ce) | 9.AJ.20 | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| ⓘ | Gadolinite-(Y) | 9.AJ.20 | Y2Fe2+Be2Si2O10 |
| ⓘ | Okanoganite-(Y) (TL) | 9.AJ.35 | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| ⓘ | Chevkinite-(Ce) | 9.BE.70 | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite var. Thulite | 9.BG.10 | {Ca2}{Al,Mn3+3}(Si2O7)(SiO4)O(OH) |
| ⓘ | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) | |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Thalénite-(Y) | 9.BJ.20 | Y3Si3O10F |
| ⓘ | Calciocatapleiite | 9.CA.15 | CaZr(Si3O9) · 2H2O |
| ⓘ | Kainosite-(Y) | 9.CF.10 | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| ⓘ | Beryl ? | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Brannockite | 9.CM.05 | K◻2Sn2Li3[Si12O30] |
| ⓘ | Sogdianite | 9.CM.05 | K◻2Zr2Li3[Si12O30] |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Omphacite | 9.DA.20 | (NaaCabFe2+cMgd)(AleFe3+fFe2+gMgh)Si2O6 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Astrophyllite | 9.DC.05 | K2NaFe2+7Ti2Si8O26(OH)4F |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Ferro-hornblende | 9.DE.10 | ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Hastingsite var. Alkali-ferrohastingsite | 9.DE.15 | {Na}{Ca2}{Fe2+4Fe3+}(Al2Si6O22)(OH)2 |
| ⓘ | 9.DE.15 | NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 | |
| ⓘ | Ferro-richterite | 9.DE.20 | {Na}{CaNa}{Fe2+5}(Si8O22)(OH)2 |
| ⓘ | Arfvedsonite | 9.DE.25 | [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 |
| ⓘ | Riebeckite | 9.DE.25 | ◻[Na2][Fe2+3Fe3+2]Si8O22(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Elpidite | 9.DG.65 | Na2ZrSi6O15 · 3H2O |
| ⓘ | var. Calcium-bearing Elpidite | 9.DG.65 | (Na,Ca)2ZrSi6O15 · 3H2O |
| ⓘ | Aenigmatite | 9.DH.40 | Na4[Fe2+10Ti2]O4[Si12O36] |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Calciohilairite (TL) | 9.DM.10 | CaZr[SiO3]3 · 3H2O |
| ⓘ | Zektzerite (TL) | 9.DN.05 | LiNaZrSi6O15 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Mariposite | 9.EC.15 | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| ⓘ | var. Phengite | 9.EC.15 | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Annite | 9.EC.20 | KFe2+3(AlSi3O10)(OH)2 |
| ⓘ | Polylithionite | 9.EC.20 | KLi2Al(Si4O10)(F,OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Clinochlore ? | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ | Clinochlore var. Chromium-bearing Clinochlore ? | 9.EC.55 | Mg5(Al,Cr)2Si3O10(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Nepheline | 9.FA.05 | Na3K(Al4Si4O16) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Sanidine | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Genthelvite | 9.FB.10 | Be3Zn4(SiO4)3S |
| ⓘ | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| ⓘ | Scolecite | 9.GA.05 | CaAl2Si3O10 · 3H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Chabazite-Ca | 9.GD.10 | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ | Mordenite | 9.GD.35 | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| Unclassified | |||
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Pyrochlore Supergroup' | - | A2-mD2X6-wZ1-n |
| ⓘ | 'Biotite var. Oxybiotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Synchysite Group' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Bastnäsite Group' | - | M(CO3)X where M = REE, Th and X = F or OH |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Gagarinite' | - | |
| ⓘ | 'Chevkinite Group' | - | |
| ⓘ | 'Garnierite' | - | |
| ⓘ | 'Clinoptilolite Subgroup' | - | M3-6(Si30Al6)O72 · 20H2O |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Fergusonite' | - | |
| ⓘ | 'Gadolinite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Synchysite' | - | Ca(Ce/Nd/Y/REE)(CO3)2F |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Hastingsite var. Alkali-ferrohastingsite | {Na}{Ca2}{Fe42+Fe3+}(Al2Si6O22)(OH)2 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| H | ⓘ Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Calciohilairite | CaZr[SiO3]3 · 3H2O |
| H | ⓘ Calciocatapleiite | CaZr(Si3O9) · 2H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinoptilolite Subgroup | M3-6(Si30Al6)O72 · 20H2O |
| H | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| H | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epsomite | MgSO4 · 7H2O |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | ⓘ Ferro-richterite | {Na}{CaNa}{Fe52+}(Si8O22)(OH)2 |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| H | ⓘ Hexahydrite | MgSO4 · 6H2O |
| H | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| H | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mirabilite | Na2SO4 · 10H2O |
| H | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Natron | Na2CO3 · 10H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Thermonatrite | Na2CO3 · H2O |
| H | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| H | ⓘ Tungstite | WO3 · H2O |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Muscovite var. Mariposite | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| H | ⓘ Bastnäsite Group | M(CO3)X where M = REE, Th and X = F or OH |
| H | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Li | Lithium | |
| Li | ⓘ Brannockite | K◻2Sn2Li3[Si12O30] |
| Li | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Li | ⓘ Sogdianite | K◻2Zr2Li3[Si12O30] |
| Li | ⓘ Zektzerite | LiNaZrSi6O15 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Be | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Be | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| B | Boron | |
| B | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| C | ⓘ Burkeite | Na6(CO3)(SO4)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| C | ⓘ Graphite | C |
| C | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| C | ⓘ Natron | Na2CO3 · 10H2O |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| C | ⓘ Synchysite-(Y) | CaY(CO3)2F |
| C | ⓘ Thermonatrite | Na2CO3 · H2O |
| C | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| C | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| C | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| C | ⓘ Bastnäsite Group | M(CO3)X where M = REE, Th and X = F or OH |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| O | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Hastingsite var. Alkali-ferrohastingsite | {Na}{Ca2}{Fe42+Fe3+}(Al2Si6O22)(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| O | ⓘ Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brannockite | K◻2Sn2Li3[Si12O30] |
| O | ⓘ Burkeite | Na6(CO3)(SO4)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calciohilairite | CaZr[SiO3]3 · 3H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Calciocatapleiite | CaZr(Si3O9) · 2H2O |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| O | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinoptilolite Subgroup | M3-6(Si30Al6)O72 · 20H2O |
| O | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epsomite | MgSO4 · 7H2O |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| O | ⓘ Fayalite | Fe22+SiO4 |
| O | ⓘ Clinofergusonite-(Y) | YNbO4 |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | ⓘ Ferro-richterite | {Na}{CaNa}{Fe52+}(Si8O22)(OH)2 |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| O | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| O | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| O | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hexahydrite | MgSO4 · 6H2O |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| O | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Mirabilite | Na2SO4 · 10H2O |
| O | ⓘ Molybdite | MoO3 |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Natron | Na2CO3 · 10H2O |
| O | ⓘ Nepheline | Na3K(Al4Si4O16) |
| O | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| O | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| O | ⓘ Corundum var. Ruby | Al2O3 |
| O | ⓘ Quartz var. Rutilated Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sanidine | K(AlSi3O8) |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Sogdianite | K◻2Zr2Li3[Si12O30] |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Synchysite-(Y) | CaY(CO3)2F |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Thalénite-(Y) | Y3Si3O10F |
| O | ⓘ Thénardite | Na2SO4 |
| O | ⓘ Thermonatrite | Na2CO3 · H2O |
| O | ⓘ Thorianite | ThO2 |
| O | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| O | ⓘ Tungstite | WO3 · H2O |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| O | ⓘ Zektzerite | LiNaZrSi6O15 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| O | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| O | ⓘ Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
| O | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Muscovite var. Mariposite | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| O | ⓘ Bastnäsite Group | M(CO3)X where M = REE, Th and X = F or OH |
| O | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| O | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Gagarinite-(Y) | NaCaYF6 |
| F | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| F | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| F | ⓘ Synchysite-(Y) | CaY(CO3)2F |
| F | ⓘ Thalénite-(Y) | Y3Si3O10F |
| F | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Bastnäsite Group | M(CO3)X where M = REE, Th and X = F or OH |
| F | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Na | ⓘ Hastingsite var. Alkali-ferrohastingsite | {Na}{Ca2}{Fe42+Fe3+}(Al2Si6O22)(OH)2 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Na | ⓘ Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| Na | ⓘ Burkeite | Na6(CO3)(SO4)2 |
| Na | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| Na | ⓘ Ferro-richterite | {Na}{CaNa}{Fe52+}(Si8O22)(OH)2 |
| Na | ⓘ Gagarinite-(Y) | NaCaYF6 |
| Na | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Na | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Na | ⓘ Mirabilite | Na2SO4 · 10H2O |
| Na | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Natron | Na2CO3 · 10H2O |
| Na | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Na | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| Na | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Thénardite | Na2SO4 |
| Na | ⓘ Thermonatrite | Na2CO3 · H2O |
| Na | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| Na | ⓘ Zektzerite | LiNaZrSi6O15 |
| Na | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Na | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Epsomite | MgSO4 · 7H2O |
| Mg | ⓘ Hexahydrite | MgSO4 · 6H2O |
| Mg | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | Aluminium | |
| Al | ⓘ Hastingsite var. Alkali-ferrohastingsite | {Na}{Ca2}{Fe42+Fe3+}(Al2Si6O22)(OH)2 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinoptilolite Subgroup | M3-6(Si30Al6)O72 · 20H2O |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Al | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Al | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Corundum var. Ruby | Al2O3 |
| Al | ⓘ Sanidine | K(AlSi3O8) |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Muscovite var. Mariposite | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Si | ⓘ Hastingsite var. Alkali-ferrohastingsite | {Na}{Ca2}{Fe42+Fe3+}(Al2Si6O22)(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Si | ⓘ Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Brannockite | K◻2Sn2Li3[Si12O30] |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Calciohilairite | CaZr[SiO3]3 · 3H2O |
| Si | ⓘ Calciocatapleiite | CaZr(Si3O9) · 2H2O |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinoptilolite Subgroup | M3-6(Si30Al6)O72 · 20H2O |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fayalite | Fe22+SiO4 |
| Si | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Ferro-richterite | {Na}{CaNa}{Fe52+}(Si8O22)(OH)2 |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Si | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Si | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| Si | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Si | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| Si | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Si | ⓘ Quartz var. Rutilated Quartz | SiO2 |
| Si | ⓘ Sanidine | K(AlSi3O8) |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Sogdianite | K◻2Zr2Li3[Si12O30] |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thalénite-(Y) | Y3Si3O10F |
| Si | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zektzerite | LiNaZrSi6O15 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Si | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Si | ⓘ Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Muscovite var. Mariposite | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| Si | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Burkeite | Na6(CO3)(SO4)2 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| S | ⓘ Covellite | CuS |
| S | ⓘ Epsomite | MgSO4 · 7H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Galenobismutite | PbBi2S4 |
| S | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| S | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Hexahydrite | MgSO4 · 6H2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Joséite | Bi4TeS2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| S | ⓘ Mirabilite | Na2SO4 · 10H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stephanite | Ag5SbS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Thénardite | Na2SO4 |
| S | ⓘ Yarrowite | Cu9S8 |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| S | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| S | ⓘ Pyrrhotite var. Nickel-bearing Pyrrhotite | (Fe,Ni)7S8 |
| Cl | Chlorine | |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| K | ⓘ Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Brannockite | K◻2Sn2Li3[Si12O30] |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Nepheline | Na3K(Al4Si4O16) |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| K | ⓘ Sanidine | K(AlSi3O8) |
| K | ⓘ Sogdianite | K◻2Zr2Li3[Si12O30] |
| K | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Mariposite | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Hastingsite var. Alkali-ferrohastingsite | {Na}{Ca2}{Fe42+Fe3+}(Al2Si6O22)(OH)2 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Calciohilairite | CaZr[SiO3]3 · 3H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Calciocatapleiite | CaZr(Si3O9) · 2H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ca | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Ferro-richterite | {Na}{CaNa}{Fe52+}(Si8O22)(OH)2 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gagarinite-(Y) | NaCaYF6 |
| Ca | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Ca | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| Ca | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Synchysite-(Y) | CaY(CO3)2F |
| Ca | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Ca | ⓘ Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
| Ca | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Ca | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| Ti | Titanium | |
| Ti | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Ti | ⓘ Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
| Ti | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Cr | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Cr | ⓘ Muscovite var. Mariposite | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| Mn | Manganese | |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Fe | ⓘ Hastingsite var. Alkali-ferrohastingsite | {Na}{Ca2}{Fe42+Fe3+}(Al2Si6O22)(OH)2 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Fe | ⓘ Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Fayalite | Fe22+SiO4 |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | ⓘ Ferro-richterite | {Na}{CaNa}{Fe52+}(Si8O22)(OH)2 |
| Fe | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Fe | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Fe | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| Fe | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Fe | ⓘ Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
| Fe | ⓘ Pyrrhotite var. Nickel-bearing Pyrrhotite | (Fe,Ni)7S8 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| Ni | ⓘ Pyrrhotite var. Nickel-bearing Pyrrhotite | (Fe,Ni)7S8 |
| Cu | Copper | |
| Cu | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Yarrowite | Cu9S8 |
| Zn | Zinc | |
| Zn | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| As | Arsenic | |
| As | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Br | Bromine | |
| Br | ⓘ Bromargyrite | AgBr |
| Y | Yttrium | |
| Y | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Y | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Y | ⓘ Clinofergusonite-(Y) | YNbO4 |
| Y | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Y | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Y | ⓘ Gagarinite-(Y) | NaCaYF6 |
| Y | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| Y | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| Y | ⓘ Synchysite-(Y) | CaY(CO3)2F |
| Y | ⓘ Thalénite-(Y) | Y3Si3O10F |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Y | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Y | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| Zr | Zirconium | |
| Zr | ⓘ Calciohilairite | CaZr[SiO3]3 · 3H2O |
| Zr | ⓘ Calciocatapleiite | CaZr(Si3O9) · 2H2O |
| Zr | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| Zr | ⓘ Sogdianite | K◻2Zr2Li3[Si12O30] |
| Zr | ⓘ Zektzerite | LiNaZrSi6O15 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Nb | Niobium | |
| Nb | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Nb | ⓘ Clinofergusonite-(Y) | YNbO4 |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Molybdite | MoO3 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Bromargyrite | AgBr |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Petzite | Ag3AuTe2 |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Silver | Ag |
| Ag | ⓘ Stephanite | Ag5SbS4 |
| Ag | ⓘ Stromeyerite | AgCuS |
| Ag | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Ag | ⓘ Sylvanite | AgAuTe4 |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Sn | Tin | |
| Sn | ⓘ Brannockite | K◻2Sn2Li3[Si12O30] |
| Sb | Antimony | |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Stephanite | Ag5SbS4 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Te | Tellurium | |
| Te | ⓘ Calaverite | AuTe2 |
| Te | ⓘ Hedleyite | Bi7Te3 |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Joséite | Bi4TeS2 |
| Te | ⓘ Petzite | Ag3AuTe2 |
| Te | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Te | ⓘ Sylvanite | AgAuTe4 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| La | Lanthanum | |
| La | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ce | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ce | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Ce | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ce | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Ce | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Nd | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Nd | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Ta | Tantalum | |
| Ta | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| W | Tungsten | |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Tungstite | WO3 · H2O |
| Pt | Platinum | |
| Pt | ⓘ Platinum | Pt |
| Au | Gold | |
| Au | ⓘ Calaverite | AuTe2 |
| Au | ⓘ Gold | Au |
| Au | ⓘ Petzite | Ag3AuTe2 |
| Au | ⓘ Sylvanite | AgAuTe4 |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Galenobismutite | PbBi2S4 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Pb | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| Bi | Bismuth | |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Galenobismutite | PbBi2S4 |
| Bi | ⓘ Hedleyite | Bi7Te3 |
| Bi | ⓘ Joséite | Bi4TeS2 |
| Th | Thorium | |
| Th | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Th | ⓘ Thorianite | ThO2 |
| Th | ⓘ Bastnäsite Group | M(CO3)X where M = REE, Th and X = F or OH |
| Th | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| U | Uranium | |
| U | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| U | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
Fossils
There are 1 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 1 | ||||||
|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 41.3 Ma (Eocene) | ||||||
| Oldest Fossil Listed | 47.8 Ma (Eocene) | ||||||
| Stratigraphic Units |
| ||||||
| Fossils from Region | Click here to show the list. | ||||||
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Okanogan_County,_Washington |
|---|---|
| Wikidata ID: | Q483958 |
| GeoNames ID: | 5805553 |
Localities in this Region
- Washington
- Okanogan County
- American Graphite Mine
- Antimony Prospect
- Barber Mountain
- Brown Lake Prospect
- Calumet Claim
- Cassimer Bar Placer
- Cathinn Creek Valley Cordierite Occurrence
- ⭔Chewuch Mining District
- Chief Jo Mine
- ⭔Conconully Mining District
- Black Huzzar Prospect
- Blue Lake Mine
- Carl Frederick Prospect
- Central Mine
- Cheatham Quarry
- ⭔Conconully Area
- Copper Zone Claim
- Dorian Prospect
- Johnson Creek Mine
- Q.S. Prospect
- Ruby Hill
- ⭔Salmon Creek Area
- Salmon River Placers
- Sherman Mine
- Silver Bluff Mine
- Silver Mountain Mine
- Starr Mine
- Tonasket Prospect
- Yellow Girl Prospect
- Crawfish Lake Area
- Evans Lake
- Gold Ridge Prospect
- Golden Horn Batholith
- ⭔Hidden Lakes Mining District
- Lucky Knock Mine
- Malott Claim
- ⭔Malott Mining District
- Manuel Prospect
- ⭔Mazama Mining District
- ⭔Methow Mining District
- Mount Kobau Area
- Murray Placer
- ⭔Myer Creek Mining District
- Apex Prospect
- Bi-Metallic Mine
- Buckhorn Mountain
- Butcher Boy Mine
- Chesaw
- Copper Queen Claim
- Delate Prospect
- Gloucester Prospect
- Ida Prospect
- Lake Beth Prospect
- Mary Ann Creek Placer
- Myer Creek
- Nip and Tuck Claim
- Number Nine Claim
- Olentangy Prospect
- Ophir Prospect
- Poland China Mine
- Reco-Gray Eagle Mine
- Review Mine
- Strawberry Lake Prospect
- Walker Placer
- Yakima Mine
- ⭔Nespelem Mining District
- Okanogan County
- Washington
- Okanogan County
- Nespelem Mining District
- Gould and Curry Mine
- Great Divide Prospect
- Great Western Mine
- Hidden Treasure and Ramsey Prospect
- Home Run Prospect
- Hudnut Prospect
- Iron Crown Prospect
- Jumbo Prospect
- Kankakee Mine
- Lilman Mine
- Little Chief Mine
- Mineral Hill Prospect
- Modoc Prospect
- Montana Prospect
- Multnomah Prospect
- Nespelem River Placers
- Newport Prospect
- Oversight Prospect
- Panama Mine
- Par Value Prospect
- Pittsburg Mine
- Rebecca Prospect
- Silver Cliff Mine
- Silver Point Prospect
- St. Paul Prospect
- Stepstone Prospect
- Sterling Prospect
- Surprise Prospect
- Tip Top Prospect
- Twin Pine Mine
- New Hope Prospect
- ⭔Nighthawk Mining District
- Bellevue Mine
- Blackbird Prospect
- Bullfrog Mine
- California Claim
- Chloride Queen Mine
- Chopaka Prospect
- ⭔Ellenham Mtn area
- Four Metals Mine
- Golden Zone Mine
- Horn Silver Mine
- Horseshoe Basin Prospect
- Kaaba Mine
- King Solomon Mine
- Lenton Flat
- Little Chopaka Mountain
- Mount Chopaka
- Mountain Sheep Mine
- Nighthawk Mine
- Peerless Prospect
- Prize Mine
- Ruby Mine
- Wyandotte Mine
- Okanogan Prospect
- Okanogan River Placers
- ⭔Oroville Mining District
- 49th Parallel Mine
- Bitter Lake
- Carlquist Prospect
- Copper Queen Prospect
- Dividend Prospect
- Gold Dust Claim
- Golden Chariot Mine
- International Prospect
- Kelsey Prospect
- Kruger Mountain
- Lakeview Prospect
- Mikelson Prospect
- Moncosilgo Prospect
- Ohio Prospect
- OK Copper Mine
- Okanogan Free Gold Mine
- Rich Bar Prospect
- Similkameen River Placers
- Tonasket Graphite Occurrence
- West side of Osoyoos Lake
- ⭔Palmer Mountain Mining District
- Adelia Mine
- Black Bear Mine
- Bunker Hill Mine
- Copper King Prospect
- Copper World Extension Mine
- Copper World Mine
- Double Standard Prospect
- Gold Crown Mine
- Hiawatha Mine
- Ivanhoe Mine
- John Judge Mine
- Kalamazoo Prospect
- Kimberly Mine
- Midas 1 Claim
- Palmer Lake Prospect
- Palmer Mountain
- Pinnacle Mine
- Prospect "E-17"
- Rainbow Mine
- Security Mine
- Spokane Mine
- Summit Mine
- Triune Mine
- War Eagle Mine
- Wehe Mines
- Palmer Prospect
- ⭔Park City Mining District
- Atkins Prospect
- Bonanza Claim
- Crounse Placer
- Eureka Prospect
- General Miles Prospect
- Gold Creek Placers
- Gove Prospect
- Hanford Prospect
- Hercules Prospect
- Independent Prospect
- Iron Dike Prospect
- Maid of Erin Claim
- Moneymaker Prospect
- Mountain Boy Mine
- Old Glory Prospect
- Park Central Prospect
- Park City Placers
- Poorman Mine
- Ramore Mine
- Sharp and Balthus Prospect
- Summit Mine
- Three L's Prospect
- Wasco Prospect
- West Fork San Poil River Placers
- Pogue Flat Mine
- Poison Lake
- Prince Prospect
- Pthomigan Prospect
- Radar Mountain Roadcuts
- Russia Prospect
- Shaw-Bergman Prospect
- Shotwell Placer
- Tonasket Chromium Prospect
- Tonasket Meionite Occurrence
- ⭔Tonasket Mining District
- Tunk Creek
- ⭔Twisp Mining District
- ⭔Wannacut Lake Mining District
- ⭔Wauconda Mining District
- Nespelem Mining District
- Okanogan County
Other Regions, Features and Areas that Intersect
North America
- Cascade RangeMountain Range
- Columbia MountainsMountain Range
North America PlateTectonic Plate
- Franciscan DomainDomain
- Kootenay DomainDomain
- Okanogan DomainDomain
- Pend Oreille DomainDomain
- Western Quesnellia DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Okanogan County, Washington, USA