| Acanthite |  |
|---|
| Formula: | Ag2S |
| Localities: | Reported from at least 10 localities in this region. |
|
|
|
|
|
|
| Photo: © CCURTO08. Acanthite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Adamite var: Cobaltoan Adamite |  |
|---|
| Formula: | (Zn,Co)AsO4OH |
| Locality: | Rappold Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
| Photo: © Thomas Witzke. Cobaltoan Adamite from Rappold Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Aikinite | |
|---|
| Formula: | PbCuBiS3 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Albite | |
|---|
| Formula: | NaAlSi3O8 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Allophane | |
|---|
| Formula: | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Almandine | |
|---|
| Formula: | Fe2+3Al2(SiO4)3 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Ammoniojarosite ? | |
|---|
| Formula: | (NH4)Fe3+3(SO4)2(OH)6 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Anatase | |
|---|
| Formula: | TiO2 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Andalusite | |
|---|
| Formula: | Al2(SiO4)O |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Andradite | |
|---|
| Formula: | Ca3Fe3+2(SiO4)3 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Anglesite | |
|---|
| Formula: | PbSO4 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Anhydrite | |
|---|
| Formula: | CaSO4 |
| Reference: | Natural History Museum Vienna collection |
|
|
|
|
|
|
|
| Ankerite | |
|---|
| Formula: | Ca(Fe2+,Mg)(CO3)2 |
| Localities: | Sauschwart Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Gesellschaft Mine (Gesellschafter Zug Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Siebenschlehen Mine (Shaft 10), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Annabergite | |
|---|
| Formula: | Ni3(AsO4)2 · 8H2O |
| Localities: | Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Adam Heber Mine (Shaft 43), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Siebenschlehen Mine (Shaft 10), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Anorthite | |
|---|
| Formula: | CaAl2Si2O8 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Antigorite | |
|---|
| Formula: | Mg3(Si2O5)(OH)4 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Apophyllite-(KF) ? | |
|---|
| Formula: | KCa4(Si8O20)(F,OH) · 8H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Aragonite | |
|---|
| Formula: | CaCO3 |
| Localities: | Neujahr Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Rappold Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Argentopyrite |  |
|---|
| Formula: | AgFe2S3 |
| Localities: | Türk Shaft (Shaft 83), Schneeberg District, Erzgebirge, Saxony, Germany Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: © Christian Rewitzer. Argentopyrite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Arsenic |  |
|---|
| Formula: | As |
| Locality: | Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
| Photo: © Thomas Witzke. Arsenic from Schneeberg District, Erzgebirge, Saxony, Germany |
| Arseniosiderite |  |
|---|
| Formula: | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| Localities: | Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Rappold Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Sauschwart Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: © Van King. Arseniosiderite from Daniel Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Arsenogorceixite | |
|---|
| Formula: | BaAl3(AsO4)2(OH)5 · H2O |
| Locality: | Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Arsenolite |  |
|---|
| Formula: | As2O3 |
| Locality: | Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
| Photo: © Thomas Witzke. Arsenolite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Arsenopyrite | |
|---|
| Formula: | FeAsS |
| Localities: | Waldschacht Mine (Shaft 26), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Priester Mine (Priester und Leviten Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Asbolane |  |
|---|
| Formula: | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Localities: | Adam Heber Mine (Shaft 43), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: Asbolane from Schneeberg District, Erzgebirge, Saxony, Germany |
| Asselbornite (TL) |  |
|---|
| Formula: | Pb(BiO)3(UO2)4(AsO4)2(OH)7·4H2O |
| Type Locality: | Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 967; Anthony, Bideaux, Bladh, Nichols: Handbook of Mineralogy, Vol. IV |
|
|
|
|
|
| Photo: © Stephan Wolfsried. Asselbornite from Walpurgis Flacher vein, Weißer Hirsch Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Atelestite (TL) |  |
|---|
| Formula: | Bi2(AsO4)O(OH) |
| Type Locality: | Neuhilfe Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 793; Lapis (2005): 30(7/8): 70. |
| Localities: | Recorded from at least 12 other localities in this region. |
|
|
|
|
| Photo: © Thomas Witzke. Atelestite from Neuhilfe Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Augite | |
|---|
| Formula: | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Austinite | |
|---|
| Formula: | CaZn(AsO4)(OH) |
| Locality: | Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Autunite | |
|---|
| Formula: | Ca(UO2)2(PO4)2 · 11H2O |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| 'Axinite Group' | |
|---|
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
|
| Azurite | |
|---|
| Formula: | Cu3(CO3)2(OH)2 |
| Localities: | St Georg Mine, Schneeberg District, Erzgebirge, Saxony, Germany König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Bariopharmacosiderite | |
|---|
| Formula: | Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O |
| Localities: | Rappold Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany Schrotschacht Mine, Schneeberg District, Erzgebirge, Saxony, Germany Adam Heber Mine (Shaft 43), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Barium-Alumopharmacosiderite | |
|---|
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
|
| Baryte |  |
|---|
| Formula: | BaSO4 |
| Localities: | Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany St Georg Mine, Schneeberg District, Erzgebirge, Saxony, Germany König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany Güldener Falk Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: © Rob Lavinsky. Baryte from Schneeberg District, Erzgebirge, Saxony, Germany |
| Bayldonite | |
|---|
| Formula: | PbCu3(AsO4)2(OH)2 |
| Locality: | König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Becquerelite | |
|---|
| Formula: | Ca(UO2)6O4(OH)6 · 8H2O |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Beryl |  |
|---|
| Formula: | Be3Al2(Si6O18) |
| Locality: | Süß Quarry, Zschorlau, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
| Photo: © M. Adelt. Beryl from Süß Quarry, Zschorlau, Schneeberg District, Erzgebirge, Saxony, Germany |
| β-Roselite (TL) |  |
|---|
| Formula: | Ca2(Co2+,Mg)(AsO4)2 · 2H2O |
| Type Locality: | Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | C. Frondel (1955): Neomesselite and Beta-roselite: two new members of the fairfieldite group.- Amer. Mineral. 40, 828-833 |
| Localities: | Recorded from at least 1 other locality in this region. |
|
|
|
|
| Photo: © Thomas Witzke. β-Roselite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Beudantite | |
|---|
| Formula: | PbFe3(AsO4)(SO4)(OH)6 |
| Localities: | Rappold Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Güldener Falk Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Beyerite (TL) |  |
|---|
| Formula: | Ca(BiO)2(CO3)2 |
| Type Locality: | Schneeberg District, Erzgebirge, Saxony, Germany |
| Localities: | Recorded from at least 6 other localities in this region. |
|
|
|
|
|
| Photo: © Thomas Witzke. Beyerite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Bieberite | |
|---|
| Formula: | CoSO4 · 7H2O |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Biotite | |
|---|
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
|
| Birnessite ? | |
|---|
| Formula: | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Bismite |  |
|---|
| Formula: | Bi2O3 |
| Locality: | Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
| Photo: © David J. Eicher. Bismite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Bismuth (TL) |  |
|---|
| Formula: | Bi |
| Type Locality: | Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | G. Agricola: De natura fossilium, Libri X, book 1, page 186 (1546) |
| Localities: | Recorded from at least 18 other localities in this region. |
|
|
|
|
| Photo: © Rob Lavinsky. Bismuth from Schneeberg District, Erzgebirge, Saxony, Germany |
| Bismuthinite | |
|---|
| Formula: | Bi2S3 |
| Localities: | Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Sauschwart Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Bergkappe Mine (Shaft 75), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Gesellschaft Mine (Gesellschafter Zug Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Schindler Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Bismutite (TL) |  |
|---|
| Formula: | (BiO)2CO3 |
| Type Locality: | Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 281; Lapis (2005): 30(7/8): 78-80. |
| Localities: | Recorded from at least 17 other localities in this region. |
|
|
|
|
| Photo: © Thomas Witzke. Bismutite from Weißer Hirsch Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Bismutoferrite (TL) |  |
|---|
| Formula: | Fe3+2Bi(SiO4)2(OH) |
| Type Locality: | Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Frenzel, 1871 |
| Localities: | Recorded from at least 10 other localities in this region. |
|
|
|
|
| Photo: © Thomas Witzke. Bismutoferrite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Bornite | |
|---|
| Formula: | Cu5FeS4 |
| Localities: | König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany St Katharina Mine, Schneeberg District, Erzgebirge, Saxony, Germany Fürstenvertrag Mine, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Bournonite ? | |
|---|
| Formula: | PbCuSbS3 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Brandtite ? | |
|---|
| Formula: | Ca2(Mn2+,Mg)(AsO4)2 · 2H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Braunite | |
|---|
| Formula: | Mn2+Mn3+6(SiO4)O8 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Brendelite (TL) |  |
|---|
| Formula: | (Bi3+,Pb)2(Fe3+,Fe2+)(PO4)O2(OH) |
| Type Locality: | Güldener Falk Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | W. Krause et al.: Mineral. Petrol. 63:263-277 (1998) |
|
|
|
|
|
| Photo: © Stephan Wolfsried. Brendelite from Güldener Falk Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Brochantite | |
|---|
| Formula: | Cu4(SO4)(OH)6 |
| Locality: | König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Brushite ? | |
|---|
| Formula: | Ca(HPO4) · 2H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Cacoxenite ? | |
|---|
| Formula: | Fe3+24Al(PO4)17O6(OH)12 · 17H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Calcite |  |
|---|
| Formula: | CaCO3 |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
| Photo: © AÖ. Calcite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Calcite var: Cobaltoan Calcite |  |
|---|
| Formula: | (Ca,Co)CO3 |
| Localities: | Adam Heber Mine (Shaft 43), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: © Rob Lavinsky. Cobaltoan Calcite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Carminite | |
|---|
| Formula: | PbFe3+2(AsO4)2(OH)2 |
| Locality: | Waldschacht Mine (Shaft 26), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Cassiterite | |
|---|
| Formula: | SnO2 |
| Reference: | No reference listed |
| Localities: | Recorded from at least 1 other locality in this region. |
|
|
|
|
|
|
| Cattierite | |
|---|
| Formula: | CoS2 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Cerussite | |
|---|
| Formula: | PbCO3 |
| Localities: | Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany Gesellschaft Mine (Gesellschafter Zug Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Weißhäuptel Mine, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Chalcanthite | |
|---|
| Formula: | CuSO4 · 5H2O |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Chalcoalumite | |
|---|
| Formula: | CuAl4(SO4)(OH)12 · 3H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Chalcocite | |
|---|
| Formula: | Cu2S |
| Localities: | St Georg Mine, Schneeberg District, Erzgebirge, Saxony, Germany Bergkappe Mine (Shaft 75), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany Schrotschacht Mine, Schneeberg District, Erzgebirge, Saxony, Germany Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Chalcophyllite | |
|---|
| Formula: | Cu18Al2(SO4)3(AsO4)3(OH)27 · 33H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Chalcopyrite | |
|---|
| Formula: | CuFeS2 |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
|
| Chenevixite | |
|---|
| Formula: | Cu2Fe3+2(AsO4)2(OH)4 |
| Localities: | Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany Adam Heber Mine (Shaft 43), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany ? (more information)
|
|
|
|
|
|
|
|
| Chlorargyrite |  |
|---|
| Formula: | AgCl |
| Localities: | St Georg Mine, Schneeberg District, Erzgebirge, Saxony, Germany Bergkappe Mine (Shaft 75), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Katharina Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Chlorargyrite from Weißer Hirsch Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| 'Chlorotile (of Frenzel)' | |
|---|
| Locality: | Rappold Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
|
| Chrysocolla | |
|---|
| Formula: | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O (x < 1) |
| Localities: | König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany Greif Mine, Schneeberg District, Erzgebirge, Saxony, Germany Gesellschaft Mine (Gesellschafter Zug Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Churchite-(Y) |  |
|---|
| Formula: | Y(PO4) · 2H2O |
| Locality: | Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
| Photo: © Thomas Witzke. Churchite-(Y) from Walpurgis Flacher vein, Weißer Hirsch Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Clausthalite | |
|---|
| Formula: | PbSe |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Clinochlore | |
|---|
| Formula: | (Mg,Fe2+)5Al(AlSi3O10)(OH)8 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Clinozoisite | |
|---|
| Formula: | {Ca2}{Al3}(Si2O7)(SiO4)O(OH) |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Cobaltaustinite |  |
|---|
| Formula: | CaCo(AsO4)(OH) |
| Localities: | Rappold Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: © Thomas Witzke. Cobaltaustinite from Rappold Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Cobaltite ? |  |
|---|
| Formula: | CoAsS |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
| Photo: © Rob Lavinsky . Cobaltite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Cobaltkoritnigite |  |
|---|
| Formula: | (Co,Zn)(HAsO4) · H2O |
| Localities: | Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Adam Heber Mine (Shaft 43), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Schindler Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: © Thomas Witzke. Cobaltkoritnigite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Cobaltlotharmeyerite (TL) |  |
|---|
| Formula: | Ca(Co,Fe3+,Ni)2(AsO4)2 · 2(H2O,OH) |
| Type Locality: | Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | W. Krause et al.: N. Jb. Mineral. Mh. 1999:505-517 |
| Localities: | Recorded from at least 4 other localities in this region. |
|
|
|
|
| Photo: © DV Minerals. Cobaltlotharmeyerite from Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany |
| Cobaltneustädtelite (TL) |  |
|---|
| Formula: | Bi3+2Fe3+(Co,Fe3+)2(AsO4)2(OH,O)4 |
| Type Locality: | Güldener Falk Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | W. Krause, H.-J. Bernhardt, C. McCammon & H. Effenberger (2002): Neustädtelite and cobaltneustädtelite, the Fe3+- and Co2+- analogues of medenbachite.- American Mineralogist 87, 726 - 738 |
| Localities: | Recorded from at least 4 other localities in this region. |
|
|
|
|
| Photo: © Thomas Witzke. Cobaltneustädtelite from Güldener Falk Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Cobalttsumcorite (TL) |  |
|---|
| Formula: | Pb(Co,Fe3+,Ni)2(AsO4)2 · 2(H2O,OH) |
| Type Locality: | Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | MinRec 33:351; Lapis 30(7/8):68 (2005) |
| Localities: | Recorded from at least 1 other locality in this region. |
|
|
|
|
| Photo: © Stephan Wolfsried. Cobalttsumcorite from Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany |
| Coffinite | |
|---|
| Formula: | (U4+,Th)(SiO4)1-x(OH)4x |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Conichalcite | |
|---|
| Formula: | CaCu(AsO4)(OH) |
| Localities: | Rappold Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Güldener Falk Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Adam Heber Mine (Shaft 43), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Sauschwart Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Connellite | |
|---|
| Formula: | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Copper | |
|---|
| Formula: | Cu |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
|
| Corkite | |
|---|
| Formula: | PbFe3(PO4)(SO4)(OH)6 |
| Locality: | Waldschacht Mine (Shaft 26), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Cornwallite | |
|---|
| Formula: | Cu5(AsO4)2(OH)4 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Corundum | |
|---|
| Formula: | Al2O3 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Covellite | |
|---|
| Formula: | CuS |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Cryptomelane | |
|---|
| Formula: | K(Mn4+,Mn2+)8O16 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Cuprite | |
|---|
| Formula: | Cu2O |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Cuprosklodowskite | |
|---|
| Formula: | Cu(UO2)2[HSiO4]2 · 6H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Curite | |
|---|
| Formula: | Pb3(UO2)8O8(OH)6 · 3H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Devilline | |
|---|
| Formula: | CaCu4(SO4)2(OH)6 · 3H2O |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Dewindtite | |
|---|
| Formula: | Pb(UO2)3(PO4)2(OH)2 · 3H2O |
| Locality: | Ritter Mine, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Dickite | |
|---|
| Formula: | Al2(Si2O5)(OH)4 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Diopside | |
|---|
| Formula: | CaMgSi2O6 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Djurleite | |
|---|
| Formula: | Cu31S16 |
| Localities: | König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany Bergkappe Mine (Shaft 75), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Schrotschacht Mine, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Dolomite | |
|---|
| Formula: | CaMg(CO3)2 |
| Localities: | Reported from at least 10 localities in this region. |
|
|
|
|
|
|
|
| Dravite | |
|---|
| Formula: | Na(Mg3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Dreyerite | |
|---|
| Formula: | Bi(VO4) |
| Locality: | Güldener Falk Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Duftite | |
|---|
| Formula: | PbCu(AsO4)(OH) |
| Localities: | Priester Mine (Priester und Leviten Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Güldener Falk Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Dussertite | |
|---|
| Formula: | BaFe3+3(AsO4)2(OH)5 |
| Localities: | St Georg Mine, Schneeberg District, Erzgebirge, Saxony, Germany Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Emplectite | |
|---|
| Formula: | CuBiS2 |
| Reference: | No reference listed |
| Localities: | Recorded from at least 1 other locality in this region. |
|
|
|
|
|
|
| Epidote | |
|---|
| Formula: | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Locality: | Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Erythrite (TL) |  |
|---|
| Formula: | Co3(AsO4)2 · 8H2O |
| Type Locality: | Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Wittern: "Mineralfundorte in Deutschland", 2001; Beudant, 1832 |
| Localities: | Recorded from at least 9 other localities in this region. |
|
|
|
|
| Photo: © Van King. Erythrite from Daniel Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Eulytine (TL) |  |
|---|
| Formula: | Bi4(SiO4)3 |
| Type Locality: | Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Lapis 30(7/8):41-70 (2005) |
| Localities: | Recorded from at least 13 other localities in this region. |
|
|
|
|
| Photo: © Christian Rewitzer. Eulytine from Schneeberg District, Erzgebirge, Saxony, Germany |
| Ferberite | |
|---|
| Formula: | FeWO4 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Ferrihydrite | |
|---|
| Formula: | Fe3+5O3(OH)9 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Ferrilotharmeyerite |  |
|---|
| Formula: | Ca(Fe3+,Zn)2(AsO4)2 · 2(OH,H2O) |
| Localities: | Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: © Thomas Witzke. Ferrilotharmeyerite from Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
| Ferro-Actinolite | |
|---|
| Formula: | ☐{Ca2}{Fe2+5}(Si8O22)(OH)2 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Fluorapatite ? | |
|---|
| Formula: | Ca5(PO4)3F |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Fluorite |  |
|---|
| Formula: | CaF2 |
| Localities: | Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: © 1995-2001 Trinity Mineral Co.. Fluorite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Fluor-schorl (TL) | |
|---|
| Formula: | Na(Fe2+3)Al6(Si6O18)(BO3)3(OH)3F |
| Type Locality: | Steinberg, Zschorlau, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Ertl, A., Kolitsch, U., Darby Dyar, M., Meyer, H.-P., Henry, D.J., Rossman, G.R., Prem, M., Ludwig, T., Nasdala, L., Lengauer, C.L., and Tillmanns, E. (2011): CNMNC Newsletter 8, 291 |
|
|
|
|
|
|
| Fourmarierite | |
|---|
| Formula: | Pb(UO2)4O3(OH)4 · 4H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Freibergite | |
|---|
| Formula: | (Ag4+2xCu2-2x)[(Cu, Ag)4(Fe, Zn)2]Sb4S12S1-x (0 < x < 1) |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Fritzscheite | |
|---|
| Formula: | Mn(UO2)2(PO4,VO4)2 · 10H2O (?) |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Galena | |
|---|
| Formula: | PbS |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
|
| Goethite | |
|---|
| Formula: | α-Fe3+O(OH) |
| Localities: | Güldener Falk Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Beust Mine (Beust Shaft; Shaft 24), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Waldschacht Mine (Shaft 26), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Adam Heber Mine (Shaft 43), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Gold | |
|---|
| Formula: | Au |
| Locality: | Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Graphite | |
|---|
| Formula: | C |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Greenockite | |
|---|
| Formula: | CdS |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Grossular | |
|---|
| Formula: | Ca3Al2(SiO4)3 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Grossular var: Hessonite | |
|---|
| Locality: | Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
|
| Guérinite (TL) |  |
|---|
| Formula: | Ca5(AsO4)2(HAsO4)2 · 9H2O |
| Type Locality: | Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Bulletin de Minéralogie 87 (1964), 169; Wittern: "Mineralfundorte in Deutschland", 2001 |
|
|
|
|
|
| Photo: © Thomas Witzke. Guérinite from Schneeberg District, Erzgebirge, Saxony, Germany |
| 'Gummite' | |
|---|
| Localities: | Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Adam Heber Mine (Shaft 43), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
|
| Gypsum | |
|---|
| Formula: | CaSO4 · 2H2O |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Haidingerite | |
|---|
| Formula: | CaHAsO4 · H2O |
| Reference: | Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 709. |
|
|
|
|
|
|
|
| Hammarite | |
|---|
| Formula: | Pb2Cu2Bi4S9 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Hausmannite | |
|---|
| Formula: | MnMn2O4 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Hedenbergite | |
|---|
| Formula: | CaFe2+Si2O6 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Heinrichite | |
|---|
| Formula: | Ba(UO2)2(AsO4)2 · 10H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Hematite |  |
|---|
| Formula: | Fe2O3 |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
| Photo: © M. Adelt. Hematite from Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany |
| Hemimorphite | |
|---|
| Formula: | Zn4Si2O7(OH)2 · H2O |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Heterogenite (TL) |  |
|---|
| Formula: | CoO(OH) |
| Type Locality: | Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | A. Frenzel (1872): Mineralogisches. 5. Heterogenit.- Journal für praktische Chemie [2] 5, 404-407 |
| Localities: | Recorded from at least 1 other locality in this region. |
|
|
|
|
| Photo: © Thomas Witzke. Heterogenite from Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany |
| Hinsdalite | |
|---|
| Formula: | PbAl3(PO4)(SO4)(OH)6 |
| Locality: | Waldschacht Mine (Shaft 26), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| 'Hornblende' | |
|---|
| Locality: | Waldschacht Mine (Shaft 26), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
|
| Hörnesite | |
|---|
| Formula: | Mg3(AsO4)2 · 8H2O |
| Locality: | Siebenschlehen Mine (Shaft 10), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Hübnerite | |
|---|
| Formula: | MnWO4 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Hydroxylapatite var: Carbonate-rich Hydroxylapatite | |
|---|
| Formula: | Ca5(PO4,CO3)3(OH,O) |
| Locality: | Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Ilvaite | |
|---|
| Formula: | CaFe2+2Fe3+(Si2O7)O(OH) |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Jarosite | |
|---|
| Formula: | KFe3+ 3(SO4)2(OH)6 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Johannite | |
|---|
| Formula: | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Kahlerite | |
|---|
| Formula: | Fe(UO2)2(AsO4)2 · 12H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Kaňkite | |
|---|
| Formula: | FeAsO4 · 3.5H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Kaolinite | |
|---|
| Formula: | Al2(Si2O5)(OH)4 |
| Locality: | Waldschacht Mine (Shaft 26), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Kettnerite |  |
|---|
| Formula: | CaBiCO3OF |
| Localities: | Waldschacht Mine (Shaft 26), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Peter und Paul Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: © Thomas Witzke. Kettnerite from Waldschacht Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Koechlinite (TL) |  |
|---|
| Formula: | Bi2MoO6 |
| Type Locality: | Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Journal of the Washington Academy of Science (1914): 4, 354-356; Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 1093; Wittern: "Mineralfundorte in Deutschland", 2001 |
| Localities: | Recorded from at least 2 other localities in this region. |
|
|
|
|
| Photo: © Thomas Witzke. Koechlinite from Adam Heber Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Köttigite (TL) | |
|---|
| Formula: | Zn3(AsO4)2 · 8H2O |
| Type Locality: | Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Köttig, O. (1849): Zinkarseniat (wasserhaltiges) von der Kobaltgrube Daniel bei Schneeberg.- Journal für praktische Chemie 48, 183-186; Can.Min.:14:437(1976); American Mineralogist (1979): 64: 376; Dana 1850; Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 752. |
|
|
|
|
|
|
| Langite | |
|---|
| Formula: | Cu4(SO4)(OH)6 · 2H2O |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Lavendulan | |
|---|
| Formula: | NaCaCu5(AsO4)4Cl · 5H2O |
| Locality: | Sauschwart Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Leadhillite | |
|---|
| Formula: | Pb4(CO3)2(SO4)(OH)2 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Lepidocrocite | |
|---|
| Formula: | γ-Fe3+O(OH) |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Libethenite | |
|---|
| Formula: | Cu2(PO4)(OH) |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Liebigite | |
|---|
| Formula: | Ca2(UO2)(CO3)3 · 11H2O |
| Localities: | Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Fürstenvertrag Mine, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Limonite | |
|---|
| Formula: | FeO(OH) · nH2O |
| Localities: | Güldener Falk Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany Glück Flacher vein, Rödergasse, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Linarite |  |
|---|
| Formula: | PbCu(SO4)(OH)2 |
| Localities: | König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: © D. L.. Linarite from König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany |
| Lithiophorite (TL) | |
|---|
| Formula: | (Al,Li)MnO2(OH)2 |
| Type Locality: | Spitzleithe, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | A. Frenzel: "Lithiophorit, ein lithionhaltiges Manganerz", J. prakt. Chem. 2:203-206 (1870) |
|
|
|
|
|
|
| Löllingite | |
|---|
| Formula: | FeAs2 |
| Locality: | Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Lukrahnite | |
|---|
| Formula: | Ca(Cu,Zn)(Fe3+,Zn)(AsO4)2 · 2(H2O,OH) |
| Locality: | Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Magnesiohornblende | |
|---|
| Formula: | ☐{Ca2}{Mg4Al}(AlSi7O22)(OH)2 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Magnetite | |
|---|
| Formula: | Fe2+Fe3+2O4 |
| Localities: | Fürstenvertrag Mine, Schneeberg District, Erzgebirge, Saxony, Germany Magnet Shaft (Magnet adit), Zschorlau, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Malachite | |
|---|
| Formula: | Cu2(CO3)(OH)2 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Manganite | |
|---|
| Formula: | Mn3+O(OH) |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Marcasite | |
|---|
| Formula: | FeS2 |
| Localities: | Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany Gesellschaft Mine (Gesellschafter Zug Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Sauschwart Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Marcasite var: Lonchidite | |
|---|
| Formula: | Fe(S,As)2 |
| Locality: | Sauschwart Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Margarite | |
|---|
| Formula: | CaAl2(Al2Si2O10)(OH)2 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Matildite | |
|---|
| Formula: | AgBiS2 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Maucherite | |
|---|
| Formula: | Ni11As8 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Mawbyite | |
|---|
| Formula: | Pb(Fe3+,Zn)2(AsO4)2 · 2(OH,H2O) |
| Localities: | Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Melanterite | |
|---|
| Formula: | FeSO4 · 7H2O |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Meta-autunite | |
|---|
| Formula: | Ca(UO2)2(PO4)2 · 6-8H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Metanováčekite | |
|---|
| Formula: | Mg(UO2)2(AsO4)2 · 4-8H2O |
| Locality: | Adam Heber Mine (Shaft 43), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Metarauchite |  |
|---|
| Formula: | Ni(UO2)2(AsO4)2 · 8H2O |
| Locality: | Adam Heber Mine (Shaft 43), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
| Photo: © Leon Hupperichs. Metarauchite from Adam Heber Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Metasaléeite | |
|---|
| Formula: | Mg(UO2)2(PO4)2 · 8H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Metatorbernite (TL) |  |
|---|
| Formula: | Cu(UO2)2(PO4)2 · 8H2O |
| Type Locality: | Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | A.F. Hallimond: Mineral. Mag. 17:333 (1916) |
| Localities: | Recorded from at least 3 other localities in this region. |
|
|
|
|
| Photo: © Thomas Witzke. Metatorbernite from Waldschacht Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Metauranocircite | |
|---|
| Formula: | Ba(UO2)2(PO4)2 · 7H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Metazeunerite (TL) |  |
|---|
| Formula: | Cu(UO2)2(AsO4)2 · 8H2O |
| Type Locality: | Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Geochemist's and Mineralogist's Compendium,(1937) p. 173; Vollstädt et al.: "Micromounts", Leipzig (1988) |
| Localities: | Recorded from at least 2 other localities in this region. |
|
|
|
|
| Photo: © Thomas Witzke. Metazeunerite from Weißer Hirsch Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Miargyrite | |
|---|
| Formula: | AgSbS2 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Microcline | |
|---|
| Formula: | KAlSi3O8 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Millerite | |
|---|
| Formula: | NiS |
| Localities: | Gesellschaft Mine (Gesellschafter Zug Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Mimetite | |
|---|
| Formula: | Pb5(AsO4)3Cl |
| Localities: | Rappold Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Waldschacht Mine (Shaft 26), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Mixite |  |
|---|
| Formula: | BiCu6(AsO4)3(OH)6 · 3H2O |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © Thomas Witzke. Mixite from Sauschwart Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Molybdenite | |
|---|
| Formula: | MoS2 |
| Localities: | Jung Wild Schwein Mine, Schneeberg District, Erzgebirge, Saxony, Germany Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Fürstenvertrag Mine, Schneeberg District, Erzgebirge, Saxony, Germany Neujahr Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Gleesberg Quarry, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Montmorillonite | |
|---|
| Formula: | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Moorhouseite | |
|---|
| Formula: | (Co,Ni,Mn)SO4 · 6H2O |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Mottramite | |
|---|
| Formula: | PbCu(VO4)(OH) |
| Locality: | Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Muscovite | |
|---|
| Formula: | KAl2(AlSi3O10)(OH)2 |
| Locality: | Gleesberg Quarry, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Nacrite | |
|---|
| Formula: | Al2(Si2O5)(OH)4 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Namibite |  |
|---|
| Formula: | Cu(BiO)2(VO4)(OH) |
| Locality: | Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
| Photo: © Thomas Witzke. Namibite from Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
| Natrouranospinite ? | |
|---|
| Formula: | (Na2,Ca)(UO2)2(AsO4)2 · 5H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Neustädtelite (TL) |  |
|---|
| Formula: | Bi3+2Fe3+(Fe3+,Co)2(AsO4)2(OH,O)4 |
| Type Locality: | Güldener Falk Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | W. Krause, H.-J. Bernhardt, C. McCammon & H. Effenberger (2002): Neustädtelite and cobaltneustädtelite, the Fe3+- and Co2+- analogues of medenbachite.- American Mineralogist 87, 726 - 738 |
| Localities: | Recorded from at least 10 other localities in this region. |
|
|
|
|
| Photo: © Stephan Wolfsried. Neustädtelite from Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
| Nickeline |  |
|---|
| Formula: | NiAs |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: Nickeline from Adam Heber Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Nickellotharmeyerite (TL) |  |
|---|
| Formula: | Ca(Ni,Fe3+,Co)2(AsO4)2 · 2(H2O,OH) |
| Type Locality: | Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Neues Jahrb. Mineral. Mon. 558-576 |
| Localities: | Recorded from at least 1 other locality in this region. |
|
|
|
|
| Photo: © Thomas Witzke. Nickellotharmeyerite from Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
| Nickelschneebergite (TL) |  |
|---|
| Formula: | (Bi3+,Ca)(Ni,Co,Fe3+)2(AsO4)2 · 2(OH,H2O) |
| Type Locality: | Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | W. Krause et al. (2002) Eur. J. Mineral. 14, 115-126 |
|
|
|
|
|
| Photo: © Thomas Witzke. Nickelschneebergite from Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany |
| Nickelskutterudite (TL) |  |
|---|
| Formula: | NiAs2-3 |
| Type Locality: | Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Wittern: "Mineralfundorte in Deutschland", 2001 |
| Localities: | Recorded from at least 8 other localities in this region. |
|
|
|
|
| Photo: © Paul Bongaerts. Nickelskutterudite from Siebenschlehen Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Nickelskutterudite var: Chloanthite |  |
|---|
| Formula: | NiAs2 - excess As up to As2.5 |
| Localities: | Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Schindler Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: © Rob Lavinsky. Chloanthite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Nontronite | |
|---|
| Formula: | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Nováčekite-I (TL) | |
|---|
| Formula: | Mg(UO2)2(AsO4)2 · 12H2O |
| Type Locality: | Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Amer.Min.(1951) 36, 680-686 |
|
|
|
|
|
|
| Olivenite | |
|---|
| Formula: | Cu2(AsO4)(OH) |
| Localities: | Rappold Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Schrotschacht Mine, Schneeberg District, Erzgebirge, Saxony, Germany Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany Güldener Falk Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Opal | |
|---|
| Formula: | SiO2 · nH2O |
| Locality: | Waldschacht Mine (Shaft 26), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Orpiment | |
|---|
| Formula: | As2S3 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Orthoclase | |
|---|
| Formula: | KAlSi3O8 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Orthoserpierite | |
|---|
| Formula: | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Pararammelsbergite | |
|---|
| Formula: | NiAs2 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Parasymplesite | |
|---|
| Formula: | Fe2+3(AsO4)2 · 8H2O |
| Locality: | Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Parsonsite |  |
|---|
| Formula: | Pb2(UO2)(PO4)2 · 2H2O |
| Locality: | Waldschacht Mine (Shaft 26), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
| Photo: © Thomas Witzke. Parsonsite from Waldschacht Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Paulkellerite (TL) | |
|---|
| Formula: | (BiO)2Fe3+(PO4)(OH)2 |
| Type Locality: | Neuhilfe Flacher vein, Junge Kalbe Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Amer. Min. (1988) 73, 870-872 and 873-875 |
|
|
|
|
|
|
| Petitjeanite |  |
|---|
| Formula: | Bi3(PO4)2O(OH) |
| Localities: | Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Güldener Falk Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Gesellschaft Mine (Gesellschafter Zug Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: © Leon Hupperichs. Petitjeanite from Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
| Pharmacoalumite | |
|---|
| Formula: | KAl4(AsO4)3(OH)4 · 6.5H2O |
| Locality: | Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Pharmacolite | |
|---|
| Formula: | Ca(HAsO4) · 2H2O |
| Locality: | Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Pharmacosiderite | |
|---|
| Formula: | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| Localities: | Ritter Mine, Schneeberg District, Erzgebirge, Saxony, Germany Adam Heber Mine (Shaft 43), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Phlogopite ? | |
|---|
| Formula: | KMg3(AlSi3O10)(OH,F)2 |
| Locality: | Schindler Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany - erroneously reported |
|
|
|
|
|
|
|
| Phosphuranylite | |
|---|
| Formula: | (H3O)3KCa(UO2)7(PO4)4O4 · 8H2O |
| Locality: | Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Picropharmacolite | |
|---|
| Formula: | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Locality: | Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Pitticite | |
|---|
| Formula: | (Fe, SO4, AsO4, H2O) ? |
| Reference: | Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 1015. |
|
|
|
|
|
|
|
| Plumbogummite | |
|---|
| Formula: | PbAl3(PO4)2(OH)5 · H2O |
| Locality: | Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Plumbojarosite | |
|---|
| Formula: | Pb0.5Fe3+3(SO4)2(OH)6 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Polybasite | |
|---|
| Formula: | [(Ag,Cu)6(Sb,As)2S7][Ag9CuS4] |
| Localities: | Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Priester Mine (Priester und Leviten Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Katharina Flacher vein, Türk Shaft (Shaft 83), Schneeberg District, Erzgebirge, Saxony, Germany Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Posnjakite | |
|---|
| Formula: | Cu4(SO4)(OH)6 · H2O |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Prehnite | |
|---|
| Formula: | Ca2Al2Si3O12(OH) |
| Locality: | Waldschacht Mine (Shaft 26), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Preisingerite |  |
|---|
| Formula: | Bi3(AsO4)2O(OH) |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
| Photo: © Thomas Witzke. Preisingerite from Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
| Proustite |  |
|---|
| Formula: | Ag3AsS3 |
| Localities: | Reported from at least 11 localities in this region. |
|
|
|
|
|
|
| Photo: © fabreminerals.com. Proustite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Pseudomalachite | |
|---|
| Formula: | Cu5(PO4)2(OH)4 |
| Localities: | Schrotschacht Mine, Schneeberg District, Erzgebirge, Saxony, Germany Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Pucherite (TL) |  |
|---|
| Formula: | Bi(VO4) |
| Type Locality: | Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | A. Frenzel (1871): Mineralogisches. 1. Pucherit.- Journal für praktische Chemie 4, 227-231; Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 1051. |
| Localities: | Recorded from at least 6 other localities in this region. |
|
|
|
|
| Photo: © Stephan Wolfsried. Pucherite from Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
| Pyrargyrite |  |
|---|
| Formula: | Ag3SbS3 |
| Localities: | Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Priester Mine (Priester und Leviten Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Sauschwart Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Katharina Flacher vein, Türk Shaft (Shaft 83), Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: © . Pyrargyrite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Pyrite | |
|---|
| Formula: | FeS2 |
| Localities: | Reported from at least 13 localities in this region. |
|
|
|
|
|
|
|
| Pyrolusite | |
|---|
| Formula: | MnO2 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Pyromorphite |  |
|---|
| Formula: | Pb5(PO4)3Cl |
| Localities: | Reported from at least 7 localities in this region. |
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Pyromorphite from Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
| 'Pyromorphite Subgroup' | |
|---|
| Localities: | Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Güldener Falk Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
|
| Pyrophyllite | |
|---|
| Formula: | Al2(Si4O10)(OH)2 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Pyrostilpnite | |
|---|
| Formula: | Ag3SbS3 |
| Locality: | Katharina Flacher vein, Türk Shaft (Shaft 83), Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Pyrrhotite |  |
|---|
| Formula: | Fe1-xS (x = 0 to 0.17) |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
| Photo: © Weinrich Minerals, Inc.. Pyrrhotite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Quartz | |
|---|
| Formula: | SiO2 |
| Localities: | Reported from at least 24 localities in this region. |
|
|
|
|
|
|
|
| Quartz var: Agate | |
|---|
| Formula: | SiO2 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Quartz var: Amethyst | |
|---|
| Formula: | SiO2 |
| Locality: | Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Quartz var: Chalcedony | |
|---|
| Reference: | Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 281. |
| Localities: | Recorded from at least 5 other localities in this region. |
|
|
|
|
|
|
|
| Quartz var: Citrine ? | |
|---|
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
|
| Quartz var: Eisenkiesel | |
|---|
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
|
| Quartz var: Jasper | |
|---|
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
|
| Quartz var: Milky Quartz | |
|---|
| Locality: | Neujahr Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
|
| Quartz var: Rock Crystal | |
|---|
| Locality: | Gleesberg Quarry, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
|
| Quartz var: Rose Quartz ? | |
|---|
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
|
| Quartz var: Smoky Quartz | |
|---|
| Formula: | SiO2 |
| Localities: | Neujahr Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Alexander Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Glück Flacher vein, Rödergasse, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Rammelsbergite (TL) |  |
|---|
| Formula: | NiAs2 |
| Type Locality: | Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Haidinger W (1845) Zweite Klasse: Geogenide. XIII. Ordnung. Kiese III. Kobaltkies. Rammelsbergit. in Handbuch der Bestimmenden Mineralogie Bei Braumüller and Seidel Wien 559-562 |
| Localities: | Recorded from at least 3 other localities in this region. |
|
|
|
|
| Photo: © . Rammelsbergite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Rappoldite (TL) |  |
|---|
| Formula: | Pb(Co,Ni,Zn)2(AsO4)2 · 2H2O |
| Type Locality: | Rappold Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | [MinRec 32:418] |
|
|
|
|
|
| Photo: © Stephan Wolfsried. Rappoldite from Rappold Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Rauenthalite | |
|---|
| Formula: | Ca3(AsO4)2 · 10H2O |
| Locality: | Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Realgar | |
|---|
| Formula: | As4S4 |
| Localities: | Segen Gottes Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Beust Mine (Beust Shaft; Shaft 24), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Rhabdophane-(Nd) | |
|---|
| Formula: | (Nd,Ce,La)(PO4) · H2O |
| Locality: | Glück Flacher vein, Rödergasse, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Rhodochrosite | |
|---|
| Formula: | MnCO3 |
| Locality: | Adam Heber Mine (Shaft 43), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Richelsdorfite | |
|---|
| Formula: | Ca2Cu5Sb(AsO4)4(OH)6Cl · 6H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Romanèchite |  |
|---|
| Formula: | (Ba,H2O)2Mn5O10 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
| Photo: © Christopher O'Neill. Romanèchite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Rooseveltite | |
|---|
| Formula: | Bi(AsO4) |
| Locality: | Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Rosasite | |
|---|
| Formula: | (Cu,Zn)2(CO3)(OH)2 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Roselite (TL) |  |
|---|
| Formula: | Ca2(Co2+,Mg)(AsO4)2 · 2H2O |
| Type Locality: | Rappold Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 725; Wittern: "Mineralfundorte in Deutschland", 2001 |
| Localities: | Recorded from at least 5 other localities in this region. |
|
|
|
|
| Photo: © Edward Rosenzweig. Roselite from Rappold Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Rösslerite | |
|---|
| Formula: | Mg(HAsO4) · 7H2O |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Rösslerite var: Wapplerite | |
|---|
| Localities: | Sauschwart Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Eiserner Landgraf Mine, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
|
| Rozenite | |
|---|
| Formula: | FeSO4 · 4H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Russellite |  |
|---|
| Formula: | Bi2WO6 |
| Locality: | Wolfsgrün Quarry, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
| Photo: Russellite from Wolfsgrün Quarry, Schneeberg District, Erzgebirge, Saxony, Germany |
| Rutherfordine | |
|---|
| Formula: | (UO2)CO3 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Safflorite (TL) |  |
|---|
| Formula: | (Co,Fe,Ni)As2 |
| Type Locality: | Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | A. Breithaupt (1817): Strahliger Weisser Speiskobold.- C.A.S. Hoffmann´s Handbuch der Mineralogie, Vol. 4.1.- Freiberg, Verl. Craz & Gerlach, p. 181-182 |
| Localities: | Recorded from at least 6 other localities in this region. |
|
|
|
|
| Photo: © 2008 Jesse Crawford. Safflorite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Sainfeldite | |
|---|
| Formula: | CaCa2Ca2(AsO4)2(HAsO4)2 · 4H2O |
| Locality: | Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Saléeite (TL) |  |
|---|
| Formula: | Mg(UO2)2(PO4)2 · 10H2O |
| Type Locality: | Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Mrose (1950) American Mineralogist: 35: 525. |
| Localities: | Recorded from at least 1 other locality in this region. |
|
|
|
|
| Photo: © Leon Hupperichs. Saléeite from Weißer Hirsch Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Schapbachite ? | |
|---|
| Formula: | AgBiS2 |
| Description: | might be a pseudo-cubic paramorph after matildite |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
| Scheelite | |
|---|
| Formula: | Ca(WO4) |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Schlegelite (TL) | |
|---|
| Formula: | Bi7(AsO4)3(MoO4)2O4 |
| Type Locality: | Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
| Habit: | Spherical aggregates (1 mm) composed of small orthorhombic lath-like crystals |
| Colour: | Yellow |
| Reference: | Krause, K., Bernhardt, H.-J., Effenberger, H. (2006): Schlegelite, Bi7O4(MoO4)2(AsO4)3, a new mineral from Schneeberg, Saxony, Germany. European Journal of Mineralogy, 18, 803-811; Acta Cryst. (2004), A60, p. 192 |
|
|
|
|
| Schneebergite (TL) |  |
|---|
| Formula: | (Bi3+,Ca)(Co,Ni,Fe3+)2(AsO4)2 · 2(OH,H2O) |
| Type Locality: | Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | W. Krause et al. (2002) Eur. J. Mineral. 14, 115-126 |
|
|
|
|
|
| Photo: © Thomas Witzke. Schneebergite from Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany |
| Schoepite | |
|---|
| Formula: | (UO2)8O2(OH)12 · 12H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Schorl | |
|---|
| Formula: | Na(Fe2+3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Schumacherite (TL) |  |
|---|
| Formula: | Bi3(VO4)2O(OH) |
| Type Locality: | Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | Tscherm.Min.Petr.Mitt.(1983) 31, 165-173; Wittern: "Mineralfundorte in Deutschland", 2001 |
| Localities: | Recorded from at least 3 other localities in this region. |
|
|
|
|
| Photo: © 2004 JBS. Schumacherite from Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
| Scorodite |  |
|---|
| Formula: | FeAsO4 · 2H2O |
| Localities: | Reported from at least 8 localities in this region. |
|
|
|
|
|
|
| Photo: © Thomas Uhlig. Scorodite from Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany |
| Segnitite | |
|---|
| Formula: | PbFe3+3(AsO4)2(OH,H2O)6 |
| Reference: | Wittern: "Mineralfundorte in Deutschland", 2001 |
|
|
|
|
|
|
|
| Sepiolite | |
|---|
| Formula: | Mg4(Si6O15)(OH)2 · 6H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Serpierite | |
|---|
| Formula: | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Siderite | |
|---|
| Formula: | FeCO3 |
| Locality: | Fürstenvertrag Mine, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Sillénite |  |
|---|
| Formula: | Bi12SiO20 |
| Localities: | Junge Kalbe Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Sauschwart Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Güldener Falk Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: © Thomas Witzke. Sillénite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Silver |  |
|---|
| Formula: | Ag |
| Localities: | Reported from at least 11 localities in this region. |
|
|
|
|
|
|
| Photo: © Thomas Witzke. Silver from Schneeberg District, Erzgebirge, Saxony, Germany |
| Skutterudite |  |
|---|
| Formula: | (Co,Fe,Ni)As2-3 |
| Localities: | Reported from at least 9 localities in this region. |
|
|
|
|
|
|
| Photo: © Kiyoshi Kiikuni. Skutterudite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Smolianinovite | |
|---|
| Formula: | (Co,Ni,Mg,Ca)3(Fe3+,Al)2(AsO4)4 · 11H2O |
| Reference: | Min. Mag. 41, 385-388(1977) |
|
|
|
|
|
|
|
| Spessartine | |
|---|
| Formula: | Mn2+3Al2(SiO4)3 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Sphalerite | |
|---|
| Formula: | ZnS |
| Localities: | Türk Shaft (Shaft 83), Schneeberg District, Erzgebirge, Saxony, Germany Fürstenvertrag Mine, Schneeberg District, Erzgebirge, Saxony, Germany Priester Mine (Priester und Leviten Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Katharina Flacher vein, Türk Shaft (Shaft 83), Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Spherocobaltite (TL) |  |
|---|
| Formula: | CoCO3 |
| Type Locality: | Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | [Jahrb. Berg- und Hüttenwesen, Abh.(1877) p. 53; Clark, 1993 - "Hey's Mineral Index"] |
| Localities: | Recorded from at least 1 other locality in this region. |
|
|
|
|
| Photo: © Paul De Bondt. Spherocobaltite from Daniel Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Stephanite |  |
|---|
| Formula: | Ag5SbS4 |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
| Photo: © 2001 John H. Betts. Stephanite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Sternbergite | |
|---|
| Formula: | AgFe2S3 |
| Localities: | Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Sauschwart Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Stibnite ? | |
|---|
| Formula: | Sb2S3 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Stilpnomelane | |
|---|
| Formula: | (K,Ca,Na)(Fe2+,Mg,Al,Fe3+)8(Si,Al)12(O,OH)36 · nH2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Sylvanite |  |
|---|
| Formula: | (Au,Ag)2Te4 |
| Locality: | Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
| Photo: © Rob Lavinsky. Sylvanite from Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany |
| Symplesite ? | |
|---|
| Formula: | Fe2+3(AsO4)2 · 8H2O |
| Description: | could never be confirmed in contemporary analyses |
| Reference: | Lapis 30(7/8):41-70 (2005) |
| Localities: | Recorded from at least 1 other locality in this region. |
|
|
|
|
|
| Talc | |
|---|
| Formula: | Mg3(Si4O10)(OH)2 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Talmessite | |
|---|
| Formula: | Ca2Mg(AsO4)2 · 2H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Tennantite | |
|---|
| Formula: | (Cu,Ag,Fe,Zn)12As4S13 |
| Localities: | König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany Katharina Flacher vein, Türk Shaft (Shaft 83), Schneeberg District, Erzgebirge, Saxony, Germany Sauschwart Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Rappold Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Bergkappe Mine (Shaft 75), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Tenorite | |
|---|
| Formula: | CuO |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Tetrahedrite | |
|---|
| Formula: | (Cu,Fe,Ag,Zn)12Sb4S13 |
| Locality: | König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Titanite | |
|---|
| Formula: | CaTi(SiO4)O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Topaz | |
|---|
| Formula: | Al2(SiO4)(F,OH)2 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Torbernite |  |
|---|
| Formula: | Cu(UO2)2(PO4)2 · 12H2O |
| Localities: | Waldschacht Mine (Shaft 26), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Schrotschacht Mine, Schneeberg District, Erzgebirge, Saxony, Germany Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Glück Flacher vein, Rödergasse, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: © Peter Haas. Torbernite from Glück Flacher vein, Rödergasse, Schneeberg District, Erzgebirge, Saxony, Germany |
| 'Tourmaline' | |
|---|
| Formula: | A(D3)G6(T6O18)(BO3)3X3Z |
| Localities: | Türk Shaft (Shaft 83), Schneeberg District, Erzgebirge, Saxony, Germany Zschorlau Mine (Zschorlauer Bergsegen Mine; Dodos Glück Mine), Zschorlau, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Tremolite | |
|---|
| Formula: | ☐{Ca2}{Mg5}(Si8O22)(OH)2 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Trögerite (TL) |  |
|---|
| Formula: | (UO2)3(AsO4)2 · 12H2O (?) |
| Type Locality: | Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | A. Weisbach (1871): Vorläufige Mittheilung [Über Trögerit und Walpurgin].- Neues Jahrbuch für Mineralogie, Geologie und Paläontologie, 869-870; Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 967, 991. |
| Localities: | Recorded from at least 2 other localities in this region. |
|
|
|
|
| Photo: © Stephan Wolfsried. Trögerite from Walpurgis Flacher vein, Weißer Hirsch Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Tungstite | |
|---|
| Formula: | WO3 · H2O |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Turquoise | |
|---|
| Formula: | Cu(Al,Fe3+)6(PO4)4(OH)8 · 4H2O |
| Locality: | Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Tyrolite | |
|---|
| Formula: | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Localities: | König David Mine, Schneeberg District, Erzgebirge, Saxony, Germany Daniel Mine (St. Daniel Mine), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| Uraninite | |
|---|
| Formula: | UO2 |
| Localities: | Reported from at least 10 localities in this region. |
|
|
|
|
|
|
|
| Uranocircite | |
|---|
| Formula: | Ba(UO2)2(PO4)2 · 10H2O |
| Localities: | Waldschacht Mine (Shaft 26), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Glück Flacher vein, Rödergasse, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
|
| 'Uranocker' | |
|---|
| Locality: | Glück Flacher vein, Rödergasse, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
|
| Uranophane |  |
|---|
| Formula: | Ca(UO2)2[HSiO4]2 · 5H2O |
| Locality: | Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
| Photo: © Tamás Ungvári 2010. Uranophane from Weißer Hirsch Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Uranopilite | |
|---|
| Formula: | (UO2)6(SO4)O2(OH)6 · 14H2O |
| Locality: | Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Uranospathite | |
|---|
| Formula: | (Al,☐)(UO2)2(PO4)2F · 20(H2O,F) |
| Locality: | Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
| Uranosphaerite (TL) |  |
|---|
| Formula: | Bi(UO2)O2(OH) |
| Type Locality: | Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | A. Weisbach (1873): Neue Uranerze von Neustädtel bei Schneeberg.- Jahrbuch für das Berg- und Hüttenwesen im Königreiche Sachsen, Abhandlungen, 119-121; Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 967. |
|
|
|
|
|
| Photo: © Thomas Witzke. Uranosphaerite from Walpurgis Flacher vein, Weißer Hirsch Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Uranospinite (TL) | |
|---|
| Formula: | Ca(UO2)(AsO4)2 · 10H2O |
| Type Locality: | Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | A. Weisbach (1873): Neue Uranerze von Neustädtel bei Schneeberg.- Jahrbuch für das Berg- und Hüttenwesen im Königreiche Sachsen, Abhandlungen, 119-121; Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 967, 991. |
|
|
|
|
|
|
| Vaesite | |
|---|
| Formula: | NiS2 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Vesuvianite | |
|---|
| Formula: | (Ca,Na,☐)19(Al,Mg,Fe3+)13(☐,B,Al,Fe3+)5(Si2O7)4(SiO4)10(OH,F,O)10 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| 'Wad var: Cobaltian Wad' | |
|---|
| Locality: | Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
|
| Wagnerite ? | |
|---|
| Formula: | (Mg,Fe2+)2(PO4)F |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Walpurgite (TL) |  |
|---|
| Formula: | (BiO)4(UO2)(AsO4)2 · 3H2O |
| Type Locality: | Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | A. Weisbach (1871): Vorläufige Mittheilung [Über Trögerit und Walpurgin].- Neues Jahrbuch für Mineralogie, Geologie und Paläontologie, 869-870; Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 797, 967, 991. |
| Localities: | Recorded from at least 9 other localities in this region. |
|
|
|
|
| Photo: © Thomas Witzke. Walpurgite from Walpurgis Flacher vein, Weißer Hirsch Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Waylandite |  |
|---|
| Formula: | BiAl3(PO4)2(OH)6 |
| Localities: | Pucher Shaft, Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany Waldschacht Mine (Shaft 26), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: © Stephan Wolfsried. Waylandite from Roter Berg District, Schneeberg District, Erzgebirge, Saxony, Germany |
| Weilite (TL) | |
|---|
| Formula: | Ca(HAsO4) |
| Type Locality: | Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | P. Herpin & R. Pierrot (1963): La weilite, CaH(AsO4), un nouvel arseniate de calcium isomorphe de la monetite.- Bull. Soc. franc. Miner. Crist. 86, 368-372 |
| Localities: | Recorded from at least 1 other locality in this region. |
|
|
|
|
|
| Wendwilsonite |  |
|---|
| Formula: | Ca2(Mg,Co2+)(AsO4)2 · 2H2O |
| Reference: | J. Gröbner und U. Kolitsch (2005), Lapis 30 (7-8), 71-73; 81-82; Kolitsch & Fleck (2006), European Journal of Mineralogy, 18, 471-482. |
|
|
|
|
|
|
| Photo: © P. Lunzer. Wendwilsonite from Schneeberg District, Erzgebirge, Saxony, Germany |
| Willemite | |
|---|
| Formula: | Zn2SiO4 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Wolframite | |
|---|
| Formula: | (Fe2+)WO4 to (Mn2+)WO4 |
| Reference: | Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 1069. |
| Localities: | Recorded from at least 1 other locality in this region. |
|
|
|
|
|
|
| Wollastonite | |
|---|
| Formula: | CaSiO3 |
| Reference: | No reference listed |
|
|
|
|
|
|
|
| Woodwardite | |
|---|
| Formula: | Cu4Al2(SO4)(OH)12 · 2-4H2O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Wulfenite | |
|---|
| Formula: | Pb(MoO4) |
| Localities: | Reported from at least 6 localities in this region. |
|
|
|
|
|
|
|
| Wurtzite | |
|---|
| Formula: | (Zn,Fe)S |
| Reference: | Wittern: "Mineralfundorte in Deutschland", 2001 |
|
|
|
|
|
|
|
| Xanthoconite |  |
|---|
| Formula: | Ag3AsS3 |
| Localities: | Türk Shaft (Shaft 83), Schneeberg District, Erzgebirge, Saxony, Germany Wolfgang Maaßen Mine field, Schneeberg District, Erzgebirge, Saxony, Germany Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany Magnet Shaft (Magnet adit), Zschorlau, Schneeberg District, Erzgebirge, Saxony, Germany
|
|
|
|
|
|
|
| Photo: Xanthoconite from Magnet Shaft, Zschorlau, Schneeberg District, Erzgebirge, Saxony, Germany |
| Zeunerite (TL) |  |
|---|
| Formula: | Cu(UO2)2(AsO4)2 · 12H2O |
| Type Locality: | Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Reference: | A. Weisbach (1872) Neues Jahrbuch für Mineralogie, 206-208; Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 967, 991. |
| Localities: | Recorded from at least 5 other localities in this region. |
|
|
|
|
| Photo: © Stephan Wolfsried. Zeunerite from Walpurgis Flacher vein, Weißer Hirsch Mine, Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
| Zincite | |
|---|
| Formula: | (Zn,Mn2+,Fe2+)O |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Zinnwaldite | |
|---|
| Formula: | KLiFe2+Al(AlSi3O10)(F,OH)2 |
| Reference: | Lapis 30(7/8):78-80 (2005) |
|
|
|
|
|
|
|
| Zippeite | |
|---|
| Formula: | K4(UO2)6(SO4)3(OH)10 · 4H2O |
| Locality: | Walpurgis Flacher vein, Weißer Hirsch Mine (Shaft 3), Neustädtel, Schneeberg District, Erzgebirge, Saxony, Germany |
|
|
|
|
|
|
|
330 entries listed. 299 valid minerals. 43 type localities (valid minerals).
- Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 1015, 1069.
- Bode, R. (1982): Die Mineralien Schneebergs. Emser Hefte 4 (1), 38-71. (in German)
- Flach, S. (1982): Der Bergbau von Schneeberg. Emser Hefte 4 (1), 15-31. (in German)
- Schlegel, F., Schumann, K. & Siemroth, J. (1991): Seltene Phosphatminerale von Schneeberg im Erzgebirge. - Lapis, 16 (6), 40-43. (in German)
- Schlegel, F., Schumann, K. & Siemroth, J. (1992): Haldenfunde sekundärer Wismutminerale von Schneeberg im Erzgebirge. Lapis 17 (11), 29-36; 50. (in German)
- Schlegel, F. (2000): Neufunde aus dem Bergrevier Schneeberg/Sachsen, 1995-99 (I). Lapis 25 (2), 31-38; 50. (in German)
- Schlegel, F. (2002): Neufunde und Neubestimmungen aus dem Bergrevier Schneeberg/Sachsen, 1990–2002 (II). Lapis 27 (7-8), 67-72. (in German)
- Stefan Weiß (2002): Neue Mineralien: aus Schneeberg/Sachsen. Lapis 27 (7-8), 73-76. (in German)
- Herrmann, S. (2005): Geologie, Erzgänge und Mineralisation der Lagerstätte Schneeberg/Sachsen. Lapis 30 (7-8), 30-40. (in German)
- Lahl, B. (2005): Von 1470 bis 1956: Der Schneeberger Bergbau. Lapis 30 (7-8), 13-21. (in German)
- Massanek, A. & Michalski, S. (2005): Die Mineralien des Schneeberger Reviers. Lapis 30 (7-8), 41-66. (in German)
- J. Gröbner und U. Kolitsch (2005): Neufunde aus dem Bergrevier Schneeberg im Erzgebirge. Lapis 30 (7-8), 71-73; 81-82. (in German)
- Kolitsch, U. & Fleck, M. (2006): Third update on compounds with kröhnkite-type chains: the crystal structure of wendwilsonite [Ca2Mg(AsO4)2·2H2O] and the new triclinic structure types of AgSc(CrO4)2·2H2O and M2Cu(Cr2O7)2·2H2O (M = Rb, Cs). European Journal of Mineralogy, 18, 471-482.