Laochang ore field (Laochang Mine), Gejiu Sn-polymetallic ore field, Gejiu City, Honghe, Yunnan, Chinai
| Regional Level Types | |
|---|---|
| Laochang ore field (Laochang Mine) | Ore Field |
| Gejiu Sn-polymetallic ore field | Ore Field |
| Gejiu City | County |
| Honghe | Prefecture |
| Yunnan | Province |
| China | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
23° 11' 58'' North , 103° 17' 4'' East
Latitude & Longitude (decimal):
Type:
KΓΆppen climate type:
Mindat Locality ID:
155491
Long-form identifier:
mindat:1:2:155491:8
GUID (UUID V4):
9ad9db05-e42f-4cf3-8fdc-ca37f2414f22
Name(s) in local language(s):
θει‘ηΏη° (θει‘ηΏ), δΈͺζ§ι‘ε€ιε±ηΏη°, δΈͺζ§εΈ, ηΊ’ζ²³εε°Όζε½ζθͺζ²»ε·, δΊεη, δΈε½
Hydrothermal Sn-Be vein-type deposits.
Located about 11 km SE of Gejiu City.
In the Laochang deposit, many mineralization types have been discovered, such as: altered rock-type, skarn-type, greisen-type, tourmaline vein-type, basalt-type and interlayer sulfide and/or oxide-type mineralization.
Veszelyite labeled as from Gejiu City or from Laochang are in fact from the former Kafang open pit.
A Geologist from Nanjing University wrote: Gejiu Sn ore field produces Veszelyite and it comes from Kafang deposit in the south, not Laochang. Gejiu is the largest Sn ore field in the world and it comprises 5 major deposits from north to south and can be further divided into several dozens of ore segments. It is so complicate there that they have several mining companies to explore at the same time. Laochang is the largest Sn deposit in the middle and Kafang is the second largest in the south. Open pit mining in Gejiu has ended many years ago and currently all mining activities are working underground. Veszelyit on market from Gejiu is most likely produced from the abandoned open pit besides the Kafang town. It is now filled with water.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities27 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| β 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| β Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| β Arsenopyrite Formula: FeAsS Localities: References: |
| β Beryl Formula: Be3Al2(Si6O18) |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β Bismuthinite Formula: Bi2S3 |
| β Calcite Formula: CaCO3 Localities: |
| β Cassiterite Formula: SnO2 Localities: |
| β Chalcopyrite Formula: CuFeS2 Localities: References: |
| β 'Chlorite Group' |
| β Cuprozheshengite (TL) Formula: Pb4CuZn2(AsO4)2(PO4)2(OH)2 Type Locality: |
| β Diopside Formula: CaMgSi2O6 |
| β Dolomite Formula: CaMg(CO3)2 Localities: |
| β Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β 'Feldspar Group' Localities: |
| β 'Feldspar Group var. Perthite' |
| β Fluorite Formula: CaF2 Localities: |
| β Galena Formula: PbS References: |
| β 'Garnet Group' Formula: X3Z2(SiO4)3 |
| β Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O References: |
| β 'K Feldspar' |
| β Kipushite Formula: (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| β 'Lepidolite' |
| β Microcline Formula: K(AlSi3O8) |
| β 'Monazite' Formula: REE(PO4) |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| β 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| β Pyrite Formula: FeS2 Localities: References: |
| β Pyrrhotite Formula: Fe1-xS Localities: References: |
| β Quartz Formula: SiO2 Localities: References: |
| β Scheelite Formula: Ca(WO4) Localities: |
| β Siderite Formula: FeCO3 |
| β Sphalerite Formula: ZnS Localities: |
| β Theisite Formula: Cu5Zn5(AsO4,SbO4)2(OH)14 Habit: bluish green rosettes Description: EDS analysis Association Jean Wyart - Paris References: |
| β Titanite Formula: CaTi(SiO4)O |
| β 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: References: |
| β Veszelyite Formula: (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O Colour: Deep blue Description: Originally sold as coming from Wenshan [Rock Currier specimens (Jewel Tunnel Imports) and other dealers, Denver show, 2008], later info showed that the veszelyite came from the Laochang ore field (Laochang mine), Gejiu county, Yunnan (http://www.mindat.org/mesg-17-108922.html) |
| β 'Wolframite Group' Localities: |
| β Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Sphalerite | 2.CB.05a | ZnS |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | Galena | 2.CD.10 | PbS |
| β | Bismuthinite | 2.DB.05 | Bi2S3 |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Quartz | 4.DA.05 | SiO2 |
| β | Cassiterite | 4.DB.05 | SnO2 |
| β | 'Wolframite Group' | 4.DB.30 va | |
| Group 5 - Nitrates and Carbonates | |||
| β | Siderite | 5.AB.05 | FeCO3 |
| β | Calcite | 5.AB.05 | CaCO3 |
| β | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Theisite | 8.BE.75 | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| β | Cuprozheshengite (TL) | 8.BH. | Pb4CuZn2(AsO4)2(PO4)2(OH)2 |
| β | Kipushite | 8.DE. | (Cu,Zn)5Zn(PO4)2(OH)6 Β· H2O |
| β | Veszelyite | 8.DE.30 | (Cu,Zn)2Zn(PO4)(OH)3 Β· 2H2O |
| Group 9 - Silicates | |||
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 Β· H2O |
| β | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Diopside | 9.DA.15 | CaMgSi2O6 |
| β | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| β | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 Β· 2.5-3H2O |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| β | 'Monazite' | - | REE(PO4) |
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| β | 'Lepidolite' | - | |
| β | 'Feldspar Group' | - | |
| β | 'var. Perthite' | - | |
| β | 'Chlorite Group' | - | |
| β | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| β | 'K Feldspar' | - | |
| β | 'Garnet Group' | - | X3Z2(SiO4)3 |
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | β Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| H | β Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| H | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| H | β Cuprozheshengite | Pb4CuZn2(AsO4)2(PO4)2(OH)2 |
| Be | Beryllium | |
| Be | β Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | β Calcite | CaCO3 |
| C | β Dolomite | CaMg(CO3)2 |
| C | β Siderite | FeCO3 |
| O | Oxygen | |
| O | β Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Calcite | CaCO3 |
| O | β Cassiterite | SnO2 |
| O | β Diopside | CaMgSi2O6 |
| O | β Dolomite | CaMg(CO3)2 |
| O | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | β Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| O | β Microcline | K(AlSi3O8) |
| O | β Monazite | REE(PO4) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Quartz | SiO2 |
| O | β Scheelite | Ca(WO4) |
| O | β Siderite | FeCO3 |
| O | β Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| O | β Titanite | CaTi(SiO4)O |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| O | β Zircon | Zr(SiO4) |
| O | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | β Garnet Group | X3Z2(SiO4)3 |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | β Cuprozheshengite | Pb4CuZn2(AsO4)2(PO4)2(OH)2 |
| F | Fluorine | |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β Fluorite | CaF2 |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | β Diopside | CaMgSi2O6 |
| Mg | β Dolomite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | β Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | β Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Diopside | CaMgSi2O6 |
| Si | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Zircon | Zr(SiO4) |
| Si | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | β Garnet Group | X3Z2(SiO4)3 |
| Si | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | β Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| P | β Monazite | REE(PO4) |
| P | β Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | β Cuprozheshengite | Pb4CuZn2(AsO4)2(PO4)2(OH)2 |
| S | Sulfur | |
| S | β Arsenopyrite | FeAsS |
| S | β Bismuthinite | Bi2S3 |
| S | β Chalcopyrite | CuFeS2 |
| S | β Galena | PbS |
| S | β Pyrite | FeS2 |
| S | β Pyrrhotite | Fe1-xS |
| S | β Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Calcite | CaCO3 |
| Ca | β Diopside | CaMgSi2O6 |
| Ca | β Dolomite | CaMg(CO3)2 |
| Ca | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | β Fluorite | CaF2 |
| Ca | β Scheelite | Ca(WO4) |
| Ca | β Titanite | CaTi(SiO4)O |
| Ca | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | β Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | β Arsenopyrite | FeAsS |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | β Pyrite | FeS2 |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Siderite | FeCO3 |
| Cu | Copper | |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| Cu | β Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| Cu | β Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| Cu | β Cuprozheshengite | Pb4CuZn2(AsO4)2(PO4)2(OH)2 |
| Zn | Zinc | |
| Zn | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | β Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| Zn | β Sphalerite | ZnS |
| Zn | β Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| Zn | β Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| Zn | β Cuprozheshengite | Pb4CuZn2(AsO4)2(PO4)2(OH)2 |
| As | Arsenic | |
| As | β Arsenopyrite | FeAsS |
| As | β Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| As | β Cuprozheshengite | Pb4CuZn2(AsO4)2(PO4)2(OH)2 |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Sn | Tin | |
| Sn | β Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | β Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| W | Tungsten | |
| W | β Scheelite | Ca(WO4) |
| Pb | Lead | |
| Pb | β Galena | PbS |
| Pb | β Cuprozheshengite | Pb4CuZn2(AsO4)2(PO4)2(OH)2 |
| Bi | Bismuth | |
| Bi | β Bismuthinite | Bi2S3 |
Localities in this Region
- Yunnan
- Honghe
- Gejiu City
- Gejiu Sn-polymetallic ore field
- Laochang ore field (Laochang Mine)
- Gejiu Sn-polymetallic ore field
- Gejiu City
- Honghe
Other Regions, Features and Areas containing this locality
AsiaContinent
China
- Giant Sb metallogenic beltMineral Belt
- ⭔Southwest ChinaRegion
Eurasian PlateTectonic Plate
- Nanpanjiang BasinBasin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Laochang ore field, Gejiu Sn-polymetallic ore field, Gejiu City, Honghe, Yunnan, China