Franklin Mine, Franklin, Sussex County, New Jersey, USAi
| Regional Level Types | |
|---|---|
| Franklin Mine | Mine |
| Franklin | Borough |
| Sussex County | County |
| New Jersey | State |
| USA | Country |
This page kindly sponsored by Mark Kucera
Latitude & Longitude (WGS84):
41° 6' 56'' North , 74° 35' 15'' West
Latitude & Longitude (decimal):
Type:
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Franklin | 4,855 (2017) | 0.9km |
| Ogdensburg | 2,286 (2017) | 3.8km |
| Hamburg | 3,155 (2017) | 4.3km |
| Sparta | 19,722 (2018) | 10.1km |
| Sussex | 2,043 (2017) | 10.6km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Morris Museum Mineralogical Society | Morristown, New Jersey | 37km |
| Orange County Mineral Society | Middletown, New York | 39km |
| North Jersey Mineralogical Society, Inc. | Paterson, New Jersey | 41km |
Mindat Locality ID:
8541
Long-form identifier:
mindat:1:2:8541:3
GUID (UUID V4):
f2c1c61c-f9ff-4605-9762-f0cfc4386b94
This is the consolidated property (circa 1898) on the Franklin orebody, formerly owned by the New Jersey Zinc Co. The coordinates are for a central portion of the mine complex.
Individual named pits and shafts are nearby. It incorporated all earlier workings.
This mine was served initially by the Parker shaft, which soon proved inadequate to handle the mine's output. The Palmer shaft subsequently replaced it with a larger mill and served the mine until its closure in the mid-1950s.
This mine reached a depth of 1,150 feet (350.52 m).
This locality is within the Franklin Mining District.
The complete list of mineral species occurring within this district, as well as the official boundaries of the district, can be found under the locality file for "Franklin Mining District."
Those who share an interest in the unique mineralogy of the Franklin, NJ, area owe a special debt of thanks to mineralogists, past and present, Samuel L. Penfield, Yale University, Charles Palache, Harvard University, Clifford Frondel, Harvard University, Paulus (Paul) Brian Moore (the University of Chicago, retired), Peter Leavens, University of Delaware, retired, Pete J. Dunn, (National Museum of Natural History, Smithsonian Institution, retired), Charles B. Sclar, Lehigh University, and John L. Baum, Curator Emeritus, Franklin Mineral Museum, and former Head Geologist, New Jersey, Zinc Co., Franklin, NJ, for their significant contributions to the body of knowledge of the history, geology, and mineralogy of this district.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities246 valid minerals. 50 (TL) - type locality of valid minerals. 6 (FRL) - first recorded locality of unapproved mineral/variety/etc. 6 erroneous literature entries.
Detailed Mineral List:
| β Acanthite Formula: Ag2S References: |
| β Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: |
| β Adamite Formula: Zn2(AsO4)(OH) |
| β Aegirine Formula: NaFe3+Si2O6 Localities: |
| β Aegirine-augite Formula: (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 Localities: References: |
| β Formula: MnS |
| β Albite Formula: Na(AlSi3O8) Localities: Buckwheat pit, Franklin Mine, Franklin, Sussex County, New Jersey, USA Franklin Mine, Franklin, Sussex County, New Jersey, USA Trotter Mine, Franklin Mine, Franklin, Sussex County, New Jersey, USA Mill site dump, Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat dump mineral collecting site, Franklin Mine, Franklin, Sussex County, New Jersey, USA Colour: White Description: Ilmenite and Albite occur at the contact surfaces between Franklin marble and intruded \"camptonite\" basaltic dikes. |
| β Albite var. Anorthoclase Formula: (Na,K)AlSi3O8 |
| β Allactite Formula: Mn2+7(AsO4)2(OH)8 Colour: Brown Fluorescence: None. Description: Occurs in a restricted assemblage only in this mine. References: |
| β Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) Localities: Colour: Black Description: Occurs in the petedunnite assemblage at Franklin. |
| β 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| β Alleghanyite Formula: Mn2+5(SiO4)2(OH)2 Description: The Mn-dominant humite was originally labeled "leucophoenicite" (see Palace 1935) but it was later found that several of the βleucophoeniciteβ specimens contained alleghanyite or sonolite. Leucophoenicite and sonolite have been identified as inclusions in alleghanyite .
Alleghanyite occurs both in the primary ore and in secondary vein assemblages in Franklin. The best preserved assemblage was described by Palace (1928) and reported by Dunn (1995): βveins up to 3 cm thick, associated with calcite, franklinite and sussexite.The bulk of this material is alleghanyite: it consists of massive alleghanyite which forms euhedral crystals on exposed surfaces. Leucophoenicite is also present, both as epitaxial overgrowths on the underlying alleghanyite, and as apparently randomly oriented euhedra, perhaps of a subsequent growth period.β
Alleghanyite also occurs at Franklin as dull pink masses associated with franklinite, willemite and zincite ore, and as glassy pink crystals associated with leucophoenicite in veinlets. According to Dunn (1995) most of the preserved pink-colored material from Franklin is leucophoenicite.
|
| β Almandine ? Formula: Fe2+3Al2(SiO4)3 Localities: |
| β 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Localities: References: |
| β 'Amphibole Supergroup var. Byssolite' Formula: AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| β Analcime Formula: Na(AlSi2O6) · H2O Localities: |
| β Anatase Formula: TiO2 Localities: Description: Occurs in cavities in the Buckwheat Dolomite. References: |
| β Andradite Formula: Ca3Fe3+2(SiO4)3 Localities: Reported from at least 8 localities in this region. Colour: Dark brown, light brown, golden yellow Fluorescence: None. Description: A common skarn mineral in coarse-textured areas of the orebody. |
| β Andradite var. Melanite Formula: Ca3(Fe3+,Ti)2(SiO4)3 Localities: References: |
| β Andradite var. Polyadelphite (FRL) Formula: (Ca,Mn)3Fe3+2(SiO4)3 Type Locality: |
| β Anglesite Formula: PbSO4 Localities: References: |
| β Anhydrite Formula: CaSO4 |
| β Annabergite Formula: Ni3(AsO4)2 · 8H2O Description: Occurs as green coatings on primary nickel species in the unique nickel-cobalt-arsenic assemblage. |
| β Antigorite Formula: Mg3(Si2O5)(OH)4 Localities: |
| β Antigorite var. Vorhauserite Formula: (Mg,Mn)3(Si2O5)(OH)4 |
| β Antlerite Formula: Cu3(SO4)(OH)4 Description: Occurs on a single specimen associated mixed with gypsum and brochantite on rhodonite and andradite (Franklin Mineral Museum specimen). |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: References: |
| β Aragonite Formula: CaCO3 Localities: |
| β Arakiite Formula: (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 References: |
| β Arsenopyrite Formula: FeAsS Localities: |
| β Atacamite Formula: Cu2(OH)3Cl Localities: |
| β Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Localities: Reported from at least 6 localities in this region. References: |
| β Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 Localities: |
| β Axinite-(Mn) (TL) Formula: Ca2Mn2+Al2BSi4O15(OH) Localities: Franklin Mine, Franklin, Sussex County, New Jersey, USA Trotter Mine, Franklin Mine, Franklin, Sussex County, New Jersey, USA Parker shaft, Franklin Mine, Franklin, Sussex County, New Jersey, USA Mill site dump, Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat dump mineral collecting site, Franklin Mine, Franklin, Sussex County, New Jersey, USA Type Locality: Franklin Mine, Franklin, Sussex County, New Jersey, USA |
| β Azurite Formula: Cu3(CO3)2(OH)2 Localities: |
| βͺ Bannisterite (TL) Formula: (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O Type Locality: Habit: Large platy masses Colour: Brown |
| β Barylite Formula: Be2Ba(Si2O7) |
| β Barysilite Formula: Pb8Mn2+[Si2O7]3 Localities: |
| β Baryte Formula: BaSO4 Localities: Taylor Mine, Franklin Mine, Franklin, Sussex County, New Jersey, USA Trotter Mine, Franklin Mine, Franklin, Sussex County, New Jersey, USA Franklin Mine, Franklin, Sussex County, New Jersey, USA Mill site dump, Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat dump mineral collecting site, Franklin Mine, Franklin, Sussex County, New Jersey, USA Description: Occurs in ore in the Franklin orebody. References: |
| β 'Baumite' References: |
| β Bementite (TL) Formula: Mn7Si6O15(OH)8 Localities: Description: Occurs in ore within the Franklin orebody. References: |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β Bornite Formula: Cu5FeS4 Localities: |
| βͺ Bostwickite (TL) Formula: CaMn3+6Si3O16 · 7H2O Type Locality: Description: Occurs in ore within the Franklin orebody. |
| β Breithauptite Formula: NiSb Description: Occurred in the unique nickel-cobalt-arsenic assemblage. |
| β Brianyoungite Formula: Zn3(CO3,SO4)(OH)4 |
| β Brookite Formula: TiO2 Localities: Description: Occurs as small crystals in cavities in the Buckwheat Dolomite. |
| β Bultfonteinite Formula: Ca2(HSiO4)F · H2O |
| β Bustamite (TL) Formula: CaMn2+(Si2O6) Localities: Type Locality: Franklin Mine, Franklin, Sussex County, New Jersey, USA Habit: Blocky prismatic Colour: Pale to medium pink, rarely rich dark pink Fluorescence: Magenta red (LW UV) (rare) References: |
| βͺ Cahnite (TL) Formula: Ca2[B(OH)4](AsO4) Type Locality: |
| β Calcite Formula: CaCO3 Localities: Reported from at least 9 localities in this region. |
| β Formula: PbFe3+2(AsO4)2(OH)2 Description: Re-identified as a new mineral, jarosewichite |
| β Formula: CuCo2S4 Description: Reputedly found as sub-millimeter crystals in bornite. Contact with the person cited (Burke, E.A.J. (2013) personal communication) resulted in a disavowal of the cited 1983 personal communication. The mineral seems to have suffered from miscommunication. |
| βͺ Caryopilite Formula: Mn2+3Si2O5(OH)4 Colour: Brown Fluorescence: None. Description: Occurs in a restricted assemblage only at this mine. |
| β Celestine Formula: SrSO4 Localities: |
| β Celsian Formula: Ba(Al2Si2O8) Localities: |
| β Cerussite Formula: PbCO3 |
| β Chalcocite Formula: Cu2S Localities: |
| β Chalcopyrite Formula: CuFeS2 Localities: |
| β Chamosite Formula: (Fe2+)5Al(Si,Al)4O10(OH,O)8 Localities: |
| β Charlesite (TL) Formula: Ca6(Al,Si)2(SO4)2[B(OH)4](OH,O)12 · 26H2O Localities: Type Locality: Franklin Mine, Franklin, Sussex County, New Jersey, USA Description: Was initially described as ettringite. |
| β Chloritoid Formula: (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 Localities: Description: Occurs as thin blackish films on fracture surfaces in massive andradite garnet. Limited number of specimens, perhaps only 2. |
| β Chlorophoenicite (TL) Formula: (Mn,Mg)3Zn2(AsO4)(OH,O)6 Localities: References: Foshag, W. F., Gage, R. B. (1924) Chlorophoenicite, a new mineral from Franklin Furnace, New Jersey (preliminary description) Journal of the Washington Academy of Sciences, 14 (15) 362-363 |
| β Chondrodite Formula: Mg5(SiO4)2F2 |
| β Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 References: |
| β Chrysotile Formula: Mg3(Si2O5)(OH)4 Localities: Habit: fibrous Colour: white Description: Fibrous material associated with lizardite in a small shear zone in lean ore. References: |
| βͺ Cianciulliite (TL) Formula: Mn(Mg,Mn)2Zn2(OH)10 · 2-4H2O Type Locality: Description: A single specimen only with two additional suspected specimens (Franklin Mineral Museum assets). |
| β Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: |
| β 'Clinochrysotile' |
| β Clinohedrite (TL) Formula: CaZn(SiO4) · H2O Localities: Type Locality: Franklin Mine, Franklin, Sussex County, New Jersey, USA References: Palache, Charles (1935) The minerals of Franklin and Sterling Hill, Sussex County, New Jersey. Professional Paper 180. US Geological Survey doi:10.3133/pp180 |
| β Clino-suenoite Formula: ◻{Mn2+2}{Mg5}(Si8O22)(OH)2 Localities: References: Klein, Cornelis, Ito, Jun (1968) Zincian and manganoan amphiboles from Franklin, New Jersey. American Mineralogist, 53 (7-8) 1264-1275 |
| β Copper Formula: Cu Localities: Colour: Copper-red Fluorescence: None Description: Occurs embedded in massive ore minerals as specks, sheets and masses. |
| β Cuprite Formula: Cu2O Localities: References: |
| β Cuprostibite Formula: Cu2(Sb,Tl) Fluorescence: None. Description: Occurs as microscopic inclusions in a gray, massive willemite matrix associated with copper and domeykite. |
| β Cuspidine Formula: Ca8(Si2O7)2F4 Localities: |
| βͺ Cyprine Formula: Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 Habit: Masses, coarsely fibrous Colour: Vivid blue, Dark blue, dark green Fluorescence: None. Description: Fitzgerald et al. (1986), Amer. Mineral. 71, 1011-1014. 1.91% CuO, 0.74 Cu p.f.u, Cu > Mn or Fe in Y. |
| β Datolite Formula: CaB(SiO4)(OH) Localities: |
| β Datolite var. Bakerite Formula: Ca4(H5B5Si3O20) |
| β Datolite var. Botryolite |
| β Diopside Formula: CaMgSi2O6 Localities: |
| β Diopside var. Schefferite Formula: (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| β Diopside var. Zinc-Schefferite Formula: Ca(Mg,Mn,Zn)Si2O6 References: Vanrusselt, Vik (2023) Personal Communication. Identification: Dealer/Collection Label |
| β Dolomite Formula: CaMg(CO3)2 Localities: Trotter Mine, Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat pit, Franklin Mine, Franklin, Sussex County, New Jersey, USA Franklin Mine, Franklin, Sussex County, New Jersey, USA Mill site dump, Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat dump mineral collecting site, Franklin Mine, Franklin, Sussex County, New Jersey, USA |
| β Domeykite Formula: Cu3As Description: Occurs as microscopic inclusion in massive gray willemite associated with copper and cuprostibite. |
| β Edenite Formula: NaCa2Mg5(Si7Al)O22(OH)2 |
| β Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: References: |
| β 'Epidote Group' Formula: (A12+A22+)(M13+M23+M33+)O[Si2O7][SiO4](OH) |
| β Epidote-(Sr) Formula: (CaSr)(AlAlFe3+)O[Si2O7][SiO4](OH) Description: occurs as high-z near-rim bands in complexly zoned crystals of (Sr+Pb)-bearing epidote (cores) to Sr-bearing hancockite (rims), intergrown with barite, within massive epidote/hancockite, andradite, and franklinite rock. Hendricksite and cpx(?; not analyzed) are also present. |
| β Esperite (TL) Formula: PbCa2Zn3(SiO4)3 Localities: Habit: massive Colour: white to creamy, dingy Fluorescence: bright yellow-green Description: Massive, in nodules up to 15 cm, associated with hardystonite, willemite, franklinite, less commonly calcite, clinohedrite, and axinite-(Mn). |
| β Fayalite Formula: Fe2+2SiO4 Localities: References: |
| β Fayalite var. Roepperite (of Brush) Formula: (Fe2+,Mn,Zn)2SiO4 Localities: References: |
| β Feitknechtite (TL) Formula: Mn3+O(OH) Type Locality: |
| β Ferriakasakaite-(La) Formula: (CaLa)(Fe3+AlMn2+)O[Si2O7][SiO4](OH) Description: Verified by both microprobe chemical analysis and Raman Spectroscopy References: |
| β Ferrokinoshitalite Formula: (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| β Ferrorhodonite Formula: CaMn3Fe[Si5O15] References: |
| β Fersmite Formula: (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 Locality: Buckwheat dump mineral collecting site, Franklin Mine, Franklin, Sussex County, New Jersey, USA Description: Fersmite of the Euxenite Group has been verified by EMPA as inclusions and red-brown crystals associated with hydroxycalciopyrochlore. |
| β Flinkite Formula: Mn2+2Mn3+(AsO4)(OH)4 Localities: Description: Occurs associated with jarosewichite in cavities in massive andradite. |
| β Fluorapatite Formula: Ca5(PO4)3F Localities: Buckwheat pit, Franklin Mine, Franklin, Sussex County, New Jersey, USA Taylor Road dumps, Franklin Mine, Franklin, Sussex County, New Jersey, USA Hamburg Mine (Hamburg Road Mine), Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat dump mineral collecting site, Franklin Mine, Franklin, Sussex County, New Jersey, USA Description: Occurs as small crystals in cavities in the Buckwheat Dolomite. References: |
| β Fluorapophyllite-(K) Formula: KCa4(Si8O20)(F,OH) · 8H2O Localities: |
| β Formula: NaCa4(Si8O20)F · 8H2O Localities: Description: Optical analysis gave a false positive for fluorapophyllite-(Na) References: |
| β Formula: Ca5(SiO4)1.5(SO4)1.5F Description: A mineral was circulated commercially as fluorellestadite about the year 2000. Recent EDS indicates an absence of Si. The mineral seems to be an arsenatian johnbaumite. |
| β Fluorite Formula: CaF2 Localities: Reported from at least 6 localities in this region. Description: Occurs in ore within the Franklin orebody. |
| β Fluorite var. Chlorophane Formula: CaF2 |
| βͺ Fluor-uvite (TL) Formula: CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3F Type Locality: Habit: Crystals show first and second order prism and first and second order trigonal pyramids. The crystal habit is equant to only slightly elongated along "c". Oftentimes, the crystals are asymmetrical. Colour: Full range of light to dark greens including olive green and brownish green through greenish brown. Fluorescence: Orange yellow in short wave ultraviolet |
| β 'Fluor-uvite-Uvite Series' |
| βͺ Franklinfurnaceite (TL) Formula: Ca2Fe3+Mn2+3Mn3+(Zn2Si2O10)(OH)8 Type Locality: |
| β Franklinite (TL) Formula: Zn2+Fe3+2O4 Localities: Reported from at least 9 localities in this region. Type Locality: Franklin Mine, Franklin, Sussex County, New Jersey, USA Habit: Octahedral, dodecahedral Colour: Black Fluorescence: None Description: Prolific basic ore mineral. Manganese percentage varies markedly to isolated occurrences of jacobsite. References: |
| β Franklinphilite (TL) Formula: (K,Na)4(Mn2+,Mg,Zn)48(Si,Al)72(O,OH)216 · 6H2O Type Locality: |
| β Friedelite Formula: Mn2+8Si6O15(OH,Cl)10 Localities: References: |
| βͺ Gageite (TL) Formula: Mn21(Si4O12)2O3(OH)20 Type Locality: |
| β 'Gageite-2M' (FRL) Formula: (Mn,Mg,Zn)42Si16O54(OH)40 Type Locality: |
| β Gahnite Formula: ZnAl2O4 Localities: Habit: Rare cubic habit in adjacent tunnel. Colour: Dark green. |
| β Galena Formula: PbS Localities: |
| β Ganomalite Formula: Pb9Ca5Mn(Si2O7)4(SiO4)O References: |
| β Ganophyllite Formula: (K,Na,Ca)2Mn8(Si,Al)12(O,OH)32 · 8H2O Localities: |
| β Genthelvite Formula: Be3Zn4(SiO4)3S Localities: Description: Occurs in the petedunnite assemblage with willemite and other species. |
| β Gersdorffite Formula: NiAsS Localities: |
| βͺ Glaucochroite (TL) Formula: CaMn2+SiO4 Type Locality: Colour: blue, blue-gray, tan Fluorescence: None. |
| β Glaucodot Formula: (Co0.50Fe0.50)AsS Description: Occurs in the unique nickel-cobalt-arsenic assemblage. |
| β Goethite Formula: Ξ±-Fe3+O(OH) Localities: |
| β Gonyerite Formula: (Mn2+,Mg)5Fe3+(Fe3+Si3O10)(OH)8 Localities: References: |
| β Graphite Formula: C Localities: References: |
| β Greenockite Formula: CdS |
| β Grossular Formula: Ca3Al2(SiO4)3 |
| β Groutite Formula: Mn3+O(OH) |
| β Grunerite Formula: ◻{Fe2+2}{Fe2+5}(Si8O22)(OH)2 Habit: Acicular Colour: Pale yellow-green Description: Occurs as distinct feathery to flat spherical aggregates to 1 cm diameter of fine needles on matrix. |
| β Gypsum Formula: CaSO4 · 2H2O Localities: References: |
| β Hancockite (TL) Formula: (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Type Locality: Franklin Mine, Franklin, Sussex County, New Jersey, USA Habit: Crystals found in the vugs of the massive hancockite are prismatic and normally striated along the longest axis. Colour: brownish-red, maroon Description: Hancockite is found in the calcium silicate units of the Franklin ore body |
| β Hardystonite (TL) Formula: Ca2Zn[Si2O7] Localities: Franklin Mine, Franklin, Sussex County, New Jersey, USA Parker shaft, Franklin Mine, Franklin, Sussex County, New Jersey, USA Mill site dump, Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat pit, Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat dump mineral collecting site, Franklin Mine, Franklin, Sussex County, New Jersey, USA Type Locality: Franklin Mine, Franklin, Sussex County, New Jersey, USA References: |
| β Hastingsite Formula: NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 References: |
| β Hauckite Formula: Fe3+3(Mg,Mn2+)24Zn18(SO4)4(CO3)2(OH)81 References: |
| β Hausmannite Formula: Mn2+Mn3+2O4 Localities: Description: Occurs in ore within the Franklin orebody. |
| β Hawleyite Formula: CdS |
| β Hedenbergite Formula: CaFe2+Si2O6 Localities: References: |
| β Hedyphane Formula: Ca2Pb3(AsO4)3Cl |
| β Hellandite-(Y) Formula: (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 Description: The hellandite-(Y) occurs on a single specimen from the Franklin mine. Remarkably, the species occurs as a secondary mineral, not a primary pegmatitic mineral as is usually the case. It occurs on another, earlier secondary mineral (rhodochrosite). |
| β Hematite Formula: Fe2O3 Localities: Franklin Mine, Franklin, Sussex County, New Jersey, USA Trotter Mine, Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat pit, Franklin Mine, Franklin, Sussex County, New Jersey, USA Mill site dump, Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat dump mineral collecting site, Franklin Mine, Franklin, Sussex County, New Jersey, USA Description: Massive hematite at the Franklin mine exhibits a unique cubic parting. References: |
| β Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Localities: |
| β Hendricksite (TL) Formula: KZn3(Si3Al)O10(OH)2 Localities: Reported from at least 7 localities in this region. Type Locality: Franklin Mine, Franklin, Sussex County, New Jersey, USA References: Frondel, Clifford, Ito, Jun (1966) Hendricksite, a new species of mica. American Mineralogist, 51 (7) 1107-1123 Frondel, Clifford, Einaudi, Marco (1968) Zinc-rich micas from Sterling Hill, New Jersey. American Mineralogist, 53 (9-10) 1752-1753 |
| β Hetaerolite Formula: ZnMn2O4 References: |
| β 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O Localities: |
| β Hodgkinsonite (TL) Formula: Mn2+Zn2(SiO4)(OH)2 Localities: Type Locality: Franklin Mine, Franklin, Sussex County, New Jersey, USA Colour: Colorless, pale lilac, purple Fluorescence: None. |
| β Holdenite (TL) Formula: (Mn2+,Mg)6Zn3(AsO4)2(SiO4)(OH)8 Type Locality: Description: First described from the Franklin Mine by Charles Palache (1921) American Mineralogist for Harvard University graduate, mineral collector, and benefactor Albert F. Holden. References: (1921) First annual meeting of the Mineralogical Society of America. American Mineralogist, 6 (2) 35-45 p.39 - (Holdenite and cahnite, two new minerals from Franklin Furnace, N.J.. Title only, without text.) |
| β 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| β HΓΌbnerite Formula: MnWO4 |
| β Humite Formula: Mg7(SiO4)3F2 |
| β 'Humite Group' References: |
| β Hydrocerussite Formula: Pb3(CO3)2(OH)2 References: |
| β 'Hydrohausmannite' (FRL) Type Locality: |
| β Hydrotalcite Formula: Mg6Al2(CO3)(OH)16 · 4H2O |
| β Hydroxyapophyllite-(K) Formula: KCa4(Si8O20)(OH,F) · 8H2O |
| β Hydroxycalciopyrochlore Formula: (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| β HydroxycalcioromΓ©ite Formula: (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) References: |
| β Hydroxylapatite Formula: Ca5(PO4)3(OH) References: |
| β Hydrozincite Formula: Zn5(CO3)2(OH)6 Localities: Description: Occurs in ore within the Franklin orebody. References: |
| β Ilmenite Formula: Fe2+TiO3 Localities: Colour: Black. Description: Ilmenite and Albite occur at the contact surfaces between Franklin marble and intruded "camptonite" basaltic dikes. |
| β Jacobsite Formula: Mn2+Fe3+2O4 Localities: |
| β Jarosewichite (TL) Formula: Mn2+3Mn3+(AsO4)(OH)6 Localities: Description: Occurs associated with flinkite in massive andradite and franklinite. |
| β Jarosite Formula: KFe3+3(SO4)2(OH)6 Colour: Dark brown Description: A post-mining product formed on the dump. Occurred as a thick, dark brown coating of hard, mud-like material covering chunks of camptonite rock containing sulfides (pyrite, sphalerite). |
| β Jerrygibbsite (TL) Formula: Mn2+9(SiO4)4(OH)2 Type Locality: Habit: anhedral Colour: medium violet-pink in color. The mineral resembles some leucophoenicites, but is decidedly more brown and violet-colored than most leucophoenicite Description: Jerrygibbsite occurs as a massive mineral in interlocking, anhedral crystals reaching 0.5 x 2.0 mm, which display a typical metamorphic texture; there are no euhedral crystals. Jerrygibbsite has not been found associated with any Ca-bearing minerals |
| β Johannsenite (TL) Formula: CaMn2+Si2O6 Localities: Type Locality: Franklin Mine, Franklin, Sussex County, New Jersey, USA |
| β Johnbaumite (TL) Formula: Ca5(AsO4)3(OH) Localities: Type Locality: Franklin Mine, Franklin, Sussex County, New Jersey, USA |
| β Junitoite Formula: CaZn2Si2O7 · H2O Description: A single specimen of junitoite has been verified from the Franklin Mine. References: |
| β Kentrolite Formula: Pb2Mn3+2(Si2O7)O2 |
| β Kittatinnyite (TL) Formula: Ca2Mn2Mn(SiO4)2(OH)4 · 9H2O Type Locality: Description: Occurs in ore within the Franklin orebody. |
| β Kolicite Formula: Mn2+7Zn4(AsO4)2(SiO4)2(OH)8 |
| β Kutnohorite Formula: CaMn2+(CO3)2 |
| β Larsenite (TL) Formula: PbZnSiO4 Localities: Type Locality: Franklin Mine, Franklin, Sussex County, New Jersey, USA Habit: Acicular to long-prismatic Colour: Colourless, white Fluorescence: None. Description: Acicular to long-prismatic, colourless crystals in fracture surface cavities traversing willemite-franklinite ore with esperite present.
The type locality for larsenite is the Franklin MIne, not the Parker Shaft. Palache (1935) makes it clear: "Larsenite was first found in 1928 and, with the closely related, was described in papers by Palache, Bauer, and Berman (256, 259). The first specimens were found on the picking table at Franklin, and the mineral was afterwards located in the mine at the north end, 20 feet above the 400-foot level in top slice 1080." |
| β Lead Formula: Pb Localities: |
| β Lennilenapeite (TL) Formula: K6-7(Mg,Mn,Fe,Zn)48(Si,Al)72(O,OH)216 · 16H2O Localities: Type Locality: Franklin Mine, Franklin, Sussex County, New Jersey, USA |
| β Leucophoenicite (TL) Formula: Mn2+7(SiO4)3(OH)2 Localities: Type Locality: Franklin Mine, Franklin, Sussex County, New Jersey, USA Habit: commonly prismatic, although tabular crystals are known. Colour: commonly some shade of pink, but violet-red and brownish-red hues are known. Description: occurs in secondary veins and vuggy assemblages, both as massive material and as euhedral crystals. It has been found in several different mineral assemblages in these veins, and is also found in calcium-rich primary ore, hydroxyl-bearing ore assemblages, and recrystallized aggregates. In vein assemblages, leucophoenicite crystallizes late, commonly contemporaneously with willemite, the most commonly associated mineral.
Crystals of leucophoenicite appear to be confined to open hydrothermal veins. References: Palache, Charles (1935) The minerals of Franklin and Sterling Hill, Sussex County, New Jersey. Professional Paper 180. US Geological Survey doi:10.3133/pp180 pp.103-105 |
| β Lizardite Formula: Mg3(Si2O5)(OH)4 Localities: |
| β LΓΆllingite Formula: FeAs2 Localities: Trotter Mine, Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat pit, Franklin Mine, Franklin, Sussex County, New Jersey, USA Franklin Mine, Franklin, Sussex County, New Jersey, USA Mill site dump, Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat dump mineral collecting site, Franklin Mine, Franklin, Sussex County, New Jersey, USA Description: Occurs in the unique nickel-cobalt-arsenic assemblage. |
| βͺ Loseyite (TL) Formula: (Mn2+,Zn,Mg)4Zn3(CO3)2(OH)10 Type Locality: |
| β Macfallite Formula: Ca2Mn3+3(SiO4)(Si2O7)(OH)3 |
| β Magnesiochlorophoenicite (TL) Formula: (Mg,Mn)3Zn2(AsO4)(OH,O)6 Type Locality: |
| β Magnesio-hornblende Formula: ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| β Magnesio-riebeckite Formula: ◻{Na2}{Mg3Fe3+2}(Si8O22)(OH)2 Localities: Description: Occurs as light blue to blue-gray masses of finely fibrous material associated with sphalerite, calcite and lennilenapeite. |
| β Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 7 localities in this region. |
| β Malachite Formula: Cu2(CO3)(OH)2 Localities: |
| βͺ Manganberzeliite Formula: (NaCa2)Mn2+2(AsO4)3 |
| β Manganhumite Formula: (Mn2+,Mg)7(SiO4)3(OH)2 |
| β Manganite Formula: Mn3+O(OH) Localities: |
| β Manganosite Formula: MnO Localities: Fluorescence: None. Description: Occurs in ore within the Franklin orebody. References: |
| β Marcasite Formula: FeS2 Localities: Description: Occurs in cavities in the Buckwheat Dolomite. References: |
| β Margarite Formula: CaAl2(Al2Si2O10)(OH)2 |
| β Margarosanite (TL) Formula: Pb(Ca,Mn2+)2(Si3O9) Localities: |
| βͺ Marsturite (TL) Formula: NaCaMn3Si5O14(OH) Type Locality: Colour: Tan Fluorescence: None. Description: Grows epitaxially on bladed rhodonite crystals in open fractures in massive franklinite-willemite-zincite ore. |
| β Meionite Formula: Ca4Al6Si6O24CO3 |
| β Meionite var. Algerite (FRL) Formula: Ca4Al6Si6O24CO3 Type Locality: References: |
| β Microcline Formula: K(AlSi3O8) Localities: Reported from at least 6 localities in this region. Colour: Whitish, green, dark green, blackish-green Fluorescence: Blue-gray to bluish (SW) Description: Occurs in pegmatites and in ore adjacent to pegmatite intrusives, often as crystals. |
| β Microcline var. Amazonite Formula: K(AlSi3O8) Localities: |
| β Microcline var. Hyalophane Formula: (K,Ba)[Al(Si,Al)Si2O8] Localities: |
| β Formula: NiS Locality: Buckwheat dump mineral collecting site, Franklin Mine, Franklin, Sussex County, New Jersey, USA - erroneously reported |
| β Mimetite Formula: Pb5(AsO4)3Cl |
| βͺ Minehillite (TL) Formula: (K,Na)2-3Ca28Zn4Al4Si40O112(OH)16 Type Locality: |
| β 'Mineral B ("oyelite-like" mineral)' Formula: Ca10Si8B2O29 · 12.5H2O |
| β 'Mineral E (of Dunn, et. al., 1982)' References: |
| β Molybdenite Formula: MoS2 Description: Occurs in massive, dark colored calc-silicate matrix. |
| β Monazite-(Ce) Formula: Ce(PO4) Localities: |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: References: |
| β Muscovite var. Oellacherite Formula: KAl2(AlSi3O10)(OH)2 Colour: Pink Description: Very fine-grained / massive material. |
| β Nasonite (TL) Formula: Pb6Ca4(Si2O7)3Cl2 Localities: |
| β Natrolite Formula: Na2Al2Si3O10 · 2H2O Localities: |
| βͺ Nelenite (TL) Formula: (Mn,Fe)16(Si12O30)(OH)14[As3+3O6(OH)3] Type Locality: Description: Occurred approximately 50 feet South of the Trotter shaft, Franklin orebody. |
| β Neotocite Formula: (Mn,Fe,Mg)SiO3 · H2O Localities: Description: Occurred in a thin vein in marble. |
| β Nickeline Formula: NiAs Description: Occurs in the unique nickel-cobalt-arsenic assemblage. |
| β Nickelskutterudite Formula: (Ni,Co,Fe)As3 |
| β Opal Formula: SiO2 · nH2O |
| β Orthoclase Formula: K(AlSi3O8) |
| β Pararammelsbergite Formula: NiAs2 Description: Occurs in the unique nickel-cobalt-arsenic assemblage. |
| β Pectolite Formula: NaCa2Si3O8(OH) References: |
| β Pennantite Formula: Mn2+5Al(AlSi3O10)(OH)8 |
| β Petedunnite (TL) Formula: Ca(Zn,Mn2+,Mg,Fe2+)Si2O6 Localities: Colour: Dark green. Description: Occurs in a complex assemblage including genthelvite and willemite. |
| β Peterchinite (TL) Formula: Zn3Zn2(OH)6As[O3(OH)3] Type Locality: |
| β Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: References: |
| β 'Pimelite' Formula: Ni3Si4O10(OH)2 · 4H2O |
| β 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| β Powellite Formula: Ca(MoO4) Localities: |
| β Prehnite Formula: Ca2Al2Si3O10(OH)2 Localities: |
| β Pumpellyite-(Mg) Formula: Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| β Pyrite Formula: FeS2 Localities: Reported from at least 6 localities in this region. References: |
| β Pyrobelonite Formula: PbMn2+(VO4)(OH) Localities: |
| β 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z |
| β Pyrochroite Formula: Mn(OH)2 Localities: Franklin Mine, Franklin, Sussex County, New Jersey, USA Hamburg Mine (Hamburg Road Mine), Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat pit, Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat dump mineral collecting site, Franklin Mine, Franklin, Sussex County, New Jersey, USA References: |
| βͺ Pyroxferroite Formula: (Fe,Mn,Ca)SiO3 Habit: Crystal section are prismatic with crude terminations. Colour: Tan to yellow; crystals are black Description: Originally found in a single specimen found on the Taylor Road dump and subsequently identified in specimens of a similar appearance. Vitreous. In gahnite-rich matrix. One specimen known with black crystal sections to 2 cm in a vein of rhodonite. |
| β Pyroxmangite Formula: Mn2+SiO3 Localities: Description: Occurs in ore within the Franklin orebody. |
| β Pyrrhotite Formula: Fe1-xS Localities: |
| β Quartz Formula: SiO2 Localities: Buckwheat pit, Franklin Mine, Franklin, Sussex County, New Jersey, USA Franklin Mine, Franklin, Sussex County, New Jersey, USA Mill site dump, Franklin Mine, Franklin, Sussex County, New Jersey, USA Double Rock pegmatite, Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat dump mineral collecting site, Franklin Mine, Franklin, Sussex County, New Jersey, USA Description: Occurs as small crystals in the Buckwheat Dolomite cavities. Also a major component of the pegmatitic intrusives at the South end of the Franklin orebody, including the Buckwheat Pit area. References: |
| β Rammelsbergite Formula: NiAs2 Description: Occurred in a restricted assemblage from the Trotter Mine within the Franklin orebody associated with other cobalt-nickel-arsenic species. |
| β Rhodochrosite Formula: MnCO3 Localities: References: |
| β Rhodonite Formula: CaMn3Mn[Si5O15] Localities: Reported from at least 7 localities in this region. Habit: tabular, blocky prismatic Colour: Bright pink, red-pink, light pink, dark red-black Fluorescence: None. References: |
| β Rhodonite var. Fowlerite (FRL) Formula: (Mn2+,Zn,Ca)SiO3 Localities: Type Locality: Franklin Mine, Franklin, Sussex County, New Jersey, USA References: |
| β Ribbeite Formula: Mn2+5(SiO4)2(OH)2 References: |
| β Richterite Formula: Na(NaCa)Mg5(Si8O22)(OH)2 References: |
| β Roeblingite (TL) Formula: Pb2Ca6Mn2+(Si3O9)2(SO4)2(OH)2 · 4H2O Localities: |
| β 'RomΓ©ite Group' Formula: A2(Sb5+)2O6Z Localities: |
| β Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 |
| βͺ Roweite (TL) Formula: Ca2Mn2+2B4O7(OH)6 Type Locality: Habit: Narrow veinlet Colour: Light brown |
| β Rutile Formula: TiO2 Localities: Description: Occurs as small, lustrous crystals in Buckwheat Dolomite cavities. Originally mistaken for, and listed as, millerite. References: |
| β Safflorite Formula: (Co,Ni,Fe)As2 Description: Occurs in the unique nickel-cobalt-arsenic assemblage. |
| βͺ Samfowlerite (TL) Formula: Ca28Mn6Zn4(Be,Zn)4Be12[(OH)3(SiO4)3(Si2O7)2]4 Type Locality: |
| β Saponite Formula: Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| β Sarkinite Formula: Mn2+2(AsO4)(OH) |
| β 'Scapolite' |
| β Schallerite (TL) Formula: Mn2+16As3Si12O36(OH)17 Localities: Type Locality: Franklin Mine, Franklin, Sussex County, New Jersey, USA References: Gage, R. B., Larsen, Esper S., Vassar, Helen E. (1925) Schallerite, a new arseno-silicate mineral from Franklin Furnace, New Jersey. American Mineralogist, 10 (1) 9-11 |
| β Scheelite Formula: Ca(WO4) Localities: References: |
| βͺ Sclarite (TL) Formula: Zn7(CO3)2(OH)10 Type Locality: |
| β Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O |
| β Siderite Formula: FeCO3 Localities: |
| β Silver Formula: Ag References: |
| β Skutterudite Formula: CoAs3 Description: Occurred in the unique nickel-cobalt-arsenic assemblage. |
| β Smithsonite Formula: ZnCO3 Localities: References: |
| β Sonolite Formula: Mn2+9(SiO4)4(OH)2 Localities: |
| β Spessartine Formula: Mn2+3Al2(SiO4)3 |
| β Sphalerite Formula: ZnS Localities: Reported from at least 7 localities in this region. Description: Occurs in cavities in the Buckwheat Dolomite. |
| β Sphalerite var. Cleiophane Formula: ZnS Description: Occurs in ore within the Franklin orebody. |
| β Spinel Formula: MgAl2O4 Localities: |
| β 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| β Stilpnomelane Formula: (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O Localities: Trotter Mine, Franklin Mine, Franklin, Sussex County, New Jersey, USA Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat dump mineral collecting site, Franklin Mine, Franklin, Sussex County, New Jersey, USA ? (more information) Taylor Road dumps, Franklin Mine, Franklin, Sussex County, New Jersey, USA ? (more information) |
| β Stilpnomelane var. Ferristilpnomelane Formula: K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| β Strontianite Formula: SrCO3 |
| β Sussexite (TL) Formula: Mn2+BO2(OH) Localities: Habit: Fibrous Colour: White, lilac Description: Occurs as a secondary mineral in ore within the Franklin orebody. References: |
| β Svabite Formula: Ca5(AsO4)3F Localities: Description: The report of "svabite" by Charles Palache in Professional Paper 180 of the U. S. Geological survey was probably in error given its imprecision. Many subsequent Franklin specimens were labeled "svabite" in the succeeding half century. In 2012, specimens of arsenic-bearing apatite from the Franklin Mining District were chemically and spectrographically analyzed, using quantitativel techniques and some specimens were proven to be svabite. So far the only known verified svabite specimens from the district are the handful chemically analyzed by the Crimmins (2012)study. Newly labeled svabite specimens should be accompanied with documents suitable high F values to validate the identification. |
| β Synchysite-(Ce) Formula: CaCe(CO3)2F Localities: Description: Occurs as small crystals in cavities in the Buckwheat Dolomite. Discovered by G. Bearss in material collected by Steven Kiss on the Buckwheat dump. |
| β SzaibΓ©lyite Formula: MgBO2(OH) |
| β Talc Formula: Mg3Si4O10(OH)2 Localities: |
| β 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S References: |
| β Tenorite Formula: CuO References: |
| β Tephroite Formula: Mn2+2SiO4 Localities: |
| β Thomsonite-Ca Formula: NaCa2[Al5Si5O20] · 6H2O Localities: |
| β Thorite Formula: Th(SiO4) Localities: Buckwheat pit, Franklin Mine, Franklin, Sussex County, New Jersey, USA Trotter Mine, Franklin Mine, Franklin, Sussex County, New Jersey, USA Double Rock pegmatite, Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat dump mineral collecting site, Franklin Mine, Franklin, Sussex County, New Jersey, USA Colour: Yellow to orange-yellow. Fluorescence: None. Description: Thorite occurs in microcline & quartz-rich pegmatites. In recent years it was ID'd on such pegmatitic material in the thorutite assemblage. |
| β Thorite var. Orangite Formula: Th(SiO4) |
| β Thorutite Formula: (Th,U,Ca)Ti2(O,OH)6 Localities: Habit: Black elongated rods with a characteristic re-entry angle grove along their length. Colour: Black Fluorescence: Not fluorescent Description: Occurs as small (<2 mm), dark, prismatic crystals associated with thorite in microcline-rich pegmatite. Limited number of specimens (est. 15). |
| β Tilasite Formula: CaMg(AsO4)F References: |
| β Titanite Formula: CaTi(SiO4)O Localities: Trotter Mine, Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat pit, Franklin Mine, Franklin, Sussex County, New Jersey, USA Mill site dump, Franklin Mine, Franklin, Sussex County, New Jersey, USA Double Rock pegmatite, Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat dump mineral collecting site, Franklin Mine, Franklin, Sussex County, New Jersey, USA Description: Occurs in microcline-rich, intrusive pegamtitic bodies. References: |
| β Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O Description: One, or only a few, specimens from the Franklin mine - one confirmed ex. Cianciulli coll., now in Lemanski coll. |
| β Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: |
| β Turneaureite (TL) Formula: Ca5(AsO4)3Cl Type Locality: Description: The Franklin mine is one of three co-type localities. |
| β 'UM1986-10-CO:ClHMgMnZn (also called Mineral F, Dunn, 1995)' (FRL) Formula: Mg5(Zn,Mn)3(CO3)2(OH,Cl)12 · H2O Type Locality: |
| β 'UM1986-23-O:BaMnU' Formula: Ba-Mn-U-O References: |
| β Umangite Formula: Cu3Se2 |
| β Uraninite Formula: UO2 Localities: Description: Uraninite occurs as black massive material in microcline-rich pegmatitic intrusives. |
| β Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 Localities: Description: Occurs as a red-brown berylian variety, as a component of the mixture pseudomorphic after hendricksite ("caswellite") and as both green and blue cyprine. References: |
| β Vesuvianite var. Manganese-bearing Vesuvianite ? Formula: Ca19(Fe3+,Mn2+,Mn3+)Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](O,OH)(OH)9 Description: No data available References: |
| β Wallkilldellite Formula: Ca2Mn2+3(AsO4)2(OH)4 · 9H2O Localities: Description: Verified by Heixong Yang in December 2016 using Raman spectroscopy and EDS References: |
| βͺ Wawayandaite (TL) Formula: Ca6Mn2BBe9Si6O23(OH,Cl)15 Type Locality: Habit: Thin plates Colour: Pearly white to colourless |
| β Willemite Formula: Zn2SiO4 Localities: Reported from at least 10 localities in this region. Colour: Colorless, gray, apple-green, burgundy-red, black, dark gray, yellow Fluorescence: Bright green (SW); dull green (LW) Description: Occurs abundantly throughout the locality within the Franklin orebody. References: |
| β Willemite var. Troostite Formula: (Zn,Mn)2SiO4 References: |
| β Winchite Formula: ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 Locality: Buckwheat dump mineral collecting site, Franklin Mine, Franklin, Sussex County, New Jersey, USA Description: Winchite from the Buckwheat Dump collecting site was originally labeled "tremolite", although it had a purple gray color. RDS, XRD, and single crystal study demonstartes that it is a manganoan zincian winchite. |
| β Wittichenite Formula: Cu3BiS3 References: |
| β Wollastonite Formula: Ca3(Si3O9) Localities: |
| β Xonotlite Formula: Ca6(Si6O17)(OH)2 Localities: |
| βͺ Yeatmanite (TL) Formula: Zn6Mn2+9Sb5+2(SiO4)4O12 Type Locality: Description: Yeatmanite was found on a single specimen associated with johnbaumite, sarkinite and willemite in lean ore from the Buckwheat dump. |
| β Zincite (TL) Formula: ZnO Localities: Reported from at least 7 localities in this region. Type Locality: Franklin Mine, Franklin, Sussex County, New Jersey, USA References: |
| β Zircon Formula: Zr(SiO4) Localities: Trotter Mine, Franklin Mine, Franklin, Sussex County, New Jersey, USA Mill site dump, Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat dump mineral collecting site, Franklin Mine, Franklin, Sussex County, New Jersey, USA Buckwheat pit, Franklin Mine, Franklin, Sussex County, New Jersey, USA Double Rock pegmatite, Franklin Mine, Franklin, Sussex County, New Jersey, USA |
| β Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Lead | 1.AA.05 | Pb |
| β | Copper | 1.AA.05 | Cu |
| β | Silver | 1.AA.05 | Ag |
| β | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Domeykite | 2.AA.10b | Cu3As |
| β | Cuprostibite | 2.AA.20 | Cu2(Sb,Tl) |
| β | Chalcocite | 2.BA.05 | Cu2S |
| β | Bornite | 2.BA.15 | Cu5FeS4 |
| β | Umangite | 2.BA.25 | Cu3Se2 |
| β | Acanthite | 2.BA.35 | Ag2S |
| β | Hawleyite | 2.CB.05a | CdS |
| β | Sphalerite var. Cleiophane | 2.CB.05a | ZnS |
| β | 2.CB.05a | ZnS | |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Greenockite | 2.CB.45 | CdS |
| β | Breithauptite | 2.CC.05 | NiSb |
| β | Nickeline | 2.CC.05 | NiAs |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | Millerite ? | 2.CC.20 | NiS |
| β | Galena | 2.CD.10 | PbS |
| β | Alabandite ? | 2.CD.10 | MnS |
| β | Carrollite ? | 2.DA.05 | CuCo2S4 |
| β | Molybdenite | 2.EA.30 | MoS2 |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | Marcasite | 2.EB.10a | FeS2 |
| β | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| β | Pararammelsbergite | 2.EB.10e | NiAs2 |
| β | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| β | LΓΆllingite | 2.EB.15a | FeAs2 |
| β | Rammelsbergite | 2.EB.15a | NiAs2 |
| β | Arsenopyrite | 2.EB.20 | FeAsS |
| β | Gersdorffite | 2.EB.25 | NiAsS |
| β | Nickelskutterudite | 2.EC.05 | (Ni,Co,Fe)As3 |
| β | Skutterudite | 2.EC.05 | CoAs3 |
| β | Wittichenite | 2.GA.20 | Cu3BiS3 |
| β | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| Group 3 - Halides | |||
| β | Fluorite var. Chlorophane | 3.AB.25 | CaF2 |
| β | 3.AB.25 | CaF2 | |
| β | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| Group 4 - Oxides and Hydroxides | |||
| β | Goethite | 4.00. | Ξ±-Fe3+O(OH) |
| β | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
| β | Cuprite | 4.AA.10 | Cu2O |
| β | Tenorite | 4.AB.10 | CuO |
| β | Zincite (TL) | 4.AB.20 | ZnO |
| β | Manganosite | 4.AB.25 | MnO |
| β | Jacobsite | 4.BB.05 | Mn2+Fe3+2O4 |
| β | Spinel | 4.BB.05 | MgAl2O4 |
| β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| β | Gahnite | 4.BB.05 | ZnAl2O4 |
| β | Franklinite (TL) | 4.BB.05 | Zn2+Fe3+2O4 |
| β | Hetaerolite | 4.BB.10 | ZnMn2O4 |
| β | Hausmannite | 4.BB.10 | Mn2+Mn3+2O4 |
| β | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| β | Hematite | 4.CB.05 | Fe2O3 |
| β | Quartz | 4.DA.05 | SiO2 |
| β | Opal | 4.DA.10 | SiO2 Β· nH2O |
| β | Rutile | 4.DB.05 | TiO2 |
| β | HΓΌbnerite | 4.DB.30 | MnWO4 |
| β | Anatase | 4.DD.05 | TiO2 |
| β | Brookite | 4.DD.10 | TiO2 |
| β | Fersmite | 4.DG.05 | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| β | 'RomΓ©ite Group' | 4.DH. | A2(Sb5+)2O6Z |
| β | Thorutite | 4.DH.05 | (Th,U,Ca)Ti2(O,OH)6 |
| β | Hydroxycalciopyrochlore | 4.DH.15 | (Ca,Na,U,β»)2(Nb,Ti)2O6(OH) |
| β | HydroxycalcioromΓ©ite | 4.DH.20 | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| β | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 Β· 3-4H2O |
| β | Uraninite | 4.DL.05 | UO2 |
| β | Groutite | 4.FD.10 | Mn3+O(OH) |
| β | Manganite | 4.FD.15 | Mn3+O(OH) |
| β | Pyrochroite | 4.FE.05 | Mn(OH)2 |
| β | Feitknechtite (TL) | 4.FE.25 | Mn3+O(OH) |
| β | Cianciulliite (TL) | 4.FL.55 | Mn(Mg,Mn)2Zn2(OH)10 Β· 2-4H2O |
| Group 5 - Nitrates and Carbonates | |||
| β | Smithsonite | 5.AB.05 | ZnCO3 |
| β | Siderite | 5.AB.05 | FeCO3 |
| β | Rhodochrosite | 5.AB.05 | MnCO3 |
| β | Calcite | 5.AB.05 | CaCO3 |
| β | Kutnohorite | 5.AB.10 | CaMn2+(CO3)2 |
| β | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| β | Aragonite | 5.AB.15 | CaCO3 |
| β | Cerussite | 5.AB.15 | PbCO3 |
| β | Strontianite | 5.AB.15 | SrCO3 |
| β | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| β | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| β | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| β | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| β | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| β | Loseyite (TL) | 5.BA.30 | (Mn2+,Zn,Mg)4Zn3(CO3)2(OH)10 |
| β | Sclarite (TL) | 5.BA.30 | Zn7(CO3)2(OH)10 |
| β | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| β | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| β | Brianyoungite | 5.BF.30 | Zn3(CO3,SO4)(OH)4 |
| β | 'UM1986-10-CO:ClHMgMnZn (also called Mineral F, Dunn, 1995)' (TL) | 5.DA.05 | Mg5(Zn,Mn)3(CO3)2(OH,Cl)12 Β· H2O |
| β | Hydrotalcite | 5.DA.50 | Mg6Al2(CO3)(OH)16 Β· 4H2O |
| Group 6 - Borates | |||
| β | Cahnite (TL) | 6.AC.70 | Ca2[B(OH)4](AsO4) |
| β | SzaibΓ©lyite | 6.BA.15 | MgBO2(OH) |
| β | Sussexite (TL) | 6.BA.15 | Mn2+BO2(OH) |
| β | Roweite (TL) | 6.DA.25 | Ca2Mn2+2B4O7(OH)6 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Anhydrite | 7.AD.30 | CaSO4 |
| β | Anglesite | 7.AD.35 | PbSO4 |
| β | Celestine | 7.AD.35 | SrSO4 |
| β | Baryte | 7.AD.35 | BaSO4 |
| β | Hauckite | 7.BB.10 | Fe3+3(Mg,Mn2+)24Zn18(SO4)4(CO3)2(OH)81 |
| β | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| β | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| β | Gypsum | 7.CD.40 | CaSO4 Β· 2H2O |
| β | Charlesite (TL) | 7.DG.15 | Ca6(Al,Si)2(SO4)2[B(OH)4](OH,O)12 Β· 26H2O |
| β | Powellite | 7.GA.05 | Ca(MoO4) |
| β | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Manganberzeliite | 8.AC.25 | (NaCa2)Mn2+2(AsO4)3 |
| β | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| β | Tilasite | 8.BB. | CaMg(AsO4)F |
| β | Sarkinite | 8.BB.15 | Mn2+2(AsO4)(OH) |
| β | Adamite | 8.BB.30 | Zn2(AsO4)(OH) |
| β | Allactite | 8.BE.30 | Mn2+7(AsO4)2(OH)8 |
| β | Flinkite | 8.BE.30 | Mn2+2Mn3+(AsO4)(OH)4 |
| β | Chlorophoenicite (TL) | 8.BE.35 | (Mn,Mg)3Zn2(AsO4)(OH,O)6 |
| β | Magnesiochlorophoenicite (TL) | 8.BE.35 | (Mg,Mn)3Zn2(AsO4)(OH,O)6 |
| β | 'Mineral E (of Dunn, et. al., 1982)' | 8.BE.35 | |
| β | Arakiite | 8.BE.45 | (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 |
| β | Holdenite (TL) | 8.BE.55 | (Mn2+,Mg)6Zn3(AsO4)2(SiO4)(OH)8 |
| β | Kolicite | 8.BE.60 | Mn2+7Zn4(AsO4)2(SiO4)2(OH)8 |
| β | Jarosewichite (TL) | 8.BE.70 | Mn2+3Mn3+(AsO4)(OH)6 |
| β | Peterchinite (TL) | 8.BH. | Zn3Zn2(OH)6As[O3(OH)3] |
| β | Carminite ? | 8.BH.30 | PbFe3+2(AsO4)2(OH)2 |
| β | Pyrobelonite | 8.BH.40 | PbMn2+(VO4)(OH) |
| β | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| β | Hedyphane | 8.BN.05 | Ca2Pb3(AsO4)3Cl |
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| β | Svabite | 8.BN.05 | Ca5(AsO4)3F |
| β | Johnbaumite (TL) | 8.BN.05 | Ca5(AsO4)3(OH) |
| β | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| β | Turneaureite (TL) | 8.BN.05 | Ca5(AsO4)3Cl |
| β | Annabergite | 8.CE.40 | Ni3(AsO4)2 Β· 8H2O |
| β | Wallkilldellite | 8.DL.20 | Ca2Mn2+3(AsO4)2(OH)4 Β· 9H2O |
| Group 9 - Silicates | |||
| β | Chrysotile | 9.. | Mg3(Si2O5)(OH)4 |
| β | Willemite | 9.AA.05 | Zn2SiO4 |
| β | var. Troostite | 9.AA.05 | (Zn,Mn)2SiO4 |
| β | Larsenite (TL) | 9.AB.10 | PbZnSiO4 |
| β | Esperite (TL) | 9.AB.15 | PbCa2Zn3(SiO4)3 |
| β | Glaucochroite (TL) | 9.AC.05 | CaMn2+SiO4 |
| β | Fayalite | 9.AC.05 | Fe2+2SiO4 |
| β | var. Roepperite (of Brush) | 9.AC.05 | (Fe2+,Mn,Zn)2SiO4 |
| β | Tephroite | 9.AC.05 | Mn2+2SiO4 |
| β | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| β | Andradite var. Melanite | 9.AD.25 | Ca3(Fe3+,Ti)2(SiO4)3 |
| β | var. Polyadelphite (TL) | 9.AD.25 | (Ca,Mn)3Fe3+2(SiO4)3 |
| β | 9.AD.25 | Ca3Fe3+2(SiO4)3 | |
| β | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| β | Almandine ? | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| β | Thorite var. Orangite | 9.AD.30 | Th(SiO4) |
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| β | Thorite | 9.AD.30 | Th(SiO4) |
| β | Hodgkinsonite (TL) | 9.AE.20 | Mn2+Zn2(SiO4)(OH)2 |
| β | Clinohedrite (TL) | 9.AE.30 | CaZn(SiO4) Β· H2O |
| β | Yeatmanite (TL) | 9.AE.45 | Zn6Mn2+9Sb5+2(SiO4)4O12 |
| β | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| β | Alleghanyite | 9.AF.45 | Mn2+5(SiO4)2(OH)2 |
| β | Manganhumite | 9.AF.50 | (Mn2+,Mg)7(SiO4)3(OH)2 |
| β | Humite | 9.AF.50 | Mg7(SiO4)3F2 |
| β | Sonolite | 9.AF.55 | Mn2+9(SiO4)4(OH)2 |
| β | Leucophoenicite (TL) | 9.AF.60 | Mn2+7(SiO4)3(OH)2 |
| β | Ribbeite | 9.AF.65 | Mn2+5(SiO4)2(OH)2 |
| β | Jerrygibbsite (TL) | 9.AF.70 | Mn2+9(SiO4)4(OH)2 |
| β | Chloritoid | 9.AF.85 | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | Kittatinnyite (TL) | 9.AG.35 | Ca2Mn2Mn(SiO4)2(OH)4 Β· 9H2O |
| β | Bultfonteinite | 9.AG.80 | Ca2(HSiO4)F Β· H2O |
| β | Fluorellestadite ? | 9.AH.25 | Ca5(SiO4)1.5(SO4)1.5F |
| β | Datolite | 9.AJ.20 | CaB(SiO4)(OH) |
| β | var. Bakerite | 9.AJ.20 | Ca4(H5B5Si3O20) |
| β | var. Botryolite | 9.AJ.20 | CaB(SiO4)(OH) |
| β | Hardystonite (TL) | 9.BB.10 | Ca2Zn[Si2O7] |
| β | Barylite | 9.BB.15 | Be2Ba(Si2O7) |
| β | Barysilite | 9.BC.20 | Pb8Mn2+[Si2O7]3 |
| β | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 Β· H2O |
| β | Junitoite | 9.BD.15 | CaZn2Si2O7 Β· H2O |
| β | Axinite-(Mn) (TL) | 9.BD.20 | Ca2Mn2+Al2BSi4O15(OH) |
| β | Cuspidine | 9.BE.17 | Ca8(Si2O7)2F4 |
| β | Nasonite (TL) | 9.BE.77 | Pb6Ca4(Si2O7)3Cl2 |
| β | Kentrolite | 9.BE.80 | Pb2Mn3+2(Si2O7)O2 |
| β | Samfowlerite (TL) | 9.BF.10 | Ca28Mn6Zn4(Be,Zn)4Be12[(OH)3(SiO4)3(Si2O7)2]4 |
| β | Hancockite (TL) | 9.BG.05a | (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β | Epidote-(Sr) | 9.BG.05a | (CaSr)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β | Ferriakasakaite-(La) | 9.BG.05b | (CaLa)(Fe3+AlMn2+)O[Si2O7][SiO4](OH) |
| β | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| β | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| β | Macfallite | 9.BG.15 | Ca2Mn3+3(SiO4)(Si2O7)(OH)3 |
| β | Pumpellyite-(Mg) | 9.BG.20 | Ca2MgAl2(Si2O7)(SiO4)(OH)2 Β· H2O |
| β | Ganomalite | 9.BG.25 | Pb9Ca5Mn(Si2O7)4(SiO4)O |
| β | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(β»4)β»[Si2O7]4[(SiO4)10]O(OH)9 |
| β | Cyprine | 9.BG.35 | Ca19Cu2+Al4(Al6Mg2)(β»4)β»[Si2O7]4[(SiO4)10](OH)(OH)9 |
| β | Vesuvianite var. Manganese-bearing Vesuvianite ? | 9.BG.35 | Ca19(Fe3+,Mn2+,Mn3+)Al4(Al6Mg2)(β»4)β»[Si2O7]4[(SiO4)10](O,OH)(OH)9 |
| β | Margarosanite (TL) | 9.CA.25 | Pb(Ca,Mn2+)2(Si3O9) |
| β | Roeblingite (TL) | 9.CB.05 | Pb2Ca6Mn2+(Si3O9)2(SO4)2(OH)2 Β· 4H2O |
| β | Fluor-uvite (TL) | 9.CK.05 | CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3F |
| β | Diopside | 9.DA.15 | CaMgSi2O6 |
| β | Johannsenite (TL) | 9.DA.15 | CaMn2+Si2O6 |
| β | Diopside var. Schefferite | 9.DA.15 | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| β | Petedunnite (TL) | 9.DA.15 | Ca(Zn,Mn2+,Mg,Fe2+)Si2O6 |
| β | Diopside var. Zinc-Schefferite | 9.DA.15 | Ca(Mg,Mn,Zn)Si2O6 |
| β | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| β | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| β | Aegirine-augite | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| β | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| β | Clino-suenoite | 9.DE. | β»{Mn2+2}{Mg5}(Si8O22)(OH)2 |
| β | Grunerite | 9.DE.05 | β»{Fe2+2}{Fe2+5}(Si8O22)(OH)2 |
| β | Magnesio-hornblende | 9.DE.10 | β»Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| β | Tremolite | 9.DE.10 | β»Ca2Mg5(Si8O22)(OH)2 |
| β | Actinolite | 9.DE.10 | β»Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| β | Hastingsite | 9.DE.15 | NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 |
| β | Edenite | 9.DE.15 | NaCa2Mg5(Si7Al)O22(OH)2 |
| β | Winchite | 9.DE.20 | β»{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| β | Richterite | 9.DE.20 | Na(NaCa)Mg5(Si8O22)(OH)2 |
| β | Magnesio-riebeckite | 9.DE.25 | β»{Na2}{Mg3Fe3+2}(Si8O22)(OH)2 |
| β | Bustamite (TL) | 9.DG.05 | CaMn2+(Si2O6) |
| β | Pectolite | 9.DG.05 | NaCa2Si3O8(OH) |
| β | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| β | Xonotlite | 9.DG.35 | Ca6(Si6O17)(OH)2 |
| β | 'Gageite-2M' (TL) | 9.DH. | (Mn,Mg,Zn)42Si16O54(OH)40 |
| β | Gageite (TL) | 9.DH.35 | Mn21(Si4O12)2O3(OH)20 |
| β | Ferrorhodonite | 9.DK. | CaMn3Fe[Si5O15] |
| β | Rhodonite var. Fowlerite (TL) | 9.DK.05 | (Mn2+,Zn,Ca)SiO3 |
| β | 9.DK.05 | CaMn3Mn[Si5O15] | |
| β | Marsturite (TL) | 9.DK.05 | NaCaMn3Si5O14(OH) |
| β | Hellandite-(Y) | 9.DK.20 | (Ca,REE)4Y2Alβ»2(B4Si4O22) (OH)2 |
| β | Pyroxferroite | 9.DO.05 | (Fe,Mn,Ca)SiO3 |
| β | Pyroxmangite | 9.DO.05 | Mn2+SiO3 |
| β | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| β | Fluorapophyllite-(K) | 9.EA.15 | KCa4(Si8O20)(F,OH) Β· 8H2O |
| β | Fluorapophyllite-(Na) ? | 9.EA.15 | NaCa4(Si8O20)F Β· 8H2O |
| β | Hydroxyapophyllite-(K) | 9.EA.15 | KCa4(Si8O20)(OH,F) Β· 8H2O |
| β | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| β | Muscovite var. Oellacherite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| β | Hendricksite (TL) | 9.EC.20 | KZn3(Si3Al)O10(OH)2 |
| β | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| β | 'Pimelite' | 9.EC.22 | Ni3Si4O10(OH)2 Β· 4H2O |
| β | Margarite | 9.EC.30 | CaAl2(Al2Si2O10)(OH)2 |
| β | Ferrokinoshitalite | 9.EC.35 | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| β | Saponite | 9.EC.45 | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 Β· nH2O |
| β | Gonyerite | 9.EC.55 | (Mn2+,Mg)5Fe3+(Fe3+Si3O10)(OH)8 |
| β | Pennantite | 9.EC.55 | Mn2+5Al(AlSi3O10)(OH)8 |
| β | Franklinfurnaceite (TL) | 9.EC.55 | Ca2Fe3+Mn2+3Mn3+(Zn2Si2O10)(OH)8 |
| β | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| β | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| β | 'Clinochrysotile' | 9.ED. | |
| β | Antigorite var. Vorhauserite | 9.ED.15 | (Mg,Mn)3(Si2O5)(OH)4 |
| β | Lizardite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| β | Caryopilite | 9.ED.15 | Mn2+3Si2O5(OH)4 |
| β | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| β | Neotocite | 9.ED.20 | (Mn,Fe,Mg)SiO3 Β· H2O |
| β | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 Β· nH2O, x < 1 |
| β | Bementite (TL) | 9.EE.05 | Mn7Si6O15(OH)8 |
| β | Friedelite | 9.EE.10 | Mn2+8Si6O15(OH,Cl)10 |
| β | Nelenite (TL) | 9.EE.15 | (Mn,Fe)16(Si12O30)(OH)14[As3+3O6(OH)3] |
| β | Schallerite (TL) | 9.EE.15 | Mn2+16As3Si12O36(OH)17 |
| β | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 Β· 6H2O |
| β | Minehillite (TL) | 9.EE.75 | (K,Na)2-3Ca28Zn4Al4Si40O112(OH)16 |
| β | Ganophyllite | 9.EG.30 | (K,Na,Ca)2Mn8(Si,Al)12(O,OH)32 Β· 8H2O |
| β | Franklinphilite (TL) | 9.EG.40 | (K,Na)4(Mn2+,Mg,Zn)48(Si,Al)72(O,OH)216 Β· 6H2O |
| β | Stilpnomelane var. Ferristilpnomelane | 9.EG.40 | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| β | Lennilenapeite (TL) | 9.EG.40 | K6-7(Mg,Mn,Fe,Zn)48(Si,Al)72(O,OH)216 Β· 16H2O |
| β | Stilpnomelane | 9.EG.40 | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 Β· nH2O |
| β | Bannisterite (TL) | 9.EG.75 | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 Β· nH2O |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| β | Celsian | 9.FA.30 | Ba(Al2Si2O8) |
| β | Microcline var. Hyalophane | 9.FA.30 | (K,Ba)[Al(Si,Al)Si2O8] |
| β | var. Amazonite | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | var. Anorthoclase | 9.FA.35 | (Na,K)AlSi3O8 |
| β | Genthelvite | 9.FB.10 | Be3Zn4(SiO4)3S |
| β | Meionite var. Algerite (TL) | 9.FB.15 | Ca4Al6Si6O24CO3 |
| β | 9.FB.15 | Ca4Al6Si6O24CO3 | |
| β | Natrolite | 9.GA.05 | Na2Al2Si3O10 Β· 2H2O |
| β | Thomsonite-Ca | 9.GA.10 | NaCa2[Al5Si5O20] Β· 6H2O |
| β | Analcime | 9.GB.05 | Na(AlSi2O6) Β· H2O |
| β | Wawayandaite (TL) | 9.HA.20 | Ca6Mn2BBe9Si6O23(OH,Cl)15 |
| β | Bostwickite (TL) | 9.HC.10 | CaMn3+6Si3O16 Β· 7H2O |
| Unclassified | |||
| β | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| β | 'Epidote Group' | - | (A12+A22+)(M13+M23+M33+)O[Si2O7][SiO4](OH) |
| β | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] Β· nH2O |
| β | 'UM1986-23-O:BaMnU' | - | Ba-Mn-U-O |
| β | 'Mineral B ("oyelite-like" mineral)' | - | Ca10Si8B2O29 Β· 12.5H2O |
| β | 'Fluor-uvite-Uvite Series' | - | |
| β | 'Humite Group' | - | |
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| β | 'Amphibole Supergroup var. Byssolite' | - | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| β | '' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| β | 'Hydrohausmannite' (TL) | - | |
| β | 'Hornblende Root Name Group' | - | β»Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| β | 'Scapolite' | - | |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Baumite' | - | |
| β | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] Β· nH2O |
| β | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | β Adamite | Zn2(AsO4)(OH) |
| H | β Allactite | Mn72+(AsO4)2(OH)8 |
| H | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | β Alleghanyite | Mn52+(SiO4)2(OH)2 |
| H | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | β Analcime | Na(AlSi2O6) · H2O |
| H | β Annabergite | Ni3(AsO4)2 · 8H2O |
| H | β Antigorite | Mg3(Si2O5)(OH)4 |
| H | β Antlerite | Cu3(SO4)(OH)4 |
| H | β Atacamite | Cu2(OH)3Cl |
| H | β Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | β Azurite | Cu3(CO3)2(OH)2 |
| H | β Datolite var. Bakerite | Ca4(H5B5Si3O20) |
| H | β Bannisterite | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| H | β Bementite | Mn7Si6O15(OH)8 |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Bostwickite | CaMn63+Si3O16 · 7H2O |
| H | β Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| H | β Bultfonteinite | Ca2(HSiO4)F · H2O |
| H | β Cahnite | Ca2[B(OH)4](AsO4) |
| H | β Carminite | PbFe23+(AsO4)2(OH)2 |
| H | β Caryopilite | Mn32+Si2O5(OH)4 |
| H | β Chlorophoenicite | (Mn,Mg)3Zn2(AsO4)(OH,O)6 |
| H | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| H | β Charlesite | Ca6(Al,Si)2(SO4)2[B(OH)4](OH,O)12 · 26H2O |
| H | β Chrysotile | Mg3(Si2O5)(OH)4 |
| H | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| H | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | β Cianciulliite | Mn(Mg,Mn)2Zn2(OH)10 · 2-4H2O |
| H | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | β Clinohedrite | CaZn(SiO4) · H2O |
| H | β Datolite | CaB(SiO4)(OH) |
| H | β Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| H | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | β Feitknechtite | Mn3+O(OH) |
| H | β Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| H | β Flinkite | Mn22+Mn3+(AsO4)(OH)4 |
| H | β Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| H | β Franklinfurnaceite | Ca2Fe3+Mn32+Mn3+(Zn2Si2O10)(OH)8 |
| H | β Franklinphilite | (K,Na)4(Mn2+,Mg,Zn)48(Si,Al)72(O,OH)216 · 6H2O |
| H | β Friedelite | Mn82+Si6O15(OH,Cl)10 |
| H | β Gageite | Mn21(Si4O12)2O3(OH)20 |
| H | β Ganophyllite | (K,Na,Ca)2Mn8(Si,Al)12(O,OH)32 · 8H2O |
| H | β Goethite | Ξ±-Fe3+O(OH) |
| H | β Gonyerite | (Mn2+,Mg)5Fe3+(Fe3+Si3O10)(OH)8 |
| H | β Groutite | Mn3+O(OH) |
| H | β Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| H | β Gypsum | CaSO4 · 2H2O |
| H | β Hancockite | (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | β Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| H | β Hauckite | Fe33+(Mg,Mn2+)24Zn18(SO4)4(CO3)2(OH)81 |
| H | β Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| H | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | β Hendricksite | KZn3(Si3Al)O10(OH)2 |
| H | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | β Hodgkinsonite | Mn2+Zn2(SiO4)(OH)2 |
| H | β Holdenite | (Mn2+,Mg)6Zn3(AsO4)2(SiO4)(OH)8 |
| H | β Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | β Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| H | β Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| H | β Hydroxylapatite | Ca5(PO4)3(OH) |
| H | β Hydrozincite | Zn5(CO3)2(OH)6 |
| H | β Jarosewichite | Mn32+Mn3+(AsO4)(OH)6 |
| H | β Jarosite | KFe33+(SO4)2(OH)6 |
| H | β Jerrygibbsite | Mn92+(SiO4)4(OH)2 |
| H | β Johnbaumite | Ca5(AsO4)3(OH) |
| H | β Junitoite | CaZn2Si2O7 · H2O |
| H | β Kittatinnyite | Ca2Mn2Mn(SiO4)2(OH)4 · 9H2O |
| H | β Kolicite | Mn72+Zn4(AsO4)2(SiO4)2(OH)8 |
| H | β Lennilenapeite | K6-7(Mg,Mn,Fe,Zn)48(Si,Al)72(O,OH)216 · 16H2O |
| H | β Leucophoenicite | Mn72+(SiO4)3(OH)2 |
| H | β HydroxycalcioromΓ©ite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| H | β Lizardite | Mg3(Si2O5)(OH)4 |
| H | β Loseyite | (Mn2+,Zn,Mg)4Zn3(CO3)2(OH)10 |
| H | β Manganhumite | (Mn2+,Mg)7(SiO4)3(OH)2 |
| H | β Magnesiochlorophoenicite | (Mg,Mn)3Zn2(AsO4)(OH,O)6 |
| H | β Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| H | β Macfallite | Ca2Mn33+(SiO4)(Si2O7)(OH)3 |
| H | β Magnesio-riebeckite | ◻{Na2}{Mg3Fe23+}(Si8O22)(OH)2 |
| H | β Manganite | Mn3+O(OH) |
| H | β Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| H | β Malachite | Cu2(CO3)(OH)2 |
| H | β Vesuvianite var. Manganese-bearing Vesuvianite | Ca19(Fe3+,Mn2+,Mn3+)Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](O,OH)(OH)9 |
| H | β Margarite | CaAl2(Al2Si2O10)(OH)2 |
| H | β Marsturite | NaCaMn3Si5O14(OH) |
| H | β Minehillite | (K,Na)2-3Ca28Zn4Al4Si40O112(OH)16 |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Fluorapophyllite-(Na) | NaCa4(Si8O20)F · 8H2O |
| H | β Nelenite | (Mn,Fe)16(Si12O30)(OH)14[As33+O6(OH)3] |
| H | β Neotocite | (Mn,Fe,Mg)SiO3 · H2O |
| H | β Natrolite | Na2Al2Si3O10 · 2H2O |
| H | β Opal | SiO2 · nH2O |
| H | β Pectolite | NaCa2Si3O8(OH) |
| H | β Pennantite | Mn52+Al(AlSi3O10)(OH)8 |
| H | β Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | β Prehnite | Ca2Al2Si3O10(OH)2 |
| H | β Pumpellyite-(Mg) | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| H | β Pyrobelonite | PbMn2+(VO4)(OH) |
| H | β Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | β Pyrochroite | Mn(OH)2 |
| H | β Ribbeite | Mn52+(SiO4)2(OH)2 |
| H | β Richterite | Na(NaCa)Mg5(Si8O22)(OH)2 |
| H | β Roeblingite | Pb2Ca6Mn2+(Si3O9)2(SO4)2(OH)2 · 4H2O |
| H | β Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | β Roweite | Ca2Mn22+B4O7(OH)6 |
| H | β Samfowlerite | Ca28Mn6Zn4(Be,Zn)4Be12[(OH)3(SiO4)3(Si2O7)2]4 |
| H | β Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| H | β Sarkinite | Mn22+(AsO4)(OH) |
| H | β Schallerite | Mn162+As3Si12O36(OH)17 |
| H | β Sclarite | Zn7(CO3)2(OH)10 |
| H | β Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | β Sonolite | Mn92+(SiO4)4(OH)2 |
| H | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | β Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| H | β Sussexite | Mn2+BO2(OH) |
| H | β SzaibΓ©lyite | MgBO2(OH) |
| H | β Talc | Mg3Si4O10(OH)2 |
| H | β Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| H | β Thorutite | (Th,U,Ca)Ti2(O,OH)6 |
| H | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | β Wallkilldellite | Ca2Mn32+(AsO4)2(OH)4 · 9H2O |
| H | β Wawayandaite | Ca6Mn2BBe9Si6O23(OH,Cl)15 |
| H | β Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| H | β Xonotlite | Ca6(Si6O17)(OH)2 |
| H | β Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | β Arakiite | (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 |
| H | β Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| H | β Gageite-2M | (Mn,Mg,Zn)42Si16O54(OH)40 |
| H | β Pimelite | Ni3Si4O10(OH)2 · 4H2O |
| H | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | β Stilpnomelane var. Ferristilpnomelane | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| H | β Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| H | β Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | β Epidote-(Sr) | (CaSr)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | β UM1986-10-CO:ClHMgMnZn (also called Mineral F, Dunn, 1995) | Mg5(Zn,Mn)3(CO3)2(OH,Cl)12 · H2O |
| H | β Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| H | β Antigorite var. Vorhauserite | (Mg,Mn)3(Si2O5)(OH)4 |
| H | β Fluor-uvite | CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3F |
| H | β Ferriakasakaite-(La) | (CaLa)(Fe3+AlMn2+)O[Si2O7][SiO4](OH) |
| H | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| H | β Epidote Group | (A12+A22+)(M13+M23+M33+)O[Si2O7][SiO4](OH) |
| H | β Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| H | β Clino-suenoite | ◻{Mn22+}{Mg5}(Si8O22)(OH)2 |
| H | β Mineral B ("oyelite-like" mineral) | Ca10Si8B2O29 · 12.5H2O |
| H | β Peterchinite | Zn3Zn2(OH)6As[O3(OH)3] |
| Be | Beryllium | |
| Be | β Barylite | Be2Ba(Si2O7) |
| Be | β Genthelvite | Be3Zn4(SiO4)3S |
| Be | β Samfowlerite | Ca28Mn6Zn4(Be,Zn)4Be12[(OH)3(SiO4)3(Si2O7)2]4 |
| Be | β Wawayandaite | Ca6Mn2BBe9Si6O23(OH,Cl)15 |
| B | Boron | |
| B | β Datolite var. Bakerite | Ca4(H5B5Si3O20) |
| B | β Cahnite | Ca2[B(OH)4](AsO4) |
| B | β Charlesite | Ca6(Al,Si)2(SO4)2[B(OH)4](OH,O)12 · 26H2O |
| B | β Datolite | CaB(SiO4)(OH) |
| B | β Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| B | β Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| B | β Roweite | Ca2Mn22+B4O7(OH)6 |
| B | β Sussexite | Mn2+BO2(OH) |
| B | β SzaibΓ©lyite | MgBO2(OH) |
| B | β Wawayandaite | Ca6Mn2BBe9Si6O23(OH,Cl)15 |
| B | β Fluor-uvite | CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3F |
| B | β Mineral B ("oyelite-like" mineral) | Ca10Si8B2O29 · 12.5H2O |
| C | Carbon | |
| C | β Meionite var. Algerite | Ca4Al6Si6O24CO3 |
| C | β Aragonite | CaCO3 |
| C | β Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | β Azurite | Cu3(CO3)2(OH)2 |
| C | β Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| C | β Calcite | CaCO3 |
| C | β Cerussite | PbCO3 |
| C | β Dolomite | CaMg(CO3)2 |
| C | β Graphite | C |
| C | β Hauckite | Fe33+(Mg,Mn2+)24Zn18(SO4)4(CO3)2(OH)81 |
| C | β Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | β Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| C | β Hydrozincite | Zn5(CO3)2(OH)6 |
| C | β Kutnohorite | CaMn2+(CO3)2 |
| C | β Loseyite | (Mn2+,Zn,Mg)4Zn3(CO3)2(OH)10 |
| C | β Malachite | Cu2(CO3)(OH)2 |
| C | β Meionite | Ca4Al6Si6O24CO3 |
| C | β Rhodochrosite | MnCO3 |
| C | β Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | β Sclarite | Zn7(CO3)2(OH)10 |
| C | β Siderite | FeCO3 |
| C | β Smithsonite | ZnCO3 |
| C | β Strontianite | SrCO3 |
| C | β Synchysite-(Ce) | CaCe(CO3)2F |
| C | β UM1986-10-CO:ClHMgMnZn (also called Mineral F, Dunn, 1995) | Mg5(Zn,Mn)3(CO3)2(OH,Cl)12 · H2O |
| O | Oxygen | |
| O | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | β Adamite | Zn2(AsO4)(OH) |
| O | β Aegirine | NaFe3+Si2O6 |
| O | β Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | β Albite | Na(AlSi3O8) |
| O | β Meionite var. Algerite | Ca4Al6Si6O24CO3 |
| O | β Allactite | Mn72+(AsO4)2(OH)8 |
| O | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | β Alleghanyite | Mn52+(SiO4)2(OH)2 |
| O | β Microcline var. Amazonite | K(AlSi3O8) |
| O | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | β Analcime | Na(AlSi2O6) · H2O |
| O | β Anatase | TiO2 |
| O | β Andradite | Ca3Fe23+(SiO4)3 |
| O | β Anglesite | PbSO4 |
| O | β Anhydrite | CaSO4 |
| O | β Annabergite | Ni3(AsO4)2 · 8H2O |
| O | β Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| O | β Antigorite | Mg3(Si2O5)(OH)4 |
| O | β Antlerite | Cu3(SO4)(OH)4 |
| O | β Aragonite | CaCO3 |
| O | β Atacamite | Cu2(OH)3Cl |
| O | β Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | β Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | β Azurite | Cu3(CO3)2(OH)2 |
| O | β Almandine | Fe32+Al2(SiO4)3 |
| O | β Datolite var. Bakerite | Ca4(H5B5Si3O20) |
| O | β Bannisterite | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| O | β Barylite | Be2Ba(Si2O7) |
| O | β Barysilite | Pb8Mn2+[Si2O7]3 |
| O | β Baryte | BaSO4 |
| O | β Bementite | Mn7Si6O15(OH)8 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Bostwickite | CaMn63+Si3O16 · 7H2O |
| O | β Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| O | β Brookite | TiO2 |
| O | β Bultfonteinite | Ca2(HSiO4)F · H2O |
| O | β Bustamite | CaMn2+(Si2O6) |
| O | β Cahnite | Ca2[B(OH)4](AsO4) |
| O | β Calcite | CaCO3 |
| O | β Carminite | PbFe23+(AsO4)2(OH)2 |
| O | β Caryopilite | Mn32+Si2O5(OH)4 |
| O | β Celestine | SrSO4 |
| O | β Celsian | Ba(Al2Si2O8) |
| O | β Cerussite | PbCO3 |
| O | β Chlorophoenicite | (Mn,Mg)3Zn2(AsO4)(OH,O)6 |
| O | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| O | β Charlesite | Ca6(Al,Si)2(SO4)2[B(OH)4](OH,O)12 · 26H2O |
| O | β Chrysotile | Mg3(Si2O5)(OH)4 |
| O | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| O | β Chondrodite | Mg5(SiO4)2F2 |
| O | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | β Cianciulliite | Mn(Mg,Mn)2Zn2(OH)10 · 2-4H2O |
| O | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | β Clinohedrite | CaZn(SiO4) · H2O |
| O | β Cuprite | Cu2O |
| O | β Cuspidine | Ca8(Si2O7)2F4 |
| O | β Diopside | CaMgSi2O6 |
| O | β Dolomite | CaMg(CO3)2 |
| O | β Datolite | CaB(SiO4)(OH) |
| O | β Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| O | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | β Esperite | PbCa2Zn3(SiO4)3 |
| O | β Fayalite | Fe22+SiO4 |
| O | β Feitknechtite | Mn3+O(OH) |
| O | β Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| O | β Flinkite | Mn22+Mn3+(AsO4)(OH)4 |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| O | β Fluorellestadite | Ca5(SiO4)1.5(SO4)1.5F |
| O | β Franklinfurnaceite | Ca2Fe3+Mn32+Mn3+(Zn2Si2O10)(OH)8 |
| O | β Franklinite | Zn2+Fe23+O4 |
| O | β Franklinphilite | (K,Na)4(Mn2+,Mg,Zn)48(Si,Al)72(O,OH)216 · 6H2O |
| O | β Friedelite | Mn82+Si6O15(OH,Cl)10 |
| O | β Gageite | Mn21(Si4O12)2O3(OH)20 |
| O | β Gahnite | ZnAl2O4 |
| O | β Ganomalite | Pb9Ca5Mn(Si2O7)4(SiO4)O |
| O | β Ganophyllite | (K,Na,Ca)2Mn8(Si,Al)12(O,OH)32 · 8H2O |
| O | β Genthelvite | Be3Zn4(SiO4)3S |
| O | β Glaucochroite | CaMn2+SiO4 |
| O | β Goethite | Ξ±-Fe3+O(OH) |
| O | β Gonyerite | (Mn2+,Mg)5Fe3+(Fe3+Si3O10)(OH)8 |
| O | β Grossular | Ca3Al2(SiO4)3 |
| O | β Groutite | Mn3+O(OH) |
| O | β Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| O | β Gypsum | CaSO4 · 2H2O |
| O | β Hancockite | (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | β Hardystonite | Ca2Zn[Si2O7] |
| O | β Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| O | β Hauckite | Fe33+(Mg,Mn2+)24Zn18(SO4)4(CO3)2(OH)81 |
| O | β Hausmannite | Mn2+Mn23+O4 |
| O | β Hedenbergite | CaFe2+Si2O6 |
| O | β Hedyphane | Ca2Pb3(AsO4)3Cl |
| O | β Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| O | β Hematite | Fe2O3 |
| O | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | β Hendricksite | KZn3(Si3Al)O10(OH)2 |
| O | β Hetaerolite | ZnMn2O4 |
| O | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | β Hodgkinsonite | Mn2+Zn2(SiO4)(OH)2 |
| O | β Holdenite | (Mn2+,Mg)6Zn3(AsO4)2(SiO4)(OH)8 |
| O | β HΓΌbnerite | MnWO4 |
| O | β Humite | Mg7(SiO4)3F2 |
| O | β Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| O | β Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | β Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| O | β Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| O | β Hydroxylapatite | Ca5(PO4)3(OH) |
| O | β Hydrozincite | Zn5(CO3)2(OH)6 |
| O | β Ilmenite | Fe2+TiO3 |
| O | β Jacobsite | Mn2+Fe23+O4 |
| O | β Jarosewichite | Mn32+Mn3+(AsO4)(OH)6 |
| O | β Jarosite | KFe33+(SO4)2(OH)6 |
| O | β Jerrygibbsite | Mn92+(SiO4)4(OH)2 |
| O | β Johannsenite | CaMn2+Si2O6 |
| O | β Johnbaumite | Ca5(AsO4)3(OH) |
| O | β Junitoite | CaZn2Si2O7 · H2O |
| O | β Kentrolite | Pb2Mn23+(Si2O7)O2 |
| O | β Kittatinnyite | Ca2Mn2Mn(SiO4)2(OH)4 · 9H2O |
| O | β Kolicite | Mn72+Zn4(AsO4)2(SiO4)2(OH)8 |
| O | β Kutnohorite | CaMn2+(CO3)2 |
| O | β Larsenite | PbZnSiO4 |
| O | β Lennilenapeite | K6-7(Mg,Mn,Fe,Zn)48(Si,Al)72(O,OH)216 · 16H2O |
| O | β Leucophoenicite | Mn72+(SiO4)3(OH)2 |
| O | β HydroxycalcioromΓ©ite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| O | β Lizardite | Mg3(Si2O5)(OH)4 |
| O | β Loseyite | (Mn2+,Zn,Mg)4Zn3(CO3)2(OH)10 |
| O | β Manganhumite | (Mn2+,Mg)7(SiO4)3(OH)2 |
| O | β Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| O | β Magnesiochlorophoenicite | (Mg,Mn)3Zn2(AsO4)(OH,O)6 |
| O | β Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| O | β Manganosite | MnO |
| O | β Macfallite | Ca2Mn33+(SiO4)(Si2O7)(OH)3 |
| O | β Magnesio-riebeckite | ◻{Na2}{Mg3Fe23+}(Si8O22)(OH)2 |
| O | β Manganite | Mn3+O(OH) |
| O | β Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| O | β Magnetite | Fe2+Fe23+O4 |
| O | β Malachite | Cu2(CO3)(OH)2 |
| O | β Vesuvianite var. Manganese-bearing Vesuvianite | Ca19(Fe3+,Mn2+,Mn3+)Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](O,OH)(OH)9 |
| O | β Margarite | CaAl2(Al2Si2O10)(OH)2 |
| O | β Margarosanite | Pb(Ca,Mn2+)2(Si3O9) |
| O | β Marsturite | NaCaMn3Si5O14(OH) |
| O | β Meionite | Ca4Al6Si6O24CO3 |
| O | β Microcline | K(AlSi3O8) |
| O | β Mimetite | Pb5(AsO4)3Cl |
| O | β Minehillite | (K,Na)2-3Ca28Zn4Al4Si40O112(OH)16 |
| O | β Monazite-(Ce) | Ce(PO4) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Nasonite | Pb6Ca4(Si2O7)3Cl2 |
| O | β Fluorapophyllite-(Na) | NaCa4(Si8O20)F · 8H2O |
| O | β Nelenite | (Mn,Fe)16(Si12O30)(OH)14[As33+O6(OH)3] |
| O | β Neotocite | (Mn,Fe,Mg)SiO3 · H2O |
| O | β Natrolite | Na2Al2Si3O10 · 2H2O |
| O | β Opal | SiO2 · nH2O |
| O | β Thorite var. Orangite | Th(SiO4) |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Pectolite | NaCa2Si3O8(OH) |
| O | β Pennantite | Mn52+Al(AlSi3O10)(OH)8 |
| O | β Petedunnite | Ca(Zn,Mn2+,Mg,Fe2+)Si2O6 |
| O | β Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | β Powellite | Ca(MoO4) |
| O | β Prehnite | Ca2Al2Si3O10(OH)2 |
| O | β Pumpellyite-(Mg) | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| O | β Pyrobelonite | PbMn2+(VO4)(OH) |
| O | β Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | β Pyrochroite | Mn(OH)2 |
| O | β Pyroxferroite | (Fe,Mn,Ca)SiO3 |
| O | β Pyroxmangite | Mn2+SiO3 |
| O | β Quartz | SiO2 |
| O | β Rhodochrosite | MnCO3 |
| O | β Rhodonite | CaMn3Mn[Si5O15] |
| O | β Ribbeite | Mn52+(SiO4)2(OH)2 |
| O | β Richterite | Na(NaCa)Mg5(Si8O22)(OH)2 |
| O | β Roeblingite | Pb2Ca6Mn2+(Si3O9)2(SO4)2(OH)2 · 4H2O |
| O | β RomΓ©ite Group | A2(Sb5+)2O6Z |
| O | β Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | β Roweite | Ca2Mn22+B4O7(OH)6 |
| O | β Rutile | TiO2 |
| O | β Samfowlerite | Ca28Mn6Zn4(Be,Zn)4Be12[(OH)3(SiO4)3(Si2O7)2]4 |
| O | β Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| O | β Sarkinite | Mn22+(AsO4)(OH) |
| O | β Schallerite | Mn162+As3Si12O36(OH)17 |
| O | β Scheelite | Ca(WO4) |
| O | β Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| O | β Sclarite | Zn7(CO3)2(OH)10 |
| O | β Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | β Siderite | FeCO3 |
| O | β Smithsonite | ZnCO3 |
| O | β Sonolite | Mn92+(SiO4)4(OH)2 |
| O | β Spessartine | Mn32+Al2(SiO4)3 |
| O | β Spinel | MgAl2O4 |
| O | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | β Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| O | β Strontianite | SrCO3 |
| O | β Sussexite | Mn2+BO2(OH) |
| O | β Svabite | Ca5(AsO4)3F |
| O | β Synchysite-(Ce) | CaCe(CO3)2F |
| O | β SzaibΓ©lyite | MgBO2(OH) |
| O | β Talc | Mg3Si4O10(OH)2 |
| O | β Tenorite | CuO |
| O | β Tephroite | Mn22+SiO4 |
| O | β Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| O | β Thorite | Th(SiO4) |
| O | β Thorutite | (Th,U,Ca)Ti2(O,OH)6 |
| O | β Tilasite | CaMg(AsO4)F |
| O | β Titanite | CaTi(SiO4)O |
| O | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | β Turneaureite | Ca5(AsO4)3Cl |
| O | β Uraninite | UO2 |
| O | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | β Wallkilldellite | Ca2Mn32+(AsO4)2(OH)4 · 9H2O |
| O | β Wawayandaite | Ca6Mn2BBe9Si6O23(OH,Cl)15 |
| O | β Willemite | Zn2SiO4 |
| O | β Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| O | β Wollastonite | Ca3(Si3O9) |
| O | β Xonotlite | Ca6(Si6O17)(OH)2 |
| O | β Yeatmanite | Zn6Mn92+Sb25+(SiO4)4O12 |
| O | β Zincite | ZnO |
| O | β Zircon | Zr(SiO4) |
| O | β Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | β Willemite var. Troostite | (Zn,Mn)2SiO4 |
| O | β Arakiite | (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 |
| O | β Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| O | β Gageite-2M | (Mn,Mg,Zn)42Si16O54(OH)40 |
| O | β Pimelite | Ni3Si4O10(OH)2 · 4H2O |
| O | β Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
| O | β Diopside var. Zinc-Schefferite | Ca(Mg,Mn,Zn)Si2O6 |
| O | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | β Andradite var. Polyadelphite | (Ca,Mn)3Fe23+(SiO4)3 |
| O | β Stilpnomelane var. Ferristilpnomelane | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| O | β Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| O | β Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | β Rhodonite var. Fowlerite | (Mn2+,Zn,Ca)SiO3 |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | β Epidote-(Sr) | (CaSr)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | β UM1986-10-CO:ClHMgMnZn (also called Mineral F, Dunn, 1995) | Mg5(Zn,Mn)3(CO3)2(OH,Cl)12 · H2O |
| O | β Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| O | β Antigorite var. Vorhauserite | (Mg,Mn)3(Si2O5)(OH)4 |
| O | β Fluor-uvite | CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3F |
| O | β Fayalite var. Roepperite (of Brush) | (Fe2+,Mn,Zn)2SiO4 |
| O | β Ferriakasakaite-(La) | (CaLa)(Fe3+AlMn2+)O[Si2O7][SiO4](OH) |
| O | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | β Epidote Group | (A12+A22+)(M13+M23+M33+)O[Si2O7][SiO4](OH) |
| O | β Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| O | β Ferrorhodonite | CaMn3Fe[Si5O15] |
| O | β UM1986-23-O:BaMnU | Ba-Mn-U-O |
| O | β Clino-suenoite | ◻{Mn22+}{Mg5}(Si8O22)(OH)2 |
| O | β Mineral B ("oyelite-like" mineral) | Ca10Si8B2O29 · 12.5H2O |
| O | β Peterchinite | Zn3Zn2(OH)6As[O3(OH)3] |
| F | Fluorine | |
| F | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β Bultfonteinite | Ca2(HSiO4)F · H2O |
| F | β Fluorite var. Chlorophane | CaF2 |
| F | β Chondrodite | Mg5(SiO4)2F2 |
| F | β Cuspidine | Ca8(Si2O7)2F4 |
| F | β Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| F | β Fluorapatite | Ca5(PO4)3F |
| F | β Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| F | β Fluorellestadite | Ca5(SiO4)1.5(SO4)1.5F |
| F | β Fluorite | CaF2 |
| F | β Humite | Mg7(SiO4)3F2 |
| F | β Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| F | β Fluorapophyllite-(Na) | NaCa4(Si8O20)F · 8H2O |
| F | β Svabite | Ca5(AsO4)3F |
| F | β Synchysite-(Ce) | CaCe(CO3)2F |
| F | β Tilasite | CaMg(AsO4)F |
| F | β Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| F | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | β Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | β Fluor-uvite | CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3F |
| Na | Sodium | |
| Na | β Aegirine | NaFe3+Si2O6 |
| Na | β Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Analcime | Na(AlSi2O6) · H2O |
| Na | β Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Na | β Bannisterite | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| Na | β Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Na | β Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| Na | β Franklinphilite | (K,Na)4(Mn2+,Mg,Zn)48(Si,Al)72(O,OH)216 · 6H2O |
| Na | β Ganophyllite | (K,Na,Ca)2Mn8(Si,Al)12(O,OH)32 · 8H2O |
| Na | β Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Na | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | β Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| Na | β Magnesio-riebeckite | ◻{Na2}{Mg3Fe23+}(Si8O22)(OH)2 |
| Na | β Marsturite | NaCaMn3Si5O14(OH) |
| Na | β Meionite | Ca4Al6Si6O24CO3 |
| Na | β Minehillite | (K,Na)2-3Ca28Zn4Al4Si40O112(OH)16 |
| Na | β Fluorapophyllite-(Na) | NaCa4(Si8O20)F · 8H2O |
| Na | β Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | β Pectolite | NaCa2Si3O8(OH) |
| Na | β Richterite | Na(NaCa)Mg5(Si8O22)(OH)2 |
| Na | β Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Na | β Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Na | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Na | β Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Na | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | β Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| Mg | Magnesium | |
| Mg | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | β Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | β Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | β Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | β Chlorophoenicite | (Mn,Mg)3Zn2(AsO4)(OH,O)6 |
| Mg | β Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Mg | β Chondrodite | Mg5(SiO4)2F2 |
| Mg | β Cianciulliite | Mn(Mg,Mn)2Zn2(OH)10 · 2-4H2O |
| Mg | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | β Diopside | CaMgSi2O6 |
| Mg | β Dolomite | CaMg(CO3)2 |
| Mg | β Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Mg | β Franklinphilite | (K,Na)4(Mn2+,Mg,Zn)48(Si,Al)72(O,OH)216 · 6H2O |
| Mg | β Gonyerite | (Mn2+,Mg)5Fe3+(Fe3+Si3O10)(OH)8 |
| Mg | β Hauckite | Fe33+(Mg,Mn2+)24Zn18(SO4)4(CO3)2(OH)81 |
| Mg | β Holdenite | (Mn2+,Mg)6Zn3(AsO4)2(SiO4)(OH)8 |
| Mg | β Humite | Mg7(SiO4)3F2 |
| Mg | β Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| Mg | β Lennilenapeite | K6-7(Mg,Mn,Fe,Zn)48(Si,Al)72(O,OH)216 · 16H2O |
| Mg | β Lizardite | Mg3(Si2O5)(OH)4 |
| Mg | β Loseyite | (Mn2+,Zn,Mg)4Zn3(CO3)2(OH)10 |
| Mg | β Manganhumite | (Mn2+,Mg)7(SiO4)3(OH)2 |
| Mg | β Magnesiochlorophoenicite | (Mg,Mn)3Zn2(AsO4)(OH,O)6 |
| Mg | β Magnesio-riebeckite | ◻{Na2}{Mg3Fe23+}(Si8O22)(OH)2 |
| Mg | β Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Mg | β Vesuvianite var. Manganese-bearing Vesuvianite | Ca19(Fe3+,Mn2+,Mn3+)Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](O,OH)(OH)9 |
| Mg | β Neotocite | (Mn,Fe,Mg)SiO3 · H2O |
| Mg | β Petedunnite | Ca(Zn,Mn2+,Mg,Fe2+)Si2O6 |
| Mg | β Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | β Pumpellyite-(Mg) | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| Mg | β Richterite | Na(NaCa)Mg5(Si8O22)(OH)2 |
| Mg | β Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Mg | β Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Mg | β Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | β Spinel | MgAl2O4 |
| Mg | β Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Mg | β SzaibΓ©lyite | MgBO2(OH) |
| Mg | β Talc | Mg3Si4O10(OH)2 |
| Mg | β Tilasite | CaMg(AsO4)F |
| Mg | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | β Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Mg | β Arakiite | (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 |
| Mg | β Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| Mg | β Gageite-2M | (Mn,Mg,Zn)42Si16O54(OH)40 |
| Mg | β Diopside var. Zinc-Schefferite | Ca(Mg,Mn,Zn)Si2O6 |
| Mg | β Stilpnomelane var. Ferristilpnomelane | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| Mg | β UM1986-10-CO:ClHMgMnZn (also called Mineral F, Dunn, 1995) | Mg5(Zn,Mn)3(CO3)2(OH,Cl)12 · H2O |
| Mg | β Antigorite var. Vorhauserite | (Mg,Mn)3(Si2O5)(OH)4 |
| Mg | β Fluor-uvite | CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3F |
| Mg | β Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Mg | β Clino-suenoite | ◻{Mn22+}{Mg5}(Si8O22)(OH)2 |
| Al | Aluminium | |
| Al | β Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Meionite var. Algerite | Ca4Al6Si6O24CO3 |
| Al | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | β Microcline var. Amazonite | K(AlSi3O8) |
| Al | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | β Analcime | Na(AlSi2O6) · H2O |
| Al | β Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Al | β Almandine | Fe32+Al2(SiO4)3 |
| Al | β Bannisterite | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Celsian | Ba(Al2Si2O8) |
| Al | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Al | β Charlesite | Ca6(Al,Si)2(SO4)2[B(OH)4](OH,O)12 · 26H2O |
| Al | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Al | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | β Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Al | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | β Franklinphilite | (K,Na)4(Mn2+,Mg,Zn)48(Si,Al)72(O,OH)216 · 6H2O |
| Al | β Gahnite | ZnAl2O4 |
| Al | β Ganophyllite | (K,Na,Ca)2Mn8(Si,Al)12(O,OH)32 · 8H2O |
| Al | β Grossular | Ca3Al2(SiO4)3 |
| Al | β Hancockite | (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | β Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Al | β Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| Al | β Hendricksite | KZn3(Si3Al)O10(OH)2 |
| Al | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | β Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Al | β Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| Al | β Lennilenapeite | K6-7(Mg,Mn,Fe,Zn)48(Si,Al)72(O,OH)216 · 16H2O |
| Al | β Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Al | β Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Al | β Vesuvianite var. Manganese-bearing Vesuvianite | Ca19(Fe3+,Mn2+,Mn3+)Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](O,OH)(OH)9 |
| Al | β Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Al | β Meionite | Ca4Al6Si6O24CO3 |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Minehillite | (K,Na)2-3Ca28Zn4Al4Si40O112(OH)16 |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Pennantite | Mn52+Al(AlSi3O10)(OH)8 |
| Al | β Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | β Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | β Pumpellyite-(Mg) | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| Al | β Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Al | β Spessartine | Mn32+Al2(SiO4)3 |
| Al | β Spinel | MgAl2O4 |
| Al | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | β Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Al | β Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Al | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Al | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | β Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Al | β Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | β Arakiite | (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 |
| Al | β Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| Al | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | β Stilpnomelane var. Ferristilpnomelane | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| Al | β Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| Al | β Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | β Epidote-(Sr) | (CaSr)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | β Fluor-uvite | CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3F |
| Al | β Ferriakasakaite-(La) | (CaLa)(Fe3+AlMn2+)O[Si2O7][SiO4](OH) |
| Al | β Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Si | Silicon | |
| Si | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | β Aegirine | NaFe3+Si2O6 |
| Si | β Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Meionite var. Algerite | Ca4Al6Si6O24CO3 |
| Si | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | β Alleghanyite | Mn52+(SiO4)2(OH)2 |
| Si | β Microcline var. Amazonite | K(AlSi3O8) |
| Si | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | β Analcime | Na(AlSi2O6) · H2O |
| Si | β Andradite | Ca3Fe23+(SiO4)3 |
| Si | β Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Si | β Antigorite | Mg3(Si2O5)(OH)4 |
| Si | β Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | β Almandine | Fe32+Al2(SiO4)3 |
| Si | β Datolite var. Bakerite | Ca4(H5B5Si3O20) |
| Si | β Bannisterite | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| Si | β Barylite | Be2Ba(Si2O7) |
| Si | β Barysilite | Pb8Mn2+[Si2O7]3 |
| Si | β Bementite | Mn7Si6O15(OH)8 |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Bostwickite | CaMn63+Si3O16 · 7H2O |
| Si | β Bultfonteinite | Ca2(HSiO4)F · H2O |
| Si | β Bustamite | CaMn2+(Si2O6) |
| Si | β Caryopilite | Mn32+Si2O5(OH)4 |
| Si | β Celsian | Ba(Al2Si2O8) |
| Si | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Si | β Charlesite | Ca6(Al,Si)2(SO4)2[B(OH)4](OH,O)12 · 26H2O |
| Si | β Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Si | β Chondrodite | Mg5(SiO4)2F2 |
| Si | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | β Clinohedrite | CaZn(SiO4) · H2O |
| Si | β Cuspidine | Ca8(Si2O7)2F4 |
| Si | β Diopside | CaMgSi2O6 |
| Si | β Datolite | CaB(SiO4)(OH) |
| Si | β Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Si | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | β Esperite | PbCa2Zn3(SiO4)3 |
| Si | β Fayalite | Fe22+SiO4 |
| Si | β Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Si | β Fluorellestadite | Ca5(SiO4)1.5(SO4)1.5F |
| Si | β Franklinfurnaceite | Ca2Fe3+Mn32+Mn3+(Zn2Si2O10)(OH)8 |
| Si | β Franklinphilite | (K,Na)4(Mn2+,Mg,Zn)48(Si,Al)72(O,OH)216 · 6H2O |
| Si | β Friedelite | Mn82+Si6O15(OH,Cl)10 |
| Si | β Gageite | Mn21(Si4O12)2O3(OH)20 |
| Si | β Ganomalite | Pb9Ca5Mn(Si2O7)4(SiO4)O |
| Si | β Ganophyllite | (K,Na,Ca)2Mn8(Si,Al)12(O,OH)32 · 8H2O |
| Si | β Genthelvite | Be3Zn4(SiO4)3S |
| Si | β Glaucochroite | CaMn2+SiO4 |
| Si | β Gonyerite | (Mn2+,Mg)5Fe3+(Fe3+Si3O10)(OH)8 |
| Si | β Grossular | Ca3Al2(SiO4)3 |
| Si | β Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| Si | β Hancockite | (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | β Hardystonite | Ca2Zn[Si2O7] |
| Si | β Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Si | β Hedenbergite | CaFe2+Si2O6 |
| Si | β Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| Si | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | β Hendricksite | KZn3(Si3Al)O10(OH)2 |
| Si | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | β Hodgkinsonite | Mn2+Zn2(SiO4)(OH)2 |
| Si | β Holdenite | (Mn2+,Mg)6Zn3(AsO4)2(SiO4)(OH)8 |
| Si | β Humite | Mg7(SiO4)3F2 |
| Si | β Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Si | β Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| Si | β Jerrygibbsite | Mn92+(SiO4)4(OH)2 |
| Si | β Johannsenite | CaMn2+Si2O6 |
| Si | β Junitoite | CaZn2Si2O7 · H2O |
| Si | β Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Si | β Kittatinnyite | Ca2Mn2Mn(SiO4)2(OH)4 · 9H2O |
| Si | β Kolicite | Mn72+Zn4(AsO4)2(SiO4)2(OH)8 |
| Si | β Larsenite | PbZnSiO4 |
| Si | β Lennilenapeite | K6-7(Mg,Mn,Fe,Zn)48(Si,Al)72(O,OH)216 · 16H2O |
| Si | β Leucophoenicite | Mn72+(SiO4)3(OH)2 |
| Si | β Lizardite | Mg3(Si2O5)(OH)4 |
| Si | β Manganhumite | (Mn2+,Mg)7(SiO4)3(OH)2 |
| Si | β Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Si | β Macfallite | Ca2Mn33+(SiO4)(Si2O7)(OH)3 |
| Si | β Magnesio-riebeckite | ◻{Na2}{Mg3Fe23+}(Si8O22)(OH)2 |
| Si | β Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Si | β Vesuvianite var. Manganese-bearing Vesuvianite | Ca19(Fe3+,Mn2+,Mn3+)Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](O,OH)(OH)9 |
| Si | β Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Si | β Margarosanite | Pb(Ca,Mn2+)2(Si3O9) |
| Si | β Marsturite | NaCaMn3Si5O14(OH) |
| Si | β Meionite | Ca4Al6Si6O24CO3 |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Minehillite | (K,Na)2-3Ca28Zn4Al4Si40O112(OH)16 |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Nasonite | Pb6Ca4(Si2O7)3Cl2 |
| Si | β Fluorapophyllite-(Na) | NaCa4(Si8O20)F · 8H2O |
| Si | β Nelenite | (Mn,Fe)16(Si12O30)(OH)14[As33+O6(OH)3] |
| Si | β Neotocite | (Mn,Fe,Mg)SiO3 · H2O |
| Si | β Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | β Opal | SiO2 · nH2O |
| Si | β Thorite var. Orangite | Th(SiO4) |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Pectolite | NaCa2Si3O8(OH) |
| Si | β Pennantite | Mn52+Al(AlSi3O10)(OH)8 |
| Si | β Petedunnite | Ca(Zn,Mn2+,Mg,Fe2+)Si2O6 |
| Si | β Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | β Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | β Pumpellyite-(Mg) | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| Si | β Pyroxferroite | (Fe,Mn,Ca)SiO3 |
| Si | β Pyroxmangite | Mn2+SiO3 |
| Si | β Quartz | SiO2 |
| Si | β Rhodonite | CaMn3Mn[Si5O15] |
| Si | β Ribbeite | Mn52+(SiO4)2(OH)2 |
| Si | β Richterite | Na(NaCa)Mg5(Si8O22)(OH)2 |
| Si | β Roeblingite | Pb2Ca6Mn2+(Si3O9)2(SO4)2(OH)2 · 4H2O |
| Si | β Samfowlerite | Ca28Mn6Zn4(Be,Zn)4Be12[(OH)3(SiO4)3(Si2O7)2]4 |
| Si | β Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Si | β Schallerite | Mn162+As3Si12O36(OH)17 |
| Si | β Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Si | β Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | β Sonolite | Mn92+(SiO4)4(OH)2 |
| Si | β Spessartine | Mn32+Al2(SiO4)3 |
| Si | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | β Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Si | β Talc | Mg3Si4O10(OH)2 |
| Si | β Tephroite | Mn22+SiO4 |
| Si | β Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Si | β Thorite | Th(SiO4) |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | β Wawayandaite | Ca6Mn2BBe9Si6O23(OH,Cl)15 |
| Si | β Willemite | Zn2SiO4 |
| Si | β Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Si | β Wollastonite | Ca3(Si3O9) |
| Si | β Xonotlite | Ca6(Si6O17)(OH)2 |
| Si | β Yeatmanite | Zn6Mn92+Sb25+(SiO4)4O12 |
| Si | β Zircon | Zr(SiO4) |
| Si | β Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | β Willemite var. Troostite | (Zn,Mn)2SiO4 |
| Si | β Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| Si | β Gageite-2M | (Mn,Mg,Zn)42Si16O54(OH)40 |
| Si | β Pimelite | Ni3Si4O10(OH)2 · 4H2O |
| Si | β Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
| Si | β Diopside var. Zinc-Schefferite | Ca(Mg,Mn,Zn)Si2O6 |
| Si | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | β Andradite var. Polyadelphite | (Ca,Mn)3Fe23+(SiO4)3 |
| Si | β Stilpnomelane var. Ferristilpnomelane | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| Si | β Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| Si | β Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | β Rhodonite var. Fowlerite | (Mn2+,Zn,Ca)SiO3 |
| Si | β Epidote-(Sr) | (CaSr)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | β Antigorite var. Vorhauserite | (Mg,Mn)3(Si2O5)(OH)4 |
| Si | β Fluor-uvite | CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3F |
| Si | β Fayalite var. Roepperite (of Brush) | (Fe2+,Mn,Zn)2SiO4 |
| Si | β Ferriakasakaite-(La) | (CaLa)(Fe3+AlMn2+)O[Si2O7][SiO4](OH) |
| Si | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Si | β Epidote Group | (A12+A22+)(M13+M23+M33+)O[Si2O7][SiO4](OH) |
| Si | β Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Si | β Ferrorhodonite | CaMn3Fe[Si5O15] |
| Si | β Clino-suenoite | ◻{Mn22+}{Mg5}(Si8O22)(OH)2 |
| Si | β Mineral B ("oyelite-like" mineral) | Ca10Si8B2O29 · 12.5H2O |
| P | Phosphorus | |
| P | β Fluorapatite | Ca5(PO4)3F |
| P | β Hydroxylapatite | Ca5(PO4)3(OH) |
| P | β Monazite-(Ce) | Ce(PO4) |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | β Acanthite | Ag2S |
| S | β Alabandite | MnS |
| S | β Anglesite | PbSO4 |
| S | β Anhydrite | CaSO4 |
| S | β Antlerite | Cu3(SO4)(OH)4 |
| S | β Arsenopyrite | FeAsS |
| S | β Baryte | BaSO4 |
| S | β Bornite | Cu5FeS4 |
| S | β Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| S | β Carrollite | CuCo2S4 |
| S | β Celestine | SrSO4 |
| S | β Chalcopyrite | CuFeS2 |
| S | β Chalcocite | Cu2S |
| S | β Charlesite | Ca6(Al,Si)2(SO4)2[B(OH)4](OH,O)12 · 26H2O |
| S | β Fluorellestadite | Ca5(SiO4)1.5(SO4)1.5F |
| S | β Galena | PbS |
| S | β Genthelvite | Be3Zn4(SiO4)3S |
| S | β Gersdorffite | NiAsS |
| S | β Glaucodot | (Co0.50Fe0.50)AsS |
| S | β Greenockite | CdS |
| S | β Gypsum | CaSO4 · 2H2O |
| S | β Hauckite | Fe33+(Mg,Mn2+)24Zn18(SO4)4(CO3)2(OH)81 |
| S | β Hawleyite | CdS |
| S | β Jarosite | KFe33+(SO4)2(OH)6 |
| S | β Marcasite | FeS2 |
| S | β Meionite | Ca4Al6Si6O24CO3 |
| S | β Millerite | NiS |
| S | β Molybdenite | MoS2 |
| S | β Pyrite | FeS2 |
| S | β Pyrrhotite | Fe1-xS |
| S | β Roeblingite | Pb2Ca6Mn2+(Si3O9)2(SO4)2(OH)2 · 4H2O |
| S | β Sphalerite | ZnS |
| S | β Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | β Wittichenite | Cu3BiS3 |
| S | β Sphalerite var. Cleiophane | ZnS |
| Cl | Chlorine | |
| Cl | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | β Atacamite | Cu2(OH)3Cl |
| Cl | β Friedelite | Mn82+Si6O15(OH,Cl)10 |
| Cl | β Hedyphane | Ca2Pb3(AsO4)3Cl |
| Cl | β Meionite | Ca4Al6Si6O24CO3 |
| Cl | β Mimetite | Pb5(AsO4)3Cl |
| Cl | β Nasonite | Pb6Ca4(Si2O7)3Cl2 |
| Cl | β Turneaureite | Ca5(AsO4)3Cl |
| Cl | β Wawayandaite | Ca6Mn2BBe9Si6O23(OH,Cl)15 |
| Cl | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | β Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Cl | β UM1986-10-CO:ClHMgMnZn (also called Mineral F, Dunn, 1995) | Mg5(Zn,Mn)3(CO3)2(OH,Cl)12 · H2O |
| K | Potassium | |
| K | β Microcline var. Amazonite | K(AlSi3O8) |
| K | β Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| K | β Bannisterite | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| K | β Franklinphilite | (K,Na)4(Mn2+,Mg,Zn)48(Si,Al)72(O,OH)216 · 6H2O |
| K | β Ganophyllite | (K,Na,Ca)2Mn8(Si,Al)12(O,OH)32 · 8H2O |
| K | β Hendricksite | KZn3(Si3Al)O10(OH)2 |
| K | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | β Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| K | β Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| K | β Jarosite | KFe33+(SO4)2(OH)6 |
| K | β Lennilenapeite | K6-7(Mg,Mn,Fe,Zn)48(Si,Al)72(O,OH)216 · 16H2O |
| K | β Microcline | K(AlSi3O8) |
| K | β Minehillite | (K,Na)2-3Ca28Zn4Al4Si40O112(OH)16 |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Orthoclase | K(AlSi3O8) |
| K | β Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | β Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| K | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| K | β Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| K | β Stilpnomelane var. Ferristilpnomelane | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| K | β Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | β Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Ca | β Meionite var. Algerite | Ca4Al6Si6O24CO3 |
| Ca | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | β Andradite | Ca3Fe23+(SiO4)3 |
| Ca | β Anhydrite | CaSO4 |
| Ca | β Aragonite | CaCO3 |
| Ca | β Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | β Datolite var. Bakerite | Ca4(H5B5Si3O20) |
| Ca | β Bannisterite | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| Ca | β Bostwickite | CaMn63+Si3O16 · 7H2O |
| Ca | β Bultfonteinite | Ca2(HSiO4)F · H2O |
| Ca | β Bustamite | CaMn2+(Si2O6) |
| Ca | β Cahnite | Ca2[B(OH)4](AsO4) |
| Ca | β Calcite | CaCO3 |
| Ca | β Fluorite var. Chlorophane | CaF2 |
| Ca | β Charlesite | Ca6(Al,Si)2(SO4)2[B(OH)4](OH,O)12 · 26H2O |
| Ca | β Clinohedrite | CaZn(SiO4) · H2O |
| Ca | β Cuspidine | Ca8(Si2O7)2F4 |
| Ca | β Diopside | CaMgSi2O6 |
| Ca | β Dolomite | CaMg(CO3)2 |
| Ca | β Datolite | CaB(SiO4)(OH) |
| Ca | β Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Ca | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | β Esperite | PbCa2Zn3(SiO4)3 |
| Ca | β Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Ca | β Fluorellestadite | Ca5(SiO4)1.5(SO4)1.5F |
| Ca | β Fluorite | CaF2 |
| Ca | β Franklinfurnaceite | Ca2Fe3+Mn32+Mn3+(Zn2Si2O10)(OH)8 |
| Ca | β Ganomalite | Pb9Ca5Mn(Si2O7)4(SiO4)O |
| Ca | β Ganophyllite | (K,Na,Ca)2Mn8(Si,Al)12(O,OH)32 · 8H2O |
| Ca | β Glaucochroite | CaMn2+SiO4 |
| Ca | β Grossular | Ca3Al2(SiO4)3 |
| Ca | β Gypsum | CaSO4 · 2H2O |
| Ca | β Hancockite | (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | β Hardystonite | Ca2Zn[Si2O7] |
| Ca | β Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Ca | β Hedenbergite | CaFe2+Si2O6 |
| Ca | β Hedyphane | Ca2Pb3(AsO4)3Cl |
| Ca | β Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| Ca | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | β Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| Ca | β Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | β Johannsenite | CaMn2+Si2O6 |
| Ca | β Johnbaumite | Ca5(AsO4)3(OH) |
| Ca | β Junitoite | CaZn2Si2O7 · H2O |
| Ca | β Kittatinnyite | Ca2Mn2Mn(SiO4)2(OH)4 · 9H2O |
| Ca | β Kutnohorite | CaMn2+(CO3)2 |
| Ca | β HydroxycalcioromΓ©ite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| Ca | β Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| Ca | β Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Ca | β Macfallite | Ca2Mn33+(SiO4)(Si2O7)(OH)3 |
| Ca | β Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Ca | β Vesuvianite var. Manganese-bearing Vesuvianite | Ca19(Fe3+,Mn2+,Mn3+)Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](O,OH)(OH)9 |
| Ca | β Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Ca | β Margarosanite | Pb(Ca,Mn2+)2(Si3O9) |
| Ca | β Marsturite | NaCaMn3Si5O14(OH) |
| Ca | β Meionite | Ca4Al6Si6O24CO3 |
| Ca | β Minehillite | (K,Na)2-3Ca28Zn4Al4Si40O112(OH)16 |
| Ca | β Nasonite | Pb6Ca4(Si2O7)3Cl2 |
| Ca | β Fluorapophyllite-(Na) | NaCa4(Si8O20)F · 8H2O |
| Ca | β Pectolite | NaCa2Si3O8(OH) |
| Ca | β Petedunnite | Ca(Zn,Mn2+,Mg,Fe2+)Si2O6 |
| Ca | β Powellite | Ca(MoO4) |
| Ca | β Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | β Pumpellyite-(Mg) | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| Ca | β Pyroxferroite | (Fe,Mn,Ca)SiO3 |
| Ca | β Rhodonite | CaMn3Mn[Si5O15] |
| Ca | β Richterite | Na(NaCa)Mg5(Si8O22)(OH)2 |
| Ca | β Roeblingite | Pb2Ca6Mn2+(Si3O9)2(SO4)2(OH)2 · 4H2O |
| Ca | β Roweite | Ca2Mn22+B4O7(OH)6 |
| Ca | β Samfowlerite | Ca28Mn6Zn4(Be,Zn)4Be12[(OH)3(SiO4)3(Si2O7)2]4 |
| Ca | β Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Ca | β Scheelite | Ca(WO4) |
| Ca | β Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Ca | β Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Ca | β Svabite | Ca5(AsO4)3F |
| Ca | β Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | β Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Ca | β Thorutite | (Th,U,Ca)Ti2(O,OH)6 |
| Ca | β Tilasite | CaMg(AsO4)F |
| Ca | β Titanite | CaTi(SiO4)O |
| Ca | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | β Turneaureite | Ca5(AsO4)3Cl |
| Ca | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | β Wallkilldellite | Ca2Mn32+(AsO4)2(OH)4 · 9H2O |
| Ca | β Wawayandaite | Ca6Mn2BBe9Si6O23(OH,Cl)15 |
| Ca | β Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Ca | β Wollastonite | Ca3(Si3O9) |
| Ca | β Xonotlite | Ca6(Si6O17)(OH)2 |
| Ca | β Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | β Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
| Ca | β Diopside var. Zinc-Schefferite | Ca(Mg,Mn,Zn)Si2O6 |
| Ca | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | β Andradite var. Polyadelphite | (Ca,Mn)3Fe23+(SiO4)3 |
| Ca | β Rhodonite var. Fowlerite | (Mn2+,Zn,Ca)SiO3 |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | β Epidote-(Sr) | (CaSr)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | β Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| Ca | β Fluor-uvite | CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3F |
| Ca | β Ferriakasakaite-(La) | (CaLa)(Fe3+AlMn2+)O[Si2O7][SiO4](OH) |
| Ca | β Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Ca | β Ferrorhodonite | CaMn3Fe[Si5O15] |
| Ca | β Mineral B ("oyelite-like" mineral) | Ca10Si8B2O29 · 12.5H2O |
| Ti | Titanium | |
| Ti | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | β Anatase | TiO2 |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | β Brookite | TiO2 |
| Ti | β Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| Ti | β Ilmenite | Fe2+TiO3 |
| Ti | β HydroxycalcioromΓ©ite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| Ti | β Rutile | TiO2 |
| Ti | β Thorutite | (Th,U,Ca)Ti2(O,OH)6 |
| Ti | β Titanite | CaTi(SiO4)O |
| Ti | β Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
| Ti | β Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | β Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| V | Vanadium | |
| V | β Pyrobelonite | PbMn2+(VO4)(OH) |
| Mn | Manganese | |
| Mn | β Alabandite | MnS |
| Mn | β Allactite | Mn72+(AsO4)2(OH)8 |
| Mn | β Alleghanyite | Mn52+(SiO4)2(OH)2 |
| Mn | β Bannisterite | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| Mn | β Barysilite | Pb8Mn2+[Si2O7]3 |
| Mn | β Bementite | Mn7Si6O15(OH)8 |
| Mn | β Bostwickite | CaMn63+Si3O16 · 7H2O |
| Mn | β Bustamite | CaMn2+(Si2O6) |
| Mn | β Caryopilite | Mn32+Si2O5(OH)4 |
| Mn | β Chlorophoenicite | (Mn,Mg)3Zn2(AsO4)(OH,O)6 |
| Mn | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Mn | β Cianciulliite | Mn(Mg,Mn)2Zn2(OH)10 · 2-4H2O |
| Mn | β Feitknechtite | Mn3+O(OH) |
| Mn | β Flinkite | Mn22+Mn3+(AsO4)(OH)4 |
| Mn | β Franklinfurnaceite | Ca2Fe3+Mn32+Mn3+(Zn2Si2O10)(OH)8 |
| Mn | β Franklinphilite | (K,Na)4(Mn2+,Mg,Zn)48(Si,Al)72(O,OH)216 · 6H2O |
| Mn | β Friedelite | Mn82+Si6O15(OH,Cl)10 |
| Mn | β Gageite | Mn21(Si4O12)2O3(OH)20 |
| Mn | β Ganomalite | Pb9Ca5Mn(Si2O7)4(SiO4)O |
| Mn | β Ganophyllite | (K,Na,Ca)2Mn8(Si,Al)12(O,OH)32 · 8H2O |
| Mn | β Glaucochroite | CaMn2+SiO4 |
| Mn | β Gonyerite | (Mn2+,Mg)5Fe3+(Fe3+Si3O10)(OH)8 |
| Mn | β Groutite | Mn3+O(OH) |
| Mn | β Hauckite | Fe33+(Mg,Mn2+)24Zn18(SO4)4(CO3)2(OH)81 |
| Mn | β Hausmannite | Mn2+Mn23+O4 |
| Mn | β Hetaerolite | ZnMn2O4 |
| Mn | β Hodgkinsonite | Mn2+Zn2(SiO4)(OH)2 |
| Mn | β Holdenite | (Mn2+,Mg)6Zn3(AsO4)2(SiO4)(OH)8 |
| Mn | β HΓΌbnerite | MnWO4 |
| Mn | β Jacobsite | Mn2+Fe23+O4 |
| Mn | β Jarosewichite | Mn32+Mn3+(AsO4)(OH)6 |
| Mn | β Jerrygibbsite | Mn92+(SiO4)4(OH)2 |
| Mn | β Johannsenite | CaMn2+Si2O6 |
| Mn | β Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Mn | β Kittatinnyite | Ca2Mn2Mn(SiO4)2(OH)4 · 9H2O |
| Mn | β Kolicite | Mn72+Zn4(AsO4)2(SiO4)2(OH)8 |
| Mn | β Kutnohorite | CaMn2+(CO3)2 |
| Mn | β Lennilenapeite | K6-7(Mg,Mn,Fe,Zn)48(Si,Al)72(O,OH)216 · 16H2O |
| Mn | β Leucophoenicite | Mn72+(SiO4)3(OH)2 |
| Mn | β Loseyite | (Mn2+,Zn,Mg)4Zn3(CO3)2(OH)10 |
| Mn | β Manganhumite | (Mn2+,Mg)7(SiO4)3(OH)2 |
| Mn | β Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| Mn | β Magnesiochlorophoenicite | (Mg,Mn)3Zn2(AsO4)(OH,O)6 |
| Mn | β Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Mn | β Manganosite | MnO |
| Mn | β Macfallite | Ca2Mn33+(SiO4)(Si2O7)(OH)3 |
| Mn | β Manganite | Mn3+O(OH) |
| Mn | β Vesuvianite var. Manganese-bearing Vesuvianite | Ca19(Fe3+,Mn2+,Mn3+)Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](O,OH)(OH)9 |
| Mn | β Margarosanite | Pb(Ca,Mn2+)2(Si3O9) |
| Mn | β Marsturite | NaCaMn3Si5O14(OH) |
| Mn | β Nelenite | (Mn,Fe)16(Si12O30)(OH)14[As33+O6(OH)3] |
| Mn | β Neotocite | (Mn,Fe,Mg)SiO3 · H2O |
| Mn | β Pennantite | Mn52+Al(AlSi3O10)(OH)8 |
| Mn | β Petedunnite | Ca(Zn,Mn2+,Mg,Fe2+)Si2O6 |
| Mn | β Pyrobelonite | PbMn2+(VO4)(OH) |
| Mn | β Pyrochroite | Mn(OH)2 |
| Mn | β Pyroxferroite | (Fe,Mn,Ca)SiO3 |
| Mn | β Pyroxmangite | Mn2+SiO3 |
| Mn | β Rhodochrosite | MnCO3 |
| Mn | β Rhodonite | CaMn3Mn[Si5O15] |
| Mn | β Ribbeite | Mn52+(SiO4)2(OH)2 |
| Mn | β Roeblingite | Pb2Ca6Mn2+(Si3O9)2(SO4)2(OH)2 · 4H2O |
| Mn | β Roweite | Ca2Mn22+B4O7(OH)6 |
| Mn | β Samfowlerite | Ca28Mn6Zn4(Be,Zn)4Be12[(OH)3(SiO4)3(Si2O7)2]4 |
| Mn | β Sarkinite | Mn22+(AsO4)(OH) |
| Mn | β Schallerite | Mn162+As3Si12O36(OH)17 |
| Mn | β Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Mn | β Sonolite | Mn92+(SiO4)4(OH)2 |
| Mn | β Spessartine | Mn32+Al2(SiO4)3 |
| Mn | β Sussexite | Mn2+BO2(OH) |
| Mn | β Tephroite | Mn22+SiO4 |
| Mn | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mn | β Wallkilldellite | Ca2Mn32+(AsO4)2(OH)4 · 9H2O |
| Mn | β Wawayandaite | Ca6Mn2BBe9Si6O23(OH,Cl)15 |
| Mn | β Yeatmanite | Zn6Mn92+Sb25+(SiO4)4O12 |
| Mn | β Willemite var. Troostite | (Zn,Mn)2SiO4 |
| Mn | β Arakiite | (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 |
| Mn | β Gageite-2M | (Mn,Mg,Zn)42Si16O54(OH)40 |
| Mn | β Diopside var. Zinc-Schefferite | Ca(Mg,Mn,Zn)Si2O6 |
| Mn | β Andradite var. Polyadelphite | (Ca,Mn)3Fe23+(SiO4)3 |
| Mn | β Rhodonite var. Fowlerite | (Mn2+,Zn,Ca)SiO3 |
| Mn | β UM1986-10-CO:ClHMgMnZn (also called Mineral F, Dunn, 1995) | Mg5(Zn,Mn)3(CO3)2(OH,Cl)12 · H2O |
| Mn | β Antigorite var. Vorhauserite | (Mg,Mn)3(Si2O5)(OH)4 |
| Mn | β Fayalite var. Roepperite (of Brush) | (Fe2+,Mn,Zn)2SiO4 |
| Mn | β Ferriakasakaite-(La) | (CaLa)(Fe3+AlMn2+)O[Si2O7][SiO4](OH) |
| Mn | β Ferrorhodonite | CaMn3Fe[Si5O15] |
| Mn | β UM1986-23-O:BaMnU | Ba-Mn-U-O |
| Mn | β Clino-suenoite | ◻{Mn22+}{Mg5}(Si8O22)(OH)2 |
| Fe | Iron | |
| Fe | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | β Aegirine | NaFe3+Si2O6 |
| Fe | β Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Fe | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | β Andradite | Ca3Fe23+(SiO4)3 |
| Fe | β Arsenopyrite | FeAsS |
| Fe | β Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | β Almandine | Fe32+Al2(SiO4)3 |
| Fe | β Bannisterite | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Bornite | Cu5FeS4 |
| Fe | β Carminite | PbFe23+(AsO4)2(OH)2 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Fe | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Fe | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | β Fayalite | Fe22+SiO4 |
| Fe | β Franklinfurnaceite | Ca2Fe3+Mn32+Mn3+(Zn2Si2O10)(OH)8 |
| Fe | β Franklinite | Zn2+Fe23+O4 |
| Fe | β Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | β Goethite | Ξ±-Fe3+O(OH) |
| Fe | β Gonyerite | (Mn2+,Mg)5Fe3+(Fe3+Si3O10)(OH)8 |
| Fe | β Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| Fe | β Hancockite | (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | β Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Fe | β Hauckite | Fe33+(Mg,Mn2+)24Zn18(SO4)4(CO3)2(OH)81 |
| Fe | β Hedenbergite | CaFe2+Si2O6 |
| Fe | β Hematite | Fe2O3 |
| Fe | β Ilmenite | Fe2+TiO3 |
| Fe | β Jacobsite | Mn2+Fe23+O4 |
| Fe | β Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | β Lennilenapeite | K6-7(Mg,Mn,Fe,Zn)48(Si,Al)72(O,OH)216 · 16H2O |
| Fe | β LΓΆllingite | FeAs2 |
| Fe | β Magnesio-riebeckite | ◻{Na2}{Mg3Fe23+}(Si8O22)(OH)2 |
| Fe | β Magnetite | Fe2+Fe23+O4 |
| Fe | β Vesuvianite var. Manganese-bearing Vesuvianite | Ca19(Fe3+,Mn2+,Mn3+)Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](O,OH)(OH)9 |
| Fe | β Marcasite | FeS2 |
| Fe | β Nelenite | (Mn,Fe)16(Si12O30)(OH)14[As33+O6(OH)3] |
| Fe | β Neotocite | (Mn,Fe,Mg)SiO3 · H2O |
| Fe | β Nickelskutterudite | (Ni,Co,Fe)As3 |
| Fe | β Petedunnite | Ca(Zn,Mn2+,Mg,Fe2+)Si2O6 |
| Fe | β Pyrite | FeS2 |
| Fe | β Pyroxferroite | (Fe,Mn,Ca)SiO3 |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Safflorite | (Co,Ni,Fe)As2 |
| Fe | β Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Fe | β Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Fe | β Siderite | FeCO3 |
| Fe | β Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Fe | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | β Arakiite | (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 |
| Fe | β Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| Fe | β Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
| Fe | β Andradite var. Polyadelphite | (Ca,Mn)3Fe23+(SiO4)3 |
| Fe | β Stilpnomelane var. Ferristilpnomelane | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| Fe | β Epidote-(Sr) | (CaSr)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | β Fayalite var. Roepperite (of Brush) | (Fe2+,Mn,Zn)2SiO4 |
| Fe | β Ferriakasakaite-(La) | (CaLa)(Fe3+AlMn2+)O[Si2O7][SiO4](OH) |
| Fe | β Ferrorhodonite | CaMn3Fe[Si5O15] |
| Co | Cobalt | |
| Co | β Carrollite | CuCo2S4 |
| Co | β Glaucodot | (Co0.50Fe0.50)AsS |
| Co | β Nickelskutterudite | (Ni,Co,Fe)As3 |
| Co | β Safflorite | (Co,Ni,Fe)As2 |
| Co | β Skutterudite | CoAs3 |
| Ni | Nickel | |
| Ni | β Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | β Breithauptite | NiSb |
| Ni | β Gersdorffite | NiAsS |
| Ni | β Millerite | NiS |
| Ni | β Nickelskutterudite | (Ni,Co,Fe)As3 |
| Ni | β Nickeline | NiAs |
| Ni | β Pararammelsbergite | NiAs2 |
| Ni | β Rammelsbergite | NiAs2 |
| Ni | β Safflorite | (Co,Ni,Fe)As2 |
| Ni | β Pimelite | Ni3Si4O10(OH)2 · 4H2O |
| Cu | Copper | |
| Cu | β Antlerite | Cu3(SO4)(OH)4 |
| Cu | β Atacamite | Cu2(OH)3Cl |
| Cu | β Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | β Azurite | Cu3(CO3)2(OH)2 |
| Cu | β Bornite | Cu5FeS4 |
| Cu | β Carrollite | CuCo2S4 |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Chalcocite | Cu2S |
| Cu | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | β Cuprite | Cu2O |
| Cu | β Cuprostibite | Cu2(Sb,Tl) |
| Cu | β Copper | Cu |
| Cu | β Domeykite | Cu3As |
| Cu | β Malachite | Cu2(CO3)(OH)2 |
| Cu | β Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | β Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | β Tenorite | CuO |
| Cu | β Umangite | Cu3Se2 |
| Cu | β Wittichenite | Cu3BiS3 |
| Cu | β Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Zn | Zinc | |
| Zn | β Adamite | Zn2(AsO4)(OH) |
| Zn | β Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | β Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| Zn | β Chlorophoenicite | (Mn,Mg)3Zn2(AsO4)(OH,O)6 |
| Zn | β Cianciulliite | Mn(Mg,Mn)2Zn2(OH)10 · 2-4H2O |
| Zn | β Clinohedrite | CaZn(SiO4) · H2O |
| Zn | β Esperite | PbCa2Zn3(SiO4)3 |
| Zn | β Franklinfurnaceite | Ca2Fe3+Mn32+Mn3+(Zn2Si2O10)(OH)8 |
| Zn | β Franklinite | Zn2+Fe23+O4 |
| Zn | β Franklinphilite | (K,Na)4(Mn2+,Mg,Zn)48(Si,Al)72(O,OH)216 · 6H2O |
| Zn | β Gahnite | ZnAl2O4 |
| Zn | β Genthelvite | Be3Zn4(SiO4)3S |
| Zn | β Hardystonite | Ca2Zn[Si2O7] |
| Zn | β Hauckite | Fe33+(Mg,Mn2+)24Zn18(SO4)4(CO3)2(OH)81 |
| Zn | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | β Hendricksite | KZn3(Si3Al)O10(OH)2 |
| Zn | β Hetaerolite | ZnMn2O4 |
| Zn | β Hodgkinsonite | Mn2+Zn2(SiO4)(OH)2 |
| Zn | β Holdenite | (Mn2+,Mg)6Zn3(AsO4)2(SiO4)(OH)8 |
| Zn | β Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | β Junitoite | CaZn2Si2O7 · H2O |
| Zn | β Kolicite | Mn72+Zn4(AsO4)2(SiO4)2(OH)8 |
| Zn | β Larsenite | PbZnSiO4 |
| Zn | β Lennilenapeite | K6-7(Mg,Mn,Fe,Zn)48(Si,Al)72(O,OH)216 · 16H2O |
| Zn | β Loseyite | (Mn2+,Zn,Mg)4Zn3(CO3)2(OH)10 |
| Zn | β Magnesiochlorophoenicite | (Mg,Mn)3Zn2(AsO4)(OH,O)6 |
| Zn | β Minehillite | (K,Na)2-3Ca28Zn4Al4Si40O112(OH)16 |
| Zn | β Petedunnite | Ca(Zn,Mn2+,Mg,Fe2+)Si2O6 |
| Zn | β Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | β Samfowlerite | Ca28Mn6Zn4(Be,Zn)4Be12[(OH)3(SiO4)3(Si2O7)2]4 |
| Zn | β Sclarite | Zn7(CO3)2(OH)10 |
| Zn | β Smithsonite | ZnCO3 |
| Zn | β Sphalerite | ZnS |
| Zn | β Willemite | Zn2SiO4 |
| Zn | β Yeatmanite | Zn6Mn92+Sb25+(SiO4)4O12 |
| Zn | β Zincite | ZnO |
| Zn | β Willemite var. Troostite | (Zn,Mn)2SiO4 |
| Zn | β Arakiite | (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 |
| Zn | β Gageite-2M | (Mn,Mg,Zn)42Si16O54(OH)40 |
| Zn | β Sphalerite var. Cleiophane | ZnS |
| Zn | β Diopside var. Zinc-Schefferite | Ca(Mg,Mn,Zn)Si2O6 |
| Zn | β Rhodonite var. Fowlerite | (Mn2+,Zn,Ca)SiO3 |
| Zn | β UM1986-10-CO:ClHMgMnZn (also called Mineral F, Dunn, 1995) | Mg5(Zn,Mn)3(CO3)2(OH,Cl)12 · H2O |
| Zn | β Fayalite var. Roepperite (of Brush) | (Fe2+,Mn,Zn)2SiO4 |
| Zn | β Peterchinite | Zn3Zn2(OH)6As[O3(OH)3] |
| As | Arsenic | |
| As | β Adamite | Zn2(AsO4)(OH) |
| As | β Allactite | Mn72+(AsO4)2(OH)8 |
| As | β Annabergite | Ni3(AsO4)2 · 8H2O |
| As | β Arsenopyrite | FeAsS |
| As | β Cahnite | Ca2[B(OH)4](AsO4) |
| As | β Carminite | PbFe23+(AsO4)2(OH)2 |
| As | β Chlorophoenicite | (Mn,Mg)3Zn2(AsO4)(OH,O)6 |
| As | β Domeykite | Cu3As |
| As | β Flinkite | Mn22+Mn3+(AsO4)(OH)4 |
| As | β Gersdorffite | NiAsS |
| As | β Glaucodot | (Co0.50Fe0.50)AsS |
| As | β Hedyphane | Ca2Pb3(AsO4)3Cl |
| As | β Holdenite | (Mn2+,Mg)6Zn3(AsO4)2(SiO4)(OH)8 |
| As | β Jarosewichite | Mn32+Mn3+(AsO4)(OH)6 |
| As | β Johnbaumite | Ca5(AsO4)3(OH) |
| As | β Kolicite | Mn72+Zn4(AsO4)2(SiO4)2(OH)8 |
| As | β LΓΆllingite | FeAs2 |
| As | β Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| As | β Magnesiochlorophoenicite | (Mg,Mn)3Zn2(AsO4)(OH,O)6 |
| As | β Mimetite | Pb5(AsO4)3Cl |
| As | β Nelenite | (Mn,Fe)16(Si12O30)(OH)14[As33+O6(OH)3] |
| As | β Nickelskutterudite | (Ni,Co,Fe)As3 |
| As | β Nickeline | NiAs |
| As | β Pararammelsbergite | NiAs2 |
| As | β Rammelsbergite | NiAs2 |
| As | β Safflorite | (Co,Ni,Fe)As2 |
| As | β Sarkinite | Mn22+(AsO4)(OH) |
| As | β Schallerite | Mn162+As3Si12O36(OH)17 |
| As | β Skutterudite | CoAs3 |
| As | β Svabite | Ca5(AsO4)3F |
| As | β Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | β Tilasite | CaMg(AsO4)F |
| As | β Turneaureite | Ca5(AsO4)3Cl |
| As | β Wallkilldellite | Ca2Mn32+(AsO4)2(OH)4 · 9H2O |
| As | β Arakiite | (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 |
| As | β Peterchinite | Zn3Zn2(OH)6As[O3(OH)3] |
| Se | Selenium | |
| Se | β Umangite | Cu3Se2 |
| Sr | Strontium | |
| Sr | β Celestine | SrSO4 |
| Sr | β Strontianite | SrCO3 |
| Sr | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Sr | β Epidote-(Sr) | (CaSr)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Y | Yttrium | |
| Y | β Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | β Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| Nb | β Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | β Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| Mo | Molybdenum | |
| Mo | β Molybdenite | MoS2 |
| Mo | β Powellite | Ca(MoO4) |
| Ag | Silver | |
| Ag | β Acanthite | Ag2S |
| Ag | β Silver | Ag |
| Cd | Cadmium | |
| Cd | β Greenockite | CdS |
| Cd | β Hawleyite | CdS |
| Sb | Antimony | |
| Sb | β Breithauptite | NiSb |
| Sb | β Cuprostibite | Cu2(Sb,Tl) |
| Sb | β HydroxycalcioromΓ©ite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| Sb | β RomΓ©ite Group | A2(Sb5+)2O6Z |
| Sb | β Yeatmanite | Zn6Mn92+Sb25+(SiO4)4O12 |
| Ba | Barium | |
| Ba | β Barylite | Be2Ba(Si2O7) |
| Ba | β Baryte | BaSO4 |
| Ba | β Celsian | Ba(Al2Si2O8) |
| Ba | β Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Ba | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ba | β Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| Ba | β UM1986-23-O:BaMnU | Ba-Mn-U-O |
| La | Lanthanum | |
| La | β Ferriakasakaite-(La) | (CaLa)(Fe3+AlMn2+)O[Si2O7][SiO4](OH) |
| Ce | Cerium | |
| Ce | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | β Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| Ce | β Monazite-(Ce) | Ce(PO4) |
| Ce | β Synchysite-(Ce) | CaCe(CO3)2F |
| Ta | Tantalum | |
| Ta | β Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| W | Tungsten | |
| W | β HΓΌbnerite | MnWO4 |
| W | β Scheelite | Ca(WO4) |
| Tl | Thallium | |
| Tl | β Cuprostibite | Cu2(Sb,Tl) |
| Pb | Lead | |
| Pb | β Anglesite | PbSO4 |
| Pb | β Barysilite | Pb8Mn2+[Si2O7]3 |
| Pb | β Carminite | PbFe23+(AsO4)2(OH)2 |
| Pb | β Cerussite | PbCO3 |
| Pb | β Esperite | PbCa2Zn3(SiO4)3 |
| Pb | β Galena | PbS |
| Pb | β Ganomalite | Pb9Ca5Mn(Si2O7)4(SiO4)O |
| Pb | β Hancockite | (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Pb | β Hedyphane | Ca2Pb3(AsO4)3Cl |
| Pb | β Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | β Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Pb | β Larsenite | PbZnSiO4 |
| Pb | β Lead | Pb |
| Pb | β Margarosanite | Pb(Ca,Mn2+)2(Si3O9) |
| Pb | β Mimetite | Pb5(AsO4)3Cl |
| Pb | β Nasonite | Pb6Ca4(Si2O7)3Cl2 |
| Pb | β Pyrobelonite | PbMn2+(VO4)(OH) |
| Pb | β Roeblingite | Pb2Ca6Mn2+(Si3O9)2(SO4)2(OH)2 · 4H2O |
| Bi | Bismuth | |
| Bi | β Wittichenite | Cu3BiS3 |
| Th | Thorium | |
| Th | β Thorite var. Orangite | Th(SiO4) |
| Th | β Thorite | Th(SiO4) |
| Th | β Thorutite | (Th,U,Ca)Ti2(O,OH)6 |
| U | Uranium | |
| U | β Thorutite | (Th,U,Ca)Ti2(O,OH)6 |
| U | β Uraninite | UO2 |
| U | β Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| U | β UM1986-23-O:BaMnU | Ba-Mn-U-O |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Franklin_Furnace |
|---|---|
| Wikidata ID: | Q5491516 |
Mindat Articles
Boron Metasomatism at Franklin by Richard GunterLocalities in this Region
- New Jersey
- Sussex County
- New Jersey
- Sussex County
- Franklin
- Sussex County
Other Regions, Features and Areas containing this locality
North America PlateTectonic Plate
- Appalachian BasinBasin
- Laurentides DomainDomain
USA
- New Jersey
- Sussex County
- Franklin Mining DistrictMining District
- Sussex County
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Palache, Charles (1935) The minerals of Franklin and Sterling Hill, Sussex County, New Jersey. Professional Paper 180. US Geological Survey doi:10.3133/pp180
Dunn, Pete J. (1985) The lead silicates from Franklin, New Jersey: occurrence and composition. Mineralogical Magazine, 49 (354) 721-727 doi:10.1180/minmag.1985.049.354.12
Quick NavTopCommoditiesMineral ListOther DatabasesArticlesLocalities in RegionOther RegionsReferences
Franklin Mine, Franklin, Sussex County, New Jersey, USA