Portugal Nos. 1 & 2 quarries, Malpartida e Vale de Coelha, Almeida, Guarda, Portugali
| Regional Level Types | |
|---|---|
| Portugal Nos. 1 & 2 quarries | Quarry (Active) |
| Malpartida e Vale de Coelha | Civil Parish |
| Almeida | Municipality |
| Guarda | District |
| Portugal | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
40° 45' 48'' North , 6° 53' 41'' West
Latitude & Longitude (decimal):
Type:
Quarry (Active) - last checked 2023
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Aldea del Obispo | 401 (2012) | 10.7km |
| Villar de Ciervo | 349 (2012) | 13.5km |
| Villar de la Yegua | 269 (2012) | 16.6km |
| La Alameda de GardΓ³n | 133 (2012) | 17.0km |
| Ahigal de los Aceiteros | 164 (2012) | 17.3km |
Mindat Locality ID:
106425
Long-form identifier:
mindat:1:2:106425:7
GUID (UUID V4):
762d3b86-600a-4605-9198-49a3c64ab23f
Name(s) in local language(s):
Portugal 2 (Pedreira No. 6209), Malpartida, Almeida, Distrito da Guarda, Portugal
Granite quarry with several pegmatite layers rich in pockets. Adjoining pockets may show quite a different mineralization. There are other granite quarries in the vecinity, presumibly with similar minerals.
Worked by Granitos Iberolusos.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
20 valid minerals.
Detailed Mineral List:
| β Albite Formula: Na(AlSi3O8) References: |
| β Albite var. Cleavelandite Formula: Na(AlSi3O8) References: |
| β Aragonite Formula: CaCO3 References: |
| β Arsenopyrite Formula: FeAsS References: |
| β Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O References: |
| β Bertrandite Formula: Be4(Si2O7)(OH)2 References: |
| β Beryl Formula: Be3Al2(Si6O18) References: |
| β Beryl var. Aquamarine Formula: Be3Al2Si6O18 References: |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 References: |
| β 'Chlorite Group' References: |
| β Fluorapatite Formula: Ca5(PO4)3F References: |
| β Fluorite Formula: CaF2 References: |
| β Helvine Formula: Be3Mn2+4(SiO4)3S References: |
| β Meta-autunite Formula: Ca(UO2)2(PO4)2 · 6H2O References: |
| β Microcline Formula: K(AlSi3O8) References: |
| β Molybdenite Formula: MoS2 References: |
| β 'Monazite' ? Formula: REE(PO4) References: |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| β Opal Formula: SiO2 · nH2O References: |
| β Opal var. Opal-AN Formula: SiO2 · nH2O References: |
| β Orthoclase Formula: K(AlSi3O8) References: |
| β Pyrite Formula: FeS2 References: |
| β Quartz Formula: SiO2 Description: Var: Smoky quartz References: |
| β Quartz var. Smoky Quartz Formula: SiO2 References: |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| βͺ Spessartine Formula: Mn2+3Al2(SiO4)3 References: |
| β Topaz Formula: Al2(SiO4)(F,OH)2 References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Molybdenite | 2.EA.30 | MoS2 |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Quartz | 4.DA.05 | SiO2 |
| β | var. Smoky Quartz | 4.DA.05 | SiO2 |
| β | Opal var. Opal-AN | 4.DA.10 | SiO2 Β· nH2O |
| β | 4.DA.10 | SiO2 Β· nH2O | |
| Group 5 - Nitrates and Carbonates | |||
| β | Aragonite | 5.AB.15 | CaCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| β | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 Β· 10-12H2O |
| β | Meta-autunite | 8.EB.10 | Ca(UO2)2(PO4)2 Β· 6H2O |
| Group 9 - Silicates | |||
| β | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| β | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| β | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| β | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| β | 9.CJ.05 | Be3Al2(Si6O18) | |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| β | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| Unclassified | |||
| β | 'Monazite' ? | - | REE(PO4) |
| β | 'Chlorite Group' | - | |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | β Bertrandite | Be4(Si2O7)(OH)2 |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Opal var. Opal-AN | SiO2 · nH2O |
| H | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Opal | SiO2 · nH2O |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Topaz | Al2(SiO4)(F,OH)2 |
| Be | Beryllium | |
| Be | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | β Bertrandite | Be4(Si2O7)(OH)2 |
| Be | β Beryl | Be3Al2(Si6O18) |
| Be | β Helvine | Be3Mn42+(SiO4)3S |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Aragonite | CaCO3 |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | β Aragonite | CaCO3 |
| O | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | β Bertrandite | Be4(Si2O7)(OH)2 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Helvine | Be3Mn42+(SiO4)3S |
| O | β Opal var. Opal-AN | SiO2 · nH2O |
| O | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| O | β Microcline | K(AlSi3O8) |
| O | β Monazite | REE(PO4) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Opal | SiO2 · nH2O |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β Spessartine | Mn32+Al2(SiO4)3 |
| O | β Topaz | Al2(SiO4)(F,OH)2 |
| O | β Albite var. Cleavelandite | Na(AlSi3O8) |
| F | Fluorine | |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β Fluorapatite | Ca5(PO4)3F |
| F | β Fluorite | CaF2 |
| F | β Topaz | Al2(SiO4)(F,OH)2 |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Mg | Magnesium | |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Spessartine | Mn32+Al2(SiO4)3 |
| Al | β Topaz | Al2(SiO4)(F,OH)2 |
| Al | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | β Bertrandite | Be4(Si2O7)(OH)2 |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Helvine | Be3Mn42+(SiO4)3S |
| Si | β Opal var. Opal-AN | SiO2 · nH2O |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Opal | SiO2 · nH2O |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β Spessartine | Mn32+Al2(SiO4)3 |
| Si | β Topaz | Al2(SiO4)(F,OH)2 |
| Si | β Albite var. Cleavelandite | Na(AlSi3O8) |
| P | Phosphorus | |
| P | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | β Fluorapatite | Ca5(PO4)3F |
| P | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| P | β Monazite | REE(PO4) |
| S | Sulfur | |
| S | β Arsenopyrite | FeAsS |
| S | β Helvine | Be3Mn42+(SiO4)3S |
| S | β Molybdenite | MoS2 |
| S | β Pyrite | FeS2 |
| K | Potassium | |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | β Aragonite | CaCO3 |
| Ca | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Fluorite | CaF2 |
| Ca | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| Ti | Titanium | |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mn | Manganese | |
| Mn | β Helvine | Be3Mn42+(SiO4)3S |
| Mn | β Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | β Arsenopyrite | FeAsS |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Pyrite | FeS2 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| As | Arsenic | |
| As | β Arsenopyrite | FeAsS |
| Mo | Molybdenum | |
| Mo | β Molybdenite | MoS2 |
| U | Uranium | |
| U | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Portugal Nos. 1 & 2 quarries, Malpartida e Vale de Coelha, Almeida, Guarda, Portugal