Fertőrákos, Győr-Moson-Sopron County, Hungaryi
| Regional Level Types | |
|---|---|
| Fertőrákos | Village |
| Győr-Moson-Sopron County | County |
| Hungary | Country |
This page is currently not sponsored. Click here to sponsor this page.
Locality type:
Largest Settlements:
| Place | Population |
|---|---|
| Fertőrákos | 2,179 (2011) |
Other Languages:
French:
Fertőrákos, Győr-Moson-Sopron, Hongrie
German:
Fertőrákos, Komitat Győr-Moson-Sopron, Ungarn
Hungarian:
Fertőrákos, Győr-Moson-Sopron megye, Magyarország
Italian:
Fertőrákos, provincia di Győr-Moson-Sopron, Ungheria
Simplified Chinese:
费尔特拉科什, 傑爾-莫雄-肖普朗州, 匈牙利
Catalan:
Fertőrákos, Gyõr-Moson-Sopron, Hongria
Cebuano:
Fertőrákos, Győr-Moson-Sopron megye, Unggriya
Czech:
Fertőrákos, Győr-Moson-Sopron, Maďarsko
Dutch:
Fertőrákos, Győr-Moson-Sopron, Hongarije
Esperanto:
Fertőrákos, Győr-Moson-Sopron, Hungario
Japanese:
フェルテーラーコシュ, ジェール・モション・ショプロン県, ハンガリー
Malay:
Fertőrákos, Győr-Moson-Sopron, Hungary
Minnan / Hokkien-Taiwanese:
Fertőrákos, Győr-Moson-Sopron, Hông-gâ-lī
Polish:
Fertőrákos, Komitat Győr-Moson-Sopron, Węgry
Romanian:
Fertőrákos, Győr-Moson-Sopron, Ungaria
Slovak:
Fertőrákos, Rábsko-mošonsko-šopronská župa, Maďarsko
Slovenian:
Fertőrákos, Győr-Moson-Sopron, Madžarska
Swedish:
Fertőrákos, Győr-Moson-Sopron, Ungern
Vietnamese:
Fertőrákos, Hạt Gyor-Moson-Sopron, Hungary
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities19 valid minerals.
Detailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Reference: Koch: Minerals of Hungary, 1985 |
| ⓘ Albite Formula: Na(AlSi3O8) Reference: Koch: Minerals of Hungary, 1985 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Reference: Koch: Minerals of Hungary, 1985 |
| ⓘ Arsenopyrite Formula: FeAsS Reference: Koch: Minerals of Hungary, 1985 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 Reference: Koch: Minerals of Hungary, 1985 |
| ⓘ Brannerite Formula: UTi2O6 Reference: Koch: Minerals of Hungary, 1985 |
| ⓘ Calcite Formula: CaCO3 Reference: Szakáll-Gatter-Szendrei: Mineral Species of Hungary, 2006 |
| ⓘ Goethite Formula: α-Fe3+O(OH) Reference: Szakáll-Gatter-Szendrei: Mineral Species of Hungary, 2006 |
| ⓘ Hauchecornite Formula: Ni9BiSbS8 Reference: Koch: Minerals of Hungary, 1985 |
| ⓘ Jarosite Formula: KFe3+ 3(SO4)2(OH)6 Reference: ACTA MIN. PETR. Suppl. Tomus XXXVIII., 1997 |
| ⓘ Meta-autunite Formula: Ca(UO2)2(PO4)2 · 6H2O Reference: Koch: Minerals of Hungary, 1985 |
| ⓘ Molybdenite Formula: MoS2 Reference: Koch: Minerals of Hungary, 1985 |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 Reference: Koch: Minerals of Hungary, 1985 |
| ⓘ Pyrite Formula: FeS2 Reference: Koch: Minerals of Hungary, 1985 |
| ⓘ Quartz Formula: SiO2 Reference: Koch: Minerals of Hungary, 1985 |
| ⓘ Rutile Formula: TiO2 Reference: Koch: Minerals of Hungary, 1985 |
| ⓘ Saléeite Formula: Mg(UO2)2(PO4)2 · 10H2O Reference: Koch: Minerals of Hungary, 1985 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Reference: Szakáll,2004 |
| ⓘ Silver Formula: Ag Reference: Szakáll-Gatter-Szendrei:Mineral Species of Hungary,2005 |
| ⓘ Sphalerite Formula: ZnS Reference: Koch: Minerals of Hungary, 1985 |
| ⓘ Sphalerite var. Marmatite Formula: (Zn,Fe)S Reference: Koch: Minerals of Hungary, 1985 |
| ⓘ Titanite Formula: CaTi(SiO4)O Reference: Koch: Minerals of Hungary, 1985 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Silver | 1.AA.05 | Ag |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Hauchecornite | 2.BB.10 | Ni9BiSbS8 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | var. Marmatite | 2.CB.05a | (Zn,Fe)S |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Brannerite | 4.DH.05 | UTi2O6 |
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Jarosite | 7.BC.10 | KFe3+ 3(SO4)2(OH)6 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Meta-autunite | 8.EB.10 | Ca(UO2)2(PO4)2 · 6H2O |
| ⓘ | Saléeite | 8.EB.05 | Mg(UO2)2(PO4)2 · 10H2O |
| Group 9 - Silicates | |||
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| Unclassified Minerals, Rocks, etc. | |||
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| H | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| H | ⓘ Jarosite | KFe3+ 3(SO4)2(OH)6 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| O | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| O | ⓘ Jarosite | KFe3+ 3(SO4)2(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Mg | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| P | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| S | Sulfur | |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Hauchecornite | Ni9BiSbS8 |
| S | ⓘ Jarosite | KFe3+ 3(SO4)2(OH)6 |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| K | ⓘ Jarosite | KFe3+ 3(SO4)2(OH)6 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ti | Titanium | |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Ti | ⓘ Brannerite | UTi2O6 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Jarosite | KFe3+ 3(SO4)2(OH)6 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Ni | Nickel | |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Hauchecornite | Ni9BiSbS8 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Silver | Ag |
| Sb | Antimony | |
| Sb | ⓘ Hauchecornite | Ni9BiSbS8 |
| Bi | Bismuth | |
| Bi | ⓘ Hauchecornite | Ni9BiSbS8 |
| U | Uranium | |
| U | ⓘ Brannerite | UTi2O6 |
| U | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| U | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
Fossils
This region is too big to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Fert%C5%91r%C3%A1kos |
|---|---|
| Wikidata ID: | Q766583 |
| GeoNames ID: | 3052640 |
Localities in this Region
- Győr-Moson-Sopron County
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Gödölye-bérc, Fertőrákos, Győr-Moson-Sopron County, Hungary