Shuangwang Au deposit, Taibai Co., Baoji, Shaanxi, Chinai
| Regional Level Types | |
|---|---|
| Shuangwang Au deposit | Deposit |
| Taibai Co. | County |
| Baoji | Prefecture |
| Shaanxi | Province |
| China | Country |
This page is currently not sponsored. Click here to sponsor this page.
Key
Lock Map
| Name(s) in local language(s): | 双王金矿床, 太白县, 宝鸡市, 陕西省, 中国 |
|---|
| Latitude & Longitude (WGS84): | 33° 52' 30'' North , 107° 14' 30'' East |
|---|---|
| Latitude & Longitude (decimal): | 33.87500,107.24167 |
| GeoHash: | G#: wqh28qfbp |
| Locality type: | Deposit |
| Köppen climate type: | Cwb : Subtropical highland climate or temperate oceanic climate with dry winters |
Breccia-style gold deposit.
Regions containing this locality
| Eurasian Plate | Tectonic Plate |
Select Mineral List Type
Standard Detailed Strunz Dana Chemical ElementsDetailed Mineral List:
| ⓘ Actinolite Formula: ☐{Ca2}{Mg4.5-2.5Fe0.5-2.5}(Si8O22)(OH)2 |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ 'Apatite' |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ 'Biotite' |
| ⓘ Calaverite Formula: AuTe2 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dolomite var: Ferroan Dolomite Formula: Ca(Mg,Fe)(CO3)2 |
| ⓘ Dravite Formula: Na(Mg3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ 'Electrum' Formula: (Au, Ag) |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Galena Formula: PbS |
| ⓘ Gold Formula: Au |
| ⓘ Gold var: Platinian Gold Formula: (Au,Pt) |
| ⓘ Goldmanite Formula: Ca3V3+2(SiO4)3 |
| ⓘ Graphite Formula: C |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Heazlewoodite Formula: Ni3S2 |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ 'Hornblende' |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Linnaeite Formula: Co2+Co3+2S4 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Millerite Formula: NiS |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var: Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 |
| ⓘ Muscovite var: Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ 'Parisite' ? |
| ⓘ Parkerite Formula: Ni3(Bi,Pb)2S2 |
| ⓘ Pentlandite Formula: (FexNiy)Σ9S8 |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Polydymite Formula: Ni2+Ni3+2S4 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrrhotite Formula: Fe7S8 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var: Chalcedony Formula: SiO2 |
| ⓘ Roscoelite Formula: K(V3+,Al)2(AlSi3O10)(OH)2 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Schorl Formula: Na(Fe2+3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Synchysite-(Ce) ? Formula: CaCe(CO3)2F |
| ⓘ Tellurobismuthite Formula: Bi2Te3 |
| ⓘ Tetrahedrite Formula: Cu6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ 'Tourmaline' Formula: A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ Tremolite Formula: ☐{Ca2}{Mg5}(Si8O22)(OH)2 |
| ⓘ Villamaninite Formula: (Cu,Ni,Co,Fe)S2 |
| ⓘ Violarite Formula: Fe2+Ni3+2S4 |
| ⓘ Willyamite Formula: (Co,Ni)SbS |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | 'Electrum' | 1.AA.05 | (Au, Ag) |
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | var: Platinian Gold | 1.AA.05 | (Au,Pt) |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Calaverite | 2.EA.10 | AuTe2 |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Heazlewoodite | 2.BB.05 | Ni3S2 |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Parkerite | 2.BE.20 | Ni3(Bi,Pb)2S2 |
| ⓘ | Pentlandite | 2.BB.15 | (FexNiy)Σ9S8 |
| ⓘ | Polydymite | 2.DA.05 | Ni2+Ni3+2S4 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe7S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Tetrahedrite | 2.GB.05 | Cu6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ | Villamaninite | 2.EB.05a | (Cu,Ni,Co,Fe)S2 |
| ⓘ | Violarite | 2.DA.05 | Fe2+Ni3+2S4 |
| ⓘ | Willyamite | 2.EB.25 | (Co,Ni)SbS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var: Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | var: Ferroan Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Synchysite-(Ce) ? | 5.BD.20c | CaCe(CO3)2F |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| Group 9 - Silicates | |||
| ⓘ | Actinolite | 9.DE.10 | ☐{Ca2}{Mg4.5-2.5Fe0.5-2.5}(Si8O22)(OH)2 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Dravite | 9.CK.05 | Na(Mg3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Goldmanite | 9.AD.25 | Ca3V3+2(SiO4)3 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var: Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | var: Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Roscoelite | 9.EC.15 | K(V3+,Al)2(AlSi3O10)(OH)2 |
| ⓘ | Schorl | 9.CK.05 | Na(Fe2+3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Tremolite | 9.DE.10 | ☐{Ca2}{Mg5}(Si8O22)(OH)2 |
| Unclassified Minerals, Rocks, etc. | |||
| ⓘ | 'Apatite' | - | |
| ⓘ | 'Biotite' | - | |
| ⓘ | 'Hornblende' | - | |
| ⓘ | 'Parisite' ? | - | |
| ⓘ | 'Tourmaline' | - | A(D3)G6(T6O18)(BO3)3X3Z |
List of minerals arranged by Dana 8th Edition classification
| Group 1 - NATIVE ELEMENTS AND ALLOYS | |||
|---|---|---|---|
| Metals, other than the Platinum Group | |||
| ⓘ | Gold | 1.1.1.1 | Au |
| Semi-metals and non-metals | |||
| ⓘ | Graphite | 1.3.6.2 | C |
| Group 2 - SULFIDES | |||
| AmBnXp, with (m+n):p = 5:2 | |||
| ⓘ | Parkerite | 2.3.4.1 | Ni3(Bi,Pb)2S2 |
| AmBnXp, with (m+n):p = 2:1 | |||
| ⓘ | Hessite | 2.4.2.1 | Ag2Te |
| AmBnXp, with (m+n):p = 3:2 | |||
| ⓘ | Heazlewoodite | 2.5.3.1 | Ni3S2 |
| AmBnXp, with (m+n):p = 9:8 | |||
| ⓘ | Pentlandite | 2.7.1.1 | (FexNiy)Σ9S8 |
| AmXp, with m:p = 1:1 | |||
| ⓘ | Galena | 2.8.1.1 | PbS |
| ⓘ | Millerite | 2.8.16.1 | NiS |
| ⓘ | Pyrrhotite | 2.8.10.1 | Fe7S8 |
| ⓘ | Sphalerite | 2.8.2.1 | ZnS |
| AmBnXp, with (m+n):p = 1:1 | |||
| ⓘ | Chalcopyrite | 2.9.1.1 | CuFeS2 |
| AmBnXp, with (m+n):p = 3:4 | |||
| ⓘ | Linnaeite | 2.10.1.1 | Co2+Co3+2S4 |
| ⓘ | Polydymite | 2.10.1.7 | Ni2+Ni3+2S4 |
| ⓘ | Violarite | 2.10.1.8 | Fe2+Ni3+2S4 |
| AmBnXp, with (m+n):p = 2:3 | |||
| ⓘ | Tellurobismuthite | 2.11.7.2 | Bi2Te3 |
| AmBnXp, with (m+n):p = 1:2 | |||
| ⓘ | Arsenopyrite | 2.12.4.1 | FeAsS |
| ⓘ | Calaverite | 2.12.13.2 | AuTe2 |
| ⓘ | Cobaltite | 2.12.3.1 | CoAsS |
| ⓘ | Marcasite | 2.12.2.1 | FeS2 |
| ⓘ | Molybdenite | 2.12.10.1 | MoS2 |
| ⓘ | Pyrite | 2.12.1.1 | FeS2 |
| ⓘ | Villamaninite | 2.12.1.6 | (Cu,Ni,Co,Fe)S2 |
| ⓘ | Willyamite | 2.12.3.4 | (Co,Ni)SbS |
| Group 3 - SULFOSALTS | |||
| 3 <ø < 4 | |||
| ⓘ | Tetrahedrite | 3.3.6.1 | Cu6[Cu4(Fe,Zn)2]Sb4S13 |
| Group 4 - SIMPLE OXIDES | |||
| A2X3 | |||
| ⓘ | Ilmenite | 4.3.5.1 | Fe2+TiO3 |
| AX2 | |||
| ⓘ | Rutile | 4.4.1.1 | TiO2 |
| Group 7 - MULTIPLE OXIDES | |||
| AB2X4 | |||
| ⓘ | Magnetite | 7.2.2.3 | Fe2+Fe3+2O4 |
| Group 9 - NORMAL HALIDES | |||
| AX2 | |||
| ⓘ | Fluorite | 9.2.1.1 | CaF2 |
| Group 14 - ANHYDROUS NORMAL CARBONATES | |||
| A(XO3) | |||
| ⓘ | Calcite | 14.1.1.1 | CaCO3 |
| ⓘ | Siderite | 14.1.1.3 | FeCO3 |
| AB(XO3)2 | |||
| ⓘ | Ankerite | 14.2.1.2 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 14.2.1.1 | CaMg(CO3)2 |
| Group 16a - ANHYDROUS CARBONATES CONTAINING HYDROXYL OR HALOGEN | |||
| ⓘ | Synchysite-(Ce) ? | 16a.1.3.1 | CaCe(CO3)2F |
| Group 28 - ANHYDROUS ACID AND NORMAL SULFATES | |||
| AXO4 | |||
| ⓘ | Anhydrite | 28.3.2.1 | CaSO4 |
| ⓘ | Baryte | 28.3.1.1 | BaSO4 |
| Group 29 - HYDRATED ACID AND NORMAL SULFATES | |||
| AXO4·xH2O | |||
| ⓘ | Gypsum | 29.6.3.1 | CaSO4 · 2H2O |
| Group 51 - NESOSILICATES Insular SiO4 Groups Only | |||
| Insular SiO4 Groups Only with cations in [6] and >[6] coordination | |||
| ⓘ | Goldmanite | 51.4.3b.4 | Ca3V3+2(SiO4)3 |
| Group 52 - NESOSILICATES Insular SiO4 Groups and O,OH,F,H2O | |||
| Insular SiO4 Groups and O, OH, F, and H2O with cations in [4] and >[4] coordination | |||
| ⓘ | Andalusite | 52.2.2b.1 | Al2(SiO4)O |
| Group 61 - CYCLOSILICATES Six-Membered Rings | |||
| Six-Membered Rings with Al substituted rings | |||
| ⓘ | Cordierite | 61.2.1.1 | (Mg,Fe)2Al3(AlSi5O18) |
| Six-Membered Rings with borate groups | |||
| ⓘ | Dravite | 61.3.1.9 | Na(Mg3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 61.3.1.10 | Na(Fe2+3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Group 66 - INOSILICATES Double-Width,Unbranched Chains,(W=2) | |||
| Amphiboles - Mg-Fe-Mn-Li subgroup | |||
| ⓘ | Tremolite | 66.1.3a.1 | ☐{Ca2}{Mg5}(Si8O22)(OH)2 |
| Group 71 - PHYLLOSILICATES Sheets of Six-Membered Rings | |||
| Sheets of 6-membered rings with 1:1 layers | |||
| ⓘ | Dickite | 71.1.1.1 | Al2(Si2O5)(OH)4 |
| Sheets of 6-membered rings with 2:1 layers | |||
| ⓘ | Muscovite | 71.2.2a.1 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 71.2.2b.1 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Roscoelite | 71.2.2a.4 | K(V3+,Al)2(AlSi3O10)(OH)2 |
| Group 75 - TECTOSILICATES Si Tetrahedral Frameworks | |||
| Si Tetrahedral Frameworks - SiO2 with [4] coordinated Si | |||
| ⓘ | Quartz | 75.1.3.1 | SiO2 |
| Group 76 - TECTOSILICATES Al-Si Framework | |||
| Al-Si Framework with Al-Si frameworks | |||
| ⓘ | Albite | 76.1.3.1 | Na(AlSi3O8) |
| Unclassified Minerals, Mixtures, etc. | |||
| ⓘ | Actinolite | - | ☐{Ca2}{Mg4.5-2.5Fe0.5-2.5}(Si8O22)(OH)2 |
| ⓘ | 'Apatite' | - | |
| ⓘ | 'Biotite' | - | |
| ⓘ | Dolomite var: Ferroan Dolomite | - | Ca(Mg,Fe)(CO3)2 |
| ⓘ | 'Electrum' | - | (Au, Ag) |
| ⓘ | Gold var: Platinian Gold | - | (Au,Pt) |
| ⓘ | 'Hornblende' | - | |
| ⓘ | Muscovite var: Fuchsite | - | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | var: Sericite | - | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 'Parisite' ? | - | |
| ⓘ | Quartz var: Chalcedony | - | SiO2 |
| ⓘ | 'Tourmaline' | - | A(D3)G6(T6O18)(BO3)3X3Z |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Muscovite (var: Sericite) | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
| H | ⓘ Tremolite | ☐{Ca2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Actinolite | ☐{Ca2}{Mg4.5-2.5Fe0.5-2.5}(Si8O22)(OH)2 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Muscovite (var: Fuchsite) | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Dravite | Na(Mg3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | Boron | |
| B | ⓘ Dravite | Na(Mg3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | A(D3)G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Dolomite (var: Ferroan Dolomite) | Ca(Mg,Fe)(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Muscovite (var: Sericite) | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Dolomite (var: Ferroan Dolomite) | Ca(Mg,Fe)(CO3)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
| O | ⓘ Tremolite | ☐{Ca2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Actinolite | ☐{Ca2}{Mg4.5-2.5Fe0.5-2.5}(Si8O22)(OH)2 |
| O | ⓘ Goldmanite | Ca3V23+(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Muscovite (var: Fuchsite) | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Quartz (var: Chalcedony) | SiO2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Dravite | Na(Mg3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Tourmaline | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | Na(Mg3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Dolomite (var: Ferroan Dolomite) | Ca(Mg,Fe)(CO3)2 |
| Mg | ⓘ Tremolite | ☐{Ca2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Actinolite | ☐{Ca2}{Mg4.5-2.5Fe0.5-2.5}(Si8O22)(OH)2 |
| Mg | ⓘ Dravite | Na(Mg3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Muscovite (var: Sericite) | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
| Al | ⓘ Muscovite (var: Fuchsite) | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Dravite | Na(Mg3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Muscovite (var: Sericite) | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
| Si | ⓘ Tremolite | ☐{Ca2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Actinolite | ☐{Ca2}{Mg4.5-2.5Fe0.5-2.5}(Si8O22)(OH)2 |
| Si | ⓘ Goldmanite | Ca3V23+(SiO4)3 |
| Si | ⓘ Muscovite (var: Fuchsite) | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Quartz (var: Chalcedony) | SiO2 |
| Si | ⓘ Dravite | Na(Mg3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| S | Sulfur | |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Pyrrhotite | Fe7S8 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Violarite | Fe2+Ni23+S4 |
| S | ⓘ Polydymite | Ni2+Ni23+S4 |
| S | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Tetrahedrite | Cu6[Cu4(Fe,Zn)2]Sb4S13 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Willyamite | (Co,Ni)SbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Villamaninite | (Cu,Ni,Co,Fe)S2 |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Pentlandite | (FexNiy)Σ9S8 |
| S | ⓘ Heazlewoodite | Ni3S2 |
| K | Potassium | |
| K | ⓘ Muscovite (var: Sericite) | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite (var: Fuchsite) | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Dolomite (var: Ferroan Dolomite) | Ca(Mg,Fe)(CO3)2 |
| Ca | ⓘ Tremolite | ☐{Ca2}{Mg5}(Si8O22)(OH)2 |
| Ca | ⓘ Actinolite | ☐{Ca2}{Mg4.5-2.5Fe0.5-2.5}(Si8O22)(OH)2 |
| Ca | ⓘ Goldmanite | Ca3V23+(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| V | Vanadium | |
| V | ⓘ Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
| V | ⓘ Goldmanite | Ca3V23+(SiO4)3 |
| Cr | Chromium | |
| Cr | ⓘ Muscovite (var: Fuchsite) | K(Al,Cr)3Si3O10(OH)2 |
| Fe | Iron | |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Dolomite (var: Ferroan Dolomite) | Ca(Mg,Fe)(CO3)2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrrhotite | Fe7S8 |
| Fe | ⓘ Violarite | Fe2+Ni23+S4 |
| Fe | ⓘ Actinolite | ☐{Ca2}{Mg4.5-2.5Fe0.5-2.5}(Si8O22)(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Tetrahedrite | Cu6[Cu4(Fe,Zn)2]Sb4S13 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Villamaninite | (Cu,Ni,Co,Fe)S2 |
| Fe | ⓘ Pentlandite | (FexNiy)Σ9S8 |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Siderite | FeCO3 |
| Co | Cobalt | |
| Co | ⓘ Willyamite | (Co,Ni)SbS |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Villamaninite | (Cu,Ni,Co,Fe)S2 |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Ni | Nickel | |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Violarite | Fe2+Ni23+S4 |
| Ni | ⓘ Polydymite | Ni2+Ni23+S4 |
| Ni | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| Ni | ⓘ Willyamite | (Co,Ni)SbS |
| Ni | ⓘ Villamaninite | (Cu,Ni,Co,Fe)S2 |
| Ni | ⓘ Pentlandite | (FexNiy)Σ9S8 |
| Ni | ⓘ Heazlewoodite | Ni3S2 |
| Cu | Copper | |
| Cu | ⓘ Tetrahedrite | Cu6[Cu4(Fe,Zn)2]Sb4S13 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Villamaninite | (Cu,Ni,Co,Fe)S2 |
| Zn | Zinc | |
| Zn | ⓘ Tetrahedrite | Cu6[Cu4(Fe,Zn)2]Sb4S13 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Cobaltite | CoAsS |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Electrum | (Au, Ag) |
| Sb | Antimony | |
| Sb | ⓘ Tetrahedrite | Cu6[Cu4(Fe,Zn)2]Sb4S13 |
| Sb | ⓘ Willyamite | (Co,Ni)SbS |
| Te | Tellurium | |
| Te | ⓘ Calaverite | AuTe2 |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Te | ⓘ Hessite | Ag2Te |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ce | Cerium | |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Pt | Platinum | |
| Pt | ⓘ Gold (var: Platinian Gold) | (Au,Pt) |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Au | ⓘ Calaverite | AuTe2 |
| Au | ⓘ Electrum | (Au, Ag) |
| Au | ⓘ Gold (var: Platinian Gold) | (Au,Pt) |
| Pb | Lead | |
| Pb | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Bi | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
Regional Geology
This geological map and associated information on rock units at or nearby to the coordinates given for this locality is based on relatively small scale geological maps provided by various national Geological Surveys. This does not necessarily represent the complete geology at this locality but it gives a background for the region in which it is found.
Click on geological units on the map for more information. Click here to view full-screen map on Macrostrat.org
| Paleozoic 251.902 - 541 Ma ID: 3187133 | Paleozoic sedimentary rocks Age: Phanerozoic (251.902 - 541 Ma) Lithology: Sedimentary rocks Reference: Chorlton, L.B. Generalized geology of the world: bedrock domains and major faults in GIS format: a small-scale world geology map with an extended geological attribute database. doi: 10.4095/223767. Geological Survey of Canada, Open File 5529. [154] |
Data and map coding provided by Macrostrat.org, used under Creative Commons Attribution 4.0 License
References
Sort by
Year (asc) Year (desc) Author (A-Z) Author (Z-A)Zhiping Li, and S.G. Peters (1998): Comparative Geology and Geochemistry of Sedimentary-Rock-Hosted (Carlin-Type) Gold Deposits in the People's Republic of China and in Nevada, USA. USGS Open-File Report 98-466.
Defeng Hui and Naiwu Zhu (2001): Study on mineralization type of Shuangwang gold ore deposit. Gold Journal 3(1), 1-5 (in Chinese with English abstract).
Peters, S.G. (2002): Geology, Geochemistry, and Geophysics of Sedimentary-Hosted Au Deposits in P.R. China. Chapter 4. USGS Open-File Report: 02-131, pp. 213-214.
Jingwen Mao, Yumin Qiu, Goldfarb, R.J., Zhaochong Zhang, Garwin, S., and Ren Fengshou (2002): Geology, distribution, and classification of gold deposits in the western Qinling belt, central China. Mineralium Deposita 37(3/4), 352-377.
Zuoheng Zhang, Jingwen Mao, and Xiaofeng Li (2004): Geology, Geochemistry and Metallogenic Mechanism of Shuangwang Breccia Type Gold Deposit. Mineral Deposits 23(2), 241-252 (in Chinese with English abstract).
Zuoheng Zhang, Jingwen Mao, Xiaofeng Li, Ruiting Wang, and Zhiliang Wang (2005): C, H, and O isotope characteristics of the Shuangwang gold deposit, West China. Goldschmidt Conference Abstracts 2005, A 869.
Ruiting Wang, Tao Wang, Zhangjian Gao, Erhu Chen, and Lixia Liu (2007): The main metal deposits metallogenic series and exploration direction in Feng-Tai ore cluster region, Shaanxi Province. Northwestern Geology 40(2), 77-84 (in Chinese with English abstract).
Xishun Hu (2009): A further understanding on genesis of Shuangwang gold deposit in Shaanxi Province. Gold Science and Technology 17(2), 17-22, 27 (in Chinese with English abstract).
Xiangtao Zeng, Jianping Wang, Bizheng Liu, Chonghao Liu, Ruirong Cao, Chuang Gao, Luo Wang, Guogang Zhang, Xinjiang Zhao, and Feng Qi (2012): Typomorphic chracteristics of pyrite from the no. 5 orebody in the Shuangwang gold deposit, Shaanxi Province. Geology and Exploration 48(1), 76-84.
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.