Kensington Mica Mine (Gilmore Mine; B. H. Warner Mine), Wheaton, Montgomery County, Maryland, USAi
| Regional Level Types | |
|---|---|
| Kensington Mica Mine (Gilmore Mine; B. H. Warner Mine) | Mine |
| Wheaton | Town |
| Montgomery County | County |
| Maryland | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
39° 3' 24'' North , 77° 0' 47'' West
Latitude & Longitude (decimal):
Type:
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Kemp Mill | 12,564 (2011) | 2.0km |
| Colesville | 14,647 (2011) | 2.3km |
| White Oak | 17,403 (2011) | 2.5km |
| Glenmont | 13,529 (2018) | 3.2km |
| Four Corners | 7,945 (2011) | 4.0km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Gem, Lapidary, and Mineral Society of Montgomery County, MD., Inc. | Rockville, Maryland | 12km |
| Northern Virginia Mineral Club, Inc. | Arlington, Virginia | 21km |
| American Fossil Federation | Bowie, Maryland | 28km |
| Maryland Geological Society | Bowie, Maryland | 28km |
| Central Maryland Rock and Mineral Collectors Exchange | Elkridge, Maryland | 31km |
Mindat Locality ID:
13818
Long-form identifier:
mindat:1:2:13818:4
GUID (UUID V4):
49a8e61b-98c8-4c5b-b824-9b595f2309ff
Known as the Kensington or Gilmore Mica Mine
Located in Wheaton, Maryland (a suburb of Washington, DC)
Years of operation - 1882 to approx. 1914
This was a mica mine in pegmatite.
Remains of the Kensington Mica Mine can be found in what is now the "Springbrook Forest" subdivision (Wheaton, Maryland) and the adjoining "Northwest Branch Park." Little remains of the workings, which consisted of two shafts, a number of dumps, and a large cut through the pegmatite. The trenches used to float the mica in the seperating process are still extant and a very small portion of the dump piles remain, extending down into the park on the west side of Northwest Branch. An old shack, associated with the mine, still exists in the park as well. Some of the driveway borders for homes along Stonington and Remington Drive are decorated with pegmatite material left from the mining operation, some encrusted with large almandine garnets and splays of schorl.
After heavy rain, small books of mica can be seen washed out onto some of the streets of the neighborhood, especially at the corner of Remington Drive and Stonington Drive.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
11 valid minerals. 1 erroneous literature entry.
Detailed Mineral List:
| β Albite Formula: Na(AlSi3O8) |
| β 'Almandine-Spessartine Series' |
| β Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| β Bertrandite Formula: Be4(Si2O7)(OH)2 References: |
| β Beryl Formula: Be3Al2(Si6O18) |
| β Beryl var. Heliodor Formula: Be3Al2(Si6O18) |
| β Fluorapatite Formula: Ca5(PO4)3F |
| β Gahnite Formula: ZnAl2O4 |
| β 'Limonite' |
| β Microcline Formula: K(AlSi3O8) References: |
| β 'Microlite Group' ? Formula: A2-mTa2X6-wZ-n References: |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β Formula: K(AlSi3O8) Description: Microcline - obsolete identification References: |
| β 'Pyrochlore Group' ? Formula: A2Nb2(O,OH)6Z References: |
| β Quartz Formula: SiO2 |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Spessartine ? Formula: Mn2+3Al2(SiO4)3 Description: Spessartine is unlikely as this is a simple, undifferentiated pegmatite. |
| β 'Wad' References: |
| β 'Zinnwaldite' ? References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| β | 'Microlite Group' ? | 4.00. | A2-mTa2X6-wZ-n |
| β | 'Pyrochlore Group' ? | 4.00. | A2Nb2(O,OH)6Z |
| β | Gahnite | 4.BB.05 | ZnAl2O4 |
| β | Quartz | 4.DA.05 | SiO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| β | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 Β· 10-12H2O |
| Group 9 - Silicates | |||
| β | Spessartine ? | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| β | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | var. Heliodor | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Orthoclase ? | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| β | 'Wad' | - | |
| β | 'Zinnwaldite' ? | - | |
| β | 'Limonite' | - | |
| β | 'Almandine-Spessartine Series' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | β Bertrandite | Be4(Si2O7)(OH)2 |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Be | Beryllium | |
| Be | β Bertrandite | Be4(Si2O7)(OH)2 |
| Be | β Beryl | Be3Al2(Si6O18) |
| Be | β Beryl var. Heliodor | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | β Bertrandite | Be4(Si2O7)(OH)2 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Gahnite | ZnAl2O4 |
| O | β Microcline | K(AlSi3O8) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | β Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Spessartine | Mn32+Al2(SiO4)3 |
| O | β Beryl var. Heliodor | Be3Al2(Si6O18) |
| F | Fluorine | |
| F | β Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Gahnite | ZnAl2O4 |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Spessartine | Mn32+Al2(SiO4)3 |
| Al | β Beryl var. Heliodor | Be3Al2(Si6O18) |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Bertrandite | Be4(Si2O7)(OH)2 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Spessartine | Mn32+Al2(SiO4)3 |
| Si | β Beryl var. Heliodor | Be3Al2(Si6O18) |
| P | Phosphorus | |
| P | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | β Fluorapatite | Ca5(PO4)3F |
| K | Potassium | |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Mn | Manganese | |
| Mn | β Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Zn | Zinc | |
| Zn | β Gahnite | ZnAl2O4 |
| Nb | Niobium | |
| Nb | β Pyrochlore Group | A2Nb2(O,OH)6Z |
| Ta | Tantalum | |
| Ta | β Microlite Group | A2-mTa2X6-wZ-n |
| U | Uranium | |
| U | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
Other Regions, Features and Areas containing this locality
North America PlateTectonic Plate
- Piedmontia DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
