Rainy River District, Ontario, Canadai
| Regional Level Types | |
|---|---|
| Rainy River District | District |
| Ontario | Province |
| Canada | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Fort Frances | 7,931 (2018) |
| Atikokan | 3,400 (2018) |
Mindat Locality ID:
13994
Long-form identifier:
mindat:1:2:13994:3
GUID (UUID V4):
a82f3413-8c42-4829-bf08-cef5f59f98e6
Other Languages:
French:
district de Rainy River, Ontario, Canada
German:
Rainy River District, Ontario, Kanada
Italian:
Distretto di Rainy River, Ontario, Canada
Russian:
Рейни-Ривер, Онтарио, Канада
Simplified Chinese:
雷尼河區, 安大略省, 加拿大
Albanian:
Distrikti Rainy River, Ontario, Kanadaja
Bavarian:
Rainy River District, Ontario, Kanada
Cebuano:
Rainy River District, Ontario, Canada
Dutch:
Rainy River District, Ontario, Canada
Farsi/Persian:
بخش رینی ریور, انتاریو, کانادا
Japanese:
レイニーリバー地区, オンタリオ州, カナダ
Polish:
Dystrykt Rainy River, Ontario, Kanada
Portuguese:
Rainy River, Ontário, Canadá
Swedish:
Rainy River District, Ontario, Kanada
Ukrainian:
Рейні-Рівер , Онтаріо, Канада
Western Punjabi:
ضلع رینی رور, اونٹاریو, کینیڈا
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities68 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: References: |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) Description: Coarse crystals up to 30 cm long.
Huttenlocher exsolution between I-anorthite (I-1) and intermediate plagioclase (An 20-70). |
| ⓘ Anorthite var. Bytownite Formula: (Ca,Na)[Al(Al,Si)Si2O8] Description: Coarse crystals up to 30 cm long.
Huttenlocher exsolution between I-anorthite (I-1) and intermediate plagioclase (An 20-70). |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: References: |
| ⓘ Aragonite Formula: CaCO3 Localities: Steep Rock Iron Mine, Freeborn Township, Rainy River District, Ontario, Canada Caland pit, Schwenger Township, Rainy River District, Ontario, Canada Roberts pit, Steep Rock Iron Mine, Freeborn Township, Rainy River District, Ontario, Canada Hogarth pit, Steep Rock Iron Mine, Freeborn Township, Rainy River District, Ontario, Canada Errington pit, Steep Rock Iron Mine, Freeborn Township, Rainy River District, Ontario, Canada References: |
| ⓘ Arfvedsonite ? Formula: [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: References: |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Cacoxenite Formula: Fe3+24AlO6(PO4)17(OH)12 · 75H2O Localities: References: |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 Localities: References: |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcoalumite Formula: CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Chlorite Group' Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Clay minerals' |
| ⓘ 'Conchilites' |
| ⓘ Covellite Formula: CuS |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: |
| ⓘ Edenite Formula: NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: References: |
| ⓘ Froodite Formula: α-PdBi2 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gibbsite Formula: Al(OH)3 |
| ⓘ Goethite Formula: α-Fe3+O(OH) Localities: Reported from at least 8 localities in this region. |
| ⓘ Gold Formula: Au Localities: Reported from at least 8 localities in this region. References: |
| ⓘ Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Graphite Formula: C |
| ⓘ Groutite Formula: Mn3+O(OH) |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Hollingworthite Formula: (Rh,Pt,Pd)AsS |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ 'K Feldspar' |
| ⓘ 'Limonite' Localities: References: |
| ⓘ Magnesio-hastingsite Formula: NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ Magnesio-hornblende Formula: ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Atikokan mining area, Rainy River District, Ontario, Canada Poohbah Lake Alkalic Complex, Sturgeon Lake Area and Burt Lake Area, Rainy River District, Ontario, Canada Samuels Lake intrusive, Rainy River District, Ontario, Canada Iron occurrence, Finlayson Lake Area, Rainy River District, Ontario, Canada Rainy River Mine, Richardson Township, Rainy River District, Ontario, Canada |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: References: |
| ⓘ Manganite Formula: Mn3+O(OH) Localities: Reported from at least 6 localities in this region. |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Molybdenite Formula: MoS2 Localities: CN Rocky Islet quarry (Seven Mile quarry), Watten Township, Rainy River District, Ontario, Canada Bear Passage prospect (Smith-Cousineau property), Halkirk Township, Rainy River District, Ontario, Canada Mine Centre area, Bad Vermilion Lake Area, Rainy River District, Ontario, Canada Fort Frances, Rainy River District, Ontario, Canada References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: References: |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O |
| ⓘ Nepheline Formula: Na3K(Al4Si4O16) |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 Localities: |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: References: |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 18 localities in this region. |
| ⓘ Pyrolusite Formula: Mn4+O2 Localities: Steep Rock Iron Mine, Freeborn Township, Rainy River District, Ontario, Canada Caland pit, Schwenger Township, Rainy River District, Ontario, Canada Roberts pit, Steep Rock Iron Mine, Freeborn Township, Rainy River District, Ontario, Canada Errington pit, Steep Rock Iron Mine, Freeborn Township, Rainy River District, Ontario, Canada Hogarth pit, Steep Rock Iron Mine, Freeborn Township, Rainy River District, Ontario, Canada References: |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 15 localities in this region. |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rozenite Formula: FeSO4 · 4H2O |
| ⓘ Rutile ? Formula: TiO2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Serpierite Formula: Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Silver Formula: Ag |
| ⓘ Smythite Formula: (Fe,Ni)3+xS4 (x=0-0.3) |
| ⓘ Sperrylite Formula: PtAs2 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 9 localities in this region. |
| ⓘ Spionkopite Formula: Cu39S28 |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: |
| ⓘ Tellurium Formula: Te |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: References: |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ Yarrowite Formula: Cu9S8 |
| ⓘ Zircon Formula: Zr(SiO4) Localities: References: |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Tellurium | 1.CC.10 | Te |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Froodite | 2.AC.45a | α-PdBi2 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Spionkopite | 2.CA.05c | Cu39S28 |
| ⓘ | Yarrowite | 2.CA.05d | Cu9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Smythite | 2.CC.10 | (Fe,Ni)3+xS4 (x=0-0.3) |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Sperrylite | 2.EB.05a | PtAs2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Hollingworthite | 2.EB.25 | (Rh,Pt,Pd)AsS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile ? | 4.DB.05 | TiO2 |
| ⓘ | Groutite | 4.FD.10 | Mn3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Rozenite | 7.CB.15 | FeSO4 · 4H2O |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ | Chalcoalumite | 7.DD.75 | CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Cacoxenite | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| Group 9 - Silicates | |||
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Magnesio-hornblende | 9.DE.10 | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ | Magnesio-hastingsite | 9.DE.15 | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ | Edenite | 9.DE.15 | NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ | Arfvedsonite ? | 9.DE.25 | [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Nepheline | 9.FA.05 | Na3K(Al4Si4O16) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Bytownite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Conchilites' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| H | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Groutite | Mn3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Rozenite | FeSO4 · 4H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Groutite | Mn3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nepheline | Na3K(Al4Si4O16) |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rozenite | FeSO4 · 4H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Na | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Na | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Na | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Mg | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Al | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Al | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Si | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| P | Phosphorus | |
| P | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Rozenite | FeSO4 · 4H2O |
| S | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Spionkopite | Cu39S28 |
| S | ⓘ Yarrowite | Cu9S8 |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Nepheline | Na3K(Al4Si4O16) |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | ⓘ Groutite | Mn3+O(OH) |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Rozenite | FeSO4 · 4H2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| Ni | Nickel | |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| Cu | Copper | |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Spionkopite | Cu39S28 |
| Cu | ⓘ Yarrowite | Cu9S8 |
| Zn | Zinc | |
| Zn | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| As | ⓘ Sperrylite | PtAs2 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Rh | Rhodium | |
| Rh | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| Pd | Palladium | |
| Pd | ⓘ Froodite | α-PdBi2 |
| Pd | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| Ag | Silver | |
| Ag | ⓘ Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Silver | Ag |
| Te | Tellurium | |
| Te | ⓘ Tellurium | Te |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Pt | Platinum | |
| Pt | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| Pt | ⓘ Sperrylite | PtAs2 |
| Au | Gold | |
| Au | ⓘ Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Froodite | α-PdBi2 |
Fossils
There are 1 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 2 | |||||||||
|---|---|---|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 450 Ma (Late/Upper Ordovician) | |||||||||
| Oldest Fossil Listed | 461 Ma (Middle Ordovician) | |||||||||
| Stratigraphic Units |
| |||||||||
| Fossils from Region | Click here to show the list. | |||||||||
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Rainy_River_District |
|---|---|
| Wikidata ID: | Q943829 |
| GeoNames ID: | 6116135 |
Localities in this Region
- Ontario
- Rainy River District
- Ontario
- Rainy River District
- Freeborn Township
- Steep Rock Iron Mine
- Steep Rock Lake
- ⭔Halkirk Township
- ⭔Little Turtle Lake Area
- ⭔McCaul Township
- ⭔Richardson Township
- Samuels Lake intrusive
- ⭔Schwenger Township
- ⭔Sturgeon Lake Area and Burt Lake Area
- ⭔Watten Township
- Freeborn Township
- Rainy River District
Other Regions, Features and Areas that Intersect
Canada
- Ontario
- Rainy River District
- Atikokan mining areaMining Area
- Rainy River District
North America PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Steep Rock Iron Mine, Freeborn Township, Rainy River District, Ontario, Canada