South Aegean, Greecei
| Regional Level Types | |
|---|---|
| South Aegean | Administrative Region |
| Greece | Country |
This page is currently not sponsored. Click here to sponsor this page.
Mindat Locality ID:
14524
Long-form identifier:
mindat:1:2:14524:5
GUID (UUID V4):
bafb82e8-8804-40ef-b437-6d22d84f970c
Other Languages:
French:
Égée-Méridionale, Grèce
German:
Südliche Ägäis, Griechenland
Greek:
Περιφέρεια Νοτίου Αιγαίου, Ελλάδα
Italian:
Egeo Meridionale, Grecia
Russian:
Южные Эгейские острова, Греция
Simplified Chinese:
南愛琴, 希腊
Spanish:
Periferia de Egeo Meridional, Grecia
Arabic:
جنوب إيجة, اليونان
Armenian:
Հարավային Եգեյան կղզիներ, Հունաստան
Asturian:
Exéu Meridional, Grecia
Belarusian:
Паўднёвыя Эгейскія астравы, Грэцыя
Bulgarian:
Южен Егей, Гърция
Catalan:
Egeu Meridional, Grècia
Cebuano:
South Aegean, Gresya
Croatian:
Periferija Južni Egej, Grčka
Czech:
Jižní Egeis, Řecko
Dutch:
Zuid-Egeïsche Eilanden, Griekenland
Esperanto:
Suda Egeo, Grekio
Estonian:
Lõuna-Egeuse piirkond, Kreeka
Farsi/Persian:
استان اژه جنوبی, یونان
Finnish:
Etelä-Egean saaret, Kreikka
Galician:
Exeo Meridional, Grecia
Georgian:
სამხრეთ ეგეოსის კუნძულები, საბერძნეთი
Hebrew:
דרום הים האגאי, יוון
Hungarian:
Dél-Égei-szigetek, Görögország
Indonesian:
Aegea Selatan, Yunani
Japanese:
南エーゲ, ギリシャ
Javanese:
Aegea Kidul, Grikenlan
Korean:
남에게주, 그리스
Latin:
Aegaeum Australe, Graecia
Limburgian:
Zuid-Egeïsche Eilen, Griekeland
Lithuanian:
Pietų Egėjo periferija, Graikija
Lombard:
Egéo Meridiunàl, Grecia
Macedonian:
Јужен Егеј, Грција
Malay:
Aegea Selatan, Yunani
Northern Frisian:
Süüd-Egeeis, Grekenlun
Norwegian:
Sørlige egeiske øyer, Hellas
Norwegian (Nynorsk):
Dei sørlege egeiske øyane, Hellas
Polish:
Region Wyspy Egejskie Południowe, Grecja
Portuguese:
Egeu Meridional, Grécia
Romanian:
Egeea de Sud, Grecia
Scots:
Sooth Aegean, Greece
Serbian:
Периферија Јужни Егеј, Грчка
Serbo-Croatian:
Periferija Južni Egej, Grčka
South Azerbaijani:
گونئی اژه اوستانی, یونان
Swedish:
Sydegeiska öarna, Grekland
Turkish:
Güney Ege, Yunanistan
Ukrainian:
Південні Егейські острови, Греція
Urdu:
جنوبی ایجیئن, یونان
Vietnamese:
Nam Aegea, Hy Lạp
Waray:
Salatan nga Aegeo, Gresya
Western Punjabi:
صوبہ تھلواں ایجیئن, یونان
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities241 valid minerals. 4 (TL) - type locality of valid minerals. 2 erroneous literature entries.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Abswurmbachite (TL) Formula: CuMn3+6(SiO4)O8 Type Locality: Habit: fibrous to elongate prismatic grains 6-50 μm in diameter and 1-5 μm in length, and as subhedral equant grains 5-50 μm Description: occurs in low-temp, high-pressure metamorphosed Mn-rich quartzites. |
| ⓘ Acanthite Formula: Ag2S Localities: |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Aegirine Formula: NaFe3+Si2O6 Description: In mica-eclogites. |
| ⓘ Aegirine-augite Formula: (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 Localities: Description: In mica-eclogites : Large crystals rpseudomorphs after magmatic pyroxenes. References: |
| ⓘ Aikinite Formula: PbCuBiS3 |
| ⓘ 'Aikinite-Bismuthinite Series' |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 14 localities in this region. Description: Millimetric porphyroblasts. References: |
| ⓘ 'Alkali pyroxene' |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: Description: In eclogites.
In garnet/epidote glaucophanites : With inclusions of titanite, rutile, quartz, epidote and albite . References: |
| ⓘ Altaite Formula: PbTe |
| ⓘ Alunite Formula: KAl3(SO4)2(OH)6 Localities: Reported from at least 6 localities in this region. References: Kilias, Stephanos P., Naden, Jon, Cheliotis, Ioannis, Shepherd, Thomas J., Constandinidou, Heleni, Crossing, John, Simos, Ioannis (2001) Epithermal gold mineralisation in the active Aegean Volcanic Arc: the Profitis Ilias deposit, Milos Island, Greece. Mineralium Deposita, 36 (1) 32-44 doi:10.1007/s001260050284 |
| ⓘ Alunogen Formula: Al2(SO4)3 · 17H2O Localities: |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Localities: Reported from at least 7 localities in this region. Description: The best crystals are found at Aghia Marina |
| ⓘ Andradite var. Melanite Formula: Ca3(Fe3+,Ti)2(SiO4)3 Localities: References: |
| ⓘ Anglesite Formula: PbSO4 Localities: |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) Localities: |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ Antlerite ? Formula: Cu3(SO4)(OH)4 Description: Only visual ID. |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: References: |
| ⓘ Aragonite Formula: CaCO3 Localities: Reported from at least 8 localities in this region. |
| ⓘ Ardennite-(As) Formula: Mn2+4Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 Locality: Andros, South Aegean, Greece |
| ⓘ Argentopyrite Formula: AgFe2S3 |
| ⓘ Arsenic Formula: As |
| ⓘ Arseniosiderite Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ Arsenopyrite Formula: FeAsS Localities: |
| ⓘ Atacamite Formula: Cu2(OH)3Cl Localities: |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Description: In metagabbros at Grizas, replaced by omphacite. |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: |
| ⓘ Barroisite Formula: ◻{CaNa}{Mg3Al2}(AlSi7O22)(OH)2 |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 16 localities in this region. References: |
| ⓘ Berryite Formula: Cu3Ag2Pb3Bi7S16 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Beryl var. Aquamarine Formula: Be3Al2Si6O18 |
| ⓘ Betekhtinite Formula: Pb2(Cu,Fe)22-24S15 |
| ⓘ Beudantite Formula: PbFe3(AsO4)(SO4)(OH)6 |
| ⓘ 'Bindheimite' Formula: Pb2Sb2O6O Locality: Sifnos, Milos, South Aegean, Greece |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Birnessite Formula: (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O Localities: |
| ⓘ Bismuth Formula: Bi |
| ⓘ Bismuthinite Formula: Bi2S3 Localities: |
| ⓘ Bornite Formula: Cu5FeS4 Localities: References: |
| ⓘ Boulangerite Formula: Pb5Sb4S11 |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 Localities: Reported from at least 6 localities in this region. |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Cacoxenite Formula: Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ 'Calamine' Locality: Anafi, Thira, South Aegean, Greece |
| ⓘ Calaverite Formula: AuTe2 |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 22 localities in this region. Description: Replaces initial aragonite. References: |
| ⓘ Canfieldite Formula: Ag8SnS6 |
| ⓘ Caracolite Formula: Na3Pb2(SO4)3Cl |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Celadonite Formula: K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ Celsian Formula: Ba(Al2Si2O8) |
| ⓘ Cerussite Formula: PbCO3 Localities: |
| ⓘ Cervelleite Formula: Ag4TeS |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcophyllite ? Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Chamosite Formula: (Fe2+)5Al(Si,Al)4O10(OH,O)8 Localities: |
| ⓘ 'Chamosite-Clinochlore Series' |
| ⓘ Chlorargyrite Formula: AgCl Localities: References: Kilias, Stephanos P., Naden, Jon, Cheliotis, Ioannis, Shepherd, Thomas J., Constandinidou, Heleni, Crossing, John, Simos, Ioannis (2001) Epithermal gold mineralisation in the active Aegean Volcanic Arc: the Profitis Ilias deposit, Milos Island, Greece. Mineralium Deposita, 36 (1) 32-44 doi:10.1007/s001260050284 |
| ⓘ 'Chlorite Group' Localities: Reported from at least 13 localities in this region. |
| ⓘ Chloritoid Formula: (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 Localities: |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ 'Cimolite' Formula: Al4Si9O24 · 6H2O |
| ⓘ Cinnabar Formula: HgS |
| ⓘ 'Clay minerals' |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: |
| ⓘ Clinochlore var. Ripidolite Formula: (Mg,Fe,Al)6(Si,Al)4O10(OH)8 Localities: Description: Pychnochlorite. References: |
| ⓘ 'Clinoptilolite Subgroup' Formula: M3-6(Si30Al6)O72 · 20H2O Localities: |
| ⓘ 'Clinopyroxene Subgroup' Localities: |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: Description: Inclusions in albite. References: |
| ⓘ 'Clinozoisite-Epidote Series' |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Conichalcite Formula: CaCu(AsO4)(OH) |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ Copper Formula: Cu |
| ⓘ Coquimbite Formula: AlFe3(SO4)6(H2O)12 · 6H2O |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 |
| ⓘ Corundum Formula: Al2O3 Localities: |
| ⓘ Corundum var. Sapphire Formula: Al2O3 Localities: |
| ⓘ Cotunnite Formula: PbCl2 |
| ⓘ Covellite Formula: CuS Localities: |
| ⓘ Cristobalite Formula: SiO2 |
| ⓘ 'Crossite' Localities: Description: In garnet/epidote glaucophanites. References: |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 Localities: References: Kilias, Stephanos P., Ivarsson, Magnus, Chi Fru, Ernest Chi, Rattray, Jayne E., Gustafsson, Håkan, Naden, Jonathan, Detsi, Kleopatra (2020) Precipitation of Mn Oxides in Quaternary Microbially Induced Sedimentary Structures (MISS), Cape Vani Paleo-Hydrothermal Vent Field, Milos, Greece. Minerals, 10 (6) 536 doi:10.3390/min10060536 |
| ⓘ Cummingtonite Formula: ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ Cuprite Formula: Cu2O Localities: References: |
| ⓘ Cymrite Formula: BaAl2Si2(O,OH)8 · H2O |
| ⓘ Deerite Formula: (Fe,Mn)6(Fe,Al)3[Si6O17]O3(OH)5 Description: In meta-ironstones, associated with magnetite and crossite. References: |
| ⓘ Diaphorite Formula: Ag3Pb2Sb3S8 |
| ⓘ Diaspore Formula: AlO(OH) Localities: |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 Localities: |
| ⓘ Digenite Formula: Cu9S5 Localities: References: Kilias, Stephanos P., Naden, Jon, Cheliotis, Ioannis, Shepherd, Thomas J., Constandinidou, Heleni, Crossing, John, Simos, Ioannis (2001) Epithermal gold mineralisation in the active Aegean Volcanic Arc: the Profitis Ilias deposit, Milos Island, Greece. Mineralium Deposita, 36 (1) 32-44 doi:10.1007/s001260050284 Grosche, Anna, Klemd, Reiner, Denkel, Katja, Keith, Manuel, Haase, Karsten M., Voudouris, Panagiotis C., Alfieris, Dimitrios, Wiedenbeck, Michael (2023) Sources, transport, and deposition of metal(loid)s recorded by sulfide and rock geochemistry: constraints from a vertical profile through the epithermal Profitis Ilias Au prospect, Milos Island, Greece. Mineralium Deposita, 58 (6) 1101-1122 doi:10.1007/s00126-023-01170-2 |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: |
| ⓘ Diopside var. Violan Formula: CaMgSi2O6 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: |
| ⓘ Drugmanite Formula: Pb2(Fe3+,Al)(PO4)(PO3OH)(OH)2 |
| ⓘ Enargite Formula: Cu3AsS4 Localities: |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 16 localities in this region. References: |
| ⓘ Epistilbite Formula: CaAl2Si6O16 · 5H2O |
| ⓘ Famatinite Formula: Cu3SbS4 Localities: References: |
| ⓘ 'Feldspar Group' |
| ⓘ Ferrihydrite Formula: Fe3+10O14(OH)2 Localities: |
| ⓘ Ferro-glaucophane Formula: ◻[Na2][Fe2+3Al2]Si8O22(OH)2 Localities: References: |
| ⓘ Fluor-dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3F Localities: |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Franklinite Formula: Zn2+Fe3+2O4 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 13 localities in this region. |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Gersdorffite Formula: NiAsS Localities: |
| ⓘ Giorgiosite (TL) Formula: Mg5(CO3)4(OH)2 · 5-6H2O Type Locality: |
| ⓘ 'Glass' |
| ⓘ 'Glauconite' Formula: K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| ⓘ Glaucophane (TL) Formula: ◻[Na2][Mg3Al2]Si8O22(OH)2 Localities: Reported from at least 7 localities in this region. Type Locality: Syros Island, Syros, South Aegean, Greece Description: In metagabbros.
In eclogites.
In glaucophanites (Manna) and in garnet/epidote glaucophanites. References: |
| ⓘ Goethite Formula: α-Fe3+O(OH) Localities: Reported from at least 11 localities in this region. References: |
| ⓘ Gold Formula: Au Localities: Reported from at least 8 localities in this region. |
| ⓘ Gold var. Electrum Formula: (Au,Ag) Localities: |
| ⓘ Goldfieldite Formula: (Cu4◻2)(Cu4Cu+2)Te4S12S |
| ⓘ Graphite Formula: C |
| ⓘ Greenockite Formula: CdS Localities: References: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Halite Formula: NaCl Localities: |
| ⓘ Hausmannite Formula: Mn2+Mn3+2O4 |
| ⓘ Heazlewoodite Formula: Ni3S2 |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 Localities: Reported from at least 7 localities in this region. |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 22 localities in this region. References: |
| ⓘ Hematite var. Iron Rose Formula: Fe2O3 |
| ⓘ Hessite Formula: Ag2Te Localities: References: |
| ⓘ Hetaerolite Formula: ZnMn2O4 |
| ⓘ Hetaerolite var. Hydrohetaerolite Formula: Zn(Mn,◻)2(O,OH)4 |
| ⓘ Heulandite-Na Formula: (Na,Ca,K)6(Si,Al)36O72 · 22H2O |
| ⓘ Hollandite Formula: Ba(Mn4+6Mn3+2)O16 Localities: |
| ⓘ 'Hollandite Supergroup' Formula: A2+[M4+6M3+2]O16 |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 Localities: Description: As inclusions in glaucophane. |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: |
| ⓘ Ilvaite Formula: CaFe3+Fe2+2(Si2O7)O(OH) Localities: References: |
| ⓘ Iodargyrite Formula: AgI |
| ⓘ Jacobsite Formula: Mn2+Fe3+2O4 Localities: References: Kilias, Stephanos P., Ivarsson, Magnus, Chi Fru, Ernest Chi, Rattray, Jayne E., Gustafsson, Håkan, Naden, Jonathan, Detsi, Kleopatra (2020) Precipitation of Mn Oxides in Quaternary Microbially Induced Sedimentary Structures (MISS), Cape Vani Paleo-Hydrothermal Vent Field, Milos, Greece. Minerals, 10 (6) 536 doi:10.3390/min10060536 |
| ⓘ Jadeite Formula: Na(Al,Fe3+)Si2O6 Localities: Reported from at least 6 localities in this region. Description: In metagabbros.
In eclogites. |
| ⓘ Jadeite var. Chloromelanite Formula: Na(Al,Fe3+)Si2O6 Localities: Description: In mica-eclogites. References: |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Johannsenite Formula: CaMn2+Si2O6 |
| ⓘ Kanonaite Formula: Mn3+Al(SiO4)O |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 6 localities in this region. References: Kilias, Stephanos P., Naden, Jon, Cheliotis, Ioannis, Shepherd, Thomas J., Constandinidou, Heleni, Crossing, John, Simos, Ioannis (2001) Epithermal gold mineralisation in the active Aegean Volcanic Arc: the Profitis Ilias deposit, Milos Island, Greece. Mineralium Deposita, 36 (1) 32-44 doi:10.1007/s001260050284 Grosche, Anna, Klemd, Reiner, Denkel, Katja, Keith, Manuel, Haase, Karsten M., Voudouris, Panagiotis C., Alfieris, Dimitrios, Wiedenbeck, Michael (2023) Sources, transport, and deposition of metal(loid)s recorded by sulfide and rock geochemistry: constraints from a vertical profile through the epithermal Profitis Ilias Au prospect, Milos Island, Greece. Mineralium Deposita, 58 (6) 1101-1122 doi:10.1007/s00126-023-01170-2 |
| ⓘ Katophorite Formula: {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| ⓘ 'K Feldspar' Localities: Reported from at least 9 localities in this region. |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Kostovite Formula: CuAuTe4 |
| ⓘ Krennerite Formula: Au3AgTe8 |
| ⓘ Kyanite Formula: Al2(SiO4)O Habit: crystals to 10cm Colour: blue |
| ⓘ Langisite Formula: CoAs Localities: |
| ⓘ Laurite Formula: RuS2 |
| ⓘ Lawsonite Formula: CaAl2(Si2O7)(OH)2 · H2O Localities: Description: In metagabbros.
In eclogites : Inclusions in garnets, lawsonite is replaced by epidote + phengite + quartz.
In garnet/epidote glaucophanites (Bay of Megas Lakkos, east of Panavlies Mts.) : Lawsonite (2-3 cm diameter), replaced by phengite + epidote + chlorite + albite. |
| ⓘ Lawsonite var. Chromium-bearing Lawsonite ? Formula: Ca(Al,Cr)2[Si2O7](OH)2 · H2O |
| ⓘ Lepidocrocite Formula: γ-Fe3+O(OH) |
| ⓘ 'Leucoxene' Description: Inclusions in Na-amphiboles (replacement of igneous titanoaugites). |
| ⓘ 'Limonite' Localities: Reported from at least 16 localities in this region. References: |
| ⓘ Lindqvistite Formula: Pb2Mn2+Fe16O27 |
| ⓘ Litharge Formula: PbO Localities: |
| ⓘ Luzonite Formula: Cu3AsS4 |
| ⓘ Magnesio-hornblende Formula: ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 Description: In eclogites : Actinolitic hornblende ; rims glaucophane. |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 14 localities in this region. |
| ⓘ Magnetite var. Mushketovite Formula: Fe2+Fe3+2O4 Localities: References: |
| ⓘ Magnetoplumbite Formula: (Pb,Mn)(Fe,Mn)12O19 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Maldonite Formula: Au2Bi |
| ⓘ ' Formula: Mn Locality: Cape Vani (Vani deposit), Milos Island, Milos, South Aegean, Greece - erroneously reported |
| ⓘ 'Manganese Oxides' Localities: References: Kilias, Stephanos P., Naden, Jon, Cheliotis, Ioannis, Shepherd, Thomas J., Constandinidou, Heleni, Crossing, John, Simos, Ioannis (2001) Epithermal gold mineralisation in the active Aegean Volcanic Arc: the Profitis Ilias deposit, Milos Island, Greece. Mineralium Deposita, 36 (1) 32-44 doi:10.1007/s001260050284 |
| ⓘ 'Manganese Oxides var. Manganese Dendrites' |
| ⓘ Manganiandrosite-(La) (TL) Formula: (Mn2+La)(Mn3+AlMn2+)O[Si2O7][SiO4](OH) Type Locality: Description: occurs as randomly interspersed brown-red grains in a fine-grained matrix of spessartine, rhodonite, rhodocrosite and braunite in a highly oxidized quartzitic mica-schist. The manganiandrosite-(La) described in the type description was subhedral to euhedral grains commonly with a maximum diameter of 0.02-0.06 mm (20-60 µm), and rarely up to 0.2 mm.
|
| ⓘ Manjiroite Formula: Na(Mn4+7Mn3+)O16 |
| ⓘ Marcasite Formula: FeS2 Localities: References: Kilias, Stephanos P., Naden, Jon, Cheliotis, Ioannis, Shepherd, Thomas J., Constandinidou, Heleni, Crossing, John, Simos, Ioannis (2001) Epithermal gold mineralisation in the active Aegean Volcanic Arc: the Profitis Ilias deposit, Milos Island, Greece. Mineralium Deposita, 36 (1) 32-44 doi:10.1007/s001260050284 |
| ⓘ Margarite Formula: CaAl2(Al2Si2O10)(OH)2 Localities: |
| ⓘ Mawsonite Formula: Cu6Fe2SnS8 |
| ⓘ Melonite Formula: NiTe2 |
| ⓘ 'Meta-ultramafic-rock' |
| ⓘ Metavoltine Formula: K2Na6Fe2+Fe3+6O2(SO4)12 · 18H2O |
| ⓘ 'Mica Group' |
| ⓘ Millerite Formula: NiS |
| ⓘ Minium Formula: Pb3O4 |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ 'Monazite' Formula: REE(PO4) Description: Scattered tiny inclusions of monazite-(Ce)... verified in thin section by EPMA. |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) Description: Scattered tiny inclusions of monazite-(Ce)... verified in thin section by EPMA. |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O Localities: References: Kilias, Stephanos P., Naden, Jon, Cheliotis, Ioannis, Shepherd, Thomas J., Constandinidou, Heleni, Crossing, John, Simos, Ioannis (2001) Epithermal gold mineralisation in the active Aegean Volcanic Arc: the Profitis Ilias deposit, Milos Island, Greece. Mineralium Deposita, 36 (1) 32-44 doi:10.1007/s001260050284 |
| ⓘ Mordenite Formula: (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O Localities: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 19 localities in this region. Description: In greenschist facies metabasites. References: |
| ⓘ Muscovite var. Alurgite Formula: K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 Localities: Chondro Vouno, Milos Island, Milos, South Aegean, Greece Profitis Ilias Au deposit, Milos Island, Milos, South Aegean, Greece Panormos Bay, Tinos Island, Tinos, South Aegean, Greece Cape Vani (Vani deposit), Milos Island, Milos, South Aegean, Greece Akrotiri, Santorini Island, Thira, South Aegean, Greece |
| ⓘ Muscovite var. Phengite Formula: KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Nantokite Formula: CuCl |
| ⓘ Natroalunite Formula: NaAl3(SO4)2(OH)6 |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Formula: NaNa2(Mg3Al2)(AlSi7O22)(OH)2 Locality: Palos Hill, Gria Spilia, Syros Island, Syros, South Aegean, Greece - erroneously reported Description: This mineral entry was based on a dealer label. The dealer used as reference based the identification on a pre-existing label from other sources. No analyses and no literature references has been found to indicate that nybøite is actually present at this locality, despite having the subduction sone geology required for this mineral to form. |
| ⓘ Omphacite Formula: (NaaCabFe2+cMgd)(AleFe3+fFe2+gMgh)Si2O6 Localities: Description: In metagabbros, replaces cpx.
In eclogites.
In glaucophanites (Manna) and in garnet/epidote glaucophanites. References: |
| ⓘ Opal Formula: SiO2 · nH2O Localities: Profitis Ilias Au deposit, Milos Island, Milos, South Aegean, Greece Chondro Vouno, Milos Island, Milos, South Aegean, Greece Prassa Quarry (Bentomine S.A. Quarry), Kimolos Island, Kimolos, Milos, South Aegean, Greece Nea Kameni Island, Santorini Caldera, Santorini Island, Thira, South Aegean, Greece Paliochori beach (Paleochori bay), Milos Island, Milos, South Aegean, Greece References: Kilias, Stephanos P., Naden, Jon, Cheliotis, Ioannis, Shepherd, Thomas J., Constandinidou, Heleni, Crossing, John, Simos, Ioannis (2001) Epithermal gold mineralisation in the active Aegean Volcanic Arc: the Profitis Ilias deposit, Milos Island, Greece. Mineralium Deposita, 36 (1) 32-44 doi:10.1007/s001260050284 |
| ⓘ Opal var. Opal-AN Formula: SiO2 · nH2O |
| ⓘ Opal var. Opal-CT Formula: SiO2 · nH2O |
| ⓘ Orpiment Formula: As2S3 |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Paarite Formula: Pb1.7Cu1.7Bi6.3S12 |
| ⓘ Paragonite Formula: NaAl2(AlSi3O10)(OH)2 Localities: Description: In metagabbros.
In eclogites.
In glaucophanites (Manna) and in garnet/epidote glaucophanites. References: |
| ⓘ Paratacamite Formula: Cu3(Cu,Zn)(OH)6Cl2 |
| ⓘ Pearceite Formula: [Ag6As2S7][Ag9CuS4] |
| ⓘ Pekoite Formula: PbCuBi11S18 |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Petzite Formula: Ag3AuTe2 Localities: References: |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) Localities: |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: Cape Vani (Vani deposit), Milos Island, Milos, South Aegean, Greece Nea Kameni Island, Santorini Caldera, Santorini Island, Thira, South Aegean, Greece Kos, Kos, South Aegean, Greece Kinidaros, Naxos Island, Naxos, South Aegean, Greece Profitis Ilias Au deposit, Milos Island, Milos, South Aegean, Greece References: Kilias, Stephanos P., Ivarsson, Magnus, Chi Fru, Ernest Chi, Rattray, Jayne E., Gustafsson, Håkan, Naden, Jonathan, Detsi, Kleopatra (2020) Precipitation of Mn Oxides in Quaternary Microbially Induced Sedimentary Structures (MISS), Cape Vani Paleo-Hydrothermal Vent Field, Milos, Greece. Minerals, 10 (6) 536 doi:10.3390/min10060536 |
| ⓘ Plattnerite Formula: PbO2 |
| ⓘ 'Plumasite' |
| ⓘ Polybasite Formula: [Ag6Sb2S7][Ag9CuS4] Localities: |
| ⓘ Proustite Formula: Ag3AsS3 Localities: |
| ⓘ 'Psilomelane' Locality: Panormos, Mykonos, South Aegean, Greece |
| ⓘ Pumpellyite-(Mn2+) Formula: Ca2Mn2+Al2(Si2O7)(SiO4)(OH)2 · H2O |
| ⓘ 'Pumpellyite Subgroup' Formula: Ca2XAl2[Si2O6(OH)][SiO4](OH)2A Localities: |
| ⓘ Pyrargyrite Formula: Ag3SbS3 Localities: References: |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 17 localities in this region. |
| ⓘ Pyrite var. Arsenic-bearing Pyrite Formula: Fe(S,As)2 |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyrophyllite Formula: Al2Si4O10(OH)2 |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 Localities: References: Kilias, Stephanos P., Ivarsson, Magnus, Chi Fru, Ernest Chi, Rattray, Jayne E., Gustafsson, Håkan, Naden, Jonathan, Detsi, Kleopatra (2020) Precipitation of Mn Oxides in Quaternary Microbially Induced Sedimentary Structures (MISS), Cape Vani Paleo-Hydrothermal Vent Field, Milos, Greece. Minerals, 10 (6) 536 doi:10.3390/min10060536 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 35 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 Localities: |
| ⓘ Quartz var. Chalcedony Formula: SiO2 Localities: References: Kilias, Stephanos P., Naden, Jon, Cheliotis, Ioannis, Shepherd, Thomas J., Constandinidou, Heleni, Crossing, John, Simos, Ioannis (2001) Epithermal gold mineralisation in the active Aegean Volcanic Arc: the Profitis Ilias deposit, Milos Island, Greece. Mineralium Deposita, 36 (1) 32-44 doi:10.1007/s001260050284 Grosche, Anna, Klemd, Reiner, Denkel, Katja, Keith, Manuel, Haase, Karsten M., Voudouris, Panagiotis C., Alfieris, Dimitrios, Wiedenbeck, Michael (2023) Sources, transport, and deposition of metal(loid)s recorded by sulfide and rock geochemistry: constraints from a vertical profile through the epithermal Profitis Ilias Au prospect, Milos Island, Greece. Mineralium Deposita, 58 (6) 1101-1122 doi:10.1007/s00126-023-01170-2 |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Quartz var. Prase Formula: SiO2 Localities: Serifos Island, Milos, South Aegean, Greece Mega Horio (Megalo Horio; Mega Xhorio; Mia Horio; Mega Khorio; Mega Korio), Serifos Island, Milos, South Aegean, Greece Quartz occurrences, Avissalos, Serifos Island, Milos, South Aegean, Greece Koundouros (Koundouro), Serifos Island, Milos, South Aegean, Greece Neroutsika, Serifos Island, Milos, South Aegean, Greece Description: Prase from Serifos is colored green by inclusions of fibrous actinolite, not hedenbergite (Hyrsl and Niedermayr, 2003).
References: |
| ⓘ Rammelsbergite Formula: NiAs2 |
| ⓘ Ramsdellite Formula: Mn4+O2 |
| ⓘ Realgar Formula: As4S4 |
| ⓘ Rhodochrosite Formula: MnCO3 Localities: References: |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] |
| ⓘ Rhomboclase Formula: (H5O2)Fe3+(SO4)2 · 2H2O |
| ⓘ Rickardite Formula: Cu7Te5 |
| ⓘ Robinsonite Formula: Pb4Sb6S13 |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Sanidine Formula: K(AlSi3O8) |
| ⓘ Saponite Formula: Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ Sapphirine Formula: Mg4(Mg3Al9)O4[Si3Al9O36] |
| ⓘ 'Scapolite' |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: |
| ⓘ Shattuckite Formula: Cu5(Si2O6)2(OH)2 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Silver Formula: Ag |
| ⓘ 'Smectite Group' Formula: A0.3D2-3[T4O10]Z2 · nH2O Localities: References: |
| ⓘ Smithsonite Formula: ZnCO3 Localities: References: |
| ⓘ Spangolite Formula: Cu6Al(SO4)(OH)12Cl · 3H2O |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 Localities: |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 9 localities in this region. |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Stannite Formula: Cu2FeSnS4 Localities: References: |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| ⓘ Stephanite Formula: Ag5SbS4 Localities: |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Stilpnomelane Formula: (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| ⓘ Stromeyerite Formula: AgCuS |
| ⓘ Stützite Formula: Ag5-xTe3, x = 0.24-0.36 |
| ⓘ Sulphur Formula: S8 Localities: Reported from at least 10 localities in this region. |
| ⓘ Sulvanite Formula: Cu3VS4 |
| ⓘ Sursassite Formula: Mn2+2Al3(SiO4)(Si2O7)(OH)3 |
| ⓘ Sylvanite Formula: AgAuTe4 |
| ⓘ Szaibélyite Formula: MgBO2(OH) |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Tamarugite Formula: NaAl(SO4)2 · 6H2O Localities: |
| ⓘ Tellurium Formula: Te |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S Localities: References: |
| ⓘ 'Tennantite Subgroup var. Lead-bearing Tennantite' Formula: Cu6(Cu4(Zn/Fe,Pb))2)As4S12S |
| ⓘ 'Tennantite-Tetrahedrite Series' Localities: |
| ⓘ Tenorite Formula: CuO Localities: |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: Reported from at least 8 localities in this region. References: |
| ⓘ 'Tetrahedrite Subgroup var. Lead-bearing Tetrahedrite' Formula: Cu6(Cu4(Zn/Fe,Pb))2)Sb4S12S |
| ⓘ 'Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite' Formula: (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ Tetrahedrite-(Zn) Formula: Cu6(Cu4Zn2)Sb4S12S |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: Reported from at least 6 localities in this region. |
| ⓘ Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O Localities: References: Kilias, Stephanos P., Ivarsson, Magnus, Chi Fru, Ernest Chi, Rattray, Jayne E., Gustafsson, Håkan, Naden, Jonathan, Detsi, Kleopatra (2020) Precipitation of Mn Oxides in Quaternary Microbially Induced Sedimentary Structures (MISS), Cape Vani Paleo-Hydrothermal Vent Field, Milos, Greece. Minerals, 10 (6) 536 doi:10.3390/min10060536 |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Description: In metagabbros.
In glaucophanites (Manna) and in garnet/epidote glaucophanites. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ 'UM1987-19-SiO:FeHMgMnTi' Formula: (Mn2+,Fe3+,Fe2+,Ti,Mg)9Si6O20(OH)5 Locality: Andros, South Aegean, Greece |
| ⓘ 'UM2004-31-S:AgAuCuTe' Formula: (Ag,Au,Cu)9Te2S3 |
| ⓘ 'UM2004-34-S:AgCuTe' Formula: (Ag,Cu)12Te3S2 |
| ⓘ Vernadite Formula: (Mn4+,Fe3+,Ca,Na)(O,OH)2 · nH2O |
| ⓘ Vulcanite Formula: CuTe |
| ⓘ 'Wad' Description: Barite occurs in the manganese pits and elsewhere around this area as white crystals up to 5cm. |
| ⓘ Watanabeite Formula: Cu4(As,Sb)2S5 |
| ⓘ Weissite Formula: Cu2-xTe |
| ⓘ 'White mica' |
| ⓘ Winchite Formula: ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 Localities: References: |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Wonesite ? Formula: (Na,K)(Mg,Fe,Al)6((Al,Si)4O10)2(OH,F)4 Description: No analytical data, no info on method(s) used. |
| ⓘ Wurtzite Formula: (Zn,Fe)S |
| ⓘ Xanthoconite Formula: Ag3AsS3 |
| ⓘ Zircon Formula: Zr(SiO4) Localities: References: |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Zoisite var. Thulite Formula: {Ca2}{Al,Mn3+3}(Si2O7)(SiO4)O(OH) |
| ⓘ Zunyite Formula: Al13Si5O20(OH,F)18Cl Locality: Kos, Kos, South Aegean, Greece |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | 'Manganese' ? | 1.AE.30 | Mn |
| ⓘ | Bismuth | 1.CA.05 | Bi |
| ⓘ | Arsenic | 1.CA.05 | As |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| ⓘ | Tellurium | 1.CC.10 | Te |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Maldonite | 2.AA.40 | Au2Bi |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Rickardite | 2.BA.30 | Cu7Te5 |
| ⓘ | Weissite | 2.BA.30 | Cu2-xTe |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Cervelleite | 2.BA.60 | Ag4TeS |
| ⓘ | Stützite | 2.BA.65 | Ag5-xTe3, x = 0.24-0.36 |
| ⓘ | Canfieldite | 2.BA.70 | Ag8SnS6 |
| ⓘ | Petzite | 2.BA.75 | Ag3AuTe2 |
| ⓘ | Heazlewoodite | 2.BB.05 | Ni3S2 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Betekhtinite | 2.BE.05 | Pb2(Cu,Fe)22-24S15 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Mawsonite | 2.CB.20 | Cu6Fe2SnS8 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Argentopyrite | 2.CB.65 | AgFe2S3 |
| ⓘ | Sulvanite | 2.CB.70 | Cu3VS4 |
| ⓘ | Vulcanite | 2.CB.75 | CuTe |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Langisite | 2.CC.05 | CoAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Galena var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Sylvanite | 2.EA.05 | AgAuTe4 |
| ⓘ | Calaverite | 2.EA.10 | AuTe2 |
| ⓘ | Kostovite | 2.EA.15 | CuAuTe4 |
| ⓘ | Krennerite | 2.EA.15 | Au3AgTe8 |
| ⓘ | Melonite | 2.EA.20 | NiTe2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | var. Arsenic-bearing Pyrite | 2.EB.05a | Fe(S,As)2 |
| ⓘ | Laurite | 2.EB.05a | RuS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Xanthoconite | 2.GA.10 | Ag3AsS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tennantite Subgroup var. Lead-bearing Tennantite' | 2.GB.05 | Cu6(Cu4(Zn/Fe,Pb))2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Tetrahedrite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)Sb4S12S |
| ⓘ | 'Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite' | 2.GB.05 | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ | Goldfieldite | 2.GB.05 | (Cu4◻2)(Cu4Cu+2)Te4S12S |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup var. Lead-bearing Tetrahedrite' | 2.GB.05 | Cu6(Cu4(Zn/Fe,Pb))2)Sb4S12S |
| ⓘ | Stephanite | 2.GB.10 | Ag5SbS4 |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| ⓘ | Pearceite | 2.GB.15 | [Ag6As2S7][Ag9CuS4] |
| ⓘ | Watanabeite | 2.GC.15 | Cu4(As,Sb)2S5 |
| ⓘ | Paarite | 2.HB.05a | Pb1.7Cu1.7Bi6.3S12 |
| ⓘ | Aikinite | 2.HB.05a | PbCuBiS3 |
| ⓘ | Pekoite | 2.HB.05a | PbCuBi11S18 |
| ⓘ | Berryite | 2.HB.20d | Cu3Ag2Pb3Bi7S16 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Robinsonite | 2.HC.20 | Pb4Sb6S13 |
| ⓘ | Diaphorite | 2.JB.05 | Ag3Pb2Sb3S8 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| ⓘ | Luzonite | 2.KA.10 | Cu3AsS4 |
| ⓘ | Famatinite | 2.KA.10 | Cu3SbS4 |
| Group 3 - Halides | |||
| ⓘ | Nantokite | 3.AA.05 | CuCl |
| ⓘ | Iodargyrite | 3.AA.10 | AgI |
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Cotunnite | 3.AB.85 | PbCl2 |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Paratacamite | 3.DA.10c | Cu3(Cu,Zn)(OH)6Cl2 |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Litharge | 4.AC.20 | PbO |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Magnetite var. Mushketovite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Jacobsite | 4.BB.05 | Mn2+Fe3+2O4 |
| ⓘ | Franklinite | 4.BB.05 | Zn2+Fe3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Hetaerolite | 4.BB.10 | ZnMn2O4 |
| ⓘ | Hausmannite | 4.BB.10 | Mn2+Mn3+2O4 |
| ⓘ | Hetaerolite var. Hydrohetaerolite | 4.BB.10 | Zn(Mn,◻)2(O,OH)4 |
| ⓘ | Minium | 4.BD.05 | Pb3O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite var. Iron Rose | 4.CB.05 | Fe2O3 |
| ⓘ | Corundum var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Lindqvistite | 4.CC.45 | Pb2Mn2+Fe16O27 |
| ⓘ | Magnetoplumbite | 4.CC.45 | (Pb,Mn)(Fe,Mn)12O19 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var. Prase | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | var. Opal-CT | 4.DA.10 | SiO2 · nH2O |
| ⓘ | var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cristobalite | 4.DA.15 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Plattnerite | 4.DB.05 | PbO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Ramsdellite | 4.DB.15a | Mn4+O2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | 'Bindheimite' | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Hollandite | 4.DK.05a | Ba(Mn4+6Mn3+2)O16 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Manjiroite | 4.DK.05a | Na(Mn4+7Mn3+)O16 |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Lepidocrocite | 4.FE.15 | γ-Fe3+O(OH) |
| ⓘ | Ferrihydrite | 4.FE.35 | Fe3+10O14(OH)2 |
| ⓘ | Vernadite | 4.FE.40 | (Mn4+,Fe3+,Ca,Na)(O,OH)2 · nH2O |
| ⓘ | Birnessite | 4.FL.45 | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Giorgiosite (TL) | 5.DA.05 | Mg5(CO3)4(OH)2 · 5-6H2O |
| Group 6 - Borates | |||
| ⓘ | Szaibélyite | 6.BA.15 | MgBO2(OH) |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Antlerite ? | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
| ⓘ | Natroalunite | 7.BC.10 | NaAl3(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Caracolite | 7.BD.20 | Na3Pb2(SO4)3Cl |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Alunogen | 7.CB.45 | Al2(SO4)3 · 17H2O |
| ⓘ | Coquimbite | 7.CB.55 | AlFe3(SO4)6(H2O)12 · 6H2O |
| ⓘ | Rhomboclase | 7.CB.55 | (H5O2)Fe3+(SO4)2 · 2H2O |
| ⓘ | Tamarugite | 7.CC.10 | NaAl(SO4)2 · 6H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Spangolite | 7.DD.15 | Cu6Al(SO4)(OH)12Cl · 3H2O |
| ⓘ | Metavoltine | 7.DF.35 | K2Na6Fe2+Fe3+6O2(SO4)12 · 18H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Drugmanite | 8.BH.15 | Pb2(Fe3+,Al)(PO4)(PO3OH)(OH)2 |
| ⓘ | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Beudantite | 8.BL.05 | PbFe3(AsO4)(SO4)(OH)6 |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Cacoxenite | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ | Chalcophyllite ? | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Arseniosiderite | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Andradite var. Melanite | 9.AD.25 | Ca3(Fe3+,Ti)2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Kanonaite | 9.AF.10 | Mn3+Al(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Chloritoid | 9.AF.85 | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Abswurmbachite (TL) | 9.AG.05 | CuMn3+6(SiO4)O8 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Lawsonite | 9.BE.05 | CaAl2(Si2O7)(OH)2 · H2O |
| ⓘ | var. Chromium-bearing Lawsonite ? | 9.BE.05 | Ca(Al,Cr)2[Si2O7](OH)2 · H2O |
| ⓘ | Ilvaite | 9.BE.07 | CaFe3+Fe2+2(Si2O7)O(OH) |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Manganiandrosite-(La) (TL) | 9.BG.05b | (Mn2+La)(Mn3+AlMn2+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | var. Thulite | 9.BG.10 | {Ca2}{Al,Mn3+3}(Si2O7)(SiO4)O(OH) |
| ⓘ | Sursassite | 9.BG.15 | Mn2+2Al3(SiO4)(Si2O7)(OH)3 |
| ⓘ | Pumpellyite-(Mn2+) | 9.BG.20 | Ca2Mn2+Al2(Si2O7)(SiO4)(OH)2 · H2O |
| ⓘ | Ardennite-(As) | 9.BJ.40 | Mn2+4Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| ⓘ | Zunyite | 9.BJ.55 | Al13Si5O20(OH,F)18Cl |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Fluor-dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Johannsenite | 9.DA.15 | CaMn2+Si2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | var. Violan | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Aegirine-augite | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ | Omphacite | 9.DA.20 | (NaaCabFe2+cMgd)(AleFe3+fFe2+gMgh)Si2O6 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Jadeite | 9.DA.25 | Na(Al,Fe3+)Si2O6 |
| ⓘ | var. Chloromelanite | 9.DA.25 | Na(Al,Fe3+)Si2O6 |
| ⓘ | Shattuckite | 9.DB.40 | Cu5(Si2O6)2(OH)2 |
| ⓘ | Cummingtonite | 9.DE.05 | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Magnesio-hornblende | 9.DE.10 | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ | Katophorite | 9.DE.20 | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| ⓘ | Winchite | 9.DE.20 | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| ⓘ | Barroisite | 9.DE.20 | ◻{CaNa}{Mg3Al2}(AlSi7O22)(OH)2 |
| ⓘ | Nybøite ? | 9.DE.25 | NaNa2(Mg3Al2)(AlSi7O22)(OH)2 |
| ⓘ | Ferro-glaucophane | 9.DE.25 | ◻[Na2][Fe2+3Al2]Si8O22(OH)2 |
| ⓘ | Glaucophane (TL) | 9.DE.25 | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Sapphirine | 9.DH.45 | Mg4(Mg3Al9)O4[Si3Al9O36] |
| ⓘ | Deerite | 9.DH.60 | (Fe,Mn)6(Fe,Al)3[Si6O17]O3(OH)5 |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Muscovite var. Phengite | 9.EC.15 | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ | var. Alurgite | 9.EC.15 | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| ⓘ | Celadonite | 9.EC.15 | K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ | Paragonite | 9.EC.15 | NaAl2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | Wonesite ? | 9.EC.20 | (Na,K)(Mg,Fe,Al)6((Al,Si)4O10)2(OH,F)4 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Margarite | 9.EC.30 | CaAl2(Al2Si2O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Saponite | 9.EC.45 | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ | Clinochlore var. Ripidolite | 9.EC.55 | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Cymrite | 9.EG.05 | BaAl2Si2(O,OH)8 · H2O |
| ⓘ | Stilpnomelane | 9.EG.40 | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Celsian | 9.FA.30 | Ba(Al2Si2O8) |
| ⓘ | Sanidine | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Mordenite | 9.GD.35 | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| ⓘ | Epistilbite | 9.GD.45 | CaAl2Si6O16 · 5H2O |
| ⓘ | Heulandite-Na | 9.GE.05 | (Na,Ca,K)6(Si,Al)36O72 · 22H2O |
| Unclassified | |||
| ⓘ | 'Manganese Oxides var. Manganese Dendrites' | - | |
| ⓘ | 'Glass' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'UM2004-34-S:AgCuTe' | - | (Ag,Cu)12Te3S2 |
| ⓘ | 'Plumasite' | - | |
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Aikinite-Bismuthinite Series' | - | |
| ⓘ | 'UM1987-19-SiO:FeHMgMnTi' | - | (Mn2+,Fe3+,Fe2+,Ti,Mg)9Si6O20(OH)5 |
| ⓘ | 'Meta-ultramafic-rock' | - | |
| ⓘ | 'Alkali pyroxene' | - | |
| ⓘ | 'White mica' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'UM2004-31-S:AgAuCuTe' | - | (Ag,Au,Cu)9Te2S3 |
| ⓘ | 'Hollandite Supergroup' | - | A2+[M4+6M3+2]O16 |
| ⓘ | 'Smectite Group' | - | A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Pumpellyite Subgroup' | - | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Clinoptilolite Subgroup' | - | M3-6(Si30Al6)O72 · 20H2O |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Crossite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Glauconite' | - | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Cimolite' | - | Al4Si9O24 · 6H2O |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Calamine' | - | |
| ⓘ | 'Chamosite-Clinochlore Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Clinozoisite-Epidote Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Tennantite-Tetrahedrite Series' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| H | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Barroisite | ◻{CaNa}{Mg3Al2}(AlSi7O22)(OH)2 |
| H | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinoptilolite Subgroup | M3-6(Si30Al6)O72 · 20H2O |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| H | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| H | ⓘ Deerite | (Fe,Mn)6(Fe,Al)3[Si6O17]O3(OH)5 |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Drugmanite | Pb2(Fe3+,Al)(PO4)(PO3OH)(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| H | ⓘ Ferrihydrite | Fe103+O14(OH)2 |
| H | ⓘ Ferro-glaucophane | ◻[Na2][Fe32+Al2]Si8O22(OH)2 |
| H | ⓘ Giorgiosite | Mg5(CO3)4(OH)2 · 5-6H2O |
| H | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| H | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Lawsonite | CaAl2(Si2O7)(OH)2 · H2O |
| H | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| H | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| H | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| H | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Natroalunite | NaAl3(SO4)2(OH)6 |
| H | ⓘ Nybøite | NaNa2(Mg3Al2)(AlSi7O22)(OH)2 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| H | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| H | ⓘ Pumpellyite-(Mn2+) | Ca2Mn2+Al2(Si2O7)(SiO4)(OH)2 · H2O |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| H | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| H | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| H | ⓘ Sursassite | Mn22+Al3(SiO4)(Si2O7)(OH)3 |
| H | ⓘ Szaibélyite | MgBO2(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tamarugite | NaAl(SO4)2 · 6H2O |
| H | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| H | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Vernadite | (Mn4+,Fe3+,Ca,Na)(O,OH)2 · nH2O |
| H | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| H | ⓘ Wonesite | (Na,K)(Mg,Fe,Al)6((Al,Si)4O10)2(OH,F)4 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Zunyite | Al13Si5O20(OH,F)18Cl |
| H | ⓘ Manganiandrosite-(La) | (Mn2+La)(Mn3+AlMn2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Heulandite-Na | (Na,Ca,K)6(Si,Al)36O72 · 22H2O |
| H | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| H | ⓘ Cimolite | Al4Si9O24 · 6H2O |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Opal var. Opal-CT | SiO2 · nH2O |
| H | ⓘ Lawsonite var. Chromium-bearing Lawsonite | Ca(Al,Cr)2[Si2O7](OH)2 · H2O |
| H | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| H | ⓘ UM1987-19-SiO:FeHMgMnTi | (Mn2+,Fe3+,Fe2+,Ti,Mg)9Si6O20(OH)5 |
| Be | Beryllium | |
| Be | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Szaibélyite | MgBO2(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Giorgiosite | Mg5(CO3)4(OH)2 · 5-6H2O |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| O | Oxygen | |
| O | ⓘ Abswurmbachite | CuMn63+(SiO4)O8 |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| O | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Barroisite | ◻{CaNa}{Mg3Al2}(AlSi7O22)(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caracolite | Na3Pb2(SO4)3Cl |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| O | ⓘ Celsian | Ba(Al2Si2O8) |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| O | ⓘ Jadeite var. Chloromelanite | Na(Al,Fe3+)Si2O6 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinoptilolite Subgroup | M3-6(Si30Al6)O72 · 20H2O |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cristobalite | SiO2 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| O | ⓘ Deerite | (Fe,Mn)6(Fe,Al)3[Si6O17]O3(OH)5 |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Drugmanite | Pb2(Fe3+,Al)(PO4)(PO3OH)(OH)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| O | ⓘ Ferrihydrite | Fe103+O14(OH)2 |
| O | ⓘ Ferro-glaucophane | ◻[Na2][Fe32+Al2]Si8O22(OH)2 |
| O | ⓘ Franklinite | Zn2+Fe23+O4 |
| O | ⓘ Giorgiosite | Mg5(CO3)4(OH)2 · 5-6H2O |
| O | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| O | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hausmannite | Mn2+Mn23+O4 |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hetaerolite | ZnMn2O4 |
| O | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| O | ⓘ Jacobsite | Mn2+Fe23+O4 |
| O | ⓘ Jadeite | Na(Al,Fe3+)Si2O6 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Johannsenite | CaMn2+Si2O6 |
| O | ⓘ Kanonaite | Mn3+Al(SiO4)O |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Lawsonite | CaAl2(Si2O7)(OH)2 · H2O |
| O | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| O | ⓘ Lindqvistite | Pb2Mn2+Fe16O27 |
| O | ⓘ Litharge | PbO |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Magnetoplumbite | (Pb,Mn)(Fe,Mn)12O19 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Manjiroite | Na(Mn74+Mn3+)O16 |
| O | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| O | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| O | ⓘ Minium | Pb3O4 |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Natroalunite | NaAl3(SO4)2(OH)6 |
| O | ⓘ Nybøite | NaNa2(Mg3Al2)(AlSi7O22)(OH)2 |
| O | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| O | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Plattnerite | PbO2 |
| O | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| O | ⓘ Pumpellyite-(Mn2+) | Ca2Mn2+Al2(Si2O7)(SiO4)(OH)2 · H2O |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ramsdellite | Mn4+O2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| O | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sanidine | K(AlSi3O8) |
| O | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| O | ⓘ Sursassite | Mn22+Al3(SiO4)(Si2O7)(OH)3 |
| O | ⓘ Szaibélyite | MgBO2(OH) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tamarugite | NaAl(SO4)2 · 6H2O |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Vernadite | (Mn4+,Fe3+,Ca,Na)(O,OH)2 · nH2O |
| O | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| O | ⓘ Wonesite | (Na,K)(Mg,Fe,Al)6((Al,Si)4O10)2(OH,F)4 |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Zunyite | Al13Si5O20(OH,F)18Cl |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Quartz var. Prase | SiO2 |
| O | ⓘ Manganiandrosite-(La) | (Mn2+La)(Mn3+AlMn2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Heulandite-Na | (Na,Ca,K)6(Si,Al)36O72 · 22H2O |
| O | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| O | ⓘ Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
| O | ⓘ Cimolite | Al4Si9O24 · 6H2O |
| O | ⓘ Diopside var. Violan | CaMgSi2O6 |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Magnetite var. Mushketovite | Fe2+Fe23+O4 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Hematite var. Iron Rose | Fe2O3 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Opal var. Opal-CT | SiO2 · nH2O |
| O | ⓘ Lawsonite var. Chromium-bearing Lawsonite | Ca(Al,Cr)2[Si2O7](OH)2 · H2O |
| O | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| O | ⓘ Hollandite Supergroup | A2+[M64+M23+]O16 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ UM1987-19-SiO:FeHMgMnTi | (Mn2+,Fe3+,Fe2+,Ti,Mg)9Si6O20(OH)5 |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Wonesite | (Na,K)(Mg,Fe,Al)6((Al,Si)4O10)2(OH,F)4 |
| F | ⓘ Zunyite | Al13Si5O20(OH,F)18Cl |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Barroisite | ◻{CaNa}{Mg3Al2}(AlSi7O22)(OH)2 |
| Na | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Na | ⓘ Caracolite | Na3Pb2(SO4)3Cl |
| Na | ⓘ Jadeite var. Chloromelanite | Na(Al,Fe3+)Si2O6 |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Ferro-glaucophane | ◻[Na2][Fe32+Al2]Si8O22(OH)2 |
| Na | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Jadeite | Na(Al,Fe3+)Si2O6 |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Manjiroite | Na(Mn74+Mn3+)O16 |
| Na | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| Na | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Natroalunite | NaAl3(SO4)2(OH)6 |
| Na | ⓘ Nybøite | NaNa2(Mg3Al2)(AlSi7O22)(OH)2 |
| Na | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Na | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Na | ⓘ Tamarugite | NaAl(SO4)2 · 6H2O |
| Na | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Na | ⓘ Vernadite | (Mn4+,Fe3+,Ca,Na)(O,OH)2 · nH2O |
| Na | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Na | ⓘ Wonesite | (Na,K)(Mg,Fe,Al)6((Al,Si)4O10)2(OH,F)4 |
| Na | ⓘ Heulandite-Na | (Na,Ca,K)6(Si,Al)36O72 · 22H2O |
| Na | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Barroisite | ◻{CaNa}{Mg3Al2}(AlSi7O22)(OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Mg | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Giorgiosite | Mg5(CO3)4(OH)2 · 5-6H2O |
| Mg | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Mg | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Nybøite | NaNa2(Mg3Al2)(AlSi7O22)(OH)2 |
| Mg | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Mg | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Mg | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Mg | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Mg | ⓘ Szaibélyite | MgBO2(OH) |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Mg | ⓘ Wonesite | (Na,K)(Mg,Fe,Al)6((Al,Si)4O10)2(OH,F)4 |
| Mg | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| Mg | ⓘ Diopside var. Violan | CaMgSi2O6 |
| Mg | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| Mg | ⓘ UM1987-19-SiO:FeHMgMnTi | (Mn2+,Fe3+,Fe2+,Ti,Mg)9Si6O20(OH)5 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| Al | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Barroisite | ◻{CaNa}{Mg3Al2}(AlSi7O22)(OH)2 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | ⓘ Celsian | Ba(Al2Si2O8) |
| Al | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Al | ⓘ Jadeite var. Chloromelanite | Na(Al,Fe3+)Si2O6 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinoptilolite Subgroup | M3-6(Si30Al6)O72 · 20H2O |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| Al | ⓘ Deerite | (Fe,Mn)6(Fe,Al)3[Si6O17]O3(OH)5 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Drugmanite | Pb2(Fe3+,Al)(PO4)(PO3OH)(OH)2 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| Al | ⓘ Ferro-glaucophane | ◻[Na2][Fe32+Al2]Si8O22(OH)2 |
| Al | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Al | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Jadeite | Na(Al,Fe3+)Si2O6 |
| Al | ⓘ Kanonaite | Mn3+Al(SiO4)O |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Lawsonite | CaAl2(Si2O7)(OH)2 · H2O |
| Al | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Al | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Natroalunite | NaAl3(SO4)2(OH)6 |
| Al | ⓘ Nybøite | NaNa2(Mg3Al2)(AlSi7O22)(OH)2 |
| Al | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Al | ⓘ Pumpellyite-(Mn2+) | Ca2Mn2+Al2(Si2O7)(SiO4)(OH)2 · H2O |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Al | ⓘ Sanidine | K(AlSi3O8) |
| Al | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Al | ⓘ Sursassite | Mn22+Al3(SiO4)(Si2O7)(OH)3 |
| Al | ⓘ Tamarugite | NaAl(SO4)2 · 6H2O |
| Al | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Al | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Al | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Al | ⓘ Wonesite | (Na,K)(Mg,Fe,Al)6((Al,Si)4O10)2(OH,F)4 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Zunyite | Al13Si5O20(OH,F)18Cl |
| Al | ⓘ Manganiandrosite-(La) | (Mn2+La)(Mn3+AlMn2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Heulandite-Na | (Na,Ca,K)6(Si,Al)36O72 · 22H2O |
| Al | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| Al | ⓘ Cimolite | Al4Si9O24 · 6H2O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Lawsonite var. Chromium-bearing Lawsonite | Ca(Al,Cr)2[Si2O7](OH)2 · H2O |
| Al | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| Si | Silicon | |
| Si | ⓘ Abswurmbachite | CuMn63+(SiO4)O8 |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Barroisite | ◻{CaNa}{Mg3Al2}(AlSi7O22)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Si | ⓘ Celsian | Ba(Al2Si2O8) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Si | ⓘ Jadeite var. Chloromelanite | Na(Al,Fe3+)Si2O6 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinoptilolite Subgroup | M3-6(Si30Al6)O72 · 20H2O |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cristobalite | SiO2 |
| Si | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| Si | ⓘ Deerite | (Fe,Mn)6(Fe,Al)3[Si6O17]O3(OH)5 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| Si | ⓘ Ferro-glaucophane | ◻[Na2][Fe32+Al2]Si8O22(OH)2 |
| Si | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Si | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Si | ⓘ Jadeite | Na(Al,Fe3+)Si2O6 |
| Si | ⓘ Johannsenite | CaMn2+Si2O6 |
| Si | ⓘ Kanonaite | Mn3+Al(SiO4)O |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Lawsonite | CaAl2(Si2O7)(OH)2 · H2O |
| Si | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Si | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Nybøite | NaNa2(Mg3Al2)(AlSi7O22)(OH)2 |
| Si | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Si | ⓘ Pumpellyite-(Mn2+) | Ca2Mn2+Al2(Si2O7)(SiO4)(OH)2 · H2O |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Si | ⓘ Sanidine | K(AlSi3O8) |
| Si | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Si | ⓘ Sursassite | Mn22+Al3(SiO4)(Si2O7)(OH)3 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Si | ⓘ Wonesite | (Na,K)(Mg,Fe,Al)6((Al,Si)4O10)2(OH,F)4 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Zunyite | Al13Si5O20(OH,F)18Cl |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Quartz var. Prase | SiO2 |
| Si | ⓘ Manganiandrosite-(La) | (Mn2+La)(Mn3+AlMn2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Heulandite-Na | (Na,Ca,K)6(Si,Al)36O72 · 22H2O |
| Si | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| Si | ⓘ Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
| Si | ⓘ Cimolite | Al4Si9O24 · 6H2O |
| Si | ⓘ Diopside var. Violan | CaMgSi2O6 |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Opal var. Opal-CT | SiO2 · nH2O |
| Si | ⓘ Lawsonite var. Chromium-bearing Lawsonite | Ca(Al,Cr)2[Si2O7](OH)2 · H2O |
| Si | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Si | ⓘ UM1987-19-SiO:FeHMgMnTi | (Mn2+,Fe3+,Fe2+,Ti,Mg)9Si6O20(OH)5 |
| P | Phosphorus | |
| P | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | ⓘ Drugmanite | Pb2(Fe3+,Al)(PO4)(PO3OH)(OH)2 |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aikinite | PbCuBiS3 |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Argentopyrite | AgFe2S3 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Berryite | Cu3Ag2Pb3Bi7S16 |
| S | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| S | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Canfieldite | Ag8SnS6 |
| S | ⓘ Caracolite | Na3Pb2(SO4)3Cl |
| S | ⓘ Cervelleite | Ag4TeS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Famatinite | Cu3SbS4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Goldfieldite | (Cu4◻2)(Cu4Cu2+)Te4S12S |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Heazlewoodite | Ni3S2 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Laurite | RuS2 |
| S | ⓘ Luzonite | Cu3AsS4 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Mawsonite | Cu6Fe2SnS8 |
| S | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Natroalunite | NaAl3(SO4)2(OH)6 |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| S | ⓘ Pekoite | PbCuBi11S18 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| S | ⓘ Robinsonite | Pb4Sb6S13 |
| S | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stephanite | Ag5SbS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Sulvanite | Cu3VS4 |
| S | ⓘ Tamarugite | NaAl(SO4)2 · 6H2O |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Watanabeite | Cu4(As,Sb)2S5 |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Xanthoconite | Ag3AsS3 |
| S | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| S | ⓘ Paarite | Pb1.7Cu1.7Bi6.3S12 |
| S | ⓘ Pyrite var. Arsenic-bearing Pyrite | Fe(S,As)2 |
| S | ⓘ UM2004-31-S:AgAuCuTe | (Ag,Au,Cu)9Te2S3 |
| S | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| S | ⓘ UM2004-34-S:AgCuTe | (Ag,Cu)12Te3S2 |
| S | ⓘ Tennantite Subgroup var. Lead-bearing Tennantite | Cu6(Cu4(Zn/Fe,Pb))2)As4S12S |
| S | ⓘ Tetrahedrite Subgroup var. Lead-bearing Tetrahedrite | Cu6(Cu4(Zn/Fe,Pb))2)Sb4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Caracolite | Na3Pb2(SO4)3Cl |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Cotunnite | PbCl2 |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Nantokite | CuCl |
| Cl | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cl | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Cl | ⓘ Zunyite | Al13Si5O20(OH,F)18Cl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| K | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| K | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Sanidine | K(AlSi3O8) |
| K | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| K | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| K | ⓘ Wonesite | (Na,K)(Mg,Fe,Al)6((Al,Si)4O10)2(OH,F)4 |
| K | ⓘ Heulandite-Na | (Na,Ca,K)6(Si,Al)36O72 · 22H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Barroisite | ◻{CaNa}{Mg3Al2}(AlSi7O22)(OH)2 |
| Ca | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Ca | ⓘ Johannsenite | CaMn2+Si2O6 |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Lawsonite | CaAl2(Si2O7)(OH)2 · H2O |
| Ca | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Ca | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Ca | ⓘ Pumpellyite-(Mn2+) | Ca2Mn2+Al2(Si2O7)(SiO4)(OH)2 · H2O |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Ca | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vernadite | (Mn4+,Fe3+,Ca,Na)(O,OH)2 · nH2O |
| Ca | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Heulandite-Na | (Na,Ca,K)6(Si,Al)36O72 · 22H2O |
| Ca | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| Ca | ⓘ Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
| Ca | ⓘ Diopside var. Violan | CaMgSi2O6 |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Lawsonite var. Chromium-bearing Lawsonite | Ca(Al,Cr)2[Si2O7](OH)2 · H2O |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
| Ti | ⓘ UM1987-19-SiO:FeHMgMnTi | (Mn2+,Fe3+,Fe2+,Ti,Mg)9Si6O20(OH)5 |
| V | Vanadium | |
| V | ⓘ Sulvanite | Cu3VS4 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Lawsonite var. Chromium-bearing Lawsonite | Ca(Al,Cr)2[Si2O7](OH)2 · H2O |
| Mn | Manganese | |
| Mn | ⓘ Abswurmbachite | CuMn63+(SiO4)O8 |
| Mn | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| Mn | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| Mn | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Deerite | (Fe,Mn)6(Fe,Al)3[Si6O17]O3(OH)5 |
| Mn | ⓘ Hausmannite | Mn2+Mn23+O4 |
| Mn | ⓘ Hetaerolite | ZnMn2O4 |
| Mn | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Mn | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| Mn | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Mn | ⓘ Johannsenite | CaMn2+Si2O6 |
| Mn | ⓘ Kanonaite | Mn3+Al(SiO4)O |
| Mn | ⓘ Lindqvistite | Pb2Mn2+Fe16O27 |
| Mn | ⓘ Magnetoplumbite | (Pb,Mn)(Fe,Mn)12O19 |
| Mn | ⓘ Manjiroite | Na(Mn74+Mn3+)O16 |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Mn | ⓘ Pumpellyite-(Mn2+) | Ca2Mn2+Al2(Si2O7)(SiO4)(OH)2 · H2O |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Ramsdellite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Sursassite | Mn22+Al3(SiO4)(Si2O7)(OH)3 |
| Mn | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Mn | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mn | ⓘ Vernadite | (Mn4+,Fe3+,Ca,Na)(O,OH)2 · nH2O |
| Mn | ⓘ Manganiandrosite-(La) | (Mn2+La)(Mn3+AlMn2+)O[Si2O7][SiO4](OH) |
| Mn | ⓘ Manganese | Mn |
| Mn | ⓘ UM1987-19-SiO:FeHMgMnTi | (Mn2+,Fe3+,Fe2+,Ti,Mg)9Si6O20(OH)5 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Argentopyrite | AgFe2S3 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Fe | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Fe | ⓘ Jadeite var. Chloromelanite | Na(Al,Fe3+)Si2O6 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| Fe | ⓘ Deerite | (Fe,Mn)6(Fe,Al)3[Si6O17]O3(OH)5 |
| Fe | ⓘ Drugmanite | Pb2(Fe3+,Al)(PO4)(PO3OH)(OH)2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferrihydrite | Fe103+O14(OH)2 |
| Fe | ⓘ Ferro-glaucophane | ◻[Na2][Fe32+Al2]Si8O22(OH)2 |
| Fe | ⓘ Franklinite | Zn2+Fe23+O4 |
| Fe | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Fe | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Fe | ⓘ Jadeite | Na(Al,Fe3+)Si2O6 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| Fe | ⓘ Lindqvistite | Pb2Mn2+Fe16O27 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Magnetoplumbite | (Pb,Mn)(Fe,Mn)12O19 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Fe | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| Fe | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| Fe | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Fe | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Fe | ⓘ Vernadite | (Mn4+,Fe3+,Ca,Na)(O,OH)2 · nH2O |
| Fe | ⓘ Wonesite | (Na,K)(Mg,Fe,Al)6((Al,Si)4O10)2(OH,F)4 |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Andradite var. Melanite | Ca3(Fe3+,Ti)2(SiO4)3 |
| Fe | ⓘ Magnetite var. Mushketovite | Fe2+Fe23+O4 |
| Fe | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Fe | ⓘ Hematite var. Iron Rose | Fe2O3 |
| Fe | ⓘ Pyrite var. Arsenic-bearing Pyrite | Fe(S,As)2 |
| Fe | ⓘ UM1987-19-SiO:FeHMgMnTi | (Mn2+,Fe3+,Fe2+,Ti,Mg)9Si6O20(OH)5 |
| Fe | ⓘ Tennantite Subgroup var. Lead-bearing Tennantite | Cu6(Cu4(Zn/Fe,Pb))2)As4S12S |
| Fe | ⓘ Tetrahedrite Subgroup var. Lead-bearing Tetrahedrite | Cu6(Cu4(Zn/Fe,Pb))2)Sb4S12S |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Langisite | CoAs |
| Ni | Nickel | |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Heazlewoodite | Ni3S2 |
| Ni | ⓘ Melonite | NiTe2 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Cu | Copper | |
| Cu | ⓘ Abswurmbachite | CuMn63+(SiO4)O8 |
| Cu | ⓘ Aikinite | PbCuBiS3 |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Berryite | Cu3Ag2Pb3Bi7S16 |
| Cu | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Famatinite | Cu3SbS4 |
| Cu | ⓘ Goldfieldite | (Cu4◻2)(Cu4Cu2+)Te4S12S |
| Cu | ⓘ Kostovite | CuAuTe4 |
| Cu | ⓘ Luzonite | Cu3AsS4 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Cu | ⓘ Nantokite | CuCl |
| Cu | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cu | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Cu | ⓘ Pekoite | PbCuBi11S18 |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Rickardite | Cu7Te5 |
| Cu | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Cu | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Sulvanite | Cu3VS4 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Vulcanite | CuTe |
| Cu | ⓘ Watanabeite | Cu4(As,Sb)2S5 |
| Cu | ⓘ Weissite | Cu2-xTe |
| Cu | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Cu | ⓘ Paarite | Pb1.7Cu1.7Bi6.3S12 |
| Cu | ⓘ UM2004-31-S:AgAuCuTe | (Ag,Au,Cu)9Te2S3 |
| Cu | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Cu | ⓘ UM2004-34-S:AgCuTe | (Ag,Cu)12Te3S2 |
| Cu | ⓘ Tennantite Subgroup var. Lead-bearing Tennantite | Cu6(Cu4(Zn/Fe,Pb))2)As4S12S |
| Cu | ⓘ Tetrahedrite Subgroup var. Lead-bearing Tetrahedrite | Cu6(Cu4(Zn/Fe,Pb))2)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Franklinite | Zn2+Fe23+O4 |
| Zn | ⓘ Hetaerolite | ZnMn2O4 |
| Zn | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| Zn | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| Zn | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Zn | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Zn | ⓘ Tennantite Subgroup var. Lead-bearing Tennantite | Cu6(Cu4(Zn/Fe,Pb))2)As4S12S |
| Zn | ⓘ Tetrahedrite Subgroup var. Lead-bearing Tetrahedrite | Cu6(Cu4(Zn/Fe,Pb))2)Sb4S12S |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| As | ⓘ Arsenic | As |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Langisite | CoAs |
| As | ⓘ Luzonite | Cu3AsS4 |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Watanabeite | Cu4(As,Sb)2S5 |
| As | ⓘ Xanthoconite | Ag3AsS3 |
| As | ⓘ Pyrite var. Arsenic-bearing Pyrite | Fe(S,As)2 |
| As | ⓘ Tennantite Subgroup var. Lead-bearing Tennantite | Cu6(Cu4(Zn/Fe,Pb))2)As4S12S |
| Sr | Strontium | |
| Sr | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ru | Ruthenium | |
| Ru | ⓘ Laurite | RuS2 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Argentopyrite | AgFe2S3 |
| Ag | ⓘ Berryite | Cu3Ag2Pb3Bi7S16 |
| Ag | ⓘ Canfieldite | Ag8SnS6 |
| Ag | ⓘ Cervelleite | Ag4TeS |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Ag | ⓘ Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Iodargyrite | AgI |
| Ag | ⓘ Krennerite | Au3AgTe8 |
| Ag | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Ag | ⓘ Petzite | Ag3AuTe2 |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Silver | Ag |
| Ag | ⓘ Stephanite | Ag5SbS4 |
| Ag | ⓘ Stromeyerite | AgCuS |
| Ag | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Ag | ⓘ Sylvanite | AgAuTe4 |
| Ag | ⓘ Xanthoconite | Ag3AsS3 |
| Ag | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Ag | ⓘ UM2004-31-S:AgAuCuTe | (Ag,Au,Cu)9Te2S3 |
| Ag | ⓘ UM2004-34-S:AgCuTe | (Ag,Cu)12Te3S2 |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sn | Tin | |
| Sn | ⓘ Canfieldite | Ag8SnS6 |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Sb | ⓘ Famatinite | Cu3SbS4 |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Robinsonite | Pb4Sb6S13 |
| Sb | ⓘ Stephanite | Ag5SbS4 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Watanabeite | Cu4(As,Sb)2S5 |
| Sb | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Sb | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Sb | ⓘ Tetrahedrite Subgroup var. Lead-bearing Tetrahedrite | Cu6(Cu4(Zn/Fe,Pb))2)Sb4S12S |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Calaverite | AuTe2 |
| Te | ⓘ Cervelleite | Ag4TeS |
| Te | ⓘ Goldfieldite | (Cu4◻2)(Cu4Cu2+)Te4S12S |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Kostovite | CuAuTe4 |
| Te | ⓘ Krennerite | Au3AgTe8 |
| Te | ⓘ Melonite | NiTe2 |
| Te | ⓘ Petzite | Ag3AuTe2 |
| Te | ⓘ Rickardite | Cu7Te5 |
| Te | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Te | ⓘ Sylvanite | AgAuTe4 |
| Te | ⓘ Tellurium | Te |
| Te | ⓘ Vulcanite | CuTe |
| Te | ⓘ Weissite | Cu2-xTe |
| Te | ⓘ UM2004-31-S:AgAuCuTe | (Ag,Au,Cu)9Te2S3 |
| Te | ⓘ UM2004-34-S:AgCuTe | (Ag,Cu)12Te3S2 |
| I | Iodine | |
| I | ⓘ Iodargyrite | AgI |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Celsian | Ba(Al2Si2O8) |
| Ba | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| Ba | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Ba | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| La | Lanthanum | |
| La | ⓘ Manganiandrosite-(La) | (Mn2+La)(Mn3+AlMn2+)O[Si2O7][SiO4](OH) |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Calaverite | AuTe2 |
| Au | ⓘ Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Gold | Au |
| Au | ⓘ Kostovite | CuAuTe4 |
| Au | ⓘ Krennerite | Au3AgTe8 |
| Au | ⓘ Maldonite | Au2Bi |
| Au | ⓘ Petzite | Ag3AuTe2 |
| Au | ⓘ Sylvanite | AgAuTe4 |
| Au | ⓘ UM2004-31-S:AgAuCuTe | (Ag,Au,Cu)9Te2S3 |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Pb | Lead | |
| Pb | ⓘ Aikinite | PbCuBiS3 |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Berryite | Cu3Ag2Pb3Bi7S16 |
| Pb | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Pb | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Caracolite | Na3Pb2(SO4)3Cl |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Cotunnite | PbCl2 |
| Pb | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Pb | ⓘ Drugmanite | Pb2(Fe3+,Al)(PO4)(PO3OH)(OH)2 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Lindqvistite | Pb2Mn2+Fe16O27 |
| Pb | ⓘ Litharge | PbO |
| Pb | ⓘ Magnetoplumbite | (Pb,Mn)(Fe,Mn)12O19 |
| Pb | ⓘ Minium | Pb3O4 |
| Pb | ⓘ Pekoite | PbCuBi11S18 |
| Pb | ⓘ Plattnerite | PbO2 |
| Pb | ⓘ Robinsonite | Pb4Sb6S13 |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Pb | ⓘ Paarite | Pb1.7Cu1.7Bi6.3S12 |
| Pb | ⓘ Tennantite Subgroup var. Lead-bearing Tennantite | Cu6(Cu4(Zn/Fe,Pb))2)As4S12S |
| Pb | ⓘ Tetrahedrite Subgroup var. Lead-bearing Tetrahedrite | Cu6(Cu4(Zn/Fe,Pb))2)Sb4S12S |
| Bi | Bismuth | |
| Bi | ⓘ Aikinite | PbCuBiS3 |
| Bi | ⓘ Berryite | Cu3Ag2Pb3Bi7S16 |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Maldonite | Au2Bi |
| Bi | ⓘ Pekoite | PbCuBi11S18 |
| Bi | ⓘ Paarite | Pb1.7Cu1.7Bi6.3S12 |
Fossils
There are 23 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 465 |
|---|---|
| Youngest Fossil Listed | 0.01 Ma (Pleistocene) |
| Oldest Fossil Listed | 237 Ma (Middle Triassic) |
| Stratigraphic Units | Click here to view 6 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 23 fossil localities |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/South_Aegean |
|---|---|
| Wikidata ID: | Q173616 |
| GeoNames ID: | 6697808 |
Localities in this Region
- South Aegean
Other Regions, Features and Areas that Intersect
Aegean Sea PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Santorini Island, Thira, South Aegean, Greece