Pingwu Co., Mianyang, Sichuan, Chinai
| Regional Level Types | |
|---|---|
| Pingwu Co. | County |
| Mianyang | Prefecture-level City |
| Sichuan | Province |
| China | Country |
This page is currently not sponsored. Click here to sponsor this page.
Key
Neighbouring regions:
Locality type:
Name(s) in local language(s):
平武县, 绵阳市, 四川省, 中国
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Strunz Dana Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities49 valid minerals.
Rock Types Recorded
Note: this is a very new system on mindat.org and data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Alabandite Formula: MnS Locality: Huya-Siwangpu Mn deposit, Huya township, Mt Xuebaoding, Pingwu Co., Mianyang, Sichuan, China Reference: Jiuling Zhang (1982): Geology and Prospecting 18(2), 26-40 |
| ⓘ Albite Formula: Na(AlSi3O8) Reference: Song Ye, Lijian Qi, Yong'an Luo, Kaichan Zhou, and Jingcheng Pei (2001): Geological Science and Technology Information 20(2), 65-70; Baohua Li, Zhimin Cao, Youguo Li, and Haisheng Yi (2002): Mineral Deposits 21(suppl.), 397-400; Ottens, B. (2005): The Mineralogical Record 36(1), 45-57; Yan Liu, Jun Deng, Keqin Cai, Yan Zhou, Qingfei Wang, Yinghua Zhou, Bangfei Gao, Dexiu Li, Fuyu Xu, and Yuerong Zhu (2005): Earth Science Frontiers 12(2), 324-331 |
| ⓘ Albite var: Cleavelandite Formula: Na(AlSi3O8) |
| ⓘ Anglesite Formula: PbSO4 Reference: Changhua Huang, Chengjiang Zhang, and Zhiheng Liu (2010): Geoscience 24(1), 18-25 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ 'Apatite var: Collophane' Locality: Huya-Siwangpu Mn deposit, Huya township, Mt Xuebaoding, Pingwu Co., Mianyang, Sichuan, China Reference: Hongjun Liu and Youzhi Xue (1999): Ore Geology Reviews 15, 165-176. |
| ⓘ Arsenopyrite Formula: FeAsS Reference: Jingwen Mao, Yumin Qiu, Goldfarb, R.J., Zhaochong Zhang, Garwin, S., and Ren Fengshou (2002): Mineralium Deposita 37(3/4), 352-377.; Yongjun Gao, Guangzhi Ren, Bingxin Ji, and Xinzhong Wang (2011): Gold Science and Technology 19(3), 55-58 |
| ⓘ Baryte Formula: BaSO4 Reference: Changhua Huang, Chengjiang Zhang, and Zhiheng Liu (2010): Geoscience 24(1), 18-25 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Beryl var: Aquamarine Formula: Be3Al2Si6O18 Description: Cassiterite crystals with aquamarine beryl and muscovite, 7 inches Reference: Yan Liu, Bin Zhang, and Xiaoyan Yu (2001): Geology and Prospecting 37(2), 55-57; Ottens, B. (2005): The Mineralogical Record 36(1), 45-57 |
| ⓘ Beryl var: Goshenite Formula: Be3Al2(Si6O18) Reference: Yan Liu, Bin Zhang, and Xiaoyan Yu (2001): Geology and Prospecting 37(2), 55-57 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg)([Si/Al]Si2O10)(OH/F)2 |
| ⓘ Boulangerite Formula: Pb5Sb4S11 Reference: Song Ye, Lijian Qi, Yong'an Luo, Kaichan Zhou, and Jingcheng Pei (2001): Geological Science and Technology Information 20(2), 65-70 |
| ⓘ Bournonite Formula: PbCuSbS3 Reference: Ottens, B. (2005): The Mineralogical Record 36(1), 45-57. |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 Locality: Huya-Siwangpu Mn deposit, Huya township, Mt Xuebaoding, Pingwu Co., Mianyang, Sichuan, China Reference: Jiuling Zhang (1982): Geology and Prospecting 18(2), 26-40 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Jindonggou Au deposit, Pingwu Co., Mianyang, Sichuan, China Pingwu beryl mine (Huya W-Sn-Be deposit; Xuebaoding W-Sn-Be deposit), Huya township, Mt Xuebaoding, Pingwu Co., Mianyang, Sichuan, China Yinchang Au deposit (Yinchanggou Au deposit), Pingwu Co., Mianyang, Sichuan, China Xuebaoding pegmatite deposit, Pingwu Co., Mianyang, Sichuan, China |
| ⓘ 'Chlorite Group' |
| ⓘ Cinnabar Formula: HgS Reference: Jingwen Mao, Yumin Qiu, Goldfarb, R.J., Zhaochong Zhang, Garwin, S., and Ren Fengshou (2002): Mineralium Deposita 37(3/4), 352-377.; Yongjun Gao, Guangzhi Ren, Bingxin Ji, and Xinzhong Wang (2011): Gold Science and Technology 19(3), 55-58 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Reference: Changhua Huang, Chengjiang Zhang, and Zhiheng Liu (2010): Geoscience 24(1), 18-25 |
| ⓘ Clinochlore var: Pennine Formula: Mg5Al(AlSi3O10)(OH)8 Reference: Changhua Huang, Chengjiang Zhang, and Zhiheng Liu (2010): Geoscience 24(1), 18-25 |
| ⓘ Clino-suenoite Formula: □{Mn2+2}{Mg5}(Si8O22)(OH)2 |
| ⓘ Covellite Formula: CuS Reference: Changhua Huang, Chengjiang Zhang, and Zhiheng Liu (2010): Geoscience 24(1), 18-25 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ 'Feldspar Group' |
ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Galena Formula: PbS |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Reference: Song Ye, Lijian Qi, Yong'an Luo, Kaichan Zhou, and Jingcheng Pei (2001): Geological Science and Technology Information 20(2), 65-70; Yan Liu, Jun Deng, Keqin Cai, Yan Zhou, Qingfei Wang, Yinghua Zhou, Bangfei Gao, Dexiu Li, Fuyu Xu, and Yuerong Zhu (2005): Earth Science Frontiers 12(2), 324-331 |
| ⓘ Geocronite Formula: Pb14(Sb,As)6S23 Reference: Yan Liu, Jun Deng, Keqin Cai, Yan Zhou, Qingfei Wang, Yinghua Zhou, Bangfei Gao, Dexiu Li, Fuyu Xu, and Yuerong Zhu (2005): Earth Science Frontiers 12(2), 324-331 |
| ⓘ Goethite Formula: α-Fe3+O(OH) Reference: Changhua Huang, Chengjiang Zhang, and Zhiheng Liu (2010): Geoscience 24(1), 18-25 |
| ⓘ Gold Formula: Au Localities: Reported from at least 6 localities in this region. |
| ⓘ Hausmannite Formula: Mn2+Mn3+2O4 Locality: Huya-Siwangpu Mn deposit, Huya township, Mt Xuebaoding, Pingwu Co., Mianyang, Sichuan, China Reference: Jiuling Zhang (1982): Geology and Prospecting 18(2), 26-40 |
| ⓘ Ilmenite Formula: Fe2+TiO3 Reference: Cao Zhimin, Zheng Jianbin, Li Youguo, Kabayashi, S., Ren Jianguo, Kaneda, H., Xu Shijin, Shoji, T., and Wang Rucheng (2002): Science in China, Series D (Earth Sciences), 45(8), 719-729; Yan Liu, Jun Deng, Keqin Cai, Yan Zhou, Qingfei Wang, Yinghua Zhou, Bangfei Gao, Dexiu Li, Fuyu Xu, and Yuerong Zhu (2005): Earth Science Frontiers 12(2), 324-331 |
✪ Kësterite Formula: Cu2ZnSnS4 Habit: pseudo tetrahedral xls to over a cm, coated in mushistonite Colour: Yellowish mushistonite, black on fresh break Description: About a dozen or so of these specimens hit the market in two lots in 2001 and 2002. They were called a new mineral and labeled "pandaite" which had been used before and discredited. Then they chemically analysed as Kesterite. Reference: Hedland, A. (2004): Das Scheelit-Beryll-Kassiterit-Fluorit-Vorkommen von Huya-Zibeisha bei Pingwu, Provinz Sichuan, China. Mineralien Welt 15 (6), 46-57. |
| ⓘ 'Limonite' Formula: (Fe,O,OH,H2O) |
ⓘ Magnesio-foitite Formula: (□,Na)(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) Description: confirmed by microprobe analysis at IGEM RAN, Russia Reference: Pavel Kartashov data |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
ⓘ Microcline Formula: K(AlSi3O8) Reference: Cao Zhimin, Zheng Jianbin, Li Youguo, Kabayashi, S., Ren Jianguo, Kaneda, H., Xu Shijin, Shoji, T., and Wang Rucheng (2002): Science in China, Series D (Earth Sciences), 45(8), 719-729. |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Pingwu beryl mine (Huya W-Sn-Be deposit; Xuebaoding W-Sn-Be deposit), Huya township, Mt Xuebaoding, Pingwu Co., Mianyang, Sichuan, China Jindonggou Au deposit, Pingwu Co., Mianyang, Sichuan, China Yinchang Au deposit (Yinchanggou Au deposit), Pingwu Co., Mianyang, Sichuan, China Xuebaoding pegmatite deposit, Pingwu Co., Mianyang, Sichuan, China |
| ⓘ Muscovite var: Sericite Formula: KAl2(AlSi3O10)(OH)2 |
ⓘ Mushistonite Formula: (Cu,Zn,Fe2+)[Sn(OH)6] Reference: Hedland, A. (2004): Das Scheelit-Beryll-Kassiterit-Fluorit-Vorkommen von Huya-Zibeisha bei Pingwu, Provinz Sichuan, China. Mineralien Welt 15 (6), 46-57 |
| ⓘ Orpiment Formula: As2S3 Reference: Yongjun Gao, Guangzhi Ren, Bingxin Ji, and Xinzhong Wang (2011): Gold Science and Technology 19(3), 55-58 |
| ⓘ 'Psilomelane' Formula: Mn, O Locality: Huya-Siwangpu Mn deposit, Huya township, Mt Xuebaoding, Pingwu Co., Mianyang, Sichuan, China Reference: Jiuling Zhang (1982): Geology and Prospecting 18(2), 26-40 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Pyrolusite Formula: Mn4+O2 Locality: Huya-Siwangpu Mn deposit, Huya township, Mt Xuebaoding, Pingwu Co., Mianyang, Sichuan, China Reference: Jiuling Zhang (1982): Geology and Prospecting 18(2), 26-40 |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Quartz var: Chalcedony Formula: SiO2 Reference: http://www.ruegg.co.uk/Final%20Admission%20Document%20CCG.pdf |
| ⓘ Quartz var: Rock Crystal Formula: SiO2 Reference: Baohua Li, Zhimin Cao, Youguo Li, and Haisheng Yi (2002): Mineral Deposits 21(suppl.), 397-400 |
| ⓘ Quartz var: Smoky Quartz Formula: SiO2 Reference: various correctly added photos |
| ⓘ Realgar Formula: As4S4 Reference: Yongjun Gao, Guangzhi Ren, Bingxin Ji, and Xinzhong Wang (2011): Gold Science and Technology 19(3), 55-58 |
| ⓘ Rhodochrosite Formula: MnCO3 Locality: Huya-Siwangpu Mn deposit, Huya township, Mt Xuebaoding, Pingwu Co., Mianyang, Sichuan, China Reference: Jiuling Zhang (1982): Geology and Prospecting 18(2), 26-40 |
ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: Na(Fe2+3)Al6(Si6O18)(BO3)3(OH)3(OH) Reference: Rubo Zhang, Yuyu Zhang, and Xiasheng Gong (2005): Journal of Mineralogy and Petrology 26(2), 11-14 |
| ⓘ Siderite Formula: FeCO3 Reference: Jingwen Mao, Yumin Qiu, Goldfarb, R.J., Zhaochong Zhang, Garwin, S., and Ren Fengshou (2002): Mineralium Deposita 37(3/4), 352-377.; Changhua Huang, Chengjiang Zhang, and Zhiheng Liu (2010): Geoscience 24(1), 18-25 |
| ⓘ Siderite var: Pistomesite Formula: (Fe,Mg)CO3 Reference: Changhua Huang, Chengjiang Zhang, and Zhiheng Liu (2010): Geoscience 24(1), 18-25 |
| ⓘ Silver Formula: Ag Reference: Changhua Huang, Chengjiang Zhang, and Zhiheng Liu (2010): Geoscience 24(1), 18-25 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 Locality: Huya-Siwangpu Mn deposit, Huya township, Mt Xuebaoding, Pingwu Co., Mianyang, Sichuan, China Reference: Jiuling Zhang (1982): Geology and Prospecting 18(2), 26-40 |
| ⓘ Sphalerite Formula: ZnS Localities: Jindonggou Au deposit, Pingwu Co., Mianyang, Sichuan, China Pingwu beryl mine (Huya W-Sn-Be deposit; Xuebaoding W-Sn-Be deposit), Huya township, Mt Xuebaoding, Pingwu Co., Mianyang, Sichuan, China Yinchang Au deposit (Yinchanggou Au deposit), Pingwu Co., Mianyang, Sichuan, China Xuebaoding pegmatite deposit, Pingwu Co., Mianyang, Sichuan, China |
| ⓘ Stannite Formula: Cu2FeSnS4 Reference: Carles Curto Milà |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Titanite Formula: CaTi(SiO4)O Reference: Yan Liu, Jun Deng, Keqin Cai, Yan Zhou, Qingfei Wang, Yinghua Zhou, Bangfei Gao, Dexiu Li, Fuyu Xu, and Yuerong Zhu (2005): Earth Science Frontiers 12(2), 324-331 |
| ⓘ 'Tourmaline' Formula: A(D3)G6(Si6O18)(BO3)3X3Z |
| ⓘ 'Unnamed (Fe-Sn Oxide)' Formula: Fe3+2Sn3O9 Reference: Rubo Zhang, Yuyu Zhang, and Xiasheng Gong (2005): Journal of Mineralogy and Petrology 26(2), 11-14 |
ⓘ Vismirnovite Formula: Zn[Sn(OH)6] Reference: Pavel M. Kartashov analytical data (2014), Jiangbin material |
ⓘ 'Vredenburgite' Reference: Pavel M. Kartashov analythical data of 2015, Jiangbin material |
| ⓘ 'Wolframite' Formula: (Fe2+)WO4 to (Mn2+)WO4 Reference: Ottens, B. (2005): The Mineralogical Record 36(1), 45-57. |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Silver | 1.AA.05 | Ag |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Alabandite | 2.CD.10 | MnS |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Geocronite | 2.JB.30a | Pb14(Sb,As)6S23 |
| ⓘ | Kësterite | 2.CB.15a | Cu2ZnSnS4 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Hausmannite | 4.BB.10 | Mn2+Mn3+2O4 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Mushistonite | 4.FC.10 | (Cu,Zn,Fe2+)[Sn(OH)6] |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var: Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var: Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var: Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Vismirnovite | 4.FC.10 | Zn[Sn(OH)6] |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | var: Pistomesite | 5.AB.05 | (Fe,Mg)CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var: Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var: Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| ⓘ | var: Goshenite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Clino-suenoite | 9.DE. | □{Mn2+2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var: Pennine | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Magnesio-foitite | 9.CK.05 | (□,Na)(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var: Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Schorl | 9.CK.05 | Na(Fe2+3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| Unclassified Minerals, Rocks, etc. | |||
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'var: Collophane' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg)([Si/Al]Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Limonite' | - | (Fe,O,OH,H2O) |
| ⓘ | 'Psilomelane' | - | Mn, O |
| ⓘ | 'Tourmaline' | - | A(D3)G6(Si6O18)(BO3)3X3Z |
| ⓘ | 'Unnamed (Fe-Sn Oxide)' | - | Fe3+2Sn3O9 |
| ⓘ | 'Vredenburgite' | - | |
| ⓘ | 'Wolframite' | - | (Fe2+)WO4to (Mn2+)WO4 |
List of minerals arranged by Dana 8th Edition classification
| Group 1 - NATIVE ELEMENTS AND ALLOYS | |||
|---|---|---|---|
| Metals, other than the Platinum Group | |||
| ⓘ | Gold | 1.1.1.1 | Au |
| ⓘ | Silver | 1.1.1.2 | Ag |
| Group 2 - SULFIDES | |||
| AmXp, with m:p = 1:1 | |||
| ⓘ | Alabandite | 2.8.1.4 | MnS |
| ⓘ | Cinnabar | 2.8.14.1 | HgS |
| ⓘ | Covellite | 2.8.12.1 | CuS |
| ⓘ | Galena | 2.8.1.1 | PbS |
| ⓘ | Realgar | 2.8.21.1 | As4S4 |
| ⓘ | Sphalerite | 2.8.2.1 | ZnS |
| AmBnXp, with (m+n):p = 1:1 | |||
| ⓘ | Chalcopyrite | 2.9.1.1 | CuFeS2 |
| ⓘ | Kësterite | 2.9.2.9 | Cu2ZnSnS4 |
| ⓘ | Stannite | 2.9.2.1 | Cu2FeSnS4 |
| AmBnXp, with (m+n):p = 2:3 | |||
| ⓘ | Orpiment | 2.11.1.1 | As2S3 |
| ⓘ | Stibnite | 2.11.2.1 | Sb2S3 |
| AmBnXp, with (m+n):p = 1:2 | |||
| ⓘ | Arsenopyrite | 2.12.4.1 | FeAsS |
| ⓘ | Molybdenite | 2.12.10.1 | MoS2 |
| ⓘ | Pyrite | 2.12.1.1 | FeS2 |
| Group 3 - SULFOSALTS | |||
| 3 <ø < 4 | |||
| ⓘ | Geocronite | 3.3.1.2 | Pb14(Sb,As)6S23 |
| ø = 3 | |||
| ⓘ | Bournonite | 3.4.3.2 | PbCuSbS3 |
| 2.5 < ø < 3 | |||
| ⓘ | Boulangerite | 3.5.2.1 | Pb5Sb4S11 |
| Group 4 - SIMPLE OXIDES | |||
| A2X3 | |||
| ⓘ | Ilmenite | 4.3.5.1 | Fe2+TiO3 |
| AX2 | |||
| ⓘ | Cassiterite | 4.4.1.5 | SnO2 |
| ⓘ | Pyrolusite | 4.4.1.4 | Mn4+O2 |
| Group 6 - HYDROXIDES AND OXIDES CONTAINING HYDROXYL | |||
| XO(OH) | |||
| ⓘ | Goethite | 6.1.1.2 | α-Fe3+O(OH) |
| X(OH)3 | |||
| ⓘ | Mushistonite | 6.3.6.6 | (Cu,Zn,Fe2+)[Sn(OH)6] |
| ⓘ | Vismirnovite | 6.3.6.4 | Zn[Sn(OH)6] |
| Group 7 - MULTIPLE OXIDES | |||
| AB2X4 | |||
| ⓘ | Hausmannite | 7.2.7.1 | Mn2+Mn3+2O4 |
| ⓘ | Magnetite | 7.2.2.3 | Fe2+Fe3+2O4 |
| (AB)2X3 | |||
| ⓘ | Braunite | 7.5.1.3 | Mn2+Mn3+6(SiO4)O8 |
| Group 9 - NORMAL HALIDES | |||
| AX2 | |||
| ⓘ | Fluorite | 9.2.1.1 | CaF2 |
| Group 14 - ANHYDROUS NORMAL CARBONATES | |||
| A(XO3) | |||
| ⓘ | Calcite | 14.1.1.1 | CaCO3 |
| ⓘ | Rhodochrosite | 14.1.1.4 | MnCO3 |
| ⓘ | Siderite | 14.1.1.3 | FeCO3 |
| AB(XO3)2 | |||
| ⓘ | Dolomite | 14.2.1.1 | CaMg(CO3)2 |
| Group 16a - ANHYDROUS CARBONATES CONTAINING HYDROXYL OR HALOGEN | |||
| ⓘ | Malachite | 16a.3.1.1 | Cu2(CO3)(OH)2 |
| Group 28 - ANHYDROUS ACID AND NORMAL SULFATES | |||
| AXO4 | |||
| ⓘ | Anglesite | 28.3.1.3 | PbSO4 |
| ⓘ | Baryte | 28.3.1.1 | BaSO4 |
| Group 41 - ANHYDROUS PHOSPHATES, ETC.CONTAINING HYDROXYL OR HALOGEN | |||
| A5(XO4)3Zq | |||
| ⓘ | Fluorapatite | 41.8.1.1 | Ca5(PO4)3F |
| Group 48 - ANHYDROUS MOLYBDATES AND TUNGSTATES | |||
| AXO4 | |||
| ⓘ | Scheelite | 48.1.2.1 | Ca(WO4) |
| Group 51 - NESOSILICATES Insular SiO4 Groups Only | |||
| Insular SiO4 Groups Only with cations in [6] and >[6] coordination | |||
| ⓘ | Spessartine | 51.4.3a.3 | Mn2+3Al2(SiO4)3 |
| Group 52 - NESOSILICATES Insular SiO4 Groups and O,OH,F,H2O | |||
| Insular SiO4 Groups and O, OH, F, and H2O with cations in [6] and/or >[6] coordination | |||
| ⓘ | Titanite | 52.4.3.1 | CaTi(SiO4)O |
| Group 61 - CYCLOSILICATES Six-Membered Rings | |||
| Six-Membered Rings with [Si6O18] rings; possible (OH) and Al substitution | |||
| ⓘ | Beryl | 61.1.1.1 | Be3Al2(Si6O18) |
| Six-Membered Rings with borate groups | |||
| ⓘ | Schorl | 61.3.1.10 | Na(Fe2+3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Group 71 - PHYLLOSILICATES Sheets of Six-Membered Rings | |||
| Sheets of 6-membered rings with 2:1 layers | |||
| ⓘ | Muscovite | 71.2.2a.1 | KAl2(AlSi3O10)(OH)2 |
| Sheets of 6-membered rings interlayered 1:1, 2:1, and octahedra | |||
| ⓘ | Clinochlore | 71.4.1.4 | Mg5Al(AlSi3O10)(OH)8 |
| Group 75 - TECTOSILICATES Si Tetrahedral Frameworks | |||
| Si Tetrahedral Frameworks - SiO2 with [4] coordinated Si | |||
| ⓘ | Quartz | 75.1.3.1 | SiO2 |
| Group 76 - TECTOSILICATES Al-Si Framework | |||
| Al-Si Framework with Al-Si frameworks | |||
| ⓘ | Albite | 76.1.3.1 | Na(AlSi3O8) |
| ⓘ | Microcline | 76.1.1.5 | K(AlSi3O8) |
| Unclassified Minerals, Mixtures, etc. | |||
| ⓘ | Albite var: Cleavelandite | - | Na(AlSi3O8) |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'var: Collophane' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | Beryl var: Aquamarine | - | Be3Al2Si6O18 |
| ⓘ | var: Goshenite | - | Be3Al2(Si6O18) |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg)([Si/Al]Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | Clino-suenoite | - | □{Mn2+2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Clinochlore var: Pennine | - | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Limonite' | - | (Fe,O,OH,H2O) |
| ⓘ | Magnesio-foitite | - | (□,Na)(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite var: Sericite | - | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 'Psilomelane' | - | Mn, O |
| ⓘ | Quartz var: Chalcedony | - | SiO2 |
| ⓘ | var: Rock Crystal | - | SiO2 |
| ⓘ | var: Smoky Quartz | - | SiO2 |
| ⓘ | Siderite var: Pistomesite | - | (Fe,Mg)CO3 |
| ⓘ | 'Tourmaline' | - | A(D3)G6(Si6O18)(BO3)3X3Z |
| ⓘ | 'Unnamed (Fe-Sn Oxide)' | - | Fe3+2Sn3O9 |
| ⓘ | 'Vredenburgite' | - | |
| ⓘ | 'Wolframite' | - | (Fe2+)WO4 to (Mn2+)WO4 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Mushistonite | (Cu,Zn,Fe2+)[Sn(OH)6] |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg)([Si/Al]Si2O10)(OH/F)2 |
| H | ⓘ Muscovite (var: Sericite) | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Magnesio-foitite | (□,Na)(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Clino-suenoite | □{Mn22+}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Limonite | (Fe,O,OH,H2O) |
| H | ⓘ Clinochlore (var: Pennine) | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Vismirnovite | Zn[Sn(OH)6] |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Be | Beryllium | |
| Be | ⓘ Beryl (var: Aquamarine) | Be3Al2Si6O18 |
| Be | ⓘ Beryl (var: Goshenite) | Be3Al2(Si6O18) |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | A(D3)G6(Si6O18)(BO3)3X3Z |
| B | ⓘ Magnesio-foitite | (□,Na)(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Siderite (var: Pistomesite) | (Fe,Mg)CO3 |
| O | Oxygen | |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Beryl (var: Aquamarine) | Be3Al2Si6O18 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Mushistonite | (Cu,Zn,Fe2+)[Sn(OH)6] |
| O | ⓘ Albite (var: Cleavelandite) | Na(AlSi3O8) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Beryl (var: Goshenite) | Be3Al2(Si6O18) |
| O | ⓘ Tourmaline | A(D3)G6(Si6O18)(BO3)3X3Z |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Hausmannite | Mn2+Mn23+O4 |
| O | ⓘ Quartz (var: Chalcedony) | SiO2 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Wolframite | (Fe2+)WO4 to (Mn2+)WO4 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Psilomelane | Mn, O |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg)([Si/Al]Si2O10)(OH/F)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Muscovite (var: Sericite) | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Siderite (var: Pistomesite) | (Fe,Mg)CO3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Quartz (var: Smoky Quartz) | SiO2 |
| O | ⓘ Magnesio-foitite | (□,Na)(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Unnamed (Fe-Sn Oxide) | Fe23+Sn3O9 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Clino-suenoite | □{Mn22+}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Limonite | (Fe,O,OH,H2O) |
| O | ⓘ Clinochlore (var: Pennine) | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Vismirnovite | Zn[Sn(OH)6] |
| O | ⓘ Quartz (var: Rock Crystal) | SiO2 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg)([Si/Al]Si2O10)(OH/F)2 |
| Na | Sodium | |
| Na | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite (var: Cleavelandite) | Na(AlSi3O8) |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Mg | Magnesium | |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg)([Si/Al]Si2O10)(OH/F)2 |
| Mg | ⓘ Siderite (var: Pistomesite) | (Fe,Mg)CO3 |
| Mg | ⓘ Magnesio-foitite | (□,Na)(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Clino-suenoite | □{Mn22+}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Clinochlore (var: Pennine) | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | Aluminium | |
| Al | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Beryl (var: Aquamarine) | Be3Al2Si6O18 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite (var: Cleavelandite) | Na(AlSi3O8) |
| Al | ⓘ Beryl (var: Goshenite) | Be3Al2(Si6O18) |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg)([Si/Al]Si2O10)(OH/F)2 |
| Al | ⓘ Muscovite (var: Sericite) | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Magnesio-foitite | (□,Na)(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Clinochlore (var: Pennine) | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | Silicon | |
| Si | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Beryl (var: Aquamarine) | Be3Al2Si6O18 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite (var: Cleavelandite) | Na(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Beryl (var: Goshenite) | Be3Al2(Si6O18) |
| Si | ⓘ Tourmaline | A(D3)G6(Si6O18)(BO3)3X3Z |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz (var: Chalcedony) | SiO2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg)([Si/Al]Si2O10)(OH/F)2 |
| Si | ⓘ Muscovite (var: Sericite) | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz (var: Smoky Quartz) | SiO2 |
| Si | ⓘ Magnesio-foitite | (□,Na)(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Clino-suenoite | □{Mn22+}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Clinochlore (var: Pennine) | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Quartz (var: Rock Crystal) | SiO2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Kësterite | Cu2ZnSnS4 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Galena | PbS |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Alabandite | MnS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Geocronite | Pb14(Sb,As)6S23 |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Stannite | Cu2FeSnS4 |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg)([Si/Al]Si2O10)(OH/F)2 |
| K | ⓘ Muscovite (var: Sericite) | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ti | Titanium | |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | ⓘ Hausmannite | Mn2+Mn23+O4 |
| Mn | ⓘ Wolframite | (Fe2+)WO4 to (Mn2+)WO4 |
| Mn | ⓘ Psilomelane | Mn, O |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Alabandite | MnS |
| Mn | ⓘ Clino-suenoite | □{Mn22+}{Mg5}(Si8O22)(OH)2 |
| Fe | Iron | |
| Fe | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Mushistonite | (Cu,Zn,Fe2+)[Sn(OH)6] |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Wolframite | (Fe2+)WO4 to (Mn2+)WO4 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg)([Si/Al]Si2O10)(OH/F)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Siderite (var: Pistomesite) | (Fe,Mg)CO3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Unnamed (Fe-Sn Oxide) | Fe23+Sn3O9 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Limonite | (Fe,O,OH,H2O) |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Cu | Copper | |
| Cu | ⓘ Kësterite | Cu2ZnSnS4 |
| Cu | ⓘ Mushistonite | (Cu,Zn,Fe2+)[Sn(OH)6] |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Zn | Zinc | |
| Zn | ⓘ Kësterite | Cu2ZnSnS4 |
| Zn | ⓘ Mushistonite | (Cu,Zn,Fe2+)[Sn(OH)6] |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Vismirnovite | Zn[Sn(OH)6] |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Geocronite | Pb14(Sb,As)6S23 |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Orpiment | As2S3 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Silver | Ag |
| Sn | Tin | |
| Sn | ⓘ Kësterite | Cu2ZnSnS4 |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Mushistonite | (Cu,Zn,Fe2+)[Sn(OH)6] |
| Sn | ⓘ Unnamed (Fe-Sn Oxide) | Fe23+Sn3O9 |
| Sn | ⓘ Vismirnovite | Zn[Sn(OH)6] |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Geocronite | Pb14(Sb,As)6S23 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Wolframite | (Fe2+)WO4 to (Mn2+)WO4 |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Pb | Lead | |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Geocronite | Pb14(Sb,As)6S23 |
| Pb | ⓘ Anglesite | PbSO4 |
Fossils
There are 3 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 83 | |||||||||
|---|---|---|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 260 Ma (Permian) | |||||||||
| Oldest Fossil Listed | 433 Ma (Silurian) | |||||||||
| Stratigraphic Units |
| |||||||||
| Fossils from Region | Click here to show the list. | |||||||||
| Fossil Localities | Click to show 3 fossil localities |
Localities in this Region
- Sichuan
- Sichuan
- Mianyang
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Mt Xuebaoding, Pingwu Co., Mianyang, Sichuan, China