Hampshire County, Massachusetts, USAi
| Regional Level Types | |
|---|---|
| Hampshire County | County |
| Massachusetts | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Amherst | 39,833 (2017) |
| Northampton | 28,540 (2017) |
| Amherst Center | 19,065 (2017) |
| South Hadley | 17,652 (2017) |
| Easthampton | 16,611 (2017) |
| North Amherst | 6,819 (2017) |
Mindat Locality ID:
15207
Long-form identifier:
mindat:1:2:15207:8
GUID (UUID V4):
5e14b16b-bc2d-4770-80b5-99bdec560c09
Other Languages:
French:
comté de Hampshire, Massachusetts, États-Unis
German:
Hampshire County, Massachusetts, Vereinigte Staaten
Italian:
contea di Hampshire, Massachusetts, Stati Uniti d'America
Russian:
Хампшир, Массачусетс, Соединённые Штаты Америки
Simplified Chinese:
漢普夏縣, 麻薩諸塞州, 美国
Spanish:
Condado de Hampshire, Massachusetts, Estados Unidos
Albanian:
Hampshire County, Massachusetts, Shtetet e Bashkuara të Amerikës
Arabic:
مقاطعة هامبشاير, ماساتشوستس, الولايات المتحدة
Armenian:
Համպշիր շրջան, Մասսաչուսեթս, Ամերիկայի Միացյալ Նահանգներ
Basque:
Hampshire konderria , Massachusetts
Bavarian:
Hampshire County, Massachusetts, Vaoanigte Stootn
Belarusian:
Гэмпшыр, Масачусетс, Злучаныя Штаты Амерыкі
Bishnupriya Manipuri:
হেম্পশায়ার কাউন্টি, ম্যাসাচুসেট্স, তিলপারাষ্ট্র
Bulgarian:
Хампшър, Масачузетс, Съединени американски щати
Cebuano:
Hampshire County , Massachusetts
Danish:
Hampshire County, Massachusetts, USA
Dutch:
Hampshire County, Massachusetts, Verenigde Staten
Estonian:
Hampshire'i maakond, Massachusetts, Ameerika Ühendriigid
Farsi/Persian:
شهرستان همپشر، ماساچوست, ماساچوست, ایالات متحده آمریکا
Georgian:
ჰემპშირის ოლქი, მასაჩუსეტსი, ამერიკის შეერთებული შტატები
Hebrew:
מחוז המפשייר, מסצ'וסטס, ארצות הברית
Hungarian:
Hampshire megye, Massachusetts, Amerikai Egyesült Államok
Irish Gaelic:
Contae Hampshire, Massachusetts, Stáit Aontaithe Mheiriceá
Japanese:
ハンプシャー郡, マサチューセッツ州, アメリカ合衆国
Latin:
Hamtoni comitatus, Massachusetta, Civitates Foederatae Americae
Low Saxon/Low German:
Hampshire County, Massachusetts, USA
Min Dong Chinese:
Hampshire Gông, Massachusetts
Minnan / Hokkien-Taiwanese:
Hampshire Kūn
Norwegian:
Hampshire County, Massachusetts, USA
Polish:
Hrabstwo Hampshire, Massachusetts, Stany Zjednoczone
Portuguese:
Condado de Hampshire, Massachusetts, Estados Unidos
Romanian:
Comitatul Hampshire, Massachusetts, Statele Unite ale Americii
Sardinian:
contea de Hampshire, Massachusetts, Istados Unidos de Amèrica
Scots:
Hampshire Coonty, Massachusetts
Scottish Gaelic:
Hampshire County, Massachusetts, Na Stàitean Aonaichte
Serbian:
Округ Хемпшир, Масачусетс, Сједињене Америчке Државе
Serbo-Croatian:
Hampshire County, Massachusetts, Sjedinjene Američke Države
Swedish:
Hampshire County, Massachusetts, USA
Turkish:
Hampshire County, Massachusetts, Amerika Birleşik Devletleri
Ukrainian:
Гемпшир, Массачусетс, Сполучені Штати Америки
Urdu:
ہیمپشائر کاؤنٹی، میساچوسٹس, میساچوسٹس, ریاستہائے متحدہ امریکا
Vietnamese:
Quận Hampshire, Massachusetts, Chủng Quốc Hoa Kỳ
Waray:
Condado han Hampshire, Massachusetts, Estados Unidos
Western Punjabi:
ہیمپشائر کاؤنٹی, میساچیوسٹس, امریکہ
Hampshire County was established in 1662.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities143 valid minerals. 1 (TL) - type locality of valid minerals. 2 (FRL) - first recorded locality of unapproved mineral/variety/etc. 6 erroneous literature entries.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Alabandite Formula: MnS |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 10 localities in this region. Description: Pseudomorphs after laumontite |
| ⓘ Albite var. Cleavelandite (FRL) Formula: Na(AlSi3O8) Localities: Clark Ledge pegmatite locality, Chesterfield, Hampshire County, Massachusetts, USA Macomber Ledge pegmatite locality, Chesterfield, Hampshire County, Massachusetts, USA West Chesterfield Hollow pegmatite locality, Chesterfield, Hampshire County, Massachusetts, USA Walnut Hill Pegmatite prospect, Huntington (Norwich), Hampshire County, Massachusetts, USA Barrus farm pegmatite localities, Goshen, Hampshire County, Massachusetts, USA |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Localities: |
| ⓘ Alleghanyite Formula: Mn2+5(SiO4)2(OH)2 Localities: |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: |
| ⓘ 'Almandine-Spessartine Series' Localities: Habit: trapezohedral Colour: burgundy to orange-brown Description: Probably the best "species" to list most crystals under that have not been analyzed as they cannot be reliably differentiated visually. References: |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Andalusite var. Chiastolite Formula: Al2(SiO4)O |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Anhydrite Formula: CaSO4 Localities: References: |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Annite Formula: KFe2+3(AlSi3O10)(OH)2 |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) Localities: |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ Anthophyllite Formula: ◻{Mg2}{Mg5}(Si8O22)(OH)2 Habit: Fibrous. Some fibers more than two feet long. |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 Localities: |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O22]X · 8H2O |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O Localities: References: |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: References: |
| ⓘ Babingtonite Formula: Ca2(Fe,Mn)FeSi5O14(OH) |
| ⓘ Bafertisite Formula: Ba2Fe2+4Ti2(Si2O7)2O2(OH)2F2 Description: No data in the source reference. Is there a reference that proves this species? |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Bementite Formula: Mn7Si6O15(OH)8 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Reported from at least 9 localities in this region. |
| ⓘ Beryl var. Aquamarine Formula: Be3Al2Si6O18 |
| ⓘ Beryl var. Goshenite Formula: Be3Al2(Si6O18) |
| ⓘ Beryl var. Morganite Formula: Be3Al2(Si6O18) Localities: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Birnessite Formula: (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O Localities: |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 10 localities in this region. References: |
| ⓘ Calcite var. Argentine Formula: CaCO3 Localities: References: |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ Caryopilite Formula: Mn2+3Si2O5(OH)4 |
| ⓘ Cassiterite Formula: SnO2 Localities: |
| ⓘ Cerussite Formula: PbCO3 Localities: References: |
| ⓘ 'Chabazite' Localities: |
| ⓘ Chabazite-Ca Formula: (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O Habit: pseudocubic Colour: colorless to white Description: Crystals to 6 mm with prehnite and quartz in fracture/vesicles in basalt. |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcocite Formula: Cu2S Localities: |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Chlorite Group' Localities: |
| ⓘ Chloritoid ? Formula: (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| ⓘ Chondrodite Formula: Mg5(SiO4)2F2 |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 Localities: References: |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Localities: References: |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 Localities: References: |
| ⓘ Cookeite ? Formula: (LiAl4◻)[AlSi3O10](OH)8 Localities: |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ Corundum Formula: Al2O3 Colour: some deep sapphire blue |
| ⓘ Corundum var. Sapphire Formula: Al2O3 |
| ⓘ Formula: PbCl2 Locality: Loudville Lead Mines (Manhan Lead-Silver Mine; Southampton Lead Mine; Northampton Lead Mine), Easthampton, Hampshire County, Massachusetts, USA - erroneously reported Description: The "cotunnite" reported and examined by Shepard (1866) was found in four specimens collected by Mr. P. W. Lyman. Emerson (1895) reexamined these same specimens and found them to be insoluble. He found them to contain lead and sulfur, but no chlorine, and identified them as anglesite. Ref; Emerson, B. K. (1895): A Mineralogical Lexicon of Franklin, Hampshire, and Hampden Counties, Massachusetts (USGS Bulletin 126).
|
| ⓘ Covellite Formula: CuS |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 |
| ⓘ Cummingtonite Formula: ◻{Mg2}{Mg5}(Si8O22)(OH)2 Localities: |
| ⓘ 'Cummingtonite (of Dewey)' Formula: (Fe,Mg)7Si8O22(OH)2 |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ 'Cymatolite' Localities: |
| ⓘ Datolite Formula: CaB(SiO4)(OH) |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: |
| ⓘ Djurleite Formula: Cu31S16 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) Localities: |
| ⓘ Enstatite Formula: Mg2Si2O6 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Betts Manganese Mines (Anson Betts Mine; Plainfield Manganese Mines; Taconic Manganese Mines), Plainfield, Hampshire County, Massachusetts, USA Belchertown, Hampshire County, Massachusetts, USA Pelham asbestos mine, Pelham, Hampshire County, Massachusetts, USA Pelham Granite quarry (Ward Quarry; Valley Quarry), Pelham, Hampshire County, Massachusetts, USA Rockrimmon Street construction site, Belchertown, Hampshire County, Massachusetts, USA |
| ⓘ 'Epidote Supergroup' Formula: (A1A2)(M1M2M3)O4[Si2O7][SiO4]O10 |
| ⓘ 'Fayalite-Forsterite Series' |
| ✪ Ferro-hornblende Formula: ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 Habit: radiating, bladed aggregates Colour: black Fluorescence: none Description: radiating, bladed aggregates reaching over 5 cm |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: Betts Manganese Mines (Anson Betts Mine; Plainfield Manganese Mines; Taconic Manganese Mines), Plainfield, Hampshire County, Massachusetts, USA Barrus farm pegmatite localities, Goshen, Hampshire County, Massachusetts, USA Walnut Hill Pegmatite prospect, Huntington (Norwich), Hampshire County, Massachusetts, USA |
| ⓘ Fluorite Formula: CaF2 Localities: Northampton Quarry, Northampton, Hampshire County, Massachusetts, USA Betts Manganese Mines (Anson Betts Mine; Plainfield Manganese Mines; Taconic Manganese Mines), Plainfield, Hampshire County, Massachusetts, USA Loudville Lead Mines (Manhan Lead-Silver Mine; Southampton Lead Mine; Northampton Lead Mine), Easthampton, Hampshire County, Massachusetts, USA Hatfield, Hampshire County, Massachusetts, USA Hatfield Lead Mine, Hatfield, Hampshire County, Massachusetts, USA References: |
| ⓘ Forsterite Formula: Mg2SiO4 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gedrite Formula: ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| ⓘ Goethite Formula: α-Fe3+O(OH) |
| ⓘ Gold Formula: Au Description: No specifics in reference. Is the gold from nearby alluvium? |
| ⓘ Grunerite Formula: ◻{Fe2+2}{Fe2+5}(Si8O22)(OH)2 Localities: Powell Road Grunerite locality, Cummington, Hampshire County, Massachusetts, USA Betts Manganese Mines (Anson Betts Mine; Plainfield Manganese Mines; Taconic Manganese Mines), Plainfield, Hampshire County, Massachusetts, USA Cummingtonite (of Dewey) type locality, Cummington, Hampshire County, Massachusetts, USA References: |
| ⓘ 'Gummite' |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: |
| ⓘ Halloysite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Hematite Formula: Fe2O3 Localities: Betts Manganese Mines (Anson Betts Mine; Plainfield Manganese Mines; Taconic Manganese Mines), Plainfield, Hampshire County, Massachusetts, USA Notch Quarry (Lane Quarry; Amherst Quarry; Round Mountain Quarry), Amherst, Hampshire County, Massachusetts, USA Loudville Lead Mines (Manhan Lead-Silver Mine; Southampton Lead Mine; Northampton Lead Mine), Easthampton, Hampshire County, Massachusetts, USA |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Localities: |
| ⓘ Heterosite Formula: (Fe3+,Mn3+)PO4 |
| ⓘ Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O Habit: coffin-shaped Colour: colorless Description: Crystals to a few mm associated with chabazite-Ca, quartz, prehnite in fractures in basalt. |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Hübnerite Formula: MnWO4 |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: |
| ⓘ 'Indicolite' Formula: A(D3)G6(T6O18)(BO3)3X3Z Localities: |
| ⓘ Jacobsite Formula: Mn2+Fe3+2O4 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ 'K Feldspar' |
| ⓘ Kutnohorite Formula: CaMn2+(CO3)2 |
| ⓘ Kyanite Formula: Al2(SiO4)O Localities: Chesterfield, Hampshire County, Massachusetts, USA Worthington, Hampshire County, Massachusetts, USA Chesterfield kyanite locality, Chesterfield, Hampshire County, Massachusetts, USA Walnut Hill Pegmatite prospect, Huntington (Norwich), Hampshire County, Massachusetts, USA Rufus Smith Farm kyanite locality, Worthington, Hampshire County, Massachusetts, USA Habit: up to 18 inches long, 2 to 3 inches wide Colour: azure blue References: |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ 'Lepidolite' Localities: |
| ⓘ 'Limonite' Localities: Betts Manganese Mines (Anson Betts Mine; Plainfield Manganese Mines; Taconic Manganese Mines), Plainfield, Hampshire County, Massachusetts, USA Loudville Lead Mines (Manhan Lead-Silver Mine; Southampton Lead Mine; Northampton Lead Mine), Easthampton, Hampshire County, Massachusetts, USA Hatfield Lead Mine, Hatfield, Hampshire County, Massachusetts, USA Pelham Granite quarry (Ward Quarry; Valley Quarry), Pelham, Hampshire County, Massachusetts, USA |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Litharge Formula: PbO |
| ⓘ Formula: LiMn2+PO4 Locality: Walnut Hill Pegmatite prospect, Huntington (Norwich), Hampshire County, Massachusetts, USA - erroneously reported |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Betts Manganese Mines (Anson Betts Mine; Plainfield Manganese Mines; Taconic Manganese Mines), Plainfield, Hampshire County, Massachusetts, USA Pelham asbestos mine, Pelham, Hampshire County, Massachusetts, USA Middlefield, Hampshire County, Massachusetts, USA Pelham Granite quarry (Ward Quarry; Valley Quarry), Pelham, Hampshire County, Massachusetts, USA Middlefield soapstone quarries (Metropolitan Soapstone Co. Quarry), Middlefield, Hampshire County, Massachusetts, USA |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Loudville Lead Mines (Manhan Lead-Silver Mine; Southampton Lead Mine; Northampton Lead Mine), Easthampton, Hampshire County, Massachusetts, USA Hatfield Lead Mine, Hatfield, Hampshire County, Massachusetts, USA Williamsburg, Hampshire County, Massachusetts, USA Ondrick Quarry, Granby, Hampshire County, Massachusetts, USA Rockrimmon Street construction site, Belchertown, Hampshire County, Massachusetts, USA |
| ⓘ 'Manganese Oxides' Localities: References: |
| ⓘ 'Manganese Oxides var. Manganese Dendrites' |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Margarite Formula: CaAl2(Al2Si2O10)(OH)2 |
| ⓘ Mendipite Formula: Pb3Cl2O2 |
| ⓘ 'Mica Group' Localities: |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Reported from at least 6 localities in this region. |
| ⓘ Microcline var. Amazonite Formula: K(AlSi3O8) Locality: Walnut Hill Pegmatite prospect, Huntington (Norwich), Hampshire County, Massachusetts, USA Colour: "green color of Amazon stone" - Emerson (1895) |
| ⓘ 'Microlite Group' (FRL) Formula: A2-mTa2X6-wZ-n Type Locality: Description: Sometimes occurs directly in dark green elbaite or in contact with it. Crystals usually less than 1 mm. Given the controversy the species caused in the time period, Shepard lamented that it should have been named gigantolite, a species name he also introduced for another mineral. |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O Localities: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O |
| ⓘ Neotocite Formula: (Mn,Fe,Mg)SiO3 · H2O |
| ⓘ Opal Formula: SiO2 · nH2O Localities: |
| ⓘ Opal var. Opal-AN Formula: SiO2 · nH2O |
| ⓘ Pectolite Formula: NaCa2Si3O8(OH) |
| ⓘ 'Percylite' |
| ⓘ Formula: Be2SiO4 Locality: Barrus farm pegmatite localities, Goshen, Hampshire County, Massachusetts, USA - erroneously reported Description: Erroneously reported = beryl variety goshenite. |
| ⓘ Formula: Pb2CO3Cl2 Locality: Loudville Lead Mines (Manhan Lead-Silver Mine; Southampton Lead Mine; Northampton Lead Mine), Easthampton, Hampshire County, Massachusetts, USA - erroneously reported Description: Ref: C. U. Shepard: On scheeletine; Am Jour. Sci., 2nd series. Vol XLI, p.215., 1866
"The original mineral described by Meade can not have been phosgenite, which dissolves with effervescence in dilute nitric acid. Almost all the points given in the description of Meade agree with Anglesite. The crystals of anglesite found here are often superficially green from copper. It is described further as a vitreous, nearly the luster of a precious stone, glassy fracture, brittle, melts to orange mass with lead globules, formed on galena, and but slightly acted upon by nitric acid. All these points agree with anglesite, and only the crystalline form remains; “in cubic form terminated by tetrahedral prisms”.
It will be noted further that no one has ever found the mineral since Meade’s description, but all have copied him. I found in 1885 (in the Clark collection of Smith College, which has the finest series of crystals from the Loudville mine) specimens which agreed also in crystallization. They are an exceptional form of anglesite and appear in grouped prismatic aggregates up to 10 mm in length, surrounded by acute pyramids, and resembling acicular aragonite. At times the aggregated prisms are finely striate longitudinally, changing the resinous lister to satiny. It is translucent, colorless to slightly amber.
A fragment of a crystal treated with HNO3 was only slightly affected. Before the blowpipe it turns yellow, decrepitates, and with soda gives lead globules and test for sulphur."
|
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: |
| ⓘ Plumbogummite Formula: PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Pollucite Formula: (Cs,Na)2(Al2Si4O12) · 2H2O Localities: Habit: massive; grains to several inches across (Shaub & Schenck, 1954) Colour: colorless Description: Benjamin discovered pollucite here in the spring of 1940; more was found in 1946 (Shaub & Schenck, 1954). |
| ⓘ Polybasite Formula: [Ag6Sb2S7][Ag9CuS4] |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 Localities: Northampton Quarry, Northampton, Hampshire County, Massachusetts, USA Notch Quarry (Lane Quarry; Amherst Quarry; Round Mountain Quarry), Amherst, Hampshire County, Massachusetts, USA Belchertown, Hampshire County, Massachusetts, USA Pelham Granite quarry (Ward Quarry; Valley Quarry), Pelham, Hampshire County, Massachusetts, USA References: |
| ⓘ 'Psilomelane' Localities: |
| ⓘ Formula: Mn3+(PO4) Locality: Walnut Hill Pegmatite prospect, Huntington (Norwich), Hampshire County, Massachusetts, USA - erroneously reported |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Pyrolusite Formula: Mn4+O2 Localities: Betts Manganese Mines (Anson Betts Mine; Plainfield Manganese Mines; Taconic Manganese Mines), Plainfield, Hampshire County, Massachusetts, USA Loudville Lead Mines (Manhan Lead-Silver Mine; Southampton Lead Mine; Northampton Lead Mine), Easthampton, Hampshire County, Massachusetts, USA |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Habit: crystals Colour: green Description: see http://www.mindat.org/photo-64510.html |
| ⓘ Pyrophanite Formula: Mn2+TiO3 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 24 localities in this region. |
| ⓘ Quartz var. Agate Localities: |
| ⓘ Quartz var. Amethyst Formula: SiO2 Localities: Amethyst locality, Pelham, Hampshire County, Massachusetts, USA Notch Quarry (Lane Quarry; Amherst Quarry; Round Mountain Quarry), Amherst, Hampshire County, Massachusetts, USA Loudville Lead Mines (Manhan Lead-Silver Mine; Southampton Lead Mine; Northampton Lead Mine), Easthampton, Hampshire County, Massachusetts, USA Middlefield, Hampshire County, Massachusetts, USA References: |
| ⓘ Quartz var. Chalcedony Formula: SiO2 Localities: Hatfield Lead Mine, Hatfield, Hampshire County, Massachusetts, USA Middlefield, Hampshire County, Massachusetts, USA Loudville Lead Mines (Manhan Lead-Silver Mine; Southampton Lead Mine; Northampton Lead Mine), Easthampton, Hampshire County, Massachusetts, USA Amherst, Hampshire County, Massachusetts, USA References: |
| ⓘ Quartz var. Citrine Formula: SiO2 Colour: yellow Description: According to Edward Hitchcock (1822): "Yellow Quartz: In crystals at the Southampton lead mine; of a honey yellow, resembling the Siberian topaz."
Hitchcock (1835) also wrote: "Sometimes the crystals are penetrated
throughout by a yellow coloring matter, so as to form genuine yellow quartz."
Citrine confirmed in 2009 by P. Cristofono. Specimens collected and treated with "Iron Out" maintained their original yellow color. See photo.
References:
Hitchcock, Edward (1822): A Sketch of the Geology, Mineralogy, and Scenery of Regions contiguous to the River Connecticut; with a Geological Map and Drawings of Organic Remains; and Occasional Botanical Notices. Read Before the American Geological Society at their Sitting; Sept. 11th, 1822. in American Journal of Science vol. VI, page 213 (1823).
Hitchcock, Edward (1835) in Report on the Geology, Mineralogy, Botany, and Zoology of Massachusetts, p. 489 |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Localities: Clark Ledge pegmatite locality, Chesterfield, Hampshire County, Massachusetts, USA Williamsburg, Hampshire County, Massachusetts, USA Macomber Ledge pegmatite locality, Chesterfield, Hampshire County, Massachusetts, USA West Chesterfield Hollow pegmatite locality, Chesterfield, Hampshire County, Massachusetts, USA References: |
| ⓘ Ranciéite Formula: (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| ⓘ Rhodochrosite Formula: MnCO3 Localities: |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] Localities: |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Schallerite Formula: Mn2+16As3Si12O36(OH)17 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Barrus farm pegmatite localities, Goshen, Hampshire County, Massachusetts, USA Clark Ledge pegmatite locality, Chesterfield, Hampshire County, Massachusetts, USA Walnut Hill Pegmatite prospect, Huntington (Norwich), Hampshire County, Massachusetts, USA Williamsburg, Hampshire County, Massachusetts, USA Carver Street construction site, Granby, Hampshire County, Massachusetts, USA |
| ⓘ Scolecite Formula: CaAl2Si3O10 · 3H2O Localities: |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: |
| ⓘ Siderite Formula: FeCO3 Localities: |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Silver Formula: Ag Localities: |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ 'Soapstone' |
| ⓘ Sonolite Formula: Mn2+9(SiO4)4(OH)2 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 Localities: Betts Manganese Mines (Anson Betts Mine; Plainfield Manganese Mines; Taconic Manganese Mines), Plainfield, Hampshire County, Massachusetts, USA Cummingtonite (of Dewey) type locality, Cummington, Hampshire County, Massachusetts, USA Macomber Ledge pegmatite locality, Chesterfield, Hampshire County, Massachusetts, USA West Chesterfield Hollow pegmatite locality, Chesterfield, Hampshire County, Massachusetts, USA |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 7 localities in this region. |
| ⓘ Spodumene Formula: LiAlSi2O6 Localities: Reported from at least 6 localities in this region. |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) Localities: |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O Habit: parallel aggregates of tabular crystals Colour: pale yellow Description: In a vein in coarse gneiss, crystals to 2 cm tall. |
| ⓘ Stilpnomelane Formula: (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| ⓘ Formula: Pb(WO4) |
| ⓘ Sulphur Formula: S8 |
| ⓘ Takanelite Formula: (Mn,Ca)Mn4O9 · H2O |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: |
| ⓘ Talc var. Steatite Formula: Mg3(Si4O10)(OH)2 |
| ⓘ Tephroite Formula: Mn2+2SiO4 Localities: |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Pelham asbestos mine, Pelham, Hampshire County, Massachusetts, USA Barrus farm pegmatite localities, Goshen, Hampshire County, Massachusetts, USA Macomber Ledge pegmatite locality, Chesterfield, Hampshire County, Massachusetts, USA Clark Ledge pegmatite locality, Chesterfield, Hampshire County, Massachusetts, USA Walnut Hill Pegmatite prospect, Huntington (Norwich), Hampshire County, Massachusetts, USA |
| ⓘ 'Tourmaline var. Verdelite' Formula: A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ 'Tourmaline var. Watermelon Tourmaline' Formula: A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ Triphylite Formula: LiFe2+PO4 |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O Localities: |
| ⓘ 'Wad' |
| ⓘ Witherite Formula: BaCO3 |
| ⓘ Wroewolfeite (TL) Formula: Cu4(SO4)(OH)6 · 2H2O Type Locality: |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: Colour: orange, yellow |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 6 localities in this region. |
| ⓘ Zircon var. Cyrtolite Formula: Zr[(SiO4),(OH)4] Localities: |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Alabandite | 2.CD.10 | MnS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Cotunnite ? | 3.AB.85 | PbCl2 |
| ⓘ | Mendipite | 3.DC.70 | Pb3Cl2O2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Microlite Group' (TL) | 4.00. | A2-mTa2X6-wZ-n |
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Litharge | 4.AC.20 | PbO |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Jacobsite | 4.BB.05 | Mn2+Fe3+2O4 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Pyrophanite | 4.CB.05 | Mn2+TiO3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Corundum var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | Quartz var. Citrine | 4.DA.05 | SiO2 |
| ⓘ | var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Agate | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Ranciéite | 4.FL.40 | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| ⓘ | Takanelite | 4.FL.40 | (Mn,Ca)Mn4O9 · H2O |
| ⓘ | Birnessite | 4.FL.45 | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | var. Argentine | 5.AB.05 | CaCO3 |
| ⓘ | Kutnohorite | 5.AB.10 | CaMn2+(CO3)2 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Phosgenite ? | 5.BE.20 | Pb2CO3Cl2 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Wroewolfeite (TL) | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Stolzite ? | 7.GA.05 | Pb(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Heterosite | 8.AB.10 | (Fe3+,Mn3+)PO4 |
| ⓘ | Lithiophilite ? | 8.AB.10 | LiMn2+PO4 |
| ⓘ | Triphylite | 8.AB.10 | LiFe2+PO4 |
| ⓘ | Purpurite ? | 8.AB.10 | Mn3+(PO4) |
| ⓘ | Plumbogummite | 8.BL.10 | PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.. | Mg3(Si2O5)(OH)4 |
| ⓘ | Phenakite ? | 9.AA.05 | Be2SiO4 |
| ⓘ | Tephroite | 9.AC.05 | Mn2+2SiO4 |
| ⓘ | Forsterite | 9.AC.05 | Mg2SiO4 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | var. Cyrtolite | 9.AD.30 | Zr[(SiO4),(OH)4] |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | var. Chiastolite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| ⓘ | Alleghanyite | 9.AF.45 | Mn2+5(SiO4)2(OH)2 |
| ⓘ | Sonolite | 9.AF.55 | Mn2+9(SiO4)4(OH)2 |
| ⓘ | Chloritoid ? | 9.AF.85 | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Datolite | 9.AJ.20 | CaB(SiO4)(OH) |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Bafertisite | 9.BE.55 | Ba2Fe2+4Ti2(Si2O7)2O2(OH)2F2 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl var. Goshenite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | var. Morganite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Anthophyllite | 9.DD.05 | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Gedrite | 9.DD.05 | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| ⓘ | Grunerite | 9.DE.05 | ◻{Fe2+2}{Fe2+5}(Si8O22)(OH)2 |
| ⓘ | Cummingtonite | 9.DE.05 | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Ferro-hornblende | 9.DE.10 | ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Pectolite | 9.DG.05 | NaCa2Si3O8(OH) |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Babingtonite | 9.DK.05 | Ca2(Fe,Mn)FeSi5O14(OH) |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Talc var. Steatite | 9.EC.05 | Mg3(Si4O10)(OH)2 |
| ⓘ | 9.EC.05 | Mg3Si4O10(OH)2 | |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Annite | 9.EC.20 | KFe2+3(AlSi3O10)(OH)2 |
| ⓘ | Margarite | 9.EC.30 | CaAl2(Al2Si2O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Cookeite ? | 9.EC.55 | (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Halloysite | 9.ED.10 | Al2(Si2O5)(OH)4 |
| ⓘ | Caryopilite | 9.ED.15 | Mn2+3Si2O5(OH)4 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Neotocite | 9.ED.20 | (Mn,Fe,Mg)SiO3 · H2O |
| ⓘ | Bementite | 9.EE.05 | Mn7Si6O15(OH)8 |
| ⓘ | Schallerite | 9.EE.15 | Mn2+16As3Si12O36(OH)17 |
| ⓘ | Stilpnomelane | 9.EG.40 | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | var. Amazonite | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite var. Cleavelandite (TL) | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | 9.FA.35 | Na(AlSi3O8) | |
| ⓘ | Anorthite var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | 9.FA.35 | Ca(Al2Si2O8) | |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Scolecite | 9.GA.05 | CaAl2Si3O10 · 3H2O |
| ⓘ | Pollucite | 9.GB.05 | (Cs,Na)2(Al2Si4O12) · 2H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Chabazite-Ca | 9.GD.10 | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Unclassified | |||
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Almandine-Spessartine Series' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Tourmaline var. Watermelon Tourmaline' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Soapstone' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Manganese Oxides var. Manganese Dendrites' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Cummingtonite (of Dewey)' | - | (Fe,Mg)7Si8O22(OH)2 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O22]X · 8H2O |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Gummite' | - | |
| ⓘ | 'Indicolite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Percylite' | - | |
| ⓘ | 'Epidote Supergroup' | - | (A1A2)(M1M2M3)O4[Si2O7][SiO4]O10 |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'var. Verdelite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Cymatolite' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| H | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| H | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| H | ⓘ Bementite | Mn7Si6O15(OH)8 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Caryopilite | Mn32+Si2O5(OH)4 |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Datolite | CaB(SiO4)(OH) |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Neotocite | (Mn,Fe,Mg)SiO3 · H2O |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Pectolite | NaCa2Si3O8(OH) |
| H | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| H | ⓘ Schallerite | Mn162+As3Si12O36(OH)17 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| H | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| H | ⓘ Takanelite | (Mn,Ca)Mn4O9 · H2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| H | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Cummingtonite (of Dewey) | (Fe,Mg)7Si8O22(OH)2 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Li | Lithium | |
| Li | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Lithiophilite | LiMn2+PO4 |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Li | ⓘ Triphylite | LiFe2+PO4 |
| Be | Beryllium | |
| Be | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Be | ⓘ Phenakite | Be2SiO4 |
| Be | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Datolite | CaB(SiO4)(OH) |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Indicolite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | ⓘ Tourmaline var. Verdelite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Tourmaline var. Watermelon Tourmaline | A(D3)G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Phosgenite | Pb2CO3Cl2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Witherite | BaCO3 |
| C | ⓘ Calcite var. Argentine | CaCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| O | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| O | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bementite | Mn7Si6O15(OH)8 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Caryopilite | Mn32+Si2O5(OH)4 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| O | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| O | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Quartz var. Citrine | SiO2 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Datolite | CaB(SiO4)(OH) |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Forsterite | Mg2SiO4 |
| O | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Heterosite | (Fe3+,Mn3+)PO4 |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Indicolite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Jacobsite | Mn2+Fe23+O4 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Lithiophilite | LiMn2+PO4 |
| O | ⓘ Litharge | PbO |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| O | ⓘ Mendipite | Pb3Cl2O2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Neotocite | (Mn,Fe,Mg)SiO3 · H2O |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Pectolite | NaCa2Si3O8(OH) |
| O | ⓘ Phenakite | Be2SiO4 |
| O | ⓘ Phosgenite | Pb2CO3Cl2 |
| O | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Purpurite | Mn3+(PO4) |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyrophanite | Mn2+TiO3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Schallerite | Mn162+As3Si12O36(OH)17 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Takanelite | (Mn,Ca)Mn4O9 · H2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tephroite | Mn22+SiO4 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Triphylite | LiFe2+PO4 |
| O | ⓘ Tourmaline var. Verdelite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Epidote Supergroup | (A1A2)(M1M2M3)O4[Si2O7][SiO4]O10 |
| O | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| O | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| O | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Calcite var. Argentine | CaCO3 |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Tourmaline var. Watermelon Tourmaline | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Cummingtonite (of Dewey) | (Fe,Mg)7Si8O22(OH)2 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Na | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Na | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Na | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Mg | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Forsterite | Mg2SiO4 |
| Mg | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Neotocite | (Mn,Fe,Mg)SiO3 · H2O |
| Mg | ⓘ Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| Mg | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | ⓘ Cummingtonite (of Dewey) | (Fe,Mg)7Si8O22(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| Al | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Al | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Al | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| Si | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| Si | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Si | ⓘ Bementite | Mn7Si6O15(OH)8 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Caryopilite | Mn32+Si2O5(OH)4 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| Si | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Si | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Quartz var. Citrine | SiO2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Datolite | CaB(SiO4)(OH) |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Forsterite | Mg2SiO4 |
| Si | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Si | ⓘ Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| Si | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Neotocite | (Mn,Fe,Mg)SiO3 · H2O |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Si | ⓘ Phenakite | Be2SiO4 |
| Si | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Schallerite | Mn162+As3Si12O36(OH)17 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Tephroite | Mn22+SiO4 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Epidote Supergroup | (A1A2)(M1M2M3)O4[Si2O7][SiO4]O10 |
| Si | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Si | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| Si | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Cummingtonite (of Dewey) | (Fe,Mg)7Si8O22(OH)2 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Heterosite | (Fe3+,Mn3+)PO4 |
| P | ⓘ Lithiophilite | LiMn2+PO4 |
| P | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Purpurite | Mn3+(PO4) |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Triphylite | LiFe2+PO4 |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Alabandite | MnS |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Covellite | CuS |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cl | Chlorine | |
| Cl | ⓘ Cotunnite | PbCl2 |
| Cl | ⓘ Mendipite | Pb3Cl2O2 |
| Cl | ⓘ Phosgenite | Pb2CO3Cl2 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| K | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| K | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| Ca | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Datolite | CaB(SiO4)(OH) |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Ca | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Ca | ⓘ Takanelite | (Mn,Ca)Mn4O9 · H2O |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Ca | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Calcite var. Argentine | CaCO3 |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Pyrophanite | Mn2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Mn | Manganese | |
| Mn | ⓘ Alabandite | MnS |
| Mn | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
| Mn | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| Mn | ⓘ Bementite | Mn7Si6O15(OH)8 |
| Mn | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Mn | ⓘ Caryopilite | Mn32+Si2O5(OH)4 |
| Mn | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Heterosite | (Fe3+,Mn3+)PO4 |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Mn | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Mn | ⓘ Lithiophilite | LiMn2+PO4 |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Neotocite | (Mn,Fe,Mg)SiO3 · H2O |
| Mn | ⓘ Purpurite | Mn3+(PO4) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Pyrophanite | Mn2+TiO3 |
| Mn | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Schallerite | Mn162+As3Si12O36(OH)17 |
| Mn | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Takanelite | (Mn,Ca)Mn4O9 · H2O |
| Mn | ⓘ Tephroite | Mn22+SiO4 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| Fe | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Heterosite | (Fe3+,Mn3+)PO4 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Neotocite | (Mn,Fe,Mg)SiO3 · H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Fe | ⓘ Triphylite | LiFe2+PO4 |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Cummingtonite (of Dewey) | (Fe,Mg)7Si8O22(OH)2 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Cu | Copper | |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Schallerite | Mn162+As3Si12O36(OH)17 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Silver | Ag |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cs | Caesium | |
| Cs | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Ba | Barium | |
| Ba | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Witherite | BaCO3 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ta | Tantalum | |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ-n |
| W | Tungsten | |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Cotunnite | PbCl2 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Litharge | PbO |
| Pb | ⓘ Mendipite | Pb3Cl2O2 |
| Pb | ⓘ Phosgenite | Pb2CO3Cl2 |
| Pb | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
Fossils
There are 13 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 63 | |||||||||
|---|---|---|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 0.01 Ma (Pleistocene) | |||||||||
| Oldest Fossil Listed | 201 Ma (Early Jurassic) | |||||||||
| Stratigraphic Units |
| |||||||||
| Fossils from Region | Click here to show the list. | |||||||||
| Fossil Localities | Click to show 13 fossil localities |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Hampshire_County,_Massachusetts |
|---|---|
| Wikidata ID: | Q54161 |
| GeoNames ID: | 4938757 |
Localities in this Region
- Massachusetts
- Hampshire County
- Massachusetts
- Hampshire County
- Hatfield
- ⭔Huntington (Norwich)
- ⭔Middlefield
- ⭔Northampton
- ⭔Pelham
- ⭔Plainfield
- ⭔South Hadley
- ⭔Ware
- ⭔Williamsburg
- ⭔Worthington
- Hampshire County
Other Regions, Features and Areas that Intersect
North America PlateTectonic Plate
- Ganderia DomainDomain
- Piedmontia DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Loudville Lead Mines, Easthampton, Hampshire County, Massachusetts, USA