Raymond, Rockingham County, New Hampshire, USAi
| Regional Level Types | |
|---|---|
| Raymond | Town |
| Rockingham County | County |
| New Hampshire | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Raymond | 2,855 (2017) |
Mindat Locality ID:
15862
Long-form identifier:
mindat:1:2:15862:9
GUID (UUID V4):
01d1e3c4-cdc9-4443-ae61-efa60c3165f8
Raymond is a town, incorporated in 1764. Various mines and prospects are located throughout the town, mainly intended to extract feldspar. Most are abandoned and grown over.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities55 valid minerals. 3 erroneous literature entries.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| β Albite Formula: Na(AlSi3O8) Localities: Reported from at least 7 localities in this region. |
| β Albite var. Cleavelandite Formula: Na(AlSi3O8) Localities: Reported from at least 6 localities in this region. |
| β Almandine Formula: Fe2+3Al2(SiO4)3 Localities: |
| β Andalusite Formula: Al2(SiO4)O References: |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| β Aragonite Formula: CaCO3 |
| β Arsenopyrite Formula: FeAsS Localities: |
| β Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| β Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O Localities: |
| β Azurite Formula: Cu3(CO3)2(OH)2 |
| β Bertrandite Formula: Be4(Si2O7)(OH)2 Localities: |
| β Beryl Formula: Be3Al2(Si6O18) Localities: Reported from at least 9 localities in this region. |
| β Beryl var. Heliodor Formula: Be3Al2(Si6O18) Localities: References: |
| β Beryl var. Morganite Formula: Be3Al2(Si6O18) |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 7 localities in this region. References: |
| β Calcite Formula: CaCO3 |
| β Chalcopyrite Formula: CuFeS2 Localities: |
| β Clarkeite Formula: (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| β Columbite-(Fe) Formula: Fe2+Nb2O6 Description: Occurs in the wall zone. |
| β 'Columbite-(Fe)-Columbite-(Mn) Series' Localities: Reported from at least 6 localities in this region. |
| β Columbite-(Mn) Formula: Mn2+Nb2O6 Description: Occurs in the core zone. |
| β Cookeite Formula: (LiAl4◻)[AlSi3O10](OH)8 |
| β Copiapite Formula: Fe2+Fe3+4(SO4)6(OH)2 · 20H2O Localities: References: |
| β Covellite Formula: CuS |
| β Dolomite Formula: CaMg(CO3)2 References: |
| β Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Euclase Formula: BeAl(SiO4)(OH) |
| β 'Feldspar Group' Localities: Corson Mine, Raymond, Rockingham County, New Hampshire, USA McGall mine, Raymond, Rockingham County, New Hampshire, USA McMullen prospect, Raymond, Rockingham County, New Hampshire, USA Guinae prospect (Pegmatite No. 17), Raymond, Rockingham County, New Hampshire, USA Chandler Mine (Pegmatite No. 7), Raymond, Rockingham County, New Hampshire, USA References: |
| β 'Feldspar Group var. Perthite' Localities: Chandler Mine (Pegmatite No. 7), Raymond, Rockingham County, New Hampshire, USA Corson Mine, Raymond, Rockingham County, New Hampshire, USA McGall mine, Raymond, Rockingham County, New Hampshire, USA McMullen prospect, Raymond, Rockingham County, New Hampshire, USA Guinae prospect (Pegmatite No. 17), Raymond, Rockingham County, New Hampshire, USA |
| β Fluorapatite Formula: Ca5(PO4)3F Localities: Blake-Welch Mines (Welch Mine; Mafera Mine), Raymond, Rockingham County, New Hampshire, USA Chandler Mine (Pegmatite No. 7), Raymond, Rockingham County, New Hampshire, USA Smith No. 1 Mine (Pegmatites Nos. 9 & 10), Raymond, Rockingham County, New Hampshire, USA Raymond, Rockingham County, New Hampshire, USA |
| β Fluorapatite var. Manganese-bearing Fluorapatite Formula: (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| β Fluorite Formula: CaF2 Localities: Smith No. 1 Mine (Pegmatites Nos. 9 & 10), Raymond, Rockingham County, New Hampshire, USA Chandler Mine (Pegmatite No. 7), Raymond, Rockingham County, New Hampshire, USA Raymond, Rockingham County, New Hampshire, USA Aggregate Industries Quarry (Raymond Quarry; Coastal Materials Quarry), Raymond, Rockingham County, New Hampshire, USA |
| β Galena Formula: PbS Localities: References: |
| β 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Vacher Mine (Vatcher mine), Raymond, Rockingham County, New Hampshire, USA Corson Mine, Raymond, Rockingham County, New Hampshire, USA McGall mine, Raymond, Rockingham County, New Hampshire, USA McMullen prospect, Raymond, Rockingham County, New Hampshire, USA Guinae prospect (Pegmatite No. 17), Raymond, Rockingham County, New Hampshire, USA |
| β Goethite Formula: Ξ±-Fe3+O(OH) Localities: References: |
| β 'Gummite' Localities: |
| β Hematite Formula: Fe2O3 |
| β 'Lepidolite' Localities: |
| β Lithiophilite Formula: LiMn2+PO4 Description: Lithiophilite from this location has Mn/Mn + Fe = 0.94 (Moore, 2000). |
| β Lithiophilite var. Sicklerite Formula: Li1-x(Mn3+xMn2+1-x)PO4 |
| β LΓΆllingite Formula: FeAs2 |
| β Magnetite Formula: Fe2+Fe3+2O4 |
| β Malachite Formula: Cu2(CO3)(OH)2 References: |
| β Formula: Mn3+O(OH) Locality: Chandler Mine (Pegmatite No. 7), Raymond, Rockingham County, New Hampshire, USA - erroneously reported |
| β Meta-autunite Formula: Ca(UO2)2(PO4)2 · 6H2O |
| β Microcline Formula: K(AlSi3O8) Localities: Reported from at least 6 localities in this region. |
| β Molybdenite Formula: MoS2 |
| β Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 8 localities in this region. |
| β Opal Formula: SiO2 · nH2O References: |
| β Opal var. Opal-AN Formula: SiO2 · nH2O References: |
| β 'Orthopyroxene Subgroup' |
| β Formula: (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 Localities: Description: No data. Probably a poor guess. |
| β 'Pinite' |
| β 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: References: |
| β Pyrite Formula: FeS2 Localities: Reported from at least 6 localities in this region. |
| β Formula: Mn4+O2 Locality: Chandler Mine (Pegmatite No. 7), Raymond, Rockingham County, New Hampshire, USA - erroneously reported Description: Potter and Rossman showed that pyrolusite had yet to be found in any manganese dendrite in a granite pegmatite. |
| β Pyromorphite Formula: Pb5(PO4)3Cl References: |
| β Pyrrhotite Formula: Fe1-xS Localities: |
| β Quartz Formula: SiO2 Localities: Reported from at least 14 localities in this region. Colour: Clear, Milky References: |
| β Quartz var. Amethyst Formula: SiO2 Localities: |
| β Quartz var. Chalcedony Formula: SiO2 |
| β Quartz var. Milky Quartz Formula: SiO2 |
| β Quartz var. Rock Crystal Formula: SiO2 |
| β Quartz var. Rose Quartz Formula: SiO2 Localities: |
| β Quartz var. Sceptre Quartz Formula: SiO2 |
| β Quartz var. Smoky Quartz Formula: SiO2 Localities: |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 6 localities in this region. |
| β Siderite Formula: FeCO3 Localities: |
| β Sillimanite Formula: Al2(SiO4)O Localities: References: |
| β Spessartine Formula: Mn2+3Al2(SiO4)3 Localities: |
| β Sphalerite Formula: ZnS Localities: |
| β Spodumene Formula: LiAlSi2O6 Localities: |
| β Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| β Talc Formula: Mg3Si4O10(OH)2 References: |
| β Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| β Triphylite Formula: LiFe2+PO4 Localities: References: |
| β Triploidite Formula: Mn2+2(PO4)(OH) |
| β Uraninite Formula: UO2 Localities: |
| β Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O Localities: |
| β Wodginite Formula: Mn2+Sn4+Ta2O8 |
| β Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Covellite | 2.CA.05a | CuS |
| β | Sphalerite | 2.CB.05a | ZnS |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | Galena | 2.CD.10 | PbS |
| β | Molybdenite | 2.EA.30 | MoS2 |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | LΓΆllingite | 2.EB.15a | FeAs2 |
| β | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Goethite | 4.00. | Ξ±-Fe3+O(OH) |
| β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| β | Hematite | 4.CB.05 | Fe2O3 |
| β | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| β | var. Chalcedony | 4.DA.05 | SiO2 |
| β | var. Rock Crystal | 4.DA.05 | SiO2 |
| β | var. Milky Quartz | 4.DA.05 | SiO2 |
| β | 4.DA.05 | SiO2 | |
| β | var. Rose Quartz | 4.DA.05 | SiO2 |
| β | var. Smoky Quartz | 4.DA.05 | SiO2 |
| β | var. Sceptre Quartz | 4.DA.05 | SiO2 |
| β | Opal | 4.DA.10 | SiO2 Β· nH2O |
| β | var. Opal-AN | 4.DA.10 | SiO2 Β· nH2O |
| β | Pyrolusite ? | 4.DB.05 | Mn4+O2 |
| β | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| β | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| β | Wodginite | 4.DB.40 | Mn2+Sn4+Ta2O8 |
| β | Uraninite | 4.DL.05 | UO2 |
| β | Manganite ? | 4.FD.15 | Mn3+O(OH) |
| β | Clarkeite | 4.GC.05 | (Na,Ca,Pb)(UO2)O(OH) Β· 0-1H2O |
| Group 5 - Nitrates and Carbonates | |||
| β | Siderite | 5.AB.05 | FeCO3 |
| β | Calcite | 5.AB.05 | CaCO3 |
| β | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| β | Aragonite | 5.AB.15 | CaCO3 |
| β | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| β | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 Β· 20H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Lithiophilite | 8.AB.10 | LiMn2+PO4 |
| β | var. Sicklerite | 8.AB.10 | Li1-x(Mn3+xMn2+1-x)PO4 |
| β | Triphylite | 8.AB.10 | LiFe2+PO4 |
| β | Triploidite | 8.BB.15 | Mn2+2(PO4)(OH) |
| β | Palermoite ? | 8.BH.25 | (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 |
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| β | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| β | Fluorapatite var. Manganese-bearing Fluorapatite | 8.BN.05 | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| β | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 Β· 12H2O |
| β | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 Β· 10-12H2O |
| β | Meta-autunite | 8.EB.10 | Ca(UO2)2(PO4)2 Β· 6H2O |
| Group 9 - Silicates | |||
| β | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| β | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| β | Euclase | 9.AE.10 | BeAl(SiO4)(OH) |
| β | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| β | Andalusite | 9.AF.10 | Al2(SiO4)O |
| β | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| β | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 Β· 5H2O |
| β | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| β | Beryl var. Morganite | 9.CJ.05 | Be3Al2(Si6O18) |
| β | 9.CJ.05 | Be3Al2(Si6O18) | |
| β | var. Heliodor | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| β | Spodumene | 9.DA.30 | LiAlSi2O6 |
| β | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 Β· nH2O |
| β | Cookeite | 9.EC.55 | (LiAl4β»)[AlSi3O10](OH)8 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Albite var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| β | 9.FA.35 | Na(AlSi3O8) | |
| Unclassified | |||
| β | 'Lepidolite' | - | |
| β | 'Feldspar Group var. Perthite' | - | |
| β | 'Gummite' | - | |
| β | 'Feldspar Group' | - | |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| β | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| β | 'Pinite' | - | |
| β | 'Garnet Group' | - | X3Z2(SiO4)3 |
| β | 'Orthopyroxene Subgroup' | - | |
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | β Azurite | Cu3(CO3)2(OH)2 |
| H | β Bertrandite | Be4(Si2O7)(OH)2 |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| H | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | β Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Euclase | BeAl(SiO4)(OH) |
| H | β Goethite | Ξ±-Fe3+O(OH) |
| H | β Opal var. Opal-AN | SiO2 · nH2O |
| H | β Manganite | Mn3+O(OH) |
| H | β Malachite | Cu2(CO3)(OH)2 |
| H | β Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| H | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | β Opal | SiO2 · nH2O |
| H | β Palermoite | (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Staurolite | Fe22+Al9Si4O23(OH) |
| H | β Talc | Mg3Si4O10(OH)2 |
| H | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | β Triploidite | Mn22+(PO4)(OH) |
| H | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Li | Lithium | |
| Li | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Li | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | β Lithiophilite | LiMn2+PO4 |
| Li | β Palermoite | (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 |
| Li | β Lithiophilite var. Sicklerite | Li1-x(Mnx3+Mn2+1-x)PO4 |
| Li | β Spodumene | LiAlSi2O6 |
| Li | β Triphylite | LiFe2+PO4 |
| Be | Beryllium | |
| Be | β Bertrandite | Be4(Si2O7)(OH)2 |
| Be | β Beryl | Be3Al2(Si6O18) |
| Be | β Euclase | BeAl(SiO4)(OH) |
| Be | β Beryl var. Morganite | Be3Al2(Si6O18) |
| Be | β Beryl var. Heliodor | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Aragonite | CaCO3 |
| C | β Azurite | Cu3(CO3)2(OH)2 |
| C | β Calcite | CaCO3 |
| C | β Dolomite | CaMg(CO3)2 |
| C | β Malachite | Cu2(CO3)(OH)2 |
| C | β Siderite | FeCO3 |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Quartz var. Amethyst | SiO2 |
| O | β Andalusite | Al2(SiO4)O |
| O | β Aragonite | CaCO3 |
| O | β Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | β Azurite | Cu3(CO3)2(OH)2 |
| O | β Almandine | Fe32+Al2(SiO4)3 |
| O | β Bertrandite | Be4(Si2O7)(OH)2 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Calcite | CaCO3 |
| O | β Quartz var. Chalcedony | SiO2 |
| O | β Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| O | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | β Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | β Dolomite | CaMg(CO3)2 |
| O | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Euclase | BeAl(SiO4)(OH) |
| O | β Columbite-(Fe) | Fe2+Nb2O6 |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Goethite | Ξ±-Fe3+O(OH) |
| O | β Hematite | Fe2O3 |
| O | β Opal var. Opal-AN | SiO2 · nH2O |
| O | β Lithiophilite | LiMn2+PO4 |
| O | β Manganite | Mn3+O(OH) |
| O | β Columbite-(Mn) | Mn2+Nb2O6 |
| O | β Magnetite | Fe2+Fe23+O4 |
| O | β Malachite | Cu2(CO3)(OH)2 |
| O | β Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| O | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| O | β Microcline | K(AlSi3O8) |
| O | β Beryl var. Morganite | Be3Al2(Si6O18) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | β Opal | SiO2 · nH2O |
| O | β Palermoite | (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 |
| O | β Pyrolusite | Mn4+O2 |
| O | β Pyromorphite | Pb5(PO4)3Cl |
| O | β Quartz | SiO2 |
| O | β Quartz var. Rose Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Lithiophilite var. Sicklerite | Li1-x(Mnx3+Mn2+1-x)PO4 |
| O | β Siderite | FeCO3 |
| O | β Sillimanite | Al2(SiO4)O |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β Spessartine | Mn32+Al2(SiO4)3 |
| O | β Spodumene | LiAlSi2O6 |
| O | β Staurolite | Fe22+Al9Si4O23(OH) |
| O | β Talc | Mg3Si4O10(OH)2 |
| O | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | β Triphylite | LiFe2+PO4 |
| O | β Triploidite | Mn22+(PO4)(OH) |
| O | β Uraninite | UO2 |
| O | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | β Wodginite | Mn2+Sn4+Ta2O8 |
| O | β Zircon | Zr(SiO4) |
| O | β Quartz var. Rock Crystal | SiO2 |
| O | β Quartz var. Milky Quartz | SiO2 |
| O | β Beryl var. Heliodor | Be3Al2(Si6O18) |
| O | β Quartz var. Sceptre Quartz | SiO2 |
| O | β Albite var. Cleavelandite | Na(AlSi3O8) |
| O | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | β Garnet Group | X3Z2(SiO4)3 |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β Fluorapatite | Ca5(PO4)3F |
| F | β Fluorite | CaF2 |
| F | β Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| Na | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | β Palermoite | (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | β Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | β Dolomite | CaMg(CO3)2 |
| Mg | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | β Talc | Mg3Si4O10(OH)2 |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Andalusite | Al2(SiO4)O |
| Al | β Almandine | Fe32+Al2(SiO4)3 |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Euclase | BeAl(SiO4)(OH) |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Beryl var. Morganite | Be3Al2(Si6O18) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | β Palermoite | (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Sillimanite | Al2(SiO4)O |
| Al | β Spessartine | Mn32+Al2(SiO4)3 |
| Al | β Spodumene | LiAlSi2O6 |
| Al | β Staurolite | Fe22+Al9Si4O23(OH) |
| Al | β Beryl var. Heliodor | Be3Al2(Si6O18) |
| Al | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Quartz var. Amethyst | SiO2 |
| Si | β Andalusite | Al2(SiO4)O |
| Si | β Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | β Almandine | Fe32+Al2(SiO4)3 |
| Si | β Bertrandite | Be4(Si2O7)(OH)2 |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Quartz var. Chalcedony | SiO2 |
| Si | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Euclase | BeAl(SiO4)(OH) |
| Si | β Opal var. Opal-AN | SiO2 · nH2O |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Beryl var. Morganite | Be3Al2(Si6O18) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | β Opal | SiO2 · nH2O |
| Si | β Quartz | SiO2 |
| Si | β Quartz var. Rose Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Sillimanite | Al2(SiO4)O |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β Spessartine | Mn32+Al2(SiO4)3 |
| Si | β Spodumene | LiAlSi2O6 |
| Si | β Staurolite | Fe22+Al9Si4O23(OH) |
| Si | β Talc | Mg3Si4O10(OH)2 |
| Si | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | β Zircon | Zr(SiO4) |
| Si | β Quartz var. Rock Crystal | SiO2 |
| Si | β Quartz var. Milky Quartz | SiO2 |
| Si | β Beryl var. Heliodor | Be3Al2(Si6O18) |
| Si | β Quartz var. Sceptre Quartz | SiO2 |
| Si | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | β Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | β Fluorapatite | Ca5(PO4)3F |
| P | β Lithiophilite | LiMn2+PO4 |
| P | β Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| P | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| P | β Palermoite | (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 |
| P | β Pyromorphite | Pb5(PO4)3Cl |
| P | β Lithiophilite var. Sicklerite | Li1-x(Mnx3+Mn2+1-x)PO4 |
| P | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | β Triphylite | LiFe2+PO4 |
| P | β Triploidite | Mn22+(PO4)(OH) |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | β Arsenopyrite | FeAsS |
| S | β Chalcopyrite | CuFeS2 |
| S | β Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | β Covellite | CuS |
| S | β Galena | PbS |
| S | β Molybdenite | MoS2 |
| S | β Pyrite | FeS2 |
| S | β Pyrrhotite | Fe1-xS |
| S | β Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | β Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Cl | β Pyromorphite | Pb5(PO4)3Cl |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Aragonite | CaCO3 |
| Ca | β Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | β Calcite | CaCO3 |
| Ca | β Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| Ca | β Dolomite | CaMg(CO3)2 |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Fluorite | CaF2 |
| Ca | β Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Ca | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| Ca | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | β Palermoite | (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 |
| Ca | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mn | Manganese | |
| Mn | β Lithiophilite | LiMn2+PO4 |
| Mn | β Manganite | Mn3+O(OH) |
| Mn | β Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | β Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Mn | β Pyrolusite | Mn4+O2 |
| Mn | β Lithiophilite var. Sicklerite | Li1-x(Mnx3+Mn2+1-x)PO4 |
| Mn | β Spessartine | Mn32+Al2(SiO4)3 |
| Mn | β Triploidite | Mn22+(PO4)(OH) |
| Mn | β Wodginite | Mn2+Sn4+Ta2O8 |
| Fe | Iron | |
| Fe | β Arsenopyrite | FeAsS |
| Fe | β Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | β Almandine | Fe32+Al2(SiO4)3 |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | β Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | β Goethite | Ξ±-Fe3+O(OH) |
| Fe | β Hematite | Fe2O3 |
| Fe | β LΓΆllingite | FeAs2 |
| Fe | β Magnetite | Fe2+Fe23+O4 |
| Fe | β Pyrite | FeS2 |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Siderite | FeCO3 |
| Fe | β Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | β Triphylite | LiFe2+PO4 |
| Cu | Copper | |
| Cu | β Azurite | Cu3(CO3)2(OH)2 |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Covellite | CuS |
| Cu | β Malachite | Cu2(CO3)(OH)2 |
| Cu | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Zn | Zinc | |
| Zn | β Sphalerite | ZnS |
| As | Arsenic | |
| As | β Arsenopyrite | FeAsS |
| As | β LΓΆllingite | FeAs2 |
| Sr | Strontium | |
| Sr | β Palermoite | (Li,Na)2(Sr,Ca)Al4(PO4)4(OH)4 |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | β Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | β Columbite-(Mn) | Mn2+Nb2O6 |
| Mo | Molybdenum | |
| Mo | β Molybdenite | MoS2 |
| Sn | Tin | |
| Sn | β Wodginite | Mn2+Sn4+Ta2O8 |
| Ta | Tantalum | |
| Ta | β Wodginite | Mn2+Sn4+Ta2O8 |
| Pb | Lead | |
| Pb | β Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| Pb | β Galena | PbS |
| Pb | β Pyromorphite | Pb5(PO4)3Cl |
| U | Uranium | |
| U | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | β Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| U | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| U | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | β Uraninite | UO2 |
| U | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Raymond,_New_Hampshire |
|---|---|
| Wikidata ID: | Q2323417 |
| GeoNames ID: | 5091636 |
Localities in this Region
- New Hampshire
Other Regions, Features and Areas that Intersect
North America PlateTectonic Plate
- Ganderia DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Raymond, Rockingham County, New Hampshire, USA