Cavnic (Kapnic; Kapnik), Maramureș Co., Romania
This page is currently not sponsored. Click here to sponsor this page.
Key
Lock Map
| Neighbouring regions: |
|---|
An ancient and historic mining town, known since 1336 and, in modern times, extended up to its maximum by Ceausescu's mining policies.
Located 30 km east of Baia Mare and famous for its deposits of lead, zinc, manganese, as well as small quantities of gold, silver, barium, and antimony.
Samples of exceptional beauty and value have been extracted from the mines of this locality, present in major worldwide collections.
In particular, the mines have produced the world's most beautiful tetrahedrites, by size, arrangement, and lustre.
Current situation: since 2008 all the mines are closed; adits are sealed, water pumps are off and the external structures demolished or about to be demolished.
For several years rumours persist about foreign investors, but they are slow to manifest themselves in reality.
Formerly known as Kapnik, Hungary (during the Austro-Hungarian empire).
Alternative Label Names
This is a list of additional names that have been recorded for mineral labels associated with this locality in the minID database. This may include previous versions of the locality name hierarchy from mindat.org, data entry errors, and it may also include unconfirmed sublocality names or other names that can only be matched to this level.
| Cavnic, Romania |
| Cavnic |
Select Mineral List Type
Standard Detailed Strunz Dana Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities59 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: this is a very new system on mindat.org and data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Albite var: Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Altaite Formula: PbTe |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ 'Apatite' |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Argentojarosite Formula: AgFe3+3(SO4)2(OH)6 Reference: Gábor Koller collection (EDS- and PXRD-analysed by Sándor Szakáll and Béla Fehér) |
| ⓘ Arsenic Formula: As |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Baryte Formula: BaSO4 Reference: Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 412. |
| ⓘ Berthierite Formula: FeSb2S4 |
| ⓘ Boulangerite Formula: Pb5Sb4S11 |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Calaverite Formula: AuTe2 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Boldut Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Cavnic Mine (Kapnikbánya), Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Suior Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Roata Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Cremenea vein, Suior Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania |
| ⓘ Chalcostibite Formula: CuSbS2 |
| ⓘ 'Chlorite Group' |
| ⓘ Coquandite Formula: Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) Reference: Gábor Koller collection (EDS- and PXRD-analysed by Sándor Szakáll and Béla Fehér) |
| ⓘ Covellite Formula: CuS Reference: Rocks & Minerals 81:296-300 |
| ⓘ 'Diorite' |
| ⓘ Dolomite Formula: CaMg(CO3)2 Reference: Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 214. |
| ⓘ 'Electrum' Formula: (Au, Ag) |
| ⓘ Epidote Formula: {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Fülöppite Formula: Pb3Sb8S15 Reference: Gábor Koller collection (EDS- and PXRD-analysed by Sándor Szakáll and Béla Fehér) |
| ⓘ Galena Formula: PbS Localities: Cavnic Mine (Kapnikbánya), Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Boldut Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Roata Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Cremenea vein, Suior Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Suior Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania |
| ⓘ Gold Formula: Au |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Gypsum var: Selenite Formula: CaSO4 · 2H2O |
| ⓘ Helvine Formula: Be3Mn2+4(SiO4)3S |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hübnerite Formula: MnWO4 |
| ⓘ Ilvaite Formula: CaFe3+Fe2+2(Si2O7)O(OH) |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var: Adularia' Formula: KAlSi3O8 |
| ⓘ Krautite Formula: Mn(HAsO4) · H2O Reference: Handbook for Mineralogy, v. 4 |
| ⓘ Kutnohorite Formula: CaMn2+(CO3)2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ 'Manganoan Calcite' Formula: (Ca,Mn)CO3 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Matildite Formula: AgBiS2 |
| ⓘ Metastibnite Formula: Sb2S3 Reference: Gábor Koller collection (EDS- and PXRD-analysed by Sándor Szakáll and Béla Fehér) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var: Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Orpiment Formula: As2S3 |
| ⓘ Petzite Formula: Ag3AuTe2 |
| ⓘ Proustite Formula: Ag3AsS3 |
| ⓘ Pyrargyrite Formula: Ag3SbS3 |
| ⓘ Pyrite Formula: FeS2 Localities: Cavnic Mine (Kapnikbánya), Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Boldut Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Roata Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Suior Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Cremenea vein, Suior Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania |
| ⓘ Quartz Formula: SiO2 Localities: Cavnic Mine (Kapnikbánya), Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Boldut Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Suior Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Roata Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Cremenea vein, Suior Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania |
| ⓘ Quartz var: Amethyst Formula: SiO2 |
| ⓘ Quartz var: Chalcedony Formula: SiO2 |
| ⓘ Quartz var: Milky Quartz Formula: SiO2 |
| ⓘ Quartz var: Smoky Quartz Formula: SiO2 |
| ⓘ Realgar Formula: As4S4 |
| ⓘ Rhodochrosite (TL) Formula: MnCO3 Reference: Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 174; Zeitschrift für Kristallographie (1981): 156: 233.; Grancea, L., Bailly, L., Leroy, J., Banks, D., Marcoux, E., Milési, J., ... & Fabre, C. (2002). Fluid evolution in the Baia Mare epithermal gold/polymetallic district, Inner Carpathians, Romania. Mineralium Deposita, 37(6-7), 630-647.; Hîrtopanu, P., Andersen, J., Hârtopanu, I., & Udubaşa, S. Ilvaite From The Cavnic Deposit, Romania. pp62-65; Plotinskaya, O. Y., Damian, F., Prokofiev, V. Y., Kovalenker, V. A., & Damian, G. (2009). Tellurides occurrences in the Baia Mare region, Romania. Carpathian Journal of Earth and Environmental Sciences, 4(2), 89-100. |
| ⓘ Rhodonite Formula: Mn2+SiO3 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Senarmontite Formula: Sb2O3 Reference: Gábor Koller collection (EDS-analysed by Sándor Szakáll and Béla Fehér) |
| ⓘ Siderite Formula: FeCO3 Reference: Nicu Pascanu specimen; Hîrtopanu, P., Andersen, J., Hârtopanu, I., & Udubaşa, S. Ilvaite From The Cavnic Deposit, Romania. pp62-65 |
| ⓘ Sphalerite Formula: ZnS Localities: Cavnic Mine (Kapnikbánya), Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Boldut Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Suior Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Roata Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania Cremenea vein, Suior Mine, Cavnic (Kapnic; Kapnik), Maramureș Co., Romania |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Tennantite Formula: Cu6[Cu4(Fe,Zn)2]As4S13 Reference: Olga Yu. PLOTINSKAYA, Floarea. DAMIAN, Vsevolod Yu. PROKOFIEV, Vladimir A. KOVALENKER Gheorghe DAMIAN (2009) TELLURIDES OCCURRENCES IN THE BAIA MARE REGION, ROMANIA; Carpathian Journal of Earth and Environmental Sciences, Vol. 4, No. 2, p. 89 - 100 |
| ⓘ 'Tennantite-Tetrahedrite Series' |
| ⓘ Tetrahedrite Formula: Cu6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ Wavellite Formula: Al3(PO4)2(OH,F)3 · 5H2O Reference: Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II. John Wiley and Sons, Inc., New York, 7th edition, revised and enlarged, 1124 pp.: 963; Szakáll, S., Ed. (2002): Minerals of the Carpathians. Christian Weise Verlag, Munich, Germany, 480 pp. |
| ⓘ Whewellite Formula: Ca(C2O4) · H2O Reference: Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 1101. |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ Wurtzite Formula: (Zn,Fe)S |
| ⓘ Zinkenite Formula: Pb9Sb22S42 |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Arsenic | 1.CA.05 | As |
| ⓘ | Electrum | 1.AA.05 | (Au, Ag) |
| ⓘ | Gold | 1.AA.05 | Au |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | 'Altaite' | 2.CD.10 | PbTe |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | Calaverite | 2.EA.10 | AuTe2 |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Chalcostibite | 2.HA.05 | CuSbS2 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Fülöppite | 2.HC.10a | Pb3Sb8S15 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Matildite | 2.JA.20 | AgBiS2 |
| ⓘ | Metastibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| ⓘ | Petzite | 2.BA.75 | Ag3AuTe2 |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Tennantite | 2.GB.05 | Cu6[Cu4(Fe,Zn)2]As4S13 |
| ⓘ | Tetrahedrite | 2.GB.05 | Cu6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var: Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var: Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var: Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var: Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Kutnohorite | 5.AB.10 | CaMn2+(CO3)2 |
| ⓘ | Rhodochrosite (TL) | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Argentojarosite | 7.BC.10 | AgFe3+3(SO4)2(OH)6 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Coquandite | 7.DE.35 | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var: Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Krautite | 8.CB.15 | Mn(HAsO4) · H2O |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH,F)3 · 5H2O |
| Group 9 - Silicates | |||
| ⓘ | 'Albite' | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var: Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Epidote | 9.BG.05a | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| ⓘ | Ilvaite | 9.BE.07 | CaFe3+Fe2+2(Si2O7)O(OH) |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var: Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | Rhodonite | 9.DK.05 | Mn2+SiO3 |
| Group 10 - Organic Compounds | |||
| ⓘ | Whewellite | 10.AB.45 | Ca(C2O4) · H2O |
| Unclassified Minerals, Rocks, etc. | |||
| ⓘ | Apatite | - | |
| ⓘ | Chlorite Group | - | |
| ⓘ | Diorite | - | |
| ⓘ | K Feldspar | - | |
| ⓘ | 'var: Adularia' | - | KAlSi3O8 |
| ⓘ | Manganoan Calcite | - | (Ca,Mn)CO3 |
| ⓘ | Tennantite-Tetrahedrite Series | - | |
List of minerals arranged by Dana 8th Edition classification
| Group 1 - NATIVE ELEMENTS AND ALLOYS | |||
|---|---|---|---|
| Metals, other than the Platinum Group | |||
| ⓘ | Gold | 1.1.1.1 | Au |
| Semi-metals and non-metals | |||
| ⓘ | Arsenic | 1.3.1.1 | As |
| Group 2 - SULFIDES | |||
| AmBnXp, with (m+n):p = 2:1 | |||
| ⓘ | Petzite | 2.4.3.3 | Ag3AuTe2 |
| AmXp, with m:p = 1:1 | |||
| ⓘ | Altaite | 2.8.1.3 | PbTe |
| ⓘ | Covellite | 2.8.12.1 | CuS |
| ⓘ | Galena | 2.8.1.1 | PbS |
| ⓘ | Realgar | 2.8.21.1 | As4S4 |
| ⓘ | Sphalerite | 2.8.2.1 | ZnS |
| ⓘ | Wurtzite | 2.8.7.1 | (Zn,Fe)S |
| AmBnXp, with (m+n):p = 1:1 | |||
| ⓘ | Chalcopyrite | 2.9.1.1 | CuFeS2 |
| AmBnXp, with (m+n):p = 2:3 | |||
| ⓘ | Metastibnite | 2.11.3.1 | Sb2S3 |
| ⓘ | Orpiment | 2.11.1.1 | As2S3 |
| ⓘ | Stibnite | 2.11.2.1 | Sb2S3 |
| AmBnXp, with (m+n):p = 1:2 | |||
| ⓘ | Arsenopyrite | 2.12.4.1 | FeAsS |
| ⓘ | Calaverite | 2.12.13.2 | AuTe2 |
| ⓘ | Marcasite | 2.12.2.1 | FeS2 |
| ⓘ | Pyrite | 2.12.1.1 | FeS2 |
| Group 3 - SULFOSALTS | |||
| 3 <ø < 4 | |||
| ⓘ | Tennantite | 3.3.6.2 | Cu6[Cu4(Fe,Zn)2]As4S13 |
| ⓘ | Tetrahedrite | 3.3.6.1 | Cu6[Cu4(Fe,Zn)2]Sb4S13 |
| ø = 3 | |||
| ⓘ | Bournonite | 3.4.3.2 | PbCuSbS3 |
| ⓘ | Proustite | 3.4.1.1 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 3.4.1.2 | Ag3SbS3 |
| ⓘ | Wittichenite | 3.4.8.1 | Cu3BiS3 |
| 2.5 < ø < 3 | |||
| ⓘ | Boulangerite | 3.5.2.1 | Pb5Sb4S11 |
| 2 < ø < 2.49 | |||
| ⓘ | Fülöppite | 3.6.20.1 | Pb3Sb8S15 |
| ø = 2 | |||
| ⓘ | Berthierite | 3.7.9.3 | FeSb2S4 |
| ⓘ | Chalcostibite | 3.7.5.1 | CuSbS2 |
| ⓘ | Matildite | 3.7.1.1 | AgBiS2 |
| 1 < ø < 2 | |||
| ⓘ | Zinkenite | 3.8.1.1 | Pb9Sb22S42 |
| Group 4 - SIMPLE OXIDES | |||
| A2X3 | |||
| ⓘ | Hematite | 4.3.1.2 | Fe2O3 |
| ⓘ | Senarmontite | 4.3.9.2 | Sb2O3 |
| Group 7 - MULTIPLE OXIDES | |||
| AB2X4 | |||
| ⓘ | Magnetite | 7.2.2.3 | Fe2+Fe3+2O4 |
| Group 9 - NORMAL HALIDES | |||
| AX2 | |||
| ⓘ | Fluorite | 9.2.1.1 | CaF2 |
| Group 14 - ANHYDROUS NORMAL CARBONATES | |||
| A(XO3) | |||
| ⓘ | Calcite | 14.1.1.1 | CaCO3 |
| ⓘ | Rhodochrosite (TL) | 14.1.1.4 | MnCO3 |
| ⓘ | Siderite | 14.1.1.3 | FeCO3 |
| AB(XO3)2 | |||
| ⓘ | Ankerite | 14.2.1.2 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 14.2.1.1 | CaMg(CO3)2 |
| ⓘ | Kutnohorite | 14.2.1.3 | CaMn2+(CO3)2 |
| Group 28 - ANHYDROUS ACID AND NORMAL SULFATES | |||
| AXO4 | |||
| ⓘ | Baryte | 28.3.1.1 | BaSO4 |
| Group 29 - HYDRATED ACID AND NORMAL SULFATES | |||
| AXO4·xH2O | |||
| ⓘ | Gypsum | 29.6.3.1 | CaSO4 · 2H2O |
| Group 30 - ANHYDROUS SULFATES CONTAINING HYDROXYL OR HALOGEN | |||
| (AB)m(XO4)pZq, where m:p>2:1 | |||
| ⓘ | Coquandite | 30.1.18.1 | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| (AB)2(XO4)Zq | |||
| ⓘ | Argentojarosite | 30.2.5.5 | AgFe3+3(SO4)2(OH)6 |
| Group 39 - HYDRATED ACID PHOSPHATES,ARSENATES AND VANADATES | |||
| A[HXO4]·xH2O | |||
| ⓘ | Krautite | 39.1.3.1 | Mn(HAsO4) · H2O |
| Group 42 - HYDRATED PHOSPHATES, ETC.CONTAINING HYDROXYL OR HALOGEN | |||
| A3(XO4)2Zq·xH2O | |||
| ⓘ | Wavellite | 42.10.2.1 | Al3(PO4)2(OH,F)3 · 5H2O |
| Group 48 - ANHYDROUS MOLYBDATES AND TUNGSTATES | |||
| AXO4 | |||
| ⓘ | Ferberite | 48.1.1.2 | FeWO4 |
| ⓘ | Hübnerite | 48.1.1.1 | MnWO4 |
| ⓘ | Scheelite | 48.1.2.1 | Ca(WO4) |
| Group 50 - ORGANIC COMPOUNDS | |||
| Oxalates | |||
| ⓘ | Whewellite | 50.1.1.1 | Ca(C2O4) · H2O |
| Group 56 - SOROSILICATES Si2O7 Groups, With Additional O, OH, F and H2O | |||
| Si2O7 Groups and O, OH, F, and H2O with cations in [4] and/or >[4] coordination | |||
| ⓘ | Ilvaite | 56.2.3.3 | CaFe3+Fe2+2(Si2O7)O(OH) |
| Group 58 - SOROSILICATES Insular, Mixed, Single, and Larger Tetrahedral Groups | |||
| Insular, Mixed, Single, and Larger Tetrahedral Groups with cations in [6] and higher coordination; single and double groups (n = 1, 2) | |||
| ⓘ | Epidote | 58.2.1a.7 | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Group 65 - INOSILICATES Single-Width,Unbranched Chains,(W=1) | |||
| Single-Width Unbranched Chains, W=1 with chains P=5 | |||
| ⓘ | Rhodonite | 65.4.1.1 | Mn2+SiO3 |
| Group 71 - PHYLLOSILICATES Sheets of Six-Membered Rings | |||
| Sheets of 6-membered rings with 2:1 layers | |||
| ⓘ | Muscovite | 71.2.2a.1 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var: Illite | 71.2.2d.2 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Group 75 - TECTOSILICATES Si Tetrahedral Frameworks | |||
| Si Tetrahedral Frameworks - SiO2 with [4] coordinated Si | |||
| ⓘ | Quartz | 75.1.3.1 | SiO2 |
| Si Tetrahedral Frameworks - SiO2 with H2O and organics | |||
| ⓘ | Opal | 75.2.1.1 | SiO2 · nH2O |
| Group 76 - TECTOSILICATES Al-Si Framework | |||
| Al-Si Framework with Al-Si frameworks | |||
| ⓘ | Albite | 76.1.3.1 | Na(AlSi3O8) |
| Al-Si Framework Feldspathoids and related species | |||
| ⓘ | Helvine | 76.2.4.1 | Be3Mn2+4(SiO4)3S |
| Unclassified Minerals, Rocks, etc. | |||
| ⓘ | Albite var: Andesine | - | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | 'Apatite' | - | |
| ⓘ | Aragonite | - | CaCO3 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Diorite' | - | |
| ⓘ | 'Electrum' | - | (Au, Ag) |
| ⓘ | Gypsum var: Selenite | - | CaSO4 · 2H2O |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'var: Adularia' | - | KAlSi3O8 |
| ⓘ | Kaolinite | - | Al2(Si2O5)(OH)4 |
| ⓘ | 'Manganoan Calcite' | - | (Ca,Mn)CO3 |
| ⓘ | Quartz var: Amethyst | - | SiO2 |
| ⓘ | var: Chalcedony | - | SiO2 |
| ⓘ | var: Milky Quartz | - | SiO2 |
| ⓘ | var: Smoky Quartz | - | SiO2 |
| ⓘ | 'Tennantite-Tetrahedrite Series' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| H | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| H | ⓘ Epidote | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Muscovite (var: Illite) | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Krautite | Mn(HAsO4) · H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Gypsum (var: Selenite) | CaSO4 · 2H2O |
| H | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| H | ⓘ Whewellite | Ca(C2O4) · H2O |
| Be | Beryllium | |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| C | ⓘ Manganoan Calcite | (Ca,Mn)CO3 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Whewellite | Ca(C2O4) · H2O |
| O | Oxygen | |
| O | ⓘ K Feldspar (var: Adularia) | KAlSi3O8 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Quartz (var: Amethyst) | SiO2 |
| O | ⓘ Albite (var: Andesine) | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Quartz (var: Chalcedony) | SiO2 |
| O | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Epidote | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Muscovite (var: Illite) | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Krautite | Mn(HAsO4) · H2O |
| O | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Manganoan Calcite | (Ca,Mn)CO3 |
| O | ⓘ Quartz (var: Milky Quartz) | SiO2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | Mn2+SiO3 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Gypsum (var: Selenite) | CaSO4 · 2H2O |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Quartz (var: Smoky Quartz) | SiO2 |
| O | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| O | ⓘ Whewellite | Ca(C2O4) · H2O |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite (var: Andesine) | (Na,Ca)[Al(Si,Al)Si2O8] |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar (var: Adularia) | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Albite (var: Andesine) | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Epidote | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Al | ⓘ Muscovite (var: Illite) | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| Si | Silicon | |
| Si | ⓘ K Feldspar (var: Adularia) | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Quartz (var: Amethyst) | SiO2 |
| Si | ⓘ Albite (var: Andesine) | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Quartz (var: Chalcedony) | SiO2 |
| Si | ⓘ Epidote | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Muscovite (var: Illite) | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Quartz (var: Milky Quartz) | SiO2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | Mn2+SiO3 |
| Si | ⓘ Quartz (var: Smoky Quartz) | SiO2 |
| P | Phosphorus | |
| P | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| S | Sulfur | |
| S | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcostibite | CuSbS2 |
| S | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| S | ⓘ Covellite | CuS |
| S | ⓘ Fülöppite | Pb3Sb8S15 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Matildite | AgBiS2 |
| S | ⓘ Metastibnite | Sb2S3 |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Gypsum (var: Selenite) | CaSO4 · 2H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tennantite | Cu6[Cu4(Fe,Zn)2]As4S13 |
| S | ⓘ Tetrahedrite | Cu6[Cu4(Fe,Zn)2]Sb4S13 |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| K | Potassium | |
| K | ⓘ K Feldspar (var: Adularia) | KAlSi3O8 |
| K | ⓘ Muscovite (var: Illite) | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Albite (var: Andesine) | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Ca | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Ca | ⓘ Manganoan Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Gypsum (var: Selenite) | CaSO4 · 2H2O |
| Ca | ⓘ Whewellite | Ca(C2O4) · H2O |
| Mn | Manganese | |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Krautite | Mn(HAsO4) · H2O |
| Mn | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Mn | ⓘ Manganoan Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | Mn2+SiO3 |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Tetrahedrite | Cu6[Cu4(Fe,Zn)2]Sb4S13 |
| Cu | Copper | |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcostibite | CuSbS2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Tennantite | Cu6[Cu4(Fe,Zn)2]As4S13 |
| Cu | ⓘ Tetrahedrite | Cu6[Cu4(Fe,Zn)2]Sb4S13 |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Tetrahedrite | Cu6[Cu4(Fe,Zn)2]Sb4S13 |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| As | Arsenic | |
| As | ⓘ Arsenic | As |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Krautite | Mn(HAsO4) · H2O |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Tennantite | Cu6[Cu4(Fe,Zn)2]As4S13 |
| Ag | Silver | |
| Ag | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| Ag | ⓘ Electrum | (Au, Ag) |
| Ag | ⓘ Matildite | AgBiS2 |
| Ag | ⓘ Petzite | Ag3AuTe2 |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | Antimony | |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Chalcostibite | CuSbS2 |
| Sb | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| Sb | ⓘ Fülöppite | Pb3Sb8S15 |
| Sb | ⓘ Metastibnite | Sb2S3 |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite | Cu6[Cu4(Fe,Zn)2]Sb4S13 |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Calaverite | AuTe2 |
| Te | ⓘ Petzite | Ag3AuTe2 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Calaverite | AuTe2 |
| Au | ⓘ Electrum | (Au, Ag) |
| Au | ⓘ Gold | Au |
| Au | ⓘ Petzite | Ag3AuTe2 |
| Pb | Lead | |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Fülöppite | Pb3Sb8S15 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
| Bi | Bismuth | |
| Bi | ⓘ Matildite | AgBiS2 |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
Regional Geology
This geological map and associated information on rock units at or nearby to the coordinates given for this locality is based on relatively small scale geological maps provided by various national Geological Surveys. This does not necessarily represent the complete geology at this locality but it gives a background for the region in which it is found.
Click on geological units on the map for more information. Click here to view full-screen map on Macrostrat.org
| Cenozoic 0 - 66 Ma ID: 3184425 | Cenozoic volcanic rocks Age: Cenozoic (0 - 66 Ma) Lithology: Felsic volcanic rocks Reference: Chorlton, L.B. Generalized geology of the world: bedrock domains and major faults in GIS format: a small-scale world geology map with an extended geological attribute database. doi: 10.4095/223767. Geological Survey of Canada, Open File 5529. [154] |
| Neogene 2.588 - 23.03 Ma ID: 3162663 | Neogene andesite Age: Neogene (2.588 - 23.03 Ma) Lithology: Major:{andesite}, Minor{rhyolite,rhyodacite} Reference: Asch, K. The 1:5M International Geological Map of Europe and Adjacent Areas: Development and Implementation of a GIS-enabled Concept. Geologisches Jahrbuch, SA 3. [147] |
Data and map coding provided by Macrostrat.org, used under Creative Commons Attribution 4.0 License
References
Sort by
Year (asc) Year (desc) Author (A-Z) Author (Z-A)Palache, C., Berman, H., and Frondel, C. (1951) The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II. John Wiley and Sons, Inc., New York, 7th edition, revised and enlarged, 1124 pp.: 963, 1101.
Huber, P. and Muresan, I. (1996) Mineralienübersicht der wichtigsten Bergbaue des Bezirkes Maramures. Lapis, 21 (7), 60 (in German).
Huber, P. and Muresan, I. (1996) Farbenprächtige Mineralien aus Cavnic: Vererzung und Mineralien von Cavnic (Kapnikbanya, Kapnik). Lapis, 21(7/8), 45-55 (in German).
Szakáll, S. (Ed.) (2002) Minerals of the Carpathians. Christian Weise Verlag, Munich, Germany, 480 pp.
Hîrtopanu, P., Andersen, J., Hârtopanu, I., and Udubaşa, S. (2012) Ilvaite From The Cavnic Deposit, Romania. Romanian Journal of Earth Sciences, 8, 62-65. [http://rjes.igr.ro/wp-content/uploads/2012/08/062-65-Hartopanu-2.pdf]
External Links
http://www.mineralienatlas.de/lexikon/index.php/Rum%E4nien/Maramures%2C%20Kreis/Cavnic%20%28Kapnikb%E1nya%2C%20Kapnik%29
http://www.geologie.uni-halle.de/igw/mingeo/Exkursion/day2509.htm
http://www.geologie.uni-halle.de/igw/mingeo/Exkursion/day2509.htm
Localities in this RegionShow map
Romania
- Maramureș Co.
- Cavnic (Kapnic; Kapnik)
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Cavnic, Maramureș Co., Romania