Cabonga Reservoir, Réservoir-Dozois, La Vallée-de-l'Or RCM, Abitibi-Témiscamingue, Québec, Canadai
| Regional Level Types | |
|---|---|
| Cabonga Reservoir | Reservoir |
| Réservoir-Dozois | - not defined - |
| La Vallée-de-l'Or RCM | Regional County Municipality |
| Abitibi-Témiscamingue | - not defined - |
| Québec | - not defined - |
| Canada | Country |
This page is currently not sponsored. Click here to sponsor this page.
Key
Lock Map
| Latitude & Longitude (WGS84): | 47° 21' 30'' North , 76° 40' 4'' West |
|---|---|
| Latitude & Longitude (decimal): | 47.35845,-76.66797 |
| GeoHash: | G#: f23mrmk4f |
| Locality type: | Reservoir |
| Köppen climate type: | Dfb : Warm-summer humid continental climate |
| Other/historical names associated with this locality: | Cabonga Terrane, Grenville Province, Réserve Faunique La Verendrye |
The Reservoir Cabonga Terrane is an allochtonous slab metamorphosed under granulite grade conditions and transported onto the migmatites of the Grenvillian Parautochtone
Besides the claims of GLP Mining on the east shore of the reservoir and a copper-nickel property of CopperOne to the north of the terrane, the area is mostly open to collectors. No historial mining records could be found.
Regions containing this locality
| North America Plate | Tectonic Plate |
Select Mineral List Type
Standard Detailed Strunz Dana Chemical ElementsDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection |
| Albite var: Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249 |
ⓘ 'Allanite Group' Formula: {A12+REE3+}{M3+2M32+}(Si2O7)(SiO4)O(OH) Reference: Olivier Langelier Collection; |
ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Habit: Dodecahedron Colour: Red, Burgundy, Purple Description: Present in several exposed outcrops of Paragneiss and Quartzite all around the Cabonga Dam. Specimen up to 1.5cm in size can sometime be removed from the matrix intact but in general they are heavily fractured. Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection |
| ⓘ 'Amphibole Supergroup' Formula: AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Reference: Olivier Langelier |
ⓘ Analcime Formula: Na(AlSi2O6) · H2O Habit: Trapezohedral Colour: White, Yellowish, Pink Reference: Olivier Langelier Collection |
| ⓘ Anatase Formula: TiO2 Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Colour: Red, Orange Reference: Olivier Langelier Collection |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) Habit: Tabular Colour: Yellow Description: Specimen show nice blueish adularescence but are included
and most often heavily fractured Reference: Olivier Langelier Collection |
| ⓘ Anorthite var: Bytownite Formula: (Ca,Na)[Al(Al,Si)Si2O8] Reference: Olivier Langelier Collection |
| 'Apatite' Habit: Prismatic, Massive, Granular Colour: Yellow-Green, Yellow, Green, Green with Red core, Blue Fluorescence: No UV reaction Description: Very common but always very fractured at this locality hence very little
specimen grade material. However lots of fragments are transparent and free
of inclusions yielding cuttable material. Reference: Olivier Langelier Collection |
| Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Colour: Green Reference: Olivier Langelier Collection |
'Biotite' Habit: Euhedral, Platy 'Books' Colour: Golden to Black Fluorescence: none Description: Huge 'books' of Biotite can be found in Pegmatites, often euhedral with sharp edges Reference: Olivier Langelier Collection |
Calcite Formula: CaCO3 Habit: Trigonal Rhombohedral Colour: White, Colorless, Pink, Peach, Golden, Blue (Very rare) Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection |
| ⓘ Chalcopyrite Formula: CuFeS2 Habit: Disphenoid, Botryoidal Colour: Gold-like Yellow Reference: Olivier Langelier Collection |
| ⓘ Chamosite Formula: (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 Reference: Olivier Langelier Collection |
| ⓘ 'Chlorite Group' Reference: Olivier Langelier Collection |
| ⓘ Chondrodite Formula: (Mg,Fe2+)5(SiO4)2(F,OH)2 Colour: Yellow, Orange, Brown Description: Specimen tentatively identified based on visual characteristics and geological setting.
Found in coarse to pegmatitic marbles associated with spinel. Reference: Olivier Langelier Collection |
ⓘ Chromite Formula: Fe2+Cr3+2O4 Habit: Octahedral Colour: Black Reference: Olivier Langelier Collection; Hudon, P., Friedman, R.M., Gauthier, G. & Martignole, J. (2006) Age of the Cabonga nepheline syenite, Grenville Province, western Quebec. Canadian Journal of Earth Sciences, vol. 43(9), 1237-1249. |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Reference: Olivier Langelier Collection |
Corundum Formula: Al2O3 Habit: rhombohedral Colour: White, Brown, Grey Description: Corundum is a major component of nepheline syenites at Cabonga. Reference: Cindy Hasler Collection
Olivier Langelier Collection;
Hudon, P., Friedman, R.M., Gauthier, G. & Martignole, J. (2006) Age of the Cabonga nepheline syenite, Grenville Province, western Quebec. Canadian Journal of Earth Sciences, vol. 43(9), 1237-1249. |
Corundum var: Sapphire Formula: Al2O3 Habit: Bipyramidal, Tabular, Rhombohedral Colour: White, Yellow, Blue,
Optically clear in grain mount but only translucent in hand. Fluorescence: yellow var. orange LW Description: Present in a handful of outcrops, the most interesting specimen occur in a pegmatitic nepheline syenite outcrop currently protected by a claim. The pegmatite occurs as pods enclosed in crystalline marble. Reference: Olivier Langelier Collection |
| ⓘ Cummingtonite Formula: ☐{Mg2}{Mg5}(Si8O22)(OH)2 Reference: Olivier Langelier Collection |
| ⓘ Diaspore Formula: AlO(OH) Habit: Present as inclusions in Corundum Colour: White Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection |
| ⓘ Diopside Formula: CaMgSi2O6 Habit: Granular, Prismatic, Massive Colour: Green Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection |
| ⓘ Diopside var: Chromian Diopside Formula: Ca(Mg,Cr)Si2O6 Colour: Bright Green Reference: Olivier Langelier Collection |
| ⓘ Dolomite Formula: CaMg(CO3)2 Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249 |
| ⓘ Edenite Formula: {Na}{Ca2}{Mg5}(AlSi7O22)(OH)2 Reference: Olivier Langelier Collection |
| ⓘ Enstatite Formula: MgSiO3 Reference: Olivier Langelier Collection |
| ⓘ Epidote Formula: {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) Reference: Olivier Langelier Collection |
| ⓘ 'Fayalite-Forsterite Series' Habit: Subhedral granular Colour: unknown Description: Rock forming mineral in some of the Nepheline Syenites Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249 |
| ⓘ 'Fayalite-Forsterite Series var: Hortonolite' Formula: from (Fe1.5Mg0.5)2SiO4 to (Mg1.5Fe0.5)2SiO4 Reference: Olivier Langelier Collection |
| Ferro-hornblende Formula: ☐{Ca2}{Fe2+4Al}(AlSi7O22)(OH)2 Colour: Black Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection |
| ⓘ Ferrosilite ? Formula: FeSiO3 Description: SEM-EDS insufficient. Reference: Olivier Langelier Collection |
Fluorapatite Formula: Ca5(PO4)3F Habit: Prismatic, Granular Colour: Blue with strong aquamarine dichroism Fluorescence: None Description: Present as principal accessory in a few calcite vein dykes. Nearly no intact crystals to be found. Very fractured material. Reference: Olivier Langelier Collection;
Hudon, P., Friedman, R.M., Gauthier, G. & Martignole, J. (2006) Age of the Cabonga nepheline syenite, Grenville Province, western Quebec. Canadian Journal of Earth Sciences, vol. 43(9), 1237-1249. |
| ⓘ Fluorite Formula: CaF2 Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249; Hudon, P., Friedman, R.M., Gauthier, G. & Martignole, J. (2006) Age of the Cabonga nepheline syenite, Grenville Province, western Quebec. Canadian Journal of Earth Sciences, vol. 43(9), 1237-1249. |
| ⓘ Galena Formula: PbS Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249 |
| ⓘ Garronite-Ca Formula: Na2Ca5Al12Si20O64 · 27H2O Reference: Hudon, P., Friedman, R.M., Gauthier, G. & Martignole, J. (2006) Age of the Cabonga nepheline syenite, Grenville Province, western Quebec. Canadian Journal of Earth Sciences, 43(9), 1237-1249.
|
| ⓘ Goethite Formula: α-Fe3+O(OH) Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection |
ⓘ Graphite Formula: C Habit: Anhedral Colour: Metallic grey Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles;
Martignole, Jacques Canadian Journal of Earth
Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 Colour: Red Reference: Olivier Langelier Collection |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection |
| ⓘ Halite Formula: NaCl Reference: Olivier Langelier |
| Hedenbergite Formula: CaFe2+Si2O6 Colour: Black Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection |
| ⓘ Hematite Formula: Fe2O3 Colour: Red Description: Inclusion in Quartz Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection; Hudon, P., Friedman, R.M., Gauthier, G. & Martignole, J. (2006) Age of the Cabonga nepheline syenite, Grenville Province, western Quebec. Canadian Journal of Earth Sciences, vol. 43(9), 1237-1249. |
| ⓘ 'Hornblende' Reference: Olivier L |
| ⓘ Ilmenite Formula: Fe2+TiO3 Colour: Black Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection |
ⓘ Ilmenite var: Picroilmenite Formula: (Fe2+,Mg)TiO3 Reference: Olivier Langelier Collection |
| ⓘ Kaersutite Formula: {Na}{Ca2}{Mg3AlTi}(Al2Si6O22)O2 Habit: Prismatic Colour: Black Reference: Olivier Langelier Collection |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Habit: Clay particles Colour: White Description: Alteration product of uncertain origin Reference: Olivier Langelier Collection |
| ⓘ 'Kelyphite' Colour: White, Black Description:
Extremely rare, garnet alteration symplectite Reference: Olivier Langelier Collection |
| ⓘ Knorringite Formula: Mg3Cr2(SiO4)3 Reference: Olivier Langelier Collection |
| ⓘ Kyanite Formula: Al2(SiO4)O Colour: Blue, Green Reference: Olivier Langelier Collection |
| ⓘ 'Labradorite' Formula: (Ca,Na)[Al(Al,Si)Si2O8] Habit: Tabular Colour: Yellow Description: Specimen show nice blueish adularescence but are included
and most often heavily fractured Reference: Olivier Langelier Collection |
ⓘ 'Limonite' Formula: (Fe,O,OH,H2O) Description: Occurs as an alteration product of Lamprophyre in clay like material yellow-ground Reference: Olivier Langelier Collection |
| ⓘ Magnesio-hastingsite Formula: {Na}{Ca2}{Mg4Fe3+}(Al2Si6O22)(OH)2 Colour: Black Reference: Olivier Langelier Collection |
| ⓘ Magnesite Formula: MgCO3 Reference: Hudon, P., Friedman, R.M., Gauthier, G. & Martignole, J. (2006) Age of the Cabonga nepheline syenite, Grenville Province, western Quebec. Canadian Journal of Earth Sciences, vol. 43(9), 1237-1249. |
Magnetite Formula: Fe2+Fe3+2O4 Habit: octahedral Colour: Black Fluorescence: None Description: Magnetite, Ti-Magnetite & Cr-Magnetite present
Very nice but very small octahedrons Reference: Olivier Langelier Collection;
Hudon, P., Friedman, R.M., Gauthier, G. & Martignole, J. (2006) Age of the Cabonga nepheline syenite, Grenville Province, western Quebec. Canadian Journal of Earth Sciences, vol. 43(9), 1237-1249. |
ⓘ Magnetite var: Ishkulite Formula: Fe2+(Fe3+,Cr3+)2O4 Reference: Olivier Langelier Collection |
| ⓘ Magnetite var: Titaniferous Magnetite Formula: Fe2+(Fe3+,Ti)2O4 Reference: Olivier Langelier Collection |
| ⓘ Majorite Formula: Mg3(Fe2+,Si,Al)2(SiO4)3 Colour: Purple Reference: Olivier Langelier Collection |
| ⓘ Marcasite Formula: FeS2 Colour: Black Description: Occurs as small black spheres Reference: Olivier Langelier Collection |
| ⓘ Meionite Formula: Ca4Al6Si6O24CO3 Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection |
| ⓘ Microcline Formula: K(AlSi3O8) Habit: Euhedral Colour: Pale green to grey, Red Description: Often a component of the Nepheline Syenites. Really bad color Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249;
Hudon, P., Friedman, R.M., Gauthier, G. & Martignole, J. (2006) Age of the Cabonga nepheline syenite, Grenville Province, western Quebec. Canadian Journal of Earth Sciences, vol. 43(9), 1237-1249.
Olivier Langelier Collection |
| ⓘ Microcline var: Amazonite Formula: K(AlSi3O8) Colour: Green Description: Rare and with a very unpleasant shade of green Reference: Olivier Langelier Collection |
| ⓘ 'Molybdenite-2H' Formula: MoS2 Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249 |
| ⓘ 'Monazite' Habit: Unknown Colour: Unknown Reference: Olivier Langelier Collection |
ⓘ Monazite-(Ce) Formula: Ce(PO4) Reference: Olivier Langelier Collection |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O Colour: Green, Grey Fluorescence: none Reference: Olivier Langelier Collection |
| Muscovite Formula: KAl2(AlSi3O10)(OH)2 Habit: Platy, Massive Colour: Colorless, Silver Description: Sometimes occurs as prismatic like books Reference: Olivier Langelier Collection |
| ⓘ Muscovite var: Sericite Formula: KAl2(AlSi3O10)(OH)2 Description: Occurs as inclusions in Almandine Reference: Olivier Langelier Collection |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249 |
Nepheline Formula: Na3K(Al4Si4O16) Habit: Euhedral, massive, granular Colour: White, Colorless Description: Occurs as massive xenomorphic crystals up to 70cm in diameter in pegmatitic Nepheline Syenite Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249 |
| ⓘ Omphacite Formula: (NaaCabFe2+cMgd)(AleFe3+fFe2+gMgh)Si2O6 Colour: Green Reference: Olivier Langelier |
Orthoclase Formula: K(AlSi3O8) Habit: Euhedral to Subhedral, Tabular Colour: Grey, White, Peach, Pink Description:
Some of the material is Moonstone quality showing a nice silver to blue adularescence. Often heavily fractured. Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection; Hudon, P., Friedman, R.M., Gauthier, G. & Martignole, J. (2006) Age of the Cabonga nepheline syenite, Grenville Province, western Quebec. Canadian Journal of Earth Sciences, vol. 43(9), 1237-1249. |
| Perovskite Formula: CaTiO3 Habit: pseudo-cubic Colour: dark brown Description: Very nice euhedral crystals up to 2mm in size. Extremely rare. Reference: Olivier Langelier Collection |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Reference: Olivier Langelier Collection |
ⓘ Pigeonite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Reference: Olivier Langelier Collection; |
| ⓘ Pyrite Formula: FeS2 Habit: Cubic, Globular Colour: Brassy Reference: Olivier Langelier Collection |
ⓘ Pyrope Formula: Mg3Al2(SiO4)3 Colour: Red, Pink, Purple, Orange Fluorescence: None Reference: Olivier Langelier Collection |
ⓘ Pyrope var: Chromian Pyrope Formula: Mg3(Al,Cr)2(SiO4)3 Colour: Red, Pink, Purple, Orange Fluorescence: None Reference: Olivier Langelier Collection |
| ⓘ Pyrrhotite Formula: Fe7S8 Reference: Olivier Langelier Collection |
| ⓘ Quartz Formula: SiO2 Habit: Granular Colour: Colorless, White, Smokey Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection
|
ⓘ Rutile Formula: TiO2 Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection; Hudon, P., Friedman, R.M., Gauthier, G. & Martignole, J. (2006) Age of the Cabonga nepheline syenite, Grenville Province, western Quebec. Canadian Journal of Earth Sciences, vol. 43(9), 1237-1249. |
| ⓘ Sanidine Formula: K(AlSi3O8) Reference: Olivier Langelier Collection |
| ⓘ Schorl Formula: Na(Fe2+3)Al6(Si6O18)(BO3)3(OH)3(OH) Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249 |
| ⓘ Sillimanite Formula: Al2(SiO4)O Reference: Olivier Langelier Collection |
| Sodalite Formula: Na8(Al6Si6O24)Cl2 Habit: Isometric hextetrahedral Colour: blue Description:
Sulfur bearing sodalite Reference: Olivier Langelier Collection |
Spinel Formula: MgAl2O4 Habit: Octahedral, Anhedral, Whiskers Colour: Blue, Red, Brown, Pink, Purple Fluorescence: Some of the pink spinel have a weak red fluorescence under UV Description: Spinel is ubiquitous at Cabonga as it is an aluminium rich granulite grade terrane.
The best specimen are found in coarse to pegmatitic marble dykes. Blue is the most
common color followed by red. Rare pink Zn bearing spinel up to 10mm also exists.
Some of the marbles are very rich in spinel but unfortunately specimen bigger than
3 or 4mm are very rare. In the marble spinel is often associated with apatite and
also included in the apatite.
Reference: Olivier Langelier Collection |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) Colour: Orange Reference: Olivier Langelier Collection |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Reference: Olivier Langelier Collection |
ⓘ Titanite Formula: CaTi(SiO4)O Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection; Hudon, P., Friedman, R.M., Gauthier, G. & Martignole, J. (2006) Age of the Cabonga nepheline syenite, Grenville Province, western Quebec. Canadian Journal of Earth Sciences, vol. 43(9), 1237-1249. |
| ⓘ 'Tourmaline' Formula: A(D3)G6(T6O18)(BO3)3X3Z Reference: Olivier Langelier Collection |
ⓘ Tremolite Formula: ☐{Ca2}{Mg5}(Si8O22)(OH)2 Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth Sciences, vol. 43, issue 9, pp. 1237-1249 |
| ⓘ Tugtupite Formula: Na4BeAlSi4O12Cl Colour: Red Reference: Olivier Langelier Collection |
| ⓘ Uvarovite Formula: Ca3Cr2(SiO4)3 Reference: Olivier Langelier Collection |
| ⓘ Wollastonite Formula: CaSiO3 Reference: Hudon, P., Friedman, R.M., Gauthier, G. & Martignole, J. (2006) Age of the Cabonga nepheline syenite, Grenville Province, western Quebec. Canadian Journal of Earth Sciences, vol. 43(9), 1237-1249. |
Zircon Formula: Zr(SiO4) Habit: Euhedral, tetragonal dipyramidal Colour: Brown, Pink, Yellow, Colorless Fluorescence: Orange in LW Description: Found in minute amounts in the Nepheline Syenites. Very small crystal except for
the occasional specimen up to 2cm.
Zircon up to 2cm in also found in granite and in alluvial deposits.
Reference: Age of the Cabonga nepheline syenite, Grenville Province, western Quebec Hudon, Pierre; Friedman, Richard M.; Gauthier, Gilles; Martignole, Jacques Canadian Journal of Earth
Sciences, vol. 43, issue 9, pp. 1237-1249
Olivier Langelier Collection |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe7S8 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Halite | 3.AA.20 | NaCl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | var: Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | var: Picroilmenite | 4.CB.05 | (Fe2+,Mg)TiO3 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | var: Ishkulite | 4.BB.05 | Fe2+(Fe3+,Cr3+)2O4 |
| ⓘ | var: Titaniferous Magnetite | 4.BB.05 | Fe2+(Fe3+,Ti)2O4 |
| ⓘ | Perovskite | 4.CC.30 | CaTiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| Group 9 - Silicates | |||
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var: Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var: Bytownite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| ⓘ | Chondrodite | 9.AF.45 | (Mg,Fe2+)5(SiO4)2(F,OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Cummingtonite | 9.DE.05 | ☐{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | var: Chromian Diopside | 9.DA.15 | Ca(Mg,Cr)Si2O6 |
| ⓘ | Edenite | 9.DE.15 | {Na}{Ca2}{Mg5}(AlSi7O22)(OH)2 |
| ⓘ | Enstatite | 9.DA.05 | MgSiO3 |
| ⓘ | Epidote | 9.BG.05a | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| ⓘ | Ferro-hornblende | 9.DE.10 | ☐{Ca2}{Fe2+4Al}(AlSi7O22)(OH)2 |
| ⓘ | Ferrosilite ? | 9.DA.05 | FeSiO3 |
| ⓘ | Garronite-Ca | 9.GC.05 | Na2Ca5Al12Si20O64 · 27H2O |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Kaersutite | 9.DE.15 | {Na}{Ca2}{Mg3AlTi}(Al2Si6O22)O2 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Knorringite | 9.AD.25 | Mg3Cr2(SiO4)3 |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | 'Labradorite' | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Magnesio-hastingsite | 9.DE.15 | {Na}{Ca2}{Mg4Fe3+}(Al2Si6O22)(OH)2 |
| ⓘ | Majorite | 9.AD.25 | Mg3(Fe2+,Si,Al)2(SiO4)3 |
| ⓘ | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | var: Amazonite | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var: Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Nepheline | 9.FA.05 | Na3K(Al4Si4O16) |
| ⓘ | Omphacite | 9.DA.20 | (NaaCabFe2+cMgd)(AleFe3+fFe2+gMgh)Si2O6 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Pigeonite | 9.DA.10 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| ⓘ | var: Chromian Pyrope | 9.AD.25 | Mg3(Al,Cr)2(SiO4)3 |
| ⓘ | Sanidine | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Schorl | 9.CK.05 | Na(Fe2+3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Sodalite | 9.FB.10 | Na8(Al6Si6O24)Cl2 |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Tremolite | 9.DE.10 | ☐{Ca2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Tugtupite | 9.FB.10 | Na4BeAlSi4O12Cl |
| ⓘ | Uvarovite | 9.AD.25 | Ca3Cr2(SiO4)3 |
| ⓘ | Wollastonite | 9.DG.05 | CaSiO3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| Unclassified Minerals, Rocks, etc. | |||
| ⓘ | 'Allanite Group' | - | {A12+REE3+}{M3+2M32+}(Si2O7)(SiO4)O(OH) |
| ⓘ | 'Amphibole Supergroup' | - | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Apatite' | - | |
| ⓘ | 'Biotite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'var: Hortonolite' | - | from (Fe1.5Mg0.5)2SiO4 to (Mg1.5Fe0.5)2SiO4 |
| ⓘ | 'Hornblende' | - | |
| ⓘ | 'Kelyphite' | - | |
| ⓘ | 'Limonite' | - | (Fe,O,OH,H2O) |
| ⓘ | 'Molybdenite-2H' | - | MoS2 |
| ⓘ | 'Monazite' | - | |
| ⓘ | 'Tourmaline' | - | A(D3)G6(T6O18)(BO3)3X3Z |
List of minerals arranged by Dana 8th Edition classification
| Group 1 - NATIVE ELEMENTS AND ALLOYS | |||
|---|---|---|---|
| Semi-metals and non-metals | |||
| ⓘ | Graphite | 1.3.6.2 | C |
| Group 2 - SULFIDES | |||
| AmXp, with m:p = 1:1 | |||
| ⓘ | Galena | 2.8.1.1 | PbS |
| ⓘ | Pyrrhotite | 2.8.10.1 | Fe7S8 |
| AmBnXp, with (m+n):p = 1:1 | |||
| ⓘ | Chalcopyrite | 2.9.1.1 | CuFeS2 |
| AmBnXp, with (m+n):p = 1:2 | |||
| ⓘ | Marcasite | 2.12.2.1 | FeS2 |
| ⓘ | Pyrite | 2.12.1.1 | FeS2 |
| Group 4 - SIMPLE OXIDES | |||
| A2X3 | |||
| ⓘ | Corundum | 4.3.1.1 | Al2O3 |
| ⓘ | Hematite | 4.3.1.2 | Fe2O3 |
| ⓘ | Ilmenite | 4.3.5.1 | Fe2+TiO3 |
| ⓘ | Perovskite | 4.3.3.1 | CaTiO3 |
| AX2 | |||
| ⓘ | Anatase | 4.4.4.1 | TiO2 |
| ⓘ | Rutile | 4.4.1.1 | TiO2 |
| Group 6 - HYDROXIDES AND OXIDES CONTAINING HYDROXYL | |||
| XO(OH) | |||
| ⓘ | Diaspore | 6.1.1.1 | AlO(OH) |
| ⓘ | Goethite | 6.1.1.2 | α-Fe3+O(OH) |
| Group 7 - MULTIPLE OXIDES | |||
| AB2X4 | |||
| ⓘ | Chromite | 7.2.3.3 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 7.2.2.3 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 7.2.1.1 | MgAl2O4 |
| Group 9 - NORMAL HALIDES | |||
| AX | |||
| ⓘ | Halite | 9.1.1.1 | NaCl |
| AX2 | |||
| ⓘ | Fluorite | 9.2.1.1 | CaF2 |
| Group 14 - ANHYDROUS NORMAL CARBONATES | |||
| A(XO3) | |||
| ⓘ | Calcite | 14.1.1.1 | CaCO3 |
| ⓘ | Magnesite | 14.1.1.2 | MgCO3 |
| AB(XO3)2 | |||
| ⓘ | Dolomite | 14.2.1.1 | CaMg(CO3)2 |
| Group 29 - HYDRATED ACID AND NORMAL SULFATES | |||
| AXO4·xH2O | |||
| ⓘ | Gypsum | 29.6.3.1 | CaSO4 · 2H2O |
| Group 38 - ANHYDROUS NORMAL PHOSPHATES, ARSENATES, AND VANADATES | |||
| AXO4 | |||
| ⓘ | Monazite-(Ce) | 38.4.3.1 | Ce(PO4) |
| Group 41 - ANHYDROUS PHOSPHATES, ETC.CONTAINING HYDROXYL OR HALOGEN | |||
| A5(XO4)3Zq | |||
| ⓘ | Fluorapatite | 41.8.1.1 | Ca5(PO4)3F |
| Group 51 - NESOSILICATES Insular SiO4 Groups Only | |||
| Insular SiO4 Groups Only with cations in [6] and >[6] coordination | |||
| ⓘ | Almandine | 51.4.3a.2 | Fe2+3Al2(SiO4)3 |
| ⓘ | Andradite | 51.4.3b.1 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Grossular | 51.4.3b.2 | Ca3Al2(SiO4)3 |
| ⓘ | Knorringite | 51.4.3a.4 | Mg3Cr2(SiO4)3 |
| ⓘ | Majorite | 51.4.3a.5 | Mg3(Fe2+,Si,Al)2(SiO4)3 |
| ⓘ | Pyrope | 51.4.3a.1 | Mg3Al2(SiO4)3 |
| ⓘ | Uvarovite | 51.4.3b.3 | Ca3Cr2(SiO4)3 |
| Insular SiO4 Groups Only with cations in >[6] coordination | |||
| ⓘ | Zircon | 51.5.2.1 | Zr(SiO4) |
| Group 52 - NESOSILICATES Insular SiO4 Groups and O,OH,F,H2O | |||
| Insular SiO4 Groups and O, OH, F, and H2O with cations in [4] and >[4] coordination | |||
| ⓘ | Kyanite | 52.2.2c.1 | Al2(SiO4)O |
| ⓘ | Sillimanite | 52.2.2a.1 | Al2(SiO4)O |
| ⓘ | Staurolite | 52.2.3.1 | Fe2+2Al9Si4O23(OH) |
| Insular SiO4 Groups and O, OH, F, and H2O with cations in [6] coordination only | |||
| ⓘ | Chondrodite | 52.3.2b.2 | (Mg,Fe2+)5(SiO4)2(F,OH)2 |
| Insular SiO4 Groups and O, OH, F, and H2O with cations in [6] and/or >[6] coordination | |||
| ⓘ | Titanite | 52.4.3.1 | CaTi(SiO4)O |
| Group 58 - SOROSILICATES Insular, Mixed, Single, and Larger Tetrahedral Groups | |||
| Insular, Mixed, Single, and Larger Tetrahedral Groups with cations in [6] and higher coordination; single and double groups (n = 1, 2) | |||
| ⓘ | Epidote | 58.2.1a.7 | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Group 61 - CYCLOSILICATES Six-Membered Rings | |||
| Six-Membered Rings with borate groups | |||
| ⓘ | Schorl | 61.3.1.10 | Na(Fe2+3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Group 65 - INOSILICATES Single-Width,Unbranched Chains,(W=1) | |||
| Single-Width Unbranched Chains, W=1 with chains P=2 | |||
| ⓘ | Augite | 65.1.3a.3 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 65.1.3a.1 | CaMgSi2O6 |
| ⓘ | Enstatite | 65.1.2.1 | MgSiO3 |
| ⓘ | Ferrosilite ? | 65.1.2.2 | FeSiO3 |
| ⓘ | Hedenbergite | 65.1.3a.2 | CaFe2+Si2O6 |
| ⓘ | Omphacite | 65.1.3b.1 | (NaaCabFe2+cMgd)(AleFe3+fFe2+gMgh)Si2O6 |
| ⓘ | Pigeonite | 65.1.1.4 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Single-Width Unbranched Chains, W=1 with chains P=3 | |||
| ⓘ | Wollastonite | 65.2.1.1c | CaSiO3 |
| Group 66 - INOSILICATES Double-Width,Unbranched Chains,(W=2) | |||
| Amphiboles - Mg-Fe-Mn-Li subgroup | |||
| ⓘ | Cummingtonite | 66.1.1.1 | ☐{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Edenite | 66.1.3a.10 | {Na}{Ca2}{Mg5}(AlSi7O22)(OH)2 |
| ⓘ | Kaersutite | 66.1.3a.18 | {Na}{Ca2}{Mg3AlTi}(Al2Si6O22)O2 |
| ⓘ | Tremolite | 66.1.3a.1 | ☐{Ca2}{Mg5}(Si8O22)(OH)2 |
| Group 71 - PHYLLOSILICATES Sheets of Six-Membered Rings | |||
| Sheets of 6-membered rings with 2:1 layers | |||
| ⓘ | Muscovite | 71.2.2a.1 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 71.2.2b.1 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Talc | 71.2.1.3 | Mg3Si4O10(OH)2 |
| Sheets of 6-membered rings with 2:1 clays | |||
| ⓘ | Montmorillonite | 71.3.1a.2 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Sheets of 6-membered rings interlayered 1:1, 2:1, and octahedra | |||
| ⓘ | Chamosite | 71.4.1.7 | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| ⓘ | Clinochlore | 71.4.1.4 | Mg5Al(AlSi3O10)(OH)8 |
| Group 75 - TECTOSILICATES Si Tetrahedral Frameworks | |||
| Si Tetrahedral Frameworks - SiO2 with [4] coordinated Si | |||
| ⓘ | Quartz | 75.1.3.1 | SiO2 |
| Group 76 - TECTOSILICATES Al-Si Framework | |||
| Al-Si Framework with Al-Si frameworks | |||
| ⓘ | Albite | 76.1.3.1 | Na(AlSi3O8) |
| ⓘ | Microcline | 76.1.1.5 | K(AlSi3O8) |
| ⓘ | Orthoclase | 76.1.1.1 | K(AlSi3O8) |
| ⓘ | Sanidine | 76.1.1.2 | K(AlSi3O8) |
| Al-Si Framework Feldspathoids and related species | |||
| ⓘ | Nepheline | 76.2.1.2 | Na3K(Al4Si4O16) |
| ⓘ | Sodalite | 76.2.3.1 | Na8(Al6Si6O24)Cl2 |
| ⓘ | Tugtupite | 76.2.3.7 | Na4BeAlSi4O12Cl |
| Group 77 - TECTOSILICATES Zeolites | |||
| Zeolite group - True zeolites | |||
| ⓘ | Analcime | 77.1.1.1 | Na(AlSi2O6) · H2O |
| ⓘ | Garronite-Ca | 77.1.3.3 | Na2Ca5Al12Si20O64 · 27H2O |
| ⓘ | Natrolite | 77.1.5.1 | Na2Al2Si3O10 · 2H2O |
| Unclassified Minerals, Mixtures, etc. | |||
| ⓘ | Albite var: Oligoclase | - | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | 'Allanite Group' | - | {A12+REE3+}{M3+2M32+}(Si2O7)(SiO4)O(OH) |
| ⓘ | 'Amphibole Supergroup' | - | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | Anorthite | - | Ca(Al2Si2O8) |
| ⓘ | var: Bytownite | - | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | 'Apatite' | - | |
| ⓘ | 'Biotite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | Corundum var: Sapphire | - | Al2O3 |
| ⓘ | Diopside var: Chromian Diopside | - | Ca(Mg,Cr)Si2O6 |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'var: Hortonolite' | - | from (Fe1.5Mg0.5)2SiO4 to (Mg1.5Fe0.5)2SiO4 |
| ⓘ | Ferro-hornblende | - | ☐{Ca2}{Fe2+4Al}(AlSi7O22)(OH)2 |
| ⓘ | 'Hornblende' | - | |
| ⓘ | Ilmenite var: Picroilmenite | - | (Fe2+,Mg)TiO3 |
| ⓘ | Kaolinite | - | Al2(Si2O5)(OH)4 |
| ⓘ | 'Kelyphite' | - | |
| ⓘ | 'Labradorite' | - | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | 'Limonite' | - | (Fe,O,OH,H2O) |
| ⓘ | Magnesio-hastingsite | - | {Na}{Ca2}{Mg4Fe3+}(Al2Si6O22)(OH)2 |
| ⓘ | Magnetite var: Ishkulite | - | Fe2+(Fe3+,Cr3+)2O4 |
| ⓘ | var: Titaniferous Magnetite | - | Fe2+(Fe3+,Ti)2O4 |
| ⓘ | Meionite | - | Ca4Al6Si6O24CO3 |
| ⓘ | Microcline var: Amazonite | - | K(AlSi3O8) |
| ⓘ | 'Molybdenite-2H' | - | MoS2 |
| ⓘ | 'Monazite' | - | |
| ⓘ | Muscovite var: Sericite | - | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Pyrope var: Chromian Pyrope | - | Mg3(Al,Cr)2(SiO4)3 |
| ⓘ | 'Tourmaline' | - | A(D3)G6(T6O18)(BO3)3X3Z |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Ferro-hornblende | ☐{Ca2}{Fe42+Al}(AlSi7O22)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Tremolite | ☐{Ca2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Amphibole Supergroup | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Cummingtonite | ☐{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Muscovite (var: Sericite) | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Garronite-Ca | Na2Ca5Al12Si20O64 · 27H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Limonite | (Fe,O,OH,H2O) |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Allanite Group | {A12+REE3+}{M23+M32+}(Si2O7)(SiO4)O(OH) |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Epidote | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Magnesio-hastingsite | {Na}{Ca2}{Mg4Fe3+}(Al2Si6O22)(OH)2 |
| H | ⓘ Edenite | {Na}{Ca2}{Mg5}(AlSi7O22)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Be | Beryllium | |
| Be | ⓘ Tugtupite | Na4BeAlSi4O12Cl |
| B | Boron | |
| B | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | A(D3)G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | Oxygen | |
| O | ⓘ Nepheline | Na3K(Al4Si4O16) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Corundum (var: Sapphire) | Al2O3 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Ferro-hornblende | ☐{Ca2}{Fe42+Al}(AlSi7O22)(OH)2 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Albite (var: Oligoclase) | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Perovskite | CaTiO3 |
| O | ⓘ Sodalite | Na8(Al6Si6O24)Cl2 |
| O | ⓘ Tremolite | ☐{Ca2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Amphibole Supergroup | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Sanidine | K(AlSi3O8) |
| O | ⓘ Cummingtonite | ☐{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Magnetite (var: Titaniferous Magnetite) | Fe2+(Fe3+,Ti)2O4 |
| O | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Chondrodite | (Mg,Fe2+)5(SiO4)2(F,OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Enstatite | MgSiO3 |
| O | ⓘ Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| O | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| O | ⓘ Majorite | Mg3(Fe2+,Si,Al)2(SiO4)3 |
| O | ⓘ Knorringite | Mg3Cr2(SiO4)3 |
| O | ⓘ Pyrope (var: Chromian Pyrope) | Mg3(Al,Cr)2(SiO4)3 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Microcline (var: Amazonite) | K(AlSi3O8) |
| O | ⓘ Kaersutite | {Na}{Ca2}{Mg3AlTi}(Al2Si6O22)O2 |
| O | ⓘ Diopside (var: Chromian Diopside) | Ca(Mg,Cr)Si2O6 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Muscovite (var: Sericite) | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Garronite-Ca | Na2Ca5Al12Si20O64 · 27H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Limonite | (Fe,O,OH,H2O) |
| O | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Allanite Group | {A12+REE3+}{M23+M32+}(Si2O7)(SiO4)O(OH) |
| O | ⓘ Anorthite (var: Bytownite) | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Tourmaline | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Ilmenite (var: Picroilmenite) | (Fe2+,Mg)TiO3 |
| O | ⓘ Epidote | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Magnesio-hastingsite | {Na}{Ca2}{Mg4Fe3+}(Al2Si6O22)(OH)2 |
| O | ⓘ Edenite | {Na}{Ca2}{Mg5}(AlSi7O22)(OH)2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Magnetite (var: Ishkulite) | Fe2+(Fe3+,Cr3+)2O4 |
| O | ⓘ Wollastonite | CaSiO3 |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Fayalite-Forsterite Series (var: Hortonolite) | from (Fe1.5Mg0.5)2SiO4 to (Mg1.5Fe0.5)2SiO4 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Tugtupite | Na4BeAlSi4O12Cl |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Ferrosilite | FeSiO3 |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Amphibole Supergroup | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Chondrodite | (Mg,Fe2+)5(SiO4)2(F,OH)2 |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Na | ⓘ Albite (var: Oligoclase) | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Sodalite | Na8(Al6Si6O24)Cl2 |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Na | ⓘ Kaersutite | {Na}{Ca2}{Mg3AlTi}(Al2Si6O22)O2 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Garronite-Ca | Na2Ca5Al12Si20O64 · 27H2O |
| Na | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Anorthite (var: Bytownite) | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Magnesio-hastingsite | {Na}{Ca2}{Mg4Fe3+}(Al2Si6O22)(OH)2 |
| Na | ⓘ Edenite | {Na}{Ca2}{Mg5}(AlSi7O22)(OH)2 |
| Na | ⓘ Tugtupite | Na4BeAlSi4O12Cl |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | Magnesium | |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Tremolite | ☐{Ca2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Cummingtonite | ☐{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Chondrodite | (Mg,Fe2+)5(SiO4)2(F,OH)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Enstatite | MgSiO3 |
| Mg | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Mg | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Mg | ⓘ Majorite | Mg3(Fe2+,Si,Al)2(SiO4)3 |
| Mg | ⓘ Knorringite | Mg3Cr2(SiO4)3 |
| Mg | ⓘ Pyrope (var: Chromian Pyrope) | Mg3(Al,Cr)2(SiO4)3 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Kaersutite | {Na}{Ca2}{Mg3AlTi}(Al2Si6O22)O2 |
| Mg | ⓘ Diopside (var: Chromian Diopside) | Ca(Mg,Cr)Si2O6 |
| Mg | ⓘ Ilmenite (var: Picroilmenite) | (Fe2+,Mg)TiO3 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Magnesio-hastingsite | {Na}{Ca2}{Mg4Fe3+}(Al2Si6O22)(OH)2 |
| Mg | ⓘ Edenite | {Na}{Ca2}{Mg5}(AlSi7O22)(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Fayalite-Forsterite Series (var: Hortonolite) | from (Fe1.5Mg0.5)2SiO4 to (Mg1.5Fe0.5)2SiO4 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | Aluminium | |
| Al | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Corundum (var: Sapphire) | Al2O3 |
| Al | ⓘ Ferro-hornblende | ☐{Ca2}{Fe42+Al}(AlSi7O22)(OH)2 |
| Al | ⓘ Albite (var: Oligoclase) | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Sodalite | Na8(Al6Si6O24)Cl2 |
| Al | ⓘ Amphibole Supergroup | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Sanidine | K(AlSi3O8) |
| Al | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Al | ⓘ Pyrope (var: Chromian Pyrope) | Mg3(Al,Cr)2(SiO4)3 |
| Al | ⓘ Microcline (var: Amazonite) | K(AlSi3O8) |
| Al | ⓘ Kaersutite | {Na}{Ca2}{Mg3AlTi}(Al2Si6O22)O2 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Muscovite (var: Sericite) | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Garronite-Ca | Na2Ca5Al12Si20O64 · 27H2O |
| Al | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Anorthite (var: Bytownite) | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Epidote | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Magnesio-hastingsite | {Na}{Ca2}{Mg4Fe3+}(Al2Si6O22)(OH)2 |
| Al | ⓘ Edenite | {Na}{Ca2}{Mg5}(AlSi7O22)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Tugtupite | Na4BeAlSi4O12Cl |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | Silicon | |
| Si | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Ferro-hornblende | ☐{Ca2}{Fe42+Al}(AlSi7O22)(OH)2 |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Albite (var: Oligoclase) | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Sodalite | Na8(Al6Si6O24)Cl2 |
| Si | ⓘ Tremolite | ☐{Ca2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Amphibole Supergroup | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Sanidine | K(AlSi3O8) |
| Si | ⓘ Cummingtonite | ☐{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Chondrodite | (Mg,Fe2+)5(SiO4)2(F,OH)2 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Enstatite | MgSiO3 |
| Si | ⓘ Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| Si | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Si | ⓘ Majorite | Mg3(Fe2+,Si,Al)2(SiO4)3 |
| Si | ⓘ Knorringite | Mg3Cr2(SiO4)3 |
| Si | ⓘ Pyrope (var: Chromian Pyrope) | Mg3(Al,Cr)2(SiO4)3 |
| Si | ⓘ Microcline (var: Amazonite) | K(AlSi3O8) |
| Si | ⓘ Kaersutite | {Na}{Ca2}{Mg3AlTi}(Al2Si6O22)O2 |
| Si | ⓘ Diopside (var: Chromian Diopside) | Ca(Mg,Cr)Si2O6 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Muscovite (var: Sericite) | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Garronite-Ca | Na2Ca5Al12Si20O64 · 27H2O |
| Si | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Allanite Group | {A12+REE3+}{M23+M32+}(Si2O7)(SiO4)O(OH) |
| Si | ⓘ Anorthite (var: Bytownite) | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Epidote | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Magnesio-hastingsite | {Na}{Ca2}{Mg4Fe3+}(Al2Si6O22)(OH)2 |
| Si | ⓘ Edenite | {Na}{Ca2}{Mg5}(AlSi7O22)(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Wollastonite | CaSiO3 |
| Si | ⓘ Fayalite-Forsterite Series (var: Hortonolite) | from (Fe1.5Mg0.5)2SiO4 to (Mg1.5Fe0.5)2SiO4 |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Tugtupite | Na4BeAlSi4O12Cl |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Ferrosilite | FeSiO3 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| S | Sulfur | |
| S | ⓘ Pyrrhotite | Fe7S8 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| S | ⓘ Molybdenite-2H | MoS2 |
| S | ⓘ Marcasite | FeS2 |
| Cl | Chlorine | |
| Cl | ⓘ Sodalite | Na8(Al6Si6O24)Cl2 |
| Cl | ⓘ Amphibole Supergroup | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Cl | ⓘ Tugtupite | Na4BeAlSi4O12Cl |
| K | Potassium | |
| K | ⓘ Nepheline | Na3K(Al4Si4O16) |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Sanidine | K(AlSi3O8) |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Microcline (var: Amazonite) | K(AlSi3O8) |
| K | ⓘ Muscovite (var: Sericite) | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Ferro-hornblende | ☐{Ca2}{Fe42+Al}(AlSi7O22)(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Albite (var: Oligoclase) | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Perovskite | CaTiO3 |
| Ca | ⓘ Tremolite | ☐{Ca2}{Mg5}(Si8O22)(OH)2 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| Ca | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Ca | ⓘ Kaersutite | {Na}{Ca2}{Mg3AlTi}(Al2Si6O22)O2 |
| Ca | ⓘ Diopside (var: Chromian Diopside) | Ca(Mg,Cr)Si2O6 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Garronite-Ca | Na2Ca5Al12Si20O64 · 27H2O |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Anorthite (var: Bytownite) | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Epidote | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Ca | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Magnesio-hastingsite | {Na}{Ca2}{Mg4Fe3+}(Al2Si6O22)(OH)2 |
| Ca | ⓘ Edenite | {Na}{Ca2}{Mg5}(AlSi7O22)(OH)2 |
| Ca | ⓘ Wollastonite | CaSiO3 |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ti | Titanium | |
| Ti | ⓘ Perovskite | CaTiO3 |
| Ti | ⓘ Amphibole Supergroup | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Magnetite (var: Titaniferous Magnetite) | Fe2+(Fe3+,Ti)2O4 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Kaersutite | {Na}{Ca2}{Mg3AlTi}(Al2Si6O22)O2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Ilmenite (var: Picroilmenite) | (Fe2+,Mg)TiO3 |
| Cr | Chromium | |
| Cr | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Knorringite | Mg3Cr2(SiO4)3 |
| Cr | ⓘ Pyrope (var: Chromian Pyrope) | Mg3(Al,Cr)2(SiO4)3 |
| Cr | ⓘ Diopside (var: Chromian Diopside) | Ca(Mg,Cr)Si2O6 |
| Cr | ⓘ Magnetite (var: Ishkulite) | Fe2+(Fe3+,Cr3+)2O4 |
| Fe | Iron | |
| Fe | ⓘ Ferro-hornblende | ☐{Ca2}{Fe42+Al}(AlSi7O22)(OH)2 |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrrhotite | Fe7S8 |
| Fe | ⓘ Magnetite (var: Titaniferous Magnetite) | Fe2+(Fe3+,Ti)2O4 |
| Fe | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Limonite | (Fe,O,OH,H2O) |
| Fe | ⓘ Schorl | Na(Fe32+)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Ilmenite (var: Picroilmenite) | (Fe2+,Mg)TiO3 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Epidote | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Fe | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Magnesio-hastingsite | {Na}{Ca2}{Mg4Fe3+}(Al2Si6O22)(OH)2 |
| Fe | ⓘ Magnetite (var: Ishkulite) | Fe2+(Fe3+,Cr3+)2O4 |
| Fe | ⓘ Fayalite-Forsterite Series (var: Hortonolite) | from (Fe1.5Mg0.5)2SiO4 to (Mg1.5Fe0.5)2SiO4 |
| Fe | ⓘ Ferrosilite | FeSiO3 |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite-2H | MoS2 |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
References
Sort by
Year (asc) Year (desc) Author (A-Z) Author (Z-A)Hudon, P., Friedman, R.M., Gauthier, G. & Martignole, J. (2006) Age of the Cabonga nepheline syenite, Grenville Province, western Quebec. Canadian Journal of Earth Sciences, vol. 43(9), 1237-1249.
Olivier Langelier Collection (All minerals analyzed by EDS/EMPA performed by ACT Labs, Saskatchewan Research Council, R.L.Barnett and Kerry Day)
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Cabonga Reservoir, Réservoir-Dozois, La Vallée-de-l'Or RCM, Abitibi-Témiscamingue, Québec, Canada