Madonna valley, Premolo, Bergamo Province, Lombardy, Italyi
| Regional Level Types | |
|---|---|
| Madonna valley | Valley |
| Premolo | Commune |
| Bergamo Province | Province |
| Lombardy | Region |
| Italy | - not defined - |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
45° North , 9° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~5km
Type:
KΓΆppen climate type:
Mindat Locality ID:
210041
Long-form identifier:
mindat:1:2:210041:1
GUID (UUID V4):
e072ec80-4399-496e-bd8f-f572b7f5e16a
Name(s) in local language(s):
Valle della Madonna, Premolo, Seriana Valley, Bergamo Province, Lombardy, Italy
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| β Albite Formula: Na(AlSi3O8) References: |
| β 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) References: |
| β Dessauite-(Y) Formula: (Sr,Pb)(Y,U)(Ti,Fe3+)20O38 References: |
| β Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) References: |
| β Goethite Formula: Ξ±-Fe3+O(OH) References: |
| β Graphite Formula: C References: |
| β Hematite Formula: Fe2O3 References: |
| β Ilmenite Formula: Fe2+TiO3 References: |
| β 'Limonite' References: |
| β Pyrite Formula: FeS2 References: |
| β Quartz Formula: SiO2 References: |
| β Schorl ? Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| β Titanite Formula: CaTi(SiO4)O References: |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Goethite | 4.00. | Ξ±-Fe3+O(OH) |
| β | Hematite | 4.CB.05 | Fe2O3 |
| β | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| β | Dessauite-(Y) | 4.CC.40 | (Sr,Pb)(Y,U)(Ti,Fe3+)20O38 |
| β | Quartz | 4.DA.05 | SiO2 |
| Group 9 - Silicates | |||
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β | Schorl ? | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| β | 'Limonite' | - | |
| β | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | β Goethite | Ξ±-Fe3+O(OH) |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Graphite | C |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | β Goethite | Ξ±-Fe3+O(OH) |
| O | β Hematite | Fe2O3 |
| O | β Ilmenite | Fe2+TiO3 |
| O | β Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Titanite | CaTi(SiO4)O |
| O | β Dessauite-(Y) | (Sr,Pb)(Y,U)(Ti,Fe3+)20O38 |
| O | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| S | Sulfur | |
| S | β Pyrite | FeS2 |
| Ca | Calcium | |
| Ca | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | β Titanite | CaTi(SiO4)O |
| Ti | Titanium | |
| Ti | β Ilmenite | Fe2+TiO3 |
| Ti | β Titanite | CaTi(SiO4)O |
| Ti | β Dessauite-(Y) | (Sr,Pb)(Y,U)(Ti,Fe3+)20O38 |
| Fe | Iron | |
| Fe | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | β Goethite | Ξ±-Fe3+O(OH) |
| Fe | β Hematite | Fe2O3 |
| Fe | β Ilmenite | Fe2+TiO3 |
| Fe | β Pyrite | FeS2 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Dessauite-(Y) | (Sr,Pb)(Y,U)(Ti,Fe3+)20O38 |
| Sr | Strontium | |
| Sr | β Dessauite-(Y) | (Sr,Pb)(Y,U)(Ti,Fe3+)20O38 |
| Y | Yttrium | |
| Y | β Dessauite-(Y) | (Sr,Pb)(Y,U)(Ti,Fe3+)20O38 |
| Pb | Lead | |
| Pb | β Dessauite-(Y) | (Sr,Pb)(Y,U)(Ti,Fe3+)20O38 |
| U | Uranium | |
| U | β Dessauite-(Y) | (Sr,Pb)(Y,U)(Ti,Fe3+)20O38 |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
EuropeContinent
- The AlpsMountain Range
Italy
- Lombardy
- Bergamo Province
- Seriana ValleyValley
- Bergamo Province
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
