Upper Val Saviore, Brescia Province, Lombardy, Italyi
| Regional Level Types | |
|---|---|
| Upper Val Saviore | Valley |
| Brescia Province | Province |
| Lombardy | Region |
| Italy | - not defined - |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Valle | 555 (2016) |
Mindat Locality ID:
276001
Long-form identifier:
mindat:1:2:276001:1
GUID (UUID V4):
525d7b56-094c-4103-9495-2943d16610ed
Other Languages:
Italian:
Alta Val Saviore, Brescia, Lombardia, Italia
Valle di Saviore or Val Saviore is a valley in eastern Lombardy, a lateral tributary of Val Camonica and therefore belonging, from an administrative point of view, to the Province of Brescia.
The valley, crossed by the Poia stream, is of a pure alpine style. Its entrance is located about 400 m near the center of Cedegolo, in the middle Valle Camonica, while the head is at the AdamΓ© Pass (3128 m) which leads into the great Pian di Neve glacier, one of the major peaks of the Gruppo dell 'Adamello. The upper trunk of the valley, beyond the sharp rocky step overlooking the town of Valle (1114 m), takes the name of Valle AdamΓ©.
Among the side valleys that flow into the Saviore Valley, the largest is the Brata Valley (which becomes, higher up, Val Salarno), characterized by the presence of two artificial reservoirs (exploited for the production of electricity), Lake Salarno (2058 m) and Lake Dossaccio (2069 m). The valley ends at the Salarno Pass (3168 m).
The valley, entirely included within the Adamello Regional Park, is administratively divided into two municipalities: Cevo and Saviore dell'Adamello. The two municipal capitals are located halfway up, on the northern side of the valley (which enjoys abundant sun exposure even in the winter months), at an altitude of 1070 meters and 1226 meters respectively.
The hamlets of Cevo (Andrista, part of Fresine and part of Isola), and Saviore dell'Adamello (Ponte and Valle) are located closer to the valley floor, and are, with the exception of Valle, almost completely depopulated.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities29 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| β Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| β Albite Formula: Na(AlSi3O8) Colour: White |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: Colour: White-gray to pink to emerald-green Description: Crystals to 2 cm diameter. |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β Bismutocolumbite Formula: Bi(Nb,Ta)O4 |
| β Bismutotantalite Formula: Bi(Ta,Nb)O4 |
| β Calcite Formula: CaCO3 Localities: Description: Three generations of growth. References: |
| β Celadonite Formula: K(MgFe3+◻)(Si4O10)(OH)2 |
| β 'Chabazite' Localities: |
| β Chabazite-Na Formula: (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| β Columbite-(Mn) Formula: Mn2+Nb2O6 |
| β Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) Colour: Green, yellow, amber, brownish-pink, azure-blue, purple Description: Polychrome crystals to 10 cm long. |
| β Fluorapatite Formula: Ca5(PO4)3F |
| β Fluor-elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| β Fluorite Formula: CaF2 Colour: Green & purple |
| β Fluor-liddicoatite Formula: Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| β Foitite Formula: ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β 'Gismondine Subgroup' |
| β 'Indicolite' Formula: A(D3)G6(T6O18)(BO3)3X3Z |
| β 'K Feldspar' |
| β 'Lepidolite' |
| β 'Liddicoatite' Formula: Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Mesolite Formula: Na2Ca2Si9Al6O30 · 8H2O |
| β Microcline Formula: K(AlSi3O8) |
| β 'Microlite Group' Formula: A2-mTa2X6-wZ-n |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: References: |
| β Offretite Formula: KCaMg(Si13Al5)O36 · 15H2O Localities: |
| β Orthoclase Formula: K(AlSi3O8) |
| β 'Phillipsite Subgroup' |
| β 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| β Pyrite Formula: FeS2 |
| β 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z |
| β 'Pyrochlore Group var. Stibiopyrochlore (of Pezzotta et al.)' Formula: A2Nb2(O,OH)6Z Description: A purported new species and new member of the pyrochlore group. Occurs as exsolution structures in romeite crystals. |
| β 'Pyrochlore Supergroup' Formula: A2-mD2X6-wZ1-n |
| β 'Pyrochlore Supergroup var. Betafite (of Hogarth 1977)' Formula: (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| β 'Pyrochlore Supergroup var. Stibiobetafite (of ΔernΓ½ et al.)' Formula: A2-mD2X6-wZ1-n |
| β Quartz Formula: SiO2 Localities: |
| β Quartz var. Amethyst Formula: SiO2 |
| β Quartz var. Smoky Quartz Formula: SiO2 |
| β 'RomΓ©ite Group' Formula: A2(Sb5+)2O6Z Description: Relatively abundant in small octahedral crystals to 1 mm diameter on the faces of crystals of many other minerals. |
| β Rossmanite Formula: ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Saponite Formula: Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: |
| β Spessartine Formula: Mn2+3Al2(SiO4)3 |
| β Stibiocolumbite Formula: Sb(Nb,Ta)O4 |
| β 'Stibiomicrolite (of Groat et al.)' |
| β Stibiotantalite Formula: Sb(Ta,Nb)O4 |
| β 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| β 'Tourmaline var. Verdelite' Formula: A(D3)G6(T6O18)(BO3)3X3Z |
| β Uraninite Formula: UO2 |
| β Zircon Formula: Zr(SiO4) Localities: References: |
| β Zircon var. Hafnian Zircon Formula: (Zr,Hf)SiO4 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | 'Pyrochlore Group var. Stibiopyrochlore (of Pezzotta et al.)' | 4.00. | A2Nb2(O,OH)6Z |
| β | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ-n |
| β | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
| β | Quartz | 4.DA.05 | SiO2 |
| β | var. Amethyst | 4.DA.05 | SiO2 |
| β | var. Smoky Quartz | 4.DA.05 | SiO2 |
| β | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| β | Bismutocolumbite | 4.DE.30 | Bi(Nb,Ta)O4 |
| β | Stibiotantalite | 4.DE.30 | Sb(Ta,Nb)O4 |
| β | Bismutotantalite | 4.DE.30 | Bi(Ta,Nb)O4 |
| β | Stibiocolumbite | 4.DE.30 | Sb(Nb,Ta)O4 |
| β | 'RomΓ©ite Group' | 4.DH. | A2(Sb5+)2O6Z |
| β | 'Stibiomicrolite (of Groat et al.)' | 4.DH.15 | |
| β | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Calcite | 5.AB.05 | CaCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| β | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| β | var. Hafnian Zircon | 9.AD.30 | (Zr,Hf)SiO4 |
| β | Fluor-elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| β | Rossmanite | 9.CK.05 | β»(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Fluor-liddicoatite | 9.CK.05 | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| β | Foitite | 9.CK.05 | β»(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | 'Liddicoatite' | 9.CK.05 | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Actinolite | 9.DE.10 | β»Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| β | Celadonite | 9.EC.15 | K(MgFe3+β»)(Si4O10)(OH)2 |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Saponite | 9.EC.45 | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 Β· nH2O |
| β | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | Mesolite | 9.GA.05 | Na2Ca2Si9Al6O30 Β· 8H2O |
| β | Chabazite-Na | 9.GD.10 | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 Β· 12H2O |
| β | Offretite | 9.GD.25 | KCaMg(Si13Al5)O36 Β· 15H2O |
| Unclassified | |||
| β | 'Gismondine Subgroup' | - | |
| β | 'Pyrochlore Supergroup var. Betafite (of Hogarth 1977)' | - | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| β | 'Pyrochlore Supergroup' | - | A2-mD2X6-wZ1-n |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Chabazite' | - | |
| β | 'K Feldspar' | - | |
| β | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| β | 'Lepidolite' | - | |
| β | 'Tourmaline var. Verdelite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| β | '' | - | AD3G6 (T6O18)(BO3)3X3Z |
| β | 'Indicolite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| β | 'Pyrochlore Supergroup var. Stibiobetafite (of ΔernΓ½ et al.)' | - | A2-mD2X6-wZ1-n |
| β | 'Phillipsite Subgroup' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | β Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| H | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| H | β Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | β Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Chabazite-Na | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| H | β Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Pyrochlore Group var. Stibiopyrochlore (of Pezzotta et al.) | A2Nb2(O,OH)6Z |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | β Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| H | β Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Li | Lithium | |
| Li | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | β Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | β Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | β Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Li | β Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| B | Boron | |
| B | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Indicolite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | β Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | β Tourmaline var. Verdelite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | β Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| B | β Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| C | Carbon | |
| C | β Calcite | CaCO3 |
| O | Oxygen | |
| O | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | β Albite | Na(AlSi3O8) |
| O | β Quartz var. Amethyst | SiO2 |
| O | β Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| O | β Bismutotantalite | Bi(Ta,Nb)O4 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Bismutocolumbite | Bi(Nb,Ta)O4 |
| O | β Calcite | CaCO3 |
| O | β Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| O | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Indicolite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | β Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Columbite-(Mn) | Mn2+Nb2O6 |
| O | β Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| O | β Microcline | K(AlSi3O8) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | β Quartz | SiO2 |
| O | β RomΓ©ite Group | A2(Sb5+)2O6Z |
| O | β Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β Spessartine | Mn32+Al2(SiO4)3 |
| O | β Stibiotantalite | Sb(Ta,Nb)O4 |
| O | β Stibiocolumbite | Sb(Nb,Ta)O4 |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Uraninite | UO2 |
| O | β Tourmaline var. Verdelite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | β Zircon | Zr(SiO4) |
| O | β Chabazite-Na | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| O | β Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | β Zircon var. Hafnian Zircon | (Zr,Hf)SiO4 |
| O | β Pyrochlore Group var. Stibiopyrochlore (of Pezzotta et al.) | A2Nb2(O,OH)6Z |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | β Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| O | β Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| F | Fluorine | |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β Fluorapatite | Ca5(PO4)3F |
| F | β Fluorite | CaF2 |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | β Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| F | β Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Na | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Chabazite-Na | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| Na | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | β Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Mg | Magnesium | |
| Mg | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | β Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Mg | β Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| Mg | β Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Mg | β Chabazite-Na | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Spessartine | Mn32+Al2(SiO4)3 |
| Al | β Chabazite-Na | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| Al | β Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | β Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Al | β Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Si | Silicon | |
| Si | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Quartz var. Amethyst | SiO2 |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Si | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Quartz | SiO2 |
| Si | β Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β Spessartine | Mn32+Al2(SiO4)3 |
| Si | β Zircon | Zr(SiO4) |
| Si | β Chabazite-Na | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| Si | β Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | β Zircon var. Hafnian Zircon | (Zr,Hf)SiO4 |
| Si | β Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Si | β Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| P | Phosphorus | |
| P | β Fluorapatite | Ca5(PO4)3F |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | β Pyrite | FeS2 |
| Cl | Chlorine | |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| K | β Orthoclase | K(AlSi3O8) |
| K | β Chabazite-Na | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| Ca | Calcium | |
| Ca | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | β Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Ca | β Calcite | CaCO3 |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Fluorite | CaF2 |
| Ca | β Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Ca | β Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Ca | β Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| Ca | β Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Ca | β Chabazite-Na | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| Ca | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | β Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Ti | Titanium | |
| Ti | β Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mn | Manganese | |
| Mn | β Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | β Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Fe | β Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Pyrite | FeS2 |
| Fe | β Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Sr | Strontium | |
| Sr | β Chabazite-Na | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Zr | β Zircon var. Hafnian Zircon | (Zr,Hf)SiO4 |
| Nb | Niobium | |
| Nb | β Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Nb | β Bismutotantalite | Bi(Ta,Nb)O4 |
| Nb | β Bismutocolumbite | Bi(Nb,Ta)O4 |
| Nb | β Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | β Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | β Stibiotantalite | Sb(Ta,Nb)O4 |
| Nb | β Stibiocolumbite | Sb(Nb,Ta)O4 |
| Nb | β Pyrochlore Group var. Stibiopyrochlore (of Pezzotta et al.) | A2Nb2(O,OH)6Z |
| Sb | Antimony | |
| Sb | β RomΓ©ite Group | A2(Sb5+)2O6Z |
| Sb | β Stibiotantalite | Sb(Ta,Nb)O4 |
| Sb | β Stibiocolumbite | Sb(Nb,Ta)O4 |
| Hf | Hafnium | |
| Hf | β Zircon var. Hafnian Zircon | (Zr,Hf)SiO4 |
| Ta | Tantalum | |
| Ta | β Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Ta | β Bismutotantalite | Bi(Ta,Nb)O4 |
| Ta | β Bismutocolumbite | Bi(Nb,Ta)O4 |
| Ta | β Microlite Group | A2-mTa2X6-wZ-n |
| Ta | β Stibiotantalite | Sb(Ta,Nb)O4 |
| Ta | β Stibiocolumbite | Sb(Nb,Ta)O4 |
| Bi | Bismuth | |
| Bi | β Bismutotantalite | Bi(Ta,Nb)O4 |
| Bi | β Bismutocolumbite | Bi(Nb,Ta)O4 |
| U | Uranium | |
| U | β Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| U | β Uraninite | UO2 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://it.wikipedia.org/wiki/Valle_di_Saviore |
|---|---|
| Wikidata ID: | Q4008193 |
Localities in this Region
- Lombardy
- Brescia Province
- Cevo
- Upper Val Saviore
- Brescia Province
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
Europe
- The AlpsMountain Range
Italy
- Adamello MassifMassif
- Lombardy
- Brescia Province
- Adamello Regional ParkPark
- Camonica ValleyValley
- Brescia Province
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Pegmatite occurrences, Forcel Rosso Gully, Mt. Foppa, Upper Val Saviore, Brescia Province, Lombardy, Italy