Flinders municipality, Tasmania, Australiai
| Regional Level Types | |
|---|---|
| Flinders municipality | Municipality |
| Tasmania | State |
| Australia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Locality type:
Largest Settlements:
| Place | Population |
|---|---|
| Whitemark | 600 (2017) |
| Lady Barron | 261 (2014) |
Flinders Council is a local government area of Tasmania. It covers more than 60 islands off the north-eastern tip of Tasmania at the eastern end of Bass Strait. Of these 60, 12 have permanent populations. The bigger ones are Clarke Island, Cape Barren Island, and the largest and most populous, Flinders Island. The Flinders municipality includes the Furneaux Group together with the groups of islands to the north west: Kent Group, Hogan Island Group, Curtis Group, and some Wilsons Promontory Islands (only Tasmanian part).
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities12 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| β | Cassiterite | 4.DB.05 | SnO2 |
| β | Quartz | 4.DA.05 | SiO2 |
| β | var. Smoky Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Aragonite | 5.AB.15 | CaCO3 |
| β | Calcite | 5.AB.05 | CaCO3 |
| β | Siderite | 5.AB.05 | FeCO3 |
| Group 9 - Silicates | |||
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | Analcime | 9.GB.05 | Na(AlSi2O6) Β· H2O |
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| β | var. Killiecrankie Diamond | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| Unclassified Minerals, Rocks, etc. | |||
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| β | 'Garnet Group' | - | X3Z2(SiO4)3 |
| β | 'K Feldspar' | - | KAlSi3O8 |
| β | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Topaz | Al2(SiO4)(F,OH)2 |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| H | β Analcime | Na(AlSi2O6) · H2O |
| H | β Topaz var. Killiecrankie Diamond | Al2(SiO4)(F,OH)2 |
| Be | Beryllium | |
| Be | β Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | β Calcite | CaCO3 |
| C | β Aragonite | CaCO3 |
| C | β Siderite | FeCO3 |
| O | Oxygen | |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Quartz | SiO2 |
| O | β Albite | Na(AlSi3O8) |
| O | β Cassiterite | SnO2 |
| O | β Topaz | Al2(SiO4)(F,OH)2 |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Calcite | CaCO3 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Analcime | Na(AlSi2O6) · H2O |
| O | β Aragonite | CaCO3 |
| O | β Siderite | FeCO3 |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β Zircon | Zr(SiO4) |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Topaz var. Killiecrankie Diamond | Al2(SiO4)(F,OH)2 |
| O | β K Feldspar | KAlSi3O8 |
| O | β Garnet Group | X3Z2(SiO4)3 |
| O | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| F | Fluorine | |
| F | β Topaz | Al2(SiO4)(F,OH)2 |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| F | β Topaz var. Killiecrankie Diamond | Al2(SiO4)(F,OH)2 |
| Na | Sodium | |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Analcime | Na(AlSi2O6) · H2O |
| Na | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Al | Aluminium | |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Topaz | Al2(SiO4)(F,OH)2 |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Analcime | Na(AlSi2O6) · H2O |
| Al | β Topaz var. Killiecrankie Diamond | Al2(SiO4)(F,OH)2 |
| Al | β K Feldspar | KAlSi3O8 |
| Al | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Quartz | SiO2 |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Topaz | Al2(SiO4)(F,OH)2 |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Analcime | Na(AlSi2O6) · H2O |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β Zircon | Zr(SiO4) |
| Si | β Topaz var. Killiecrankie Diamond | Al2(SiO4)(F,OH)2 |
| Si | β K Feldspar | KAlSi3O8 |
| Si | β Garnet Group | X3Z2(SiO4)3 |
| Si | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| K | Potassium | |
| K | β Orthoclase | K(AlSi3O8) |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| K | β K Feldspar | KAlSi3O8 |
| Ca | Calcium | |
| Ca | β Calcite | CaCO3 |
| Ca | β Aragonite | CaCO3 |
| Ca | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ti | Titanium | |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Fe | Iron | |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Fe | β Siderite | FeCO3 |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Sn | Tin | |
| Sn | β Cassiterite | SnO2 |
Fossils
There are 6 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 33 | |||||||||
|---|---|---|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 0.78 Ma (Pleistocene) | |||||||||
| Oldest Fossil Listed | 5.33 Ma (Miocene) | |||||||||
| Stratigraphic Units |
| |||||||||
| Fossils from Region | Click here to show the list. | |||||||||
| Fossil Localities | Click to show 6 fossil localities |
Other Databases
| GeoNames ID: | 7839668 |
|---|
Localities in this Region
- Tasmania
- Flinders Municipality
- Furneaux Group
- Flinders Municipality
Other Regions, Features and Areas that Intersect
Australia
- Lachlan OrogenOrogen
- Melbourne-Mathinna ZoneZone (Tectonic)
- Tasmania
- Bass StraitStrait
Australian PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Killiecrankie, Flinders Island, Furneaux Group, Flinders municipality, Tasmania, Australia