Strömsund, Jämtland County, Swedeni
| Regional Level Types | |
|---|---|
| Strömsund | Municipality |
| Jämtland County | County |
| Sweden | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Locality type:
Other Languages:
French:
Strömsund, Comté de Jämtland, Suède
German:
Strömsund, Jämtlands län, Schweden
Italian:
Strömsund, Contea di Jämtland, Svezia
Russian:
Стрёмсунд, Емтланд, Швеция
Simplified Chinese:
斯特伦松德市, 耶姆特兰省, 瑞典
Spanish:
Strömsund, Provincia de Jämtland, Suecia
Swedish:
Strömsunds kommun, Jämtlands län, Sverige
Asturian:
Strömsunds, Provincia de Jämtland, Suecia
Basque:
Strömsund udalerria, Jämtlandeko konderria, Suedia
Belarusian:
Стрэмсунд, Емтланд, Швецыя
Bulgarian:
Стрьомсунд, Йемтланд, Швеция
Cebuano:
Strömsunds Kommun, Jämtlands län, Suwesya
Czech:
Strömsund, Švédsko
Danish:
Strömsunds kommun, Jämtlands län, Sverige
Dutch:
Strömsund, Jämtlands län, Zweden
Estonian:
Strömsundi vald, Jämtlandi lään, Rootsi
Faroese:
Strömsunds kommuna, Jämtlands län, Svøríki
Farsi/Persian:
بخش استرومسوند, شهرستان یمتلاند, سوئد
Finnish:
Strömsundin kunta, Jämtlandin lääni, Ruotsi
Korean:
스트룀순드 시, 옘틀란드주, 스웨덴
Limburgian:
Strömsund, Jämtlands län, Zwede
Low Saxon/Low German:
Kommun Strömsund, Lehn Jämtland, Sweden
Minnan / Hokkien-Taiwanese:
Strömsund Chū-tī-chhī, Jämtland Kōan, Sūi-tián
Northern Sami:
Strömsunda gielda, Jämtlándda leatna, Ruoŧŧa
Norwegian:
Strömsund, Jämtlands län, Sverige
Norwegian (Nynorsk):
Strömsunds kommun, Jämtlands län, Sverige
Polish:
Gmina Strömsund, Jämtland, Szwecja
Portuguese:
Strömsund, Jämtland, Suécia
Romanian:
Comuna Strömsund, Jämtlands län, Suedia
Traditional Chinese:
斯特倫松德市, 耶姆特蘭省, 瑞典
Ukrainian:
Стремсунд, Ємтланд, Швеція
Vietnamese:
Strömsund, Jämtland, Thụy Điển
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities41 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Reference: Majka, J., Janák, M., Andersson, B., Klonowska, I., Gee, D.G., Rosén, Å., & Kośminska, K. (2014): Pressure-temperature estimates on the Tjeliken eclogite: new insights into the (ultra)-high pressure evolution of the Seve Nappe Complex in the Scandinavian Caledonides; in: F. Corfu, D. Gasser & D.M. Chew (Eds.) New Perspectives on the Caledonides of Scandinavia and Related Areas (pp. 369–384). Geological Society, London, Special Publications: 390. DOI: 10.1144/SP390.14 |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Anthophyllite Formula: ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Reference: http://www.geonord.org/gruvor/hoting/hoting.html |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 Reference: Majka, J., Janák, M., Andersson, B., Klonowska, I., Gee, D.G., Rosén, Å., & Kośminska, K. (2014): Pressure-temperature estimates on the Tjeliken eclogite: new insights into the (ultra)-high pressure evolution of the Seve Nappe Complex in the Scandinavian Caledonides; in: F. Corfu, D. Gasser & D.M. Chew (Eds.) New Perspectives on the Caledonides of Scandinavia and Related Areas (pp. 369–384). Geological Society, London, Special Publications: 390. DOI: 10.1144/SP390.14 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Chromium-bearing Clinochlore Formula: Mg5(Al,Cr)2Si3O10(OH)8 |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Reference: Romer, Smeds -Implications of U-Th ages of columbite-tantalites from granitic pegmatites for the Paleoproterozoic accretion fo 1.90-1.85 Ga magmatic arcs to the Baltic Shield, Precambrian Research 67 p 141-58 |
| ⓘ Diamond Formula: C Localities: Reference: Bukała, M.; Majka, J.; Walczak, K.; Włodek, A.; Schmitt, M.; Zagórska, A. (2020) U-Pb Zircon Dating of Migmatitic Paragneisses and Garnet Amphibolite from the High Pressure Seve Nappe Complex in Kittalfjäll, Swedish Caledonides. Minerals 10, 295. |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Fayalite Formula: Fe2+2SiO4 |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ 'Feldspar Group' Reference: http://www.geonord.org/gruvor/hoting/hoting.html |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorapatite var. Carbonate-rich Fluorapatite Formula: Ca5(PO4,CO3)3(F,O) |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ 'Glauconite' Formula: (K,Na)(Fe3+,Al,Mg)2(Si,Al)4O10(OH)2 |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ 'Hornblende' |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Katophorite Formula: {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 Reference: Majka, J., Janák, M., Andersson, B., Klonowska, I., Gee, D.G., Rosén, Å., & Kośminska, K. (2014): Pressure-temperature estimates on the Tjeliken eclogite: new insights into the (ultra)-high pressure evolution of the Seve Nappe Complex in the Scandinavian Caledonides; in: F. Corfu, D. Gasser & D.M. Chew (Eds.) New Perspectives on the Caledonides of Scandinavia and Related Areas (pp. 369–384). Geological Society, London, Special Publications: 390. DOI: 10.1144/SP390.14 |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnesite var. Iron-bearing Magnesite Formula: (Mg,Fe)CO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Magnetite var. Titanium-bearing Magnetite Formula: Fe2+(Fe3+,Ti)2O4 |
| ⓘ 'Mica Group' Localities: Reported from at least 6 localities in this region. Reference: http://www.geonord.org/gruvor/hoting/hoting.html |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Reference: Majka, J., Janák, M., Andersson, B., Klonowska, I., Gee, D.G., Rosén, Å., & Kośminska, K. (2014): Pressure-temperature estimates on the Tjeliken eclogite: new insights into the (ultra)-high pressure evolution of the Seve Nappe Complex in the Scandinavian Caledonides; in: F. Corfu, D. Gasser & D.M. Chew (Eds.) New Perspectives on the Caledonides of Scandinavia and Related Areas (pp. 369–384). Geological Society, London, Special Publications: 390. DOI: 10.1144/SP390.14 |
| ⓘ Muscovite var. Phengite Formula: KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 Reference: Majka, J., Janák, M., Andersson, B., Klonowska, I., Gee, D.G., Rosén, Å., & Kośminska, K. (2014): Pressure-temperature estimates on the Tjeliken eclogite: new insights into the (ultra)-high pressure evolution of the Seve Nappe Complex in the Scandinavian Caledonides; in: F. Corfu, D. Gasser & D.M. Chew (Eds.) New Perspectives on the Caledonides of Scandinavia and Related Areas (pp. 369–384). Geological Society, London, Special Publications: 390. DOI: 10.1144/SP390.14 |
| ⓘ Omphacite Formula: (NaaCabFe2+cMgd)(AleFe3+fFe2+gMgh)Si2O6 Reference: Majka, J., Janák, M., Andersson, B., Klonowska, I., Gee, D.G., Rosén, Å., & Kośminska, K. (2014): Pressure-temperature estimates on the Tjeliken eclogite: new insights into the (ultra)-high pressure evolution of the Seve Nappe Complex in the Scandinavian Caledonides; in: F. Corfu, D. Gasser & D.M. Chew (Eds.) New Perspectives on the Caledonides of Scandinavia and Related Areas (pp. 369–384). Geological Society, London, Special Publications: 390. DOI: 10.1144/SP390.14 |
| ⓘ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 Reference: Majka, J., Janák, M., Andersson, B., Klonowska, I., Gee, D.G., Rosén, Å., & Kośminska, K. (2014): Pressure-temperature estimates on the Tjeliken eclogite: new insights into the (ultra)-high pressure evolution of the Seve Nappe Complex in the Scandinavian Caledonides; in: F. Corfu, D. Gasser & D.M. Chew (Eds.) New Perspectives on the Caledonides of Scandinavia and Related Areas (pp. 369–384). Geological Society, London, Special Publications: 390. DOI: 10.1144/SP390.14 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Reference: Majka, J., Janák, M., Andersson, B., Klonowska, I., Gee, D.G., Rosén, Å., & Kośminska, K. (2014): Pressure-temperature estimates on the Tjeliken eclogite: new insights into the (ultra)-high pressure evolution of the Seve Nappe Complex in the Scandinavian Caledonides; in: F. Corfu, D. Gasser & D.M. Chew (Eds.) New Perspectives on the Caledonides of Scandinavia and Related Areas (pp. 369–384). Geological Society, London, Special Publications: 390. DOI: 10.1144/SP390.14 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reference: http://www.geonord.org/gruvor/hoting/hoting.html |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 Reference: http://www.geonord.org/gruvor/hoting/hoting.html |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Saponite Formula: Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Reference: Natural History Museum, Stockholm collection # 19410081 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ 'Soapstone' Reference: Länsstyrelsen i Jämtlands län, 2010. Sten-, mineral- och lerindustri i Jämtlands lön. Kulturmiljöer i Jämtlands län. (2010:3) |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Spinel Formula: MgAl2O4 Reference: Bukała, M.; Majka, J.; Walczak, K.; Włodek, A.; Schmitt, M.; Zagórska, A. (2020) U-Pb Zircon Dating of Migmatitic Paragneisses and Garnet Amphibolite from the High Pressure Seve Nappe Complex in Kittalfjäll, Swedish Caledonides. Minerals 10, 295. |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ 'Tantalite' Formula: (Mn,Fe)(Ta,Nb)2O6 Reference: Wilke, H.-J. (1997): Die Mineralien und Fundstellen von Schweden. Chr. Weise Verlag, München, p.146 |
| ⓘ Taramite Formula: {Na}{CaNa}{Mg3Al2}(Al2Si6O22)(OH)2 Reference: Majka, J., Janák, M., Andersson, B., Klonowska, I., Gee, D. G., Rosén, Å., & Kośmińska, K. (2014). Pressure–temperature estimates on the Tjeliken eclogite: new insights into the (ultra)-high-pressure evolution of the Seve Nappe Complex in the Scandinavian Caledonides. Geological Society, London, Special Publications, 390(1), 369-384.
|
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Reference: http://www.geonord.org/gruvor/hoting/hoting.html |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ Zircon Formula: Zr(SiO4) Description: According to the article, as um-sized inclusions. Reference: Majka, J., Janák, M., Andersson, B., Klonowska, I., Gee, D.G., Rosén, Å., & Kośminska, K. (2014): Pressure-temperature estimates on the Tjeliken eclogite: new insights into the (ultra)-high pressure evolution of the Seve Nappe Complex in the Scandinavian Caledonides; in: F. Corfu, D. Gasser & D.M. Chew (Eds.) New Perspectives on the Caledonides of Scandinavia and Related Areas (pp. 369–384). Geological Society, London, Special Publications: 390. DOI: 10.1144/SP390.14 |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Diamond | 1.CB.10a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | var. Titanium-bearing Magnetite | 4.BB.05 | Fe2+(Fe3+,Ti)2O4 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | var. Iron-bearing Magnesite | 5.AB.05 | (Mg,Fe)CO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | var. Carbonate-rich Fluorapatite | 8.BN.05 | Ca5(PO4,CO3)3(F,O) |
| Group 9 - Silicates | |||
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Anthophyllite | 9.DD.05 | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Chromium-bearing Clinochlore | 9.EC.55 | Mg5(Al,Cr)2Si3O10(OH)8 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Fayalite | 9.AC.05 | Fe2+2SiO4 |
| ⓘ | 'Glauconite' | 9.EC. | (K,Na)(Fe3+,Al,Mg)2(Si,Al)4O10(OH)2 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Katophorite | 9.DE.20 | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Phengite | 9.EC.15 | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ | Omphacite | 9.DA.20 | (NaaCabFe2+cMgd)(AleFe3+fFe2+gMgh)Si2O6 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Saponite | 9.EC.45 | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Taramite | 9.DE.20 | {Na}{CaNa}{Mg3Al2}(Al2Si6O22)(OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Unclassified Minerals, Rocks, etc. | |||
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Hornblende' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Soapstone' | - | |
| ⓘ | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Glauconite | (K,Na)(Fe3+,Al,Mg)2(Si,Al)4O10(OH)2 |
| H | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| H | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| H | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Taramite | {Na}{CaNa}{Mg3Al2}(Al2Si6O22)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| C | ⓘ Diamond | C |
| O | Oxygen | |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| O | ⓘ Glauconite | (K,Na)(Fe3+,Al,Mg)2(Si,Al)4O10(OH)2 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fayalite | Fe22+SiO4 |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| O | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Taramite | {Na}{CaNa}{Mg3Al2}(Al2Si6O22)(OH)2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Spinel | MgAl2O4 |
| F | Fluorine | |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Na | Sodium | |
| Na | ⓘ Glauconite | (K,Na)(Fe3+,Al,Mg)2(Si,Al)4O10(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Taramite | {Na}{CaNa}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Mg | Magnesium | |
| Mg | ⓘ Glauconite | (K,Na)(Fe3+,Al,Mg)2(Si,Al)4O10(OH)2 |
| Mg | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | ⓘ Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| Mg | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Mg | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Mg | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Taramite | {Na}{CaNa}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Al | Aluminium | |
| Al | ⓘ Glauconite | (K,Na)(Fe3+,Al,Mg)2(Si,Al)4O10(OH)2 |
| Al | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Al | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Taramite | {Na}{CaNa}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Spinel | MgAl2O4 |
| Si | Silicon | |
| Si | ⓘ Glauconite | (K,Na)(Fe3+,Al,Mg)2(Si,Al)4O10(OH)2 |
| Si | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fayalite | Fe22+SiO4 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Si | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Taramite | {Na}{CaNa}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| S | Sulfur | |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| K | Potassium | |
| K | ⓘ Glauconite | (K,Na)(Fe3+,Al,Mg)2(Si,Al)4O10(OH)2 |
| K | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Taramite | {Na}{CaNa}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Ti | Titanium | |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Cr | Chromium | |
| Cr | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Mn | Manganese | |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | Iron | |
| Fe | ⓘ Glauconite | (K,Na)(Fe3+,Al,Mg)2(Si,Al)4O10(OH)2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Fayalite | Fe22+SiO4 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | ⓘ Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| Fe | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Fe | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Ta | Tantalum | |
| Ta | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| U | Uranium | |
| U | ⓘ Uraninite | UO2 |
Fossils
This region is too big to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Str%C3%B6msund_Municipality |
|---|---|
| Wikidata ID: | Q514770 |
| GeoNames ID: | 2671219 |
Localities in this Region
- Jämtland County
- Strömsund
- Frostviken
- Stora Blåsjön
- Tangen Mica Quarry
- Hoting
- Lejarklumpen
- Muruhatten
- Stor Jougdan
- ?Tåsjö
- Tjeliken eclogite
- Frostviken
- Strömsund
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Lillberget, Hoting, Strömsund, Jämtland County, Sweden