St Ives Mining District, Cornwall, England, UKi
| Regional Level Types | |
|---|---|
| St Ives Mining District | Mining District |
| Cornwall | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| St Ives | 9,966 (2017) |
| Uny Lelant | 1,056 (2017) |
Mindat Locality ID:
301994
Long-form identifier:
mindat:1:2:301994:1
GUID (UUID V4):
8e2e73fa-edc5-415f-99fb-f4cfbdc98370
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities43 valid minerals. 1 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| β Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: |
| β Albite Formula: Na(AlSi3O8) |
| β 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| β Anatase Formula: TiO2 References: S. Rust collection.Identification: Visual Identification |
| β Andalusite Formula: Al2(SiO4)O |
| β Anglesite Formula: PbSO4 Description: Small (< 0.1 mm) white crystals of anglesite in uraniferous hydrocarbon at Wheal Speed, Cornwall, contain co-precipitated radium. |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| β Arsenopyrite Formula: FeAsS Localities: Reported from at least 7 localities in this region. |
| β Azurite Formula: Cu3(CO3)2(OH)2 |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β Bismuth Formula: Bi Localities: References: |
| β Bornite Formula: Cu5FeS4 Localities: |
| β 'Calamine' |
| β Cassiterite Formula: SnO2 Localities: Reported from at least 34 localities in this region. |
| β Cassiterite var. Wood Tin Formula: SnO2 Localities: References: |
| β Chalcanthite Formula: CuSO4 · 5H2O |
| β Chalcocite Formula: Cu2S Localities: Reported from at least 6 localities in this region. Habit: six-sided tabular, short-prismatic Colour: grey metallic to grey-black metallic References: |
| β Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 12 localities in this region. References: |
| β Chalcopyrite var. Blister Copper Formula: CuFeS2 Localities: |
| β 'Chalcosiderite-Turquoise Series' |
| β 'Chlorite Group' Localities: Reported from at least 10 localities in this region. References: |
| β Clinoclase Formula: Cu3(AsO4)(OH)3 Localities: |
| β 'Clinoptilolite Subgroup' Formula: M3-6(Si30Al6)O72 · 20H2O |
| β Connellite (TL) Formula: Cu19(SO4)(OH)32Cl4 · 3H2O Type Locality: |
| β Copper Formula: Cu Localities: |
| β Corundum Formula: Al2O3 Localities: |
| β Corundum var. Sapphire Formula: Al2O3 Localities: |
| β Cuprite Formula: Cu2O Localities: |
| β Cuprite var. Chalcotrichite Formula: Cu2O Localities: |
| β Dolomite Formula: CaMg(CO3)2 |
| β Erythrite Formula: Co3(AsO4)2 · 8H2O |
| β 'Feldspar Group' Localities: Reported from at least 7 localities in this region. |
| β Fluorite Formula: CaF2 |
| β Galena Formula: PbS Localities: |
| β Goethite Formula: Ξ±-Fe3+O(OH) Localities: |
| β Gypsum Formula: CaSO4 · 2H2O |
| β Hematite Formula: Fe2O3 Localities: Reported from at least 7 localities in this region. References: |
| β Hematite var. Specularite Formula: Fe2O3 |
| β 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O Localities: |
| β 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| β 'Limonite' Localities: References: |
| β Liroconite Formula: Cu2Al(AsO4)(OH)4 · 4H2O |
| β Malachite Formula: Cu2(CO3)(OH)2 Localities: References: |
| β Molybdenite Formula: MoS2 Localities: |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: |
| β Muscovite var. Gilbertite Formula: KAl2(AlSi3O10)(OH)2 |
| β Opal ? Formula: SiO2 · nH2O |
| β Opal var. Isopyre ? |
| β Orthoclase Formula: K(AlSi3O8) Localities: |
| β Pyrite Formula: FeS2 Localities: Reported from at least 11 localities in this region. References: |
| β Quartz Formula: SiO2 Localities: Reported from at least 17 localities in this region. References: |
| β Quartz var. Chalcedony Formula: SiO2 |
| β Scheelite Formula: Ca(WO4) |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 13 localities in this region. References: |
| β Siderite Formula: FeCO3 Localities: |
| β Sphalerite Formula: ZnS Localities: |
| β Tenorite Formula: CuO Localities: References: |
| β Topaz Formula: Al2(SiO4)(F,OH)2 |
| β Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O Localities: |
| β 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: |
| β Tristramite Formula: (Ca,U,Fe)(PO4,SO4) · 2H2O Localities: |
| β Uraninite Formula: UO2 Localities: References: |
| β Uraninite var. Pitchblende Formula: UO2 Localities: References: |
| β Formula: Pb(MoO4) Locality: St Ives, Cornwall, England, UK - erroneously reported |
| β Xenotime-(Y) Formula: Y(PO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Copper | 1.AA.05 | Cu |
| β | Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Chalcocite | 2.BA.05 | Cu2S |
| β | Bornite | 2.BA.15 | Cu5FeS4 |
| β | Sphalerite | 2.CB.05a | ZnS |
| β | Chalcopyrite var. Blister Copper | 2.CB.10a | CuFeS2 |
| β | 2.CB.10a | CuFeS2 | |
| β | Galena | 2.CD.10 | PbS |
| β | Molybdenite | 2.EA.30 | MoS2 |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| β | Fluorite | 3.AB.25 | CaF2 |
| β | Connellite (TL) | 3.DA.25 | Cu19(SO4)(OH)32Cl4 Β· 3H2O |
| Group 4 - Oxides and Hydroxides | |||
| β | Goethite | 4.00. | Ξ±-Fe3+O(OH) |
| β | Cuprite | 4.AA.10 | Cu2O |
| β | var. Chalcotrichite | 4.AA.10 | Cu2O |
| β | Tenorite | 4.AB.10 | CuO |
| β | Corundum | 4.CB.05 | Al2O3 |
| β | Hematite | 4.CB.05 | Fe2O3 |
| β | Corundum var. Sapphire | 4.CB.05 | Al2O3 |
| β | Hematite var. Specularite | 4.CB.05 | Fe2O3 |
| β | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| β | 4.DA.05 | SiO2 | |
| β | Opal ? | 4.DA.10 | SiO2 Β· nH2O |
| β | var. Isopyre ? | 4.DA.10 | SiO2 Β· nH2O |
| β | Cassiterite | 4.DB.05 | SnO2 |
| β | var. Wood Tin | 4.DB.05 | SnO2 |
| β | Anatase | 4.DD.05 | TiO2 |
| β | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| β | 4.DL.05 | UO2 | |
| Group 5 - Nitrates and Carbonates | |||
| β | Siderite | 5.AB.05 | FeCO3 |
| β | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| β | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| β | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Anglesite | 7.AD.35 | PbSO4 |
| β | Chalcanthite | 7.CB.20 | CuSO4 Β· 5H2O |
| β | Gypsum | 7.CD.40 | CaSO4 Β· 2H2O |
| β | Scheelite | 7.GA.05 | Ca(WO4) |
| β | Wulfenite ? | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| β | Clinoclase | 8.BE.20 | Cu3(AsO4)(OH)3 |
| β | Erythrite | 8.CE.40 | Co3(AsO4)2 Β· 8H2O |
| β | Tristramite | 8.CJ.45 | (Ca,U,Fe)(PO4,SO4) Β· 2H2O |
| β | Liroconite | 8.DF.20 | Cu2Al(AsO4)(OH)4 Β· 4H2O |
| β | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 Β· 12H2O |
| Group 9 - Silicates | |||
| β | Andalusite | 9.AF.10 | Al2(SiO4)O |
| β | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Actinolite | 9.DE.10 | β»Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| β | Muscovite var. Gilbertite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| β | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| β | 'Limonite' | - | |
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| β | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] Β· nH2O |
| β | 'Feldspar Group' | - | |
| β | 'Clinoptilolite Subgroup' | - | M3-6(Si30Al6)O72 Β· 20H2O |
| β | 'Chlorite Group' | - | |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Calamine' | - | |
| β | 'Chalcosiderite-Turquoise Series' | - | |
| β | 'Hornblende Root Name Group' | - | β»Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| β | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | β Azurite | Cu3(CO3)2(OH)2 |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Chalcanthite | CuSO4 · 5H2O |
| H | β Clinoclase | Cu3(AsO4)(OH)3 |
| H | β Clinoptilolite Subgroup | M3-6(Si30Al6)O72 · 20H2O |
| H | β Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | β Erythrite | Co3(AsO4)2 · 8H2O |
| H | β Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| H | β Goethite | Ξ±-Fe3+O(OH) |
| H | β Gypsum | CaSO4 · 2H2O |
| H | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | β Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| H | β Malachite | Cu2(CO3)(OH)2 |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Opal | SiO2 · nH2O |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Topaz | Al2(SiO4)(F,OH)2 |
| H | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | β Tristramite | (Ca,U,Fe)(PO4,SO4) · 2H2O |
| H | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | β Azurite | Cu3(CO3)2(OH)2 |
| C | β Dolomite | CaMg(CO3)2 |
| C | β Malachite | Cu2(CO3)(OH)2 |
| C | β Siderite | FeCO3 |
| O | Oxygen | |
| O | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | β Albite | Na(AlSi3O8) |
| O | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | β Anatase | TiO2 |
| O | β Andalusite | Al2(SiO4)O |
| O | β Anglesite | PbSO4 |
| O | β Azurite | Cu3(CO3)2(OH)2 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Cassiterite | SnO2 |
| O | β Chalcanthite | CuSO4 · 5H2O |
| O | β Quartz var. Chalcedony | SiO2 |
| O | β Cuprite var. Chalcotrichite | Cu2O |
| O | β Clinoclase | Cu3(AsO4)(OH)3 |
| O | β Clinoptilolite Subgroup | M3-6(Si30Al6)O72 · 20H2O |
| O | β Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | β Corundum | Al2O3 |
| O | β Cuprite | Cu2O |
| O | β Dolomite | CaMg(CO3)2 |
| O | β Erythrite | Co3(AsO4)2 · 8H2O |
| O | β Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| O | β Goethite | Ξ±-Fe3+O(OH) |
| O | β Gypsum | CaSO4 · 2H2O |
| O | β Hematite | Fe2O3 |
| O | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | β Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| O | β Malachite | Cu2(CO3)(OH)2 |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Opal | SiO2 · nH2O |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Uraninite var. Pitchblende | UO2 |
| O | β Quartz | SiO2 |
| O | β Corundum var. Sapphire | Al2O3 |
| O | β Scheelite | Ca(WO4) |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Siderite | FeCO3 |
| O | β Tenorite | CuO |
| O | β Topaz | Al2(SiO4)(F,OH)2 |
| O | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Tristramite | (Ca,U,Fe)(PO4,SO4) · 2H2O |
| O | β Uraninite | UO2 |
| O | β Cassiterite var. Wood Tin | SnO2 |
| O | β Wulfenite | Pb(MoO4) |
| O | β Xenotime-(Y) | Y(PO4) |
| O | β Hematite var. Specularite | Fe2O3 |
| O | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β Fluorite | CaF2 |
| F | β Topaz | Al2(SiO4)(F,OH)2 |
| F | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | β Dolomite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | β Andalusite | Al2(SiO4)O |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Clinoptilolite Subgroup | M3-6(Si30Al6)O72 · 20H2O |
| Al | β Corundum | Al2O3 |
| Al | β Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| Al | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | β Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Corundum var. Sapphire | Al2O3 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Topaz | Al2(SiO4)(F,OH)2 |
| Al | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | Silicon | |
| Si | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | β Andalusite | Al2(SiO4)O |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Quartz var. Chalcedony | SiO2 |
| Si | β Clinoptilolite Subgroup | M3-6(Si30Al6)O72 · 20H2O |
| Si | β Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| Si | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Opal | SiO2 · nH2O |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Topaz | Al2(SiO4)(F,OH)2 |
| Si | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| P | Phosphorus | |
| P | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | β Tristramite | (Ca,U,Fe)(PO4,SO4) · 2H2O |
| P | β Xenotime-(Y) | Y(PO4) |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | β Anglesite | PbSO4 |
| S | β Arsenopyrite | FeAsS |
| S | β Bornite | Cu5FeS4 |
| S | β Chalcopyrite | CuFeS2 |
| S | β Chalcanthite | CuSO4 · 5H2O |
| S | β Chalcocite | Cu2S |
| S | β Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | β Galena | PbS |
| S | β Gypsum | CaSO4 · 2H2O |
| S | β Molybdenite | MoS2 |
| S | β Pyrite | FeS2 |
| S | β Sphalerite | ZnS |
| S | β Tristramite | (Ca,U,Fe)(PO4,SO4) · 2H2O |
| S | β Chalcopyrite var. Blister Copper | CuFeS2 |
| Cl | Chlorine | |
| Cl | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | β Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| K | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | β Dolomite | CaMg(CO3)2 |
| Ca | β Fluorite | CaF2 |
| Ca | β Gypsum | CaSO4 · 2H2O |
| Ca | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | β Scheelite | Ca(WO4) |
| Ca | β Tristramite | (Ca,U,Fe)(PO4,SO4) · 2H2O |
| Ca | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | β Anatase | TiO2 |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | Iron | |
| Fe | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | β Arsenopyrite | FeAsS |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Bornite | Cu5FeS4 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Goethite | Ξ±-Fe3+O(OH) |
| Fe | β Hematite | Fe2O3 |
| Fe | β Pyrite | FeS2 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Siderite | FeCO3 |
| Fe | β Tristramite | (Ca,U,Fe)(PO4,SO4) · 2H2O |
| Fe | β Hematite var. Specularite | Fe2O3 |
| Fe | β Chalcopyrite var. Blister Copper | CuFeS2 |
| Co | Cobalt | |
| Co | β Erythrite | Co3(AsO4)2 · 8H2O |
| Cu | Copper | |
| Cu | β Azurite | Cu3(CO3)2(OH)2 |
| Cu | β Bornite | Cu5FeS4 |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Chalcanthite | CuSO4 · 5H2O |
| Cu | β Chalcocite | Cu2S |
| Cu | β Cuprite var. Chalcotrichite | Cu2O |
| Cu | β Clinoclase | Cu3(AsO4)(OH)3 |
| Cu | β Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | β Cuprite | Cu2O |
| Cu | β Copper | Cu |
| Cu | β Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| Cu | β Malachite | Cu2(CO3)(OH)2 |
| Cu | β Tenorite | CuO |
| Cu | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | β Chalcopyrite var. Blister Copper | CuFeS2 |
| Zn | Zinc | |
| Zn | β Sphalerite | ZnS |
| As | Arsenic | |
| As | β Arsenopyrite | FeAsS |
| As | β Clinoclase | Cu3(AsO4)(OH)3 |
| As | β Erythrite | Co3(AsO4)2 · 8H2O |
| As | β Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| Y | Yttrium | |
| Y | β Xenotime-(Y) | Y(PO4) |
| Mo | Molybdenum | |
| Mo | β Molybdenite | MoS2 |
| Mo | β Wulfenite | Pb(MoO4) |
| Sn | Tin | |
| Sn | β Cassiterite | SnO2 |
| Sn | β Cassiterite var. Wood Tin | SnO2 |
| W | Tungsten | |
| W | β Scheelite | Ca(WO4) |
| Pb | Lead | |
| Pb | β Anglesite | PbSO4 |
| Pb | β Galena | PbS |
| Pb | β Wulfenite | Pb(MoO4) |
| Bi | Bismuth | |
| Bi | β Bismuth | Bi |
| U | Uranium | |
| U | β Uraninite var. Pitchblende | UO2 |
| U | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | β Tristramite | (Ca,U,Fe)(PO4,SO4) · 2H2O |
| U | β Uraninite | UO2 |
Geochronology
| Geologic Time | Rocks, Minerals and Events | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | ||||||||||||||||||||||
| Paleozoic | ||||||||||||||||||||||
| Permian | ||||||||||||||||||||||
| Guadalupian |
| |||||||||||||||||||||
| Cisuralian |
| |||||||||||||||||||||
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Localities in this Region
- England
- Cornwall
- Ludgvan
- St Erth
- ⭔St Ives
- Carbis Bay
- Carrack Dews Mine (Carrick Du Mine)
- Gool Pellas Mine (Goole Pellas Mine)
- Halsetown
- Hor Bal (Mungren's Hill Mine)
- Knill Quarry
- Lelant
- Ludgvan Lease Mine
- North Battery Mine (Battery Mine)
- North Wheal Fortune
- Pedn Olva Mine (Pednolver Mine; North Wheal Providence)
- St Ives Consols (incl. Wellesley Mine; Wheal Mary)
- St Ives Wheal Allen (Wheal Folly)
- Trelyon Consols (Trelyon Downs Mine)
- Cornwall
- England
- Cornwall
- St Ives
- ⭔Towednack
- Amalebra (Amalebrea)
- Cripplesease
- Rosewall Hill and Ransom United Mines
- Trevega Bal (Trevegia Mine; West St Ives Consols; Brea Consols; Trevessa and Brea Mines)
- Wheal Montague (Great Wheal Cleveland)
- Wheal Music
- Wheal Sandwich
- Wheal Sperris (Wheal Sperries; Wheal Carne)
- Wheal Tyringham Consols (West Wheal Providence; Wheal Bussow; Wheal Buzza; Wheal Bussar)
- Wheal Union (Wheal Wens; Wheal Winze)
- Zennor
- Cornwall
Other Regions, Features and Areas that Intersect
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
UK
- England
- Cornwall
- Gwinear Mining DistrictMining District
- Devon and Cornwall metalliferous mining districtMining District
- Cornwall
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsLocalities in RegionOther RegionsReferences
St Ives Consols, St Ives, Cornwall, England, UK