Athabasca Basin, Saskatchewan, Canadai
| Regional Level Types | |
|---|---|
| Athabasca Basin | Basin |
| Saskatchewan | Province |
| Canada | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Mindat Locality ID:
47600
Long-form identifier:
mindat:1:2:47600:2
GUID (UUID V4):
f3955dc5-3d97-4551-b07a-2c500c002e7c
One quarter of the total world uranium production comes from uniquely rich deposits in the Proterozoic Athabasca Basin in Saskatchewan.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities104 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| β Albite Formula: Na(AlSi3O8) Description: Vermiform, with Na-depressed cpx, in clinopyroxenites. |
| β Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] Description: Vermiform, with Na-depressed cpx, in clinopyroxenites. |
| β Albite var. Anorthoclase Formula: (Na,K)AlSi3O8 Description: Ribbons with quartz in felsic gneisses. |
| β Almandine Formula: Fe2+3Al2(SiO4)3 Description: In felsic gneisses. |
| β Altaite Formula: PbTe Localities: References: |
| β 'Alunite Supergroup' Formula: AD3(XO4)2(OH)6 |
| β 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Localities: |
| β Anatase Formula: TiO2 Localities: |
| β Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| β Annabergite Formula: Ni3(AsO4)2 · 8H2O |
| β Anorthite Formula: Ca(Al2Si2O8) Description: In clinopyroxenites. |
| β Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] Description: In clinopyroxenites. |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: |
| β 'Apatite Group' |
| β Arsenoflorencite-(Ce) Formula: CeAl3(AsO4)2(OH)6 |
| β Arsenopyrite Formula: FeAsS |
| β Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Description: Associated with labradorite (retrograde after Na-cpx), in clinopyroxenites. |
| β Augite var. Fassaite Formula: (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] Description: In clinopyroxenites. |
| β Augite var. Soda-Augite Description: Associated with labradorite (retrograde after Na-cpx), in clinopyroxenites. |
| β Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| β Bayleyite Formula: Mg2(UO2)(CO3)3 · 18H2O |
| β Becquerelite Formula: Ca(UO2)6O4(OH)6 · 8H2O |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 Localities: Reported from at least 7 localities in this region. |
| β Bismutohauchecornite Formula: Ni9Bi2S8 Description: Originally reported by Watkinson et al. as Hauchecornitem 5 years before Bismutohauchecornite was defined. Watkinson et al's analysis is given under Bismutohauchecornite in the Handbook of Mineralogy, Vol 1, p 57. |
| β Boltwoodite Formula: (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| β Bornite Formula: Cu5FeS4 |
| β Brochantite Formula: Cu4(SO4)(OH)6 |
| β Calaverite Formula: AuTe2 |
| β Calcite Formula: CaCO3 Localities: Reported from at least 6 localities in this region. |
| β Carnotite Formula: K2(UO2)2(VO4)2 · 3H2O Localities: |
| β Chalcocite Formula: Cu2S Localities: |
| β Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 14 localities in this region. |
| β Chamosite Formula: (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| β Chlorapatite Formula: Ca5(PO4)3Cl Description: In felsic gneisses, with exsolution needles of monazite. |
| β 'Chlorite Group' Localities: Reported from at least 14 localities in this region. References: |
| β Clausthalite Formula: PbSe Localities: |
| β Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: |
| β Cobaltite Formula: CoAsS Localities: |
| β Coffinite Formula: U(SiO4) · nH2O Localities: Reported from at least 13 localities in this region. |
| β Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) Localities: |
| β Corundum Formula: Al2O3 Localities: Description: In clinopyroxenites.
In felsic gneisses : Lavender to violet crystals (up to 1-2 cm), replaced by garnet, or inclusions in garnets. Cr2O3 up to 1.02 wt%.
References: |
| β Covellite Formula: CuS Localities: |
| β Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 Localities: |
| β Dickite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 6 localities in this region. |
| β Digenite Formula: Cu9S5 |
| β Dolomite Formula: CaMg(CO3)2 |
| β Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 9 localities in this region. |
| β Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β 'Feldspar Group' Localities: Gneiss and clinopyroxenite outcrops, Honsvall Lake, Athabasca Basin, Saskatchewan, Canada Gryphon deposit, Wheeler River Project, Athabasca Basin, Saskatchewan, Canada Arrow deposit, Patterson Lake, Athabasca Basin, Saskatchewan, Canada Bow occurrence, Patterson Lake, Athabasca Basin, Saskatchewan, Canada Description: Orthoclase network in oligoclase host, in felsic gneisses. References: |
| β 'Feldspar Group var. Perthite' Description: Orthoclase network in oligoclase host, in felsic gneisses. |
| β Florencite-(Ce) Formula: CeAl3(PO4)2(OH)6 Localities: |
| β Galena Formula: PbS Localities: Reported from at least 12 localities in this region. |
| β 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Claude Pit, Cluff Lake mines, Athabasca Basin, Saskatchewan, Canada Cigar Lake Mine, Athabasca Basin, Saskatchewan, Canada Phoenix deposit, Wheeler River Project, Athabasca Basin, Saskatchewan, Canada Arrow deposit, Patterson Lake, Athabasca Basin, Saskatchewan, Canada Bow occurrence, Patterson Lake, Athabasca Basin, Saskatchewan, Canada References: |
| β 'Geikielite-Ilmenite Series' Description: Inclusions in coronitic garnets in opx/cpx/plagioclase mafic rocks included in felsic gneisses. |
| β Gersdorffite Formula: NiAsS Localities: Reported from at least 7 localities in this region. |
| β Glaucodot Formula: (Co0.50Fe0.50)AsS |
| β Goethite Formula: Ξ±-Fe3+O(OH) Localities: References: |
| β Gold Formula: Au Localities: |
| β Goyazite Formula: SrAl3(PO4)(PO3OH)(OH)6 Localities: |
| β Graphite Formula: C Localities: Reported from at least 12 localities in this region. |
| β 'Gummite' |
| β Haiweeite Formula: Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| β Formula: Ni9BiSbS8 Locality: Zimmer Lake area, Athabasca Basin, Saskatchewan, Canada - erroneously reported Description: Watkinson et al published Hauchecornite in 1975, 5 years before Bismutohauchecornite was defined in 1980. Watkinson's 1975 analysis was reported in the Handbook of Mineralogy, vol 1, pg 57 under Bismutohauchecornite |
| β Hematite Formula: Fe2O3 Localities: Reported from at least 16 localities in this region. References: |
| β Hematite var. Specularite Formula: Fe2O3 |
| β 'Hornblende' |
| β Ilmenite Formula: Fe2+TiO3 Localities: |
| β Jordisite Formula: MoS2 Localities: |
| β Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 9 localities in this region. |
| β 'K Feldspar' Localities: Description: Inclusions in coronitic garnets in opx/cpx/plagioclase mafic rocks included in felsic gneisses. References: |
| β Kyanite Formula: Al2(SiO4)O Description: In clinopyroxenites.
In felsic needles : Deep blue to green crystals, with Cr2O3 up to 2.21 wt%. |
| β 'Lepidolite' |
| β 'Leucoxene' |
| β 'Limonite' Localities: |
| β LΓΆllingite Formula: FeAs2 |
| β Magnesio-foitite Formula: ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) Localities: References: |
| β Magnesite Formula: MgCO3 |
| β Magnetite Formula: Fe2+Fe3+2O4 |
| β Marcasite Formula: FeS2 Localities: |
| β Masuyite Formula: Pb(UO2)3O3(OH)2 · 3H2O |
| β Maucherite Formula: Ni11As8 Localities: |
| β MetanovΓ‘Δekite Formula: Mg(UO2)2(AsO4)2 · 8H2O |
| β Millerite Formula: NiS Localities: |
| β Molybdenite Formula: MoS2 Localities: McArthur River Mine, Athabasca Basin, Saskatchewan, Canada Claude Pit, Cluff Lake mines, Athabasca Basin, Saskatchewan, Canada Cluff Lake mines, Athabasca Basin, Saskatchewan, Canada Key Lake Mine, Athabasca Basin, Saskatchewan, Canada Gryphon deposit, Wheeler River Project, Athabasca Basin, Saskatchewan, Canada |
| β 'Monazite' Formula: REE(PO4) Localities: Gneiss and clinopyroxenite outcrops, Honsvall Lake, Athabasca Basin, Saskatchewan, Canada Cluff Lake mines, Athabasca Basin, Saskatchewan, Canada McArthur River Mine, Athabasca Basin, Saskatchewan, Canada Roughrider deposit, Athabasca Basin, Saskatchewan, Canada MacAskill occurrence, Athabasca Basin, Saskatchewan, Canada Description: In felsic gneisses : High-Th inclusions in garnets . References: |
| β Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 14 localities in this region. Description: High-Ti (around 4 wt% TiO2) muscovite, associated with graphite and ilmenite-geikielite series, in felsic gneisses. References: |
| β Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 Localities: Reported from at least 11 localities in this region. |
| β Muscovite var. Phengite Formula: KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| β Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: |
| β Nickeline Formula: NiAs Localities: Reported from at least 6 localities in this region. |
| β Oxy-dravite Formula: Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| β Oxy-schorl Formula: Na(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3O |
| β Paragonite Formula: NaAl2(AlSi3O10)(OH)2 |
| β Paraguanajuatite Formula: Bi2Se3 |
| β Pararammelsbergite Formula: NiAs2 |
| β Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 Description: Retrograde phase in clinopyroxenites. |
| β Pentlandite Formula: (NixFey)Ξ£9S8 Localities: |
| β Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Description: In felsic gneisses : Inclusions in garnets, with rutile and ilmenite exsolutions ; replaced by K-feldspar+Zn/Cr-spinel symplectites ; retrograde, associated with sillimanite/quartz intergrowths, on kyanite or garnet. |
| β 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: Description: In felsic gneisses : Retrograde aroud garnet or kyanite. References: |
| β Pyrite Formula: FeS2 Localities: Reported from at least 19 localities in this region. |
| β Pyrite var. Bravoite Formula: (Fe,Ni)S2 Localities: |
| β 'Pyrobitumen' |
| β Pyrope Formula: Mg3Al2(SiO4)3 Description: Replaced by spinel+plagioclase+opx kelyphites, in clinopyroxenites. |
| β Pyrrhotite Formula: Fe1-xS Localities: Pine Channel Ni/Cu Anomaly, Honsvall Lake, Athabasca Basin, Saskatchewan, Canada Cluff Lake mines, Athabasca Basin, Saskatchewan, Canada Maverick Uranium Zone (525 Uranium Zone; 527 Uranium Zone), Moore Lake, Athabasca Basin, Saskatchewan, Canada Rabbit Lake Mine, Athabasca Basin, Saskatchewan, Canada Key Lake Mine, Athabasca Basin, Saskatchewan, Canada |
| β Quartz Formula: SiO2 Localities: Reported from at least 15 localities in this region. Description: Associated with Sapphirine, at the clinopyroxenites/gneisses contacts.
In felsic gneisses. References: |
| β Quartz var. Smoky Quartz Formula: SiO2 |
| β Rammelsbergite Formula: NiAs2 Localities: |
| β Retgersite Formula: NiSO4 · 6H2O |
| β Rutherfordine Formula: (UO2)CO3 Localities: |
| β Rutile Formula: TiO2 Localities: Description: Exsolution needles in garnets, in clinopyroxenites.
High-Fe exsolution needles in garnets, in felsic gneisses.
Crystals with zircon exsolution needles in felsic gneisses (upper mantle origin). References: |
| β Rutile var. Niobium-bearing Rutile Formula: (Ti,Nb)O2 Description: In felsic gneisses. |
| β Sapphirine Formula: Mg4(Mg3Al9)O4[Si3Al9O36] Description: At the clinopyroxenites/gneisses contacts. |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Selenium Formula: Se |
| β Siderite Formula: FeCO3 Localities: |
| β Sillimanite Formula: Al2(SiO4)O Localities: References: |
| β Sklodowskite Formula: Mg(UO2)2(SiO3OH)2 · 6H2O Localities: |
| β Skutterudite Formula: CoAs3 Localities: |
| β 'Smectite Group' Formula: A0.3D2-3[T4O10]Z2 · nH2O |
| β Smythite Formula: (Fe,Ni)3+xS4 (x=0-0.3) |
| β Sphalerite Formula: ZnS Localities: Reported from at least 8 localities in this region. |
| β Spinel Formula: MgAl2O4 Description: In clinopyroxenites.
In felsic gneisses : green to grey-brown, rich in Zn, Cr, V. |
| β Sudoite Formula: Mg2Al3(Si3Al)O10)(OH)8 Localities: Reported from at least 9 localities in this region. |
| β Svanbergite Formula: SrAl3(PO4)(SO4)(OH)6 Localities: |
| β Talc Formula: Mg3Si4O10(OH)2 |
| β Tellurium Formula: Te |
| β Titanite Formula: CaTi(SiO4)O Localities: Description: Al and F-rich titanite,inclusions in coronitic garnets in opx/cpx/plagioclase mafic rocks included in felsic gneisses. References: |
| β Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| β 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Dawn Lake Uranium Deposit, Athabasca Basin, Saskatchewan, Canada Cluff Lake mines, Athabasca Basin, Saskatchewan, Canada Roughrider deposit, Athabasca Basin, Saskatchewan, Canada Gryphon deposit, Wheeler River Project, Athabasca Basin, Saskatchewan, Canada Phoenix deposit, Wheeler River Project, Athabasca Basin, Saskatchewan, Canada |
| β Tyuyamunite Formula: Ca(UO2)2(VO4)2 · 5-8H2O |
| β 'UM1978-10-O:U' Formula: U3O7 |
| β Uraninite Formula: UO2 Localities: Reported from at least 17 localities in this region. |
| β Uraninite var. Pitchblende Formula: UO2 Localities: Reported from at least 8 localities in this region. |
| β Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O Localities: Reported from at least 8 localities in this region. |
| β Vaesite Formula: NiS2 |
| β Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| β Woodhouseite Formula: CaAl3(PO4)(SO4)(OH)6 |
| β Wulfenite Formula: Pb(MoO4) |
| β 'Xenotime' |
| β Zircon Formula: Zr(SiO4) Localities: Reported from at least 6 localities in this region. Description: In felsic gneisses. References: |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Gold | 1.AA.05 | Au |
| β | Graphite | 1.CB.05a | C |
| β | Selenium | 1.CC.10 | Se |
| β | Tellurium | 1.CC.10 | Te |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Altaite | 2.CD.10 | PbTe |
| β | Arsenopyrite | 2.EB.20 | FeAsS |
| β | Bismutohauchecornite | 2.BB.10 | Ni9Bi2S8 |
| β | Bornite | 2.BA.15 | Cu5FeS4 |
| β | Calaverite | 2.EA.10 | AuTe2 |
| β | Chalcocite | 2.BA.05 | Cu2S |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Clausthalite | 2.CD.10 | PbSe |
| β | Cobaltite | 2.EB.25 | CoAsS |
| β | Covellite | 2.CA.05a | CuS |
| β | Digenite | 2.BA.10 | Cu9S5 |
| β | Galena | 2.CD.10 | PbS |
| β | Gersdorffite | 2.EB.25 | NiAsS |
| β | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| β | Hauchecornite ? | 2.BB.10 | Ni9BiSbS8 |
| β | Jordisite | 2.EA.30 | MoS2 |
| β | LΓΆllingite | 2.EB.15a | FeAs2 |
| β | Marcasite | 2.EB.10a | FeS2 |
| β | Maucherite | 2.AB.15 | Ni11As8 |
| β | Millerite | 2.CC.20 | NiS |
| β | Molybdenite | 2.EA.30 | MoS2 |
| β | Nickeline | 2.CC.05 | NiAs |
| β | Paraguanajuatite | 2.DC.05 | Bi2Se3 |
| β | Pararammelsbergite | 2.EB.10e | NiAs2 |
| β | Pentlandite | 2.BB.15 | (NixFey)Ξ£9S8 |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | var. Bravoite | 2.EB.05a | (Fe,Ni)S2 |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | Rammelsbergite | 2.EB.15a | NiAs2 |
| β | Skutterudite | 2.EC.05 | CoAs3 |
| β | Smythite | 2.CC.10 | (Fe,Ni)3+xS4 (x=0-0.3) |
| β | Sphalerite | 2.CB.05a | ZnS |
| β | Vaesite | 2.EB.05a | NiS2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Anatase | 4.DD.05 | TiO2 |
| β | Becquerelite | 4.GB.10 | Ca(UO2)6O4(OH)6 Β· 8H2O |
| β | Carnotite | 4.HB.05 | K2(UO2)2(VO4)2 Β· 3H2O |
| β | Corundum | 4.CB.05 | Al2O3 |
| β | Goethite | 4.00. | Ξ±-Fe3+O(OH) |
| β | Hematite | 4.CB.05 | Fe2O3 |
| β | var. Specularite | 4.CB.05 | Fe2O3 |
| β | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| β | Masuyite | 4.GB.35 | Pb(UO2)3O3(OH)2 Β· 3H2O |
| β | Quartz | 4.DA.05 | SiO2 |
| β | var. Smoky Quartz | 4.DA.05 | SiO2 |
| β | Rutile | 4.DB.05 | TiO2 |
| β | var. Niobium-bearing Rutile | 4.DB.05 | (Ti,Nb)O2 |
| β | Spinel | 4.BB.05 | MgAl2O4 |
| β | Tyuyamunite | 4.HB.25 | Ca(UO2)2(VO4)2 Β· 5-8H2O |
| β | Uraninite | 4.DL.05 | UO2 |
| β | var. Pitchblende | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| β | Bayleyite | 5.ED.05 | Mg2(UO2)(CO3)3 Β· 18H2O |
| β | Calcite | 5.AB.05 | CaCO3 |
| β | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| β | Magnesite | 5.AB.05 | MgCO3 |
| β | Rutherfordine | 5.EB.05 | (UO2)CO3 |
| β | Siderite | 5.AB.05 | FeCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| β | Retgersite | 7.CB.30 | NiSO4 Β· 6H2O |
| β | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Annabergite | 8.CE.40 | Ni3(AsO4)2 Β· 8H2O |
| β | Arsenoflorencite-(Ce) | 8.BL.13 | CeAl3(AsO4)2(OH)6 |
| β | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 Β· 10-12H2O |
| β | Chlorapatite | 8.BN.05 | Ca5(PO4)3Cl |
| β | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| β | Florencite-(Ce) | 8.BL.13 | CeAl3(PO4)2(OH)6 |
| β | Goyazite | 8.BL.10 | SrAl3(PO4)(PO3OH)(OH)6 |
| β | MetanovΓ‘Δekite | 8.EB.10 | Mg(UO2)2(AsO4)2 Β· 8H2O |
| β | Svanbergite | 8.BL.05 | SrAl3(PO4)(SO4)(OH)6 |
| β | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 Β· 12H2O |
| β | Woodhouseite | 8.BL.05 | CaAl3(PO4)(SO4)(OH)6 |
| Group 9 - Silicates | |||
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| β | var. Anorthoclase | 9.FA.35 | (Na,K)AlSi3O8 |
| β | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| β | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| β | var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| β | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| β | var. Fassaite | 9.DA.15 | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| β | var. Soda-Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| β | Boltwoodite | 9.AK.15 | (K,Na)(UO2)(SiO3OH) Β· 1.5H2O |
| β | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| β | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| β | Coffinite | 9.AD.30 | U(SiO4) Β· nH2O |
| β | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| β | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| β | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β | Haiweeite | 9.AK.25 | Ca(UO2)2[Si5O12(OH)2] Β· 6H2O |
| β | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| β | Kyanite | 9.AF.15 | Al2(SiO4)O |
| β | Magnesio-foitite | 9.CK.05 | β»(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 Β· nH2O |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| β | var. Phengite | 9.EC.15 | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| β | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Oxy-dravite | 9.CK.05 | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| β | Oxy-schorl | 9.CK.05 | Na(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3O |
| β | Paragonite | 9.EC.15 | NaAl2(AlSi3O10)(OH)2 |
| β | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| β | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| β | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| β | Sapphirine | 9.DH.45 | Mg4(Mg3Al9)O4[Si3Al9O36] |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| β | Sklodowskite | 9.AK.10 | Mg(UO2)2(SiO3OH)2 Β· 6H2O |
| β | Sudoite | 9.EC.55 | Mg2Al3(Si3Al)O10)(OH)8 |
| β | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 Β· 5H2O |
| β | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 Β· 8H2O |
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| Unclassified Minerals, Rocks, etc. | |||
| β | 'Alunite Supergroup' | - | AD3(XO4)2(OH)6 |
| β | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| β | 'Apatite Group' | - | |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| β | 'Chlorite Group' | - | |
| β | 'Feldspar Group' | - | |
| β | 'var. Perthite' | - | |
| β | 'Garnet Group' | - | X3Z2(SiO4)3 |
| β | 'Geikielite-Ilmenite Series' | - | |
| β | 'Gummite' | - | |
| β | 'Hornblende' | - | |
| β | 'K Feldspar' | - | |
| β | 'Lepidolite' | - | |
| β | 'Leucoxene' | - | |
| β | 'Limonite' | - | |
| β | 'Monazite' | - | REE(PO4) |
| β | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| β | 'Pyrobitumen' | - | |
| β | 'Smectite Group' | - | A0.3D2-3[T4O10]Z2 Β· nH2O |
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| β | 'UM1978-10-O:U' | - | U3O7 |
| β | 'Xenotime' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | β Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | β Coffinite | U(SiO4) · nH2O |
| H | β Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| H | β Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| H | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | β Kaolinite | Al2(Si2O5)(OH)4 |
| H | β Dickite | Al2(Si2O5)(OH)4 |
| H | β Sudoite | Mg2Al3(Si3Al)O10)(OH)8 |
| H | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| H | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | β Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Retgersite | NiSO4 · 6H2O |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| H | β Goethite | Ξ±-Fe3+O(OH) |
| H | β Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| H | β Annabergite | Ni3(AsO4)2 · 8H2O |
| H | β Brochantite | Cu4(SO4)(OH)6 |
| H | β MetanovΓ‘Δekite | Mg(UO2)2(AsO4)2 · 8H2O |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| H | β Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| H | β Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| H | β Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| H | β Alunite Supergroup | AD3(XO4)2(OH)6 |
| H | β Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | β Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| H | β Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| H | β Talc | Mg3Si4O10(OH)2 |
| H | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | β Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | β Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| H | β Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| H | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | β Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| H | β Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| H | β Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| H | β Paragonite | NaAl2(AlSi3O10)(OH)2 |
| H | β Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| H | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| H | β Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| B | Boron | |
| B | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | β Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| B | β Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| C | Carbon | |
| C | β Graphite | C |
| C | β Dolomite | CaMg(CO3)2 |
| C | β Calcite | CaCO3 |
| C | β Siderite | FeCO3 |
| C | β Rutherfordine | (UO2)CO3 |
| C | β Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| C | β Magnesite | MgCO3 |
| C | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | Oxygen | |
| O | β Uraninite var. Pitchblende | UO2 |
| O | β Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | β Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | β Coffinite | U(SiO4) · nH2O |
| O | β Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| O | β Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| O | β Hematite | Fe2O3 |
| O | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | β Uraninite | UO2 |
| O | β Almandine | Fe32+Al2(SiO4)3 |
| O | β Quartz | SiO2 |
| O | β Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| O | β Kaolinite | Al2(Si2O5)(OH)4 |
| O | β Dickite | Al2(Si2O5)(OH)4 |
| O | β Sudoite | Mg2Al3(Si3Al)O10)(OH)8 |
| O | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | β Titanite | CaTi(SiO4)O |
| O | β Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| O | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| O | β Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | β Zircon | Zr(SiO4) |
| O | β Monazite | REE(PO4) |
| O | β Chlorapatite | Ca5(PO4)3Cl |
| O | β Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | β Sillimanite | Al2(SiO4)O |
| O | β Spinel | MgAl2O4 |
| O | β Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| O | β Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | β Pyrope | Mg3Al2(SiO4)3 |
| O | β Corundum | Al2O3 |
| O | β Kyanite | Al2(SiO4)O |
| O | β Rutile | TiO2 |
| O | β Magnetite | Fe2+Fe23+O4 |
| O | β Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Retgersite | NiSO4 · 6H2O |
| O | β Garnet Group | X3Z2(SiO4)3 |
| O | β Dolomite | CaMg(CO3)2 |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| O | β Ilmenite | Fe2+TiO3 |
| O | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | β Calcite | CaCO3 |
| O | β Siderite | FeCO3 |
| O | β Goethite | Ξ±-Fe3+O(OH) |
| O | β Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| O | β Annabergite | Ni3(AsO4)2 · 8H2O |
| O | β Brochantite | Cu4(SO4)(OH)6 |
| O | β Rutherfordine | (UO2)CO3 |
| O | β MetanovΓ‘Δekite | Mg(UO2)2(AsO4)2 · 8H2O |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β UM1978-10-O:U | U3O7 |
| O | β Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| O | β Anorthite | Ca(Al2Si2O8) |
| O | β Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | β Albite | Na(AlSi3O8) |
| O | β Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| O | β Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| O | β Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| O | β Alunite Supergroup | AD3(XO4)2(OH)6 |
| O | β Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | β Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| O | β Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| O | β Talc | Mg3Si4O10(OH)2 |
| O | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | β Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | β Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| O | β Magnesite | MgCO3 |
| O | β Anatase | TiO2 |
| O | β Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| O | β Wulfenite | Pb(MoO4) |
| O | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | β Hematite var. Specularite | Fe2O3 |
| O | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | β Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| O | β Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| O | β Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| O | β Paragonite | NaAl2(AlSi3O10)(OH)2 |
| O | β Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| O | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| O | β Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| F | Fluorine | |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| F | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Na | Sodium | |
| Na | β Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Na | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | β Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | β Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Na | β Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| Na | β Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| Na | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | β Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| Na | β Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Mg | Magnesium | |
| Mg | β Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | β Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Mg | β Sudoite | Mg2Al3(Si3Al)O10)(OH)8 |
| Mg | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | β Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | β Spinel | MgAl2O4 |
| Mg | β Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Mg | β Pyrope | Mg3Al2(SiO4)3 |
| Mg | β Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | β Dolomite | CaMg(CO3)2 |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Mg | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | β Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| Mg | β MetanovΓ‘Δekite | Mg(UO2)2(AsO4)2 · 8H2O |
| Mg | β Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| Mg | β Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | β Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| Mg | β Talc | Mg3Si4O10(OH)2 |
| Mg | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | β Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | β Magnesite | MgCO3 |
| Mg | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | β Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | Aluminium | |
| Al | β Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | β Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | β Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Al | β Almandine | Fe32+Al2(SiO4)3 |
| Al | β Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Al | β Kaolinite | Al2(Si2O5)(OH)4 |
| Al | β Dickite | Al2(Si2O5)(OH)4 |
| Al | β Sudoite | Mg2Al3(Si3Al)O10)(OH)8 |
| Al | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | β Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Al | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | β Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | β Sillimanite | Al2(SiO4)O |
| Al | β Spinel | MgAl2O4 |
| Al | β Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Al | β Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | β Pyrope | Mg3Al2(SiO4)3 |
| Al | β Corundum | Al2O3 |
| Al | β Kyanite | Al2(SiO4)O |
| Al | β Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Al | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Anorthite | Ca(Al2Si2O8) |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| Al | β Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| Al | β Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Al | β Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | β Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Al | β Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| Al | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | β Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | β Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| Al | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | β Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Al | β Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Si | Silicon | |
| Si | β Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | β Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | β Coffinite | U(SiO4) · nH2O |
| Si | β Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| Si | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | β Almandine | Fe32+Al2(SiO4)3 |
| Si | β Quartz | SiO2 |
| Si | β Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Si | β Kaolinite | Al2(Si2O5)(OH)4 |
| Si | β Dickite | Al2(Si2O5)(OH)4 |
| Si | β Sudoite | Mg2Al3(Si3Al)O10)(OH)8 |
| Si | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Si | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | β Zircon | Zr(SiO4) |
| Si | β Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | β Sillimanite | Al2(SiO4)O |
| Si | β Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Si | β Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | β Pyrope | Mg3Al2(SiO4)3 |
| Si | β Kyanite | Al2(SiO4)O |
| Si | β Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Garnet Group | X3Z2(SiO4)3 |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Si | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | β Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Anorthite | Ca(Al2Si2O8) |
| Si | β Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| Si | β Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| Si | β Talc | Mg3Si4O10(OH)2 |
| Si | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | β Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | β Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| Si | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | β Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Si | β Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| P | Phosphorus | |
| P | β Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| P | β Monazite | REE(PO4) |
| P | β Chlorapatite | Ca5(PO4)3Cl |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | β Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| P | β Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | β Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| P | β Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| P | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| S | Sulfur | |
| S | β Chalcopyrite | CuFeS2 |
| S | β Pyrite | FeS2 |
| S | β Marcasite | FeS2 |
| S | β Pyrite var. Bravoite | (Fe,Ni)S2 |
| S | β Gersdorffite | NiAsS |
| S | β Cobaltite | CoAsS |
| S | β Glaucodot | (Co0.50Fe0.50)AsS |
| S | β Bornite | Cu5FeS4 |
| S | β Digenite | Cu9S5 |
| S | β Chalcocite | Cu2S |
| S | β Covellite | CuS |
| S | β Sphalerite | ZnS |
| S | β Galena | PbS |
| S | β Jordisite | MoS2 |
| S | β Pyrrhotite | Fe1-xS |
| S | β Pentlandite | (NixFey)Ξ£9S8 |
| S | β Molybdenite | MoS2 |
| S | β Retgersite | NiSO4 · 6H2O |
| S | β Arsenopyrite | FeAsS |
| S | β Millerite | NiS |
| S | β Brochantite | Cu4(SO4)(OH)6 |
| S | β Bismutohauchecornite | Ni9Bi2S8 |
| S | β Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| S | β Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| S | β Vaesite | NiS2 |
| S | β Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| S | β Hauchecornite | Ni9BiSbS8 |
| Cl | Chlorine | |
| Cl | β Chlorapatite | Ca5(PO4)3Cl |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Cl | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| K | Potassium | |
| K | β Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | β Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| K | β Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| K | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | β Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| K | β Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | β Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| Ca | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | β Titanite | CaTi(SiO4)O |
| Ca | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | β Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | β Chlorapatite | Ca5(PO4)3Cl |
| Ca | β Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Ca | β Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | β Dolomite | CaMg(CO3)2 |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | β Calcite | CaCO3 |
| Ca | β Anorthite | Ca(Al2Si2O8) |
| Ca | β Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | β Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | β Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| Ca | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | β Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| Ca | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | β Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| Ti | Titanium | |
| Ti | β Titanite | CaTi(SiO4)O |
| Ti | β Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Ti | β Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Ti | β Rutile | TiO2 |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Ti | β Ilmenite | Fe2+TiO3 |
| Ti | β Anatase | TiO2 |
| Ti | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| V | Vanadium | |
| V | β Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| V | β Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| Fe | Iron | |
| Fe | β Hematite | Fe2O3 |
| Fe | β Almandine | Fe32+Al2(SiO4)3 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Pyrite | FeS2 |
| Fe | β Marcasite | FeS2 |
| Fe | β Pyrite var. Bravoite | (Fe,Ni)S2 |
| Fe | β Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | β Bornite | Cu5FeS4 |
| Fe | β Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Magnetite | Fe2+Fe23+O4 |
| Fe | β Pentlandite | (NixFey)Ξ£9S8 |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Fe | β Arsenopyrite | FeAsS |
| Fe | β Ilmenite | Fe2+TiO3 |
| Fe | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | β Siderite | FeCO3 |
| Fe | β Goethite | Ξ±-Fe3+O(OH) |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | β Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| Fe | β Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | β Hematite var. Specularite | Fe2O3 |
| Fe | β LΓΆllingite | FeAs2 |
| Fe | β Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| Fe | β Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Fe | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Co | Cobalt | |
| Co | β Cobaltite | CoAsS |
| Co | β Glaucodot | (Co0.50Fe0.50)AsS |
| Co | β Skutterudite | CoAs3 |
| Ni | Nickel | |
| Ni | β Pyrite var. Bravoite | (Fe,Ni)S2 |
| Ni | β Rammelsbergite | NiAs2 |
| Ni | β Nickeline | NiAs |
| Ni | β Gersdorffite | NiAsS |
| Ni | β Pentlandite | (NixFey)Ξ£9S8 |
| Ni | β Retgersite | NiSO4 · 6H2O |
| Ni | β Pararammelsbergite | NiAs2 |
| Ni | β Millerite | NiS |
| Ni | β Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | β Maucherite | Ni11As8 |
| Ni | β Bismutohauchecornite | Ni9Bi2S8 |
| Ni | β Vaesite | NiS2 |
| Ni | β Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| Ni | β Hauchecornite | Ni9BiSbS8 |
| Cu | Copper | |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Bornite | Cu5FeS4 |
| Cu | β Digenite | Cu9S5 |
| Cu | β Chalcocite | Cu2S |
| Cu | β Covellite | CuS |
| Cu | β Brochantite | Cu4(SO4)(OH)6 |
| Cu | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Zn | Zinc | |
| Zn | β Sphalerite | ZnS |
| As | Arsenic | |
| As | β Rammelsbergite | NiAs2 |
| As | β Nickeline | NiAs |
| As | β Gersdorffite | NiAsS |
| As | β Cobaltite | CoAsS |
| As | β Glaucodot | (Co0.50Fe0.50)AsS |
| As | β Arsenopyrite | FeAsS |
| As | β Pararammelsbergite | NiAs2 |
| As | β Annabergite | Ni3(AsO4)2 · 8H2O |
| As | β Maucherite | Ni11As8 |
| As | β MetanovΓ‘Δekite | Mg(UO2)2(AsO4)2 · 8H2O |
| As | β Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| As | β Skutterudite | CoAs3 |
| As | β LΓΆllingite | FeAs2 |
| Se | Selenium | |
| Se | β Clausthalite | PbSe |
| Se | β Selenium | Se |
| Se | β Paraguanajuatite | Bi2Se3 |
| Sr | Strontium | |
| Sr | β Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Sr | β Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | β Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Mo | Molybdenum | |
| Mo | β Jordisite | MoS2 |
| Mo | β Molybdenite | MoS2 |
| Mo | β Wulfenite | Pb(MoO4) |
| Sb | Antimony | |
| Sb | β Hauchecornite | Ni9BiSbS8 |
| Te | Tellurium | |
| Te | β Tellurium | Te |
| Te | β Altaite | PbTe |
| Te | β Calaverite | AuTe2 |
| Ce | Cerium | |
| Ce | β Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Ce | β Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| Au | Gold | |
| Au | β Gold | Au |
| Au | β Calaverite | AuTe2 |
| Pb | Lead | |
| Pb | β Galena | PbS |
| Pb | β Altaite | PbTe |
| Pb | β Clausthalite | PbSe |
| Pb | β Wulfenite | Pb(MoO4) |
| Pb | β Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| Bi | Bismuth | |
| Bi | β Bismutohauchecornite | Ni9Bi2S8 |
| Bi | β Paraguanajuatite | Bi2Se3 |
| Bi | β Hauchecornite | Ni9BiSbS8 |
| U | Uranium | |
| U | β Uraninite var. Pitchblende | UO2 |
| U | β Coffinite | U(SiO4) · nH2O |
| U | β Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| U | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| U | β Uraninite | UO2 |
| U | β Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| U | β Rutherfordine | (UO2)CO3 |
| U | β MetanovΓ‘Δekite | Mg(UO2)2(AsO4)2 · 8H2O |
| U | β UM1978-10-O:U | U3O7 |
| U | β Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| U | β Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| U | β Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| U | β Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| U | β Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| U | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | β Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
Localities in this Region
- Saskatchewan
- Athabasca Basin
- Saskatchewan
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
McArthur River Mine, Athabasca Basin, Saskatchewan, Canada