Alzo, Pella, Novara Province, Piedmont, Italyi
| Regional Level Types | |
|---|---|
| Alzo | - not defined - |
| Pella | Commune |
| Novara Province | Province |
| Piedmont | Region |
| Italy | - not defined - |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
45° 47' 33'' North , 8° 22' 43'' East
Latitude & Longitude (decimal):
KΓΆppen climate type:
Mindat Locality ID:
47871
Long-form identifier:
mindat:1:2:47871:8
GUID (UUID V4):
9ea6c000-4840-42ff-9b62-9bae2362e0a9
Name(s) in local language(s):
Alzo, Pella, Provincia di Novara, Piemonte, Italia
Old granite quarry, closed from many years.
Minerals are found in granites occurring in the west side of Lake Orta.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| β Albite Formula: Na(AlSi3O8) |
| β Arsenopyrite Formula: FeAsS |
| β Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH |
| β Calcite Formula: CaCO3 |
| β Chalcopyrite Formula: CuFeS2 |
| β Covellite Formula: CuS |
| β Fluorapatite Formula: Ca5(PO4)3F |
| β Fluorite Formula: CaF2 |
| β Opal Formula: SiO2 · nH2O |
| β Opal var. Opal-AN Formula: SiO2 · nH2O |
| β Orthoclase Formula: K(AlSi3O8) |
| β Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| β Pyrrhotite Formula: Fe1-xS |
| β Quartz Formula: SiO2 |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| β Xenotime-(Y) Formula: Y(PO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Covellite | 2.CA.05a | CuS |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Quartz | 4.DA.05 | SiO2 |
| β | Opal var. Opal-AN | 4.DA.10 | SiO2 Β· nH2O |
| β | 4.DA.10 | SiO2 Β· nH2O | |
| Group 5 - Nitrates and Carbonates | |||
| β | Calcite | 5.AB.05 | CaCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| β | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| β | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| β | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] Β· nH2O |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | β Opal var. Opal-AN | SiO2 · nH2O |
| H | β Opal | SiO2 · nH2O |
| H | β Prehnite | Ca2Al2Si3O10(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| B | Boron | |
| B | β Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Calcite | CaCO3 |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Calcite | CaCO3 |
| O | β Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Opal var. Opal-AN | SiO2 · nH2O |
| O | β Opal | SiO2 · nH2O |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Prehnite | Ca2Al2Si3O10(OH)2 |
| O | β Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | β Xenotime-(Y) | Y(PO4) |
| F | Fluorine | |
| F | β Fluorapatite | Ca5(PO4)3F |
| F | β Fluorite | CaF2 |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | β Opal var. Opal-AN | SiO2 · nH2O |
| Si | β Opal | SiO2 · nH2O |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| P | Phosphorus | |
| P | β Fluorapatite | Ca5(PO4)3F |
| P | β Xenotime-(Y) | Y(PO4) |
| S | Sulfur | |
| S | β Arsenopyrite | FeAsS |
| S | β Chalcopyrite | CuFeS2 |
| S | β Covellite | CuS |
| S | β Pyrrhotite | Fe1-xS |
| K | Potassium | |
| K | β Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | β Calcite | CaCO3 |
| Ca | β Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Fluorite | CaF2 |
| Ca | β Prehnite | Ca2Al2Si3O10(OH)2 |
| Fe | Iron | |
| Fe | β Arsenopyrite | FeAsS |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Covellite | CuS |
| As | Arsenic | |
| As | β Arsenopyrite | FeAsS |
| Y | Yttrium | |
| Y | β Xenotime-(Y) | Y(PO4) |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
