Dzhelisu Massif, Upper Khodzhaachkan River, Sokh Valley, Batken Region, Kyrgyzstani
| Regional Level Types | |
|---|---|
| Dzhelisu Massif | Massif |
| Upper Khodzhaachkan River | River |
| Sokh Valley | Valley |
| Batken Region | Region |
| Kyrgyzstan | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude:
39° North , 70° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~144km
Type:
Mindat Locality ID:
5476
Long-form identifier:
mindat:1:2:5476:1
GUID (UUID V4):
9a719b81-144e-4a58-85be-b1b0b0dac44a
Name(s) in local language(s):
ΠΠΆΠ΅Π»ΠΈΡΡ
Alkaline syenite massif near junction of rivers Dzhelisu, Laisu and Gaumysh.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| β Aegirine Formula: NaFe3+Si2O6 |
| β Albite Formula: Na(AlSi3O8) |
| β Astrophyllite Formula: K2NaFe2+7Ti2Si8O26(OH)4F References: |
| β Bafertisite Formula: Ba2Fe2+4Ti2(Si2O7)2O2(OH)2F2 References: |
| β Baotite Formula: Ba4(Ti,Nb,W)8O16(SiO3)4Cl References: |
| β Barylite Formula: Be2Ba(Si2O7) References: |
| β Byzantievite Formula: Ba5(Ca,REE,Y)22(Ti,Nb)18(SiO4)4[(PO4),(SiO4)]4(BO3)9O22[(OH),F]43(H2O)1.5 References: |
| β Fluorapatite Formula: Ca5(PO4)3F |
| β Fluorite Formula: CaF2 |
| β Nepheline Formula: Na3K(Al4Si4O16) |
| β Quartz Formula: SiO2 |
| β Titanite Formula: CaTi(SiO4)O |
| β Turkestanite (TL) Formula: (K,◻)(Ca,Na)2ThSi8O20 · nH2O Type Locality: References: Pautov, L. A., Agakhanov, A. A., Sokolova, E. V., Kabalov, Y. K. (1997) Turkestanite Th(Ca,Na)2(K1-xβ»x)Si8O20Β·nH2O β a new mineral. Zapiski Vserossijskogo Mineralogicheskogo Obshchestva, 126 (6) 45-55 |
| β Zircon Formula: Zr(SiO4) References: |
List of minerals arranged by Strunz 10th Edition classification
| Group 3 - Halides | |||
|---|---|---|---|
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Quartz | 4.DA.05 | SiO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | Byzantievite | 9.AH.50 | Ba5(Ca,REE,Y)22(Ti,Nb)18(SiO4)4[(PO4),(SiO4)]4(BO3)9O22[(OH),F]43(H2O)1.5 |
| β | Barylite | 9.BB.15 | Be2Ba(Si2O7) |
| β | Bafertisite | 9.BE.55 | Ba2Fe2+4Ti2(Si2O7)2O2(OH)2F2 |
| β | Baotite | 9.CE.15 | Ba4(Ti,Nb,W)8O16(SiO3)4Cl |
| β | Turkestanite (TL) | 9.CH.10 | (K,β»)(Ca,Na)2ThSi8O20 Β· nH2O |
| β | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| β | Astrophyllite | 9.DC.05 | K2NaFe2+7Ti2Si8O26(OH)4F |
| β | Nepheline | 9.FA.05 | Na3K(Al4Si4O16) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| H | β Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| H | β Turkestanite | (K,◻)(Ca,Na)2ThSi8O20 · nH2O |
| H | β Byzantievite | Ba5(Ca,REE,Y)22(Ti,Nb)18(SiO4)4[(PO4),(SiO4)]4(BO3)9O22[(OH),F]43(H2O)1.5 |
| Be | Beryllium | |
| Be | β Barylite | Be2Ba(Si2O7) |
| B | Boron | |
| B | β Byzantievite | Ba5(Ca,REE,Y)22(Ti,Nb)18(SiO4)4[(PO4),(SiO4)]4(BO3)9O22[(OH),F]43(H2O)1.5 |
| O | Oxygen | |
| O | β Aegirine | NaFe3+Si2O6 |
| O | β Albite | Na(AlSi3O8) |
| O | β Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| O | β Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| O | β Baotite | Ba4(Ti,Nb,W)8O16(SiO3)4Cl |
| O | β Barylite | Be2Ba(Si2O7) |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Nepheline | Na3K(Al4Si4O16) |
| O | β Quartz | SiO2 |
| O | β Titanite | CaTi(SiO4)O |
| O | β Zircon | Zr(SiO4) |
| O | β Turkestanite | (K,◻)(Ca,Na)2ThSi8O20 · nH2O |
| O | β Byzantievite | Ba5(Ca,REE,Y)22(Ti,Nb)18(SiO4)4[(PO4),(SiO4)]4(BO3)9O22[(OH),F]43(H2O)1.5 |
| F | Fluorine | |
| F | β Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| F | β Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| F | β Fluorapatite | Ca5(PO4)3F |
| F | β Fluorite | CaF2 |
| F | β Byzantievite | Ba5(Ca,REE,Y)22(Ti,Nb)18(SiO4)4[(PO4),(SiO4)]4(BO3)9O22[(OH),F]43(H2O)1.5 |
| Na | Sodium | |
| Na | β Aegirine | NaFe3+Si2O6 |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| Na | β Nepheline | Na3K(Al4Si4O16) |
| Na | β Turkestanite | (K,◻)(Ca,Na)2ThSi8O20 · nH2O |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Nepheline | Na3K(Al4Si4O16) |
| Si | Silicon | |
| Si | β Aegirine | NaFe3+Si2O6 |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| Si | β Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Si | β Baotite | Ba4(Ti,Nb,W)8O16(SiO3)4Cl |
| Si | β Barylite | Be2Ba(Si2O7) |
| Si | β Nepheline | Na3K(Al4Si4O16) |
| Si | β Quartz | SiO2 |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Zircon | Zr(SiO4) |
| Si | β Turkestanite | (K,◻)(Ca,Na)2ThSi8O20 · nH2O |
| Si | β Byzantievite | Ba5(Ca,REE,Y)22(Ti,Nb)18(SiO4)4[(PO4),(SiO4)]4(BO3)9O22[(OH),F]43(H2O)1.5 |
| P | Phosphorus | |
| P | β Fluorapatite | Ca5(PO4)3F |
| P | β Byzantievite | Ba5(Ca,REE,Y)22(Ti,Nb)18(SiO4)4[(PO4),(SiO4)]4(BO3)9O22[(OH),F]43(H2O)1.5 |
| Cl | Chlorine | |
| Cl | β Baotite | Ba4(Ti,Nb,W)8O16(SiO3)4Cl |
| K | Potassium | |
| K | β Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| K | β Nepheline | Na3K(Al4Si4O16) |
| K | β Turkestanite | (K,◻)(Ca,Na)2ThSi8O20 · nH2O |
| Ca | Calcium | |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Fluorite | CaF2 |
| Ca | β Titanite | CaTi(SiO4)O |
| Ca | β Turkestanite | (K,◻)(Ca,Na)2ThSi8O20 · nH2O |
| Ca | β Byzantievite | Ba5(Ca,REE,Y)22(Ti,Nb)18(SiO4)4[(PO4),(SiO4)]4(BO3)9O22[(OH),F]43(H2O)1.5 |
| Ti | Titanium | |
| Ti | β Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| Ti | β Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Ti | β Baotite | Ba4(Ti,Nb,W)8O16(SiO3)4Cl |
| Ti | β Titanite | CaTi(SiO4)O |
| Ti | β Byzantievite | Ba5(Ca,REE,Y)22(Ti,Nb)18(SiO4)4[(PO4),(SiO4)]4(BO3)9O22[(OH),F]43(H2O)1.5 |
| Fe | Iron | |
| Fe | β Aegirine | NaFe3+Si2O6 |
| Fe | β Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| Fe | β Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Y | Yttrium | |
| Y | β Byzantievite | Ba5(Ca,REE,Y)22(Ti,Nb)18(SiO4)4[(PO4),(SiO4)]4(BO3)9O22[(OH),F]43(H2O)1.5 |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | β Baotite | Ba4(Ti,Nb,W)8O16(SiO3)4Cl |
| Nb | β Byzantievite | Ba5(Ca,REE,Y)22(Ti,Nb)18(SiO4)4[(PO4),(SiO4)]4(BO3)9O22[(OH),F]43(H2O)1.5 |
| Ba | Barium | |
| Ba | β Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Ba | β Baotite | Ba4(Ti,Nb,W)8O16(SiO3)4Cl |
| Ba | β Barylite | Be2Ba(Si2O7) |
| Ba | β Byzantievite | Ba5(Ca,REE,Y)22(Ti,Nb)18(SiO4)4[(PO4),(SiO4)]4(BO3)9O22[(OH),F]43(H2O)1.5 |
| W | Tungsten | |
| W | β Baotite | Ba4(Ti,Nb,W)8O16(SiO3)4Cl |
| Th | Thorium | |
| Th | β Turkestanite | (K,◻)(Ca,Na)2ThSi8O20 · nH2O |
Other Regions, Features and Areas containing this locality
AsiaContinent
- Tian ShanGroup of Mountain Ranges
Eurasian PlateTectonic Plate
Soviet Union (1922-1991)Country
TurkestanArea
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
