Bamble, Telemark, Norwayi
| Regional Level Types | |
|---|---|
| Bamble | Municipality |
| Telemark | County |
| Norway | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Herre | 1,356 (2013) |
Mindat Locality ID:
6398
Long-form identifier:
mindat:1:2:6398:5
GUID (UUID V4):
75ffb636-a455-4ce1-befb-ecf534920cb5
Other/historical names associated with this locality:
Bamle
Other Languages:
French:
Bamble, Telemark, Norvège
German:
Bamble, Telemark, Norwegen
Italian:
Bamble, Telemark, Norvegia
Norwegian:
Bamble, Telemark, Norge
Russian:
Бамбле, Телемарк, Норвегия
Simplified Chinese:
班布勒, 泰勒马克, 挪威
Spanish:
Bamble, Telemark, Noruega
Albanian:
Bamble, Telemark, Norvegjia
Arabic:
بامبله, تلمارك, النرويج
Asturian:
Bamble, Telemark, Noruega
Basque:
Bamble, Telemark, Norvegia
Bavarian:
Bamble, Norwegn
Bishnupriya Manipuri:
বামব্লে, টেলেমার্ক, নরৱে
Bulgarian:
Бамбле, Телемарк, Норвегия
Catalan:
Bamble, Telemark, Noruega
Cebuano:
Bamble, Telemark fylke, Norway
Danish:
Bamble, Telemark, Norge
Dutch:
Bamble, Telemark, Noorwegen
Esperanto:
Bamble, Telemark, Norvegio
Estonian:
Bamble vald, Telemark, Norra
Finnish:
Bamble, Telemarkin lääni, Norja
Latin:
Bamble, Telemark, Norvegia
Limburgian:
Bamble, Telemark, Noorwege
Lithuanian:
Bamblė, Telemarkas, Norvegija
Low Saxon/Low German:
Kommun Bamble, Amt Telemark, Norwegen
Malay:
Bamble, Norway
Minnan / Hokkien-Taiwanese:
Bamble, Telemark, Lo̍k-ui
Northern Sami:
Bamble, Telemárkku fylka, Norga
Norwegian (Nynorsk):
Bamble, Telemark fylke, Noreg
Polish:
Bamble, Telemark, Norwegia
Portuguese:
Bamble, Telemark, Noruega
Romanian:
Bamble, Telemark, Norvegia
Slovenian:
Bamble, Telemark, Norveška
Swahili:
Bamble, Norwei
Swedish:
Bamble, Telemark, Norge
Vietnamese:
Bamble, Telemark, Na Uy
Waray:
Bamble, Telemark, Noruega
Many minerals that are described in the literature from "Bamble" are from the geographical and political unity called Bamble in the County of Telemark, but the designation "Bamble" may also (especially in geological litterature) refer to a geological term and area called "the Bamble sector", a high grade metamorphic gneiss terrain in the southern Norway that covers a much larger area from Lillesand in the southwest and to Bamble in the northeast.
NOTE:
On an old map made by Kristen Dale I found two new localities he probably visited in the 60's.
59.073190984124004,9.555187225341799 (sphalerite/galena)
59.071338227822636,9.562418460845949 (siderite)
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities80 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 10 localities in this region. Description: This albite was first descibed by v. Kobell as Tschermakit |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] Localities: |
| ⓘ 'Alkali Feldspar' Localities: Reported from at least 6 localities in this region. |
| ⓘ Allanite-(Y) Formula: (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Localities: Reported from at least 8 localities in this region. Description: Hornblende ? References: |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andalusite Formula: Al2(SiO4)O Locality: Fossingfjord, Bamble, Telemark, Norway |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Locality: Trosby, Bamble, Telemark, Norway |
| ⓘ Anthophyllite Formula: ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: Reported from at least 21 localities in this region. References: |
| ⓘ Arsenopyrite Formula: FeAsS Localities: References: |
| ⓘ 'Asbestos' |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 7 localities in this region. Description: The mine has produced fine, large specimens of yellow to orange to faintly bluish baryte crystals, some of them transparent, in beautiful clusters with individuals to 15 cm across |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 21 localities in this region. |
| ⓘ Bobierrite Formula: Mg3(PO4)2 · 8H2O Description: Michel (1893) described a new mineral from Ødegården and named it "hautefeuillite". Barth (1937) showed it to be identical with bobierrite. |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 20 localities in this region. |
| ⓘ Chamosite Formula: (Fe2+)5Al(Si,Al)4O10(OH,O)8 Locality: Bjordam, Bamble, Telemark, Norway |
| ⓘ Chlorapatite Formula: Ca5(PO4)3Cl Localities: Reported from at least 6 localities in this region. Description: Chlorapatite occure usualy as honey-/golden-yellow masses. Crystals are more rare. |
| ⓘ 'Chlorite Group' Localities: |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: References: |
| ⓘ Clinochlore var. Pennine Formula: Mg5Al(AlSi3O10)(OH)8 Locality: Bjordam, Bamble, Telemark, Norway |
| ⓘ Clinochlore var. Sheridanite Formula: (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| ⓘ 'Clinochrysotile' |
| ⓘ 'Clinopyroxene Subgroup' |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Locality: Kjørstad, Bamble, Telemark, Norway |
| ⓘ 'Coal blend' Localities: |
| ⓘ Copper Formula: Cu Locality: Høgenhei, Bamble, Telemark, Norway |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) Localities: |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: |
| ⓘ Dumortierite Formula: Al(Al2O)(Al2O)2(SiO4)3(BO3) Localities: |
| ⓘ Enstatite Formula: Mg2Si2O6 Localities: Reported from at least 7 localities in this region. |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: |
| ⓘ Epidote var. Yttroepidote Formula: {(Ca,Y)2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| ⓘ 'Feldspar Group' Localities: Reported from at least 10 localities in this region. |
| ⓘ 'Feldspar Group var. Sunstone' Localities: |
| ⓘ Fergusonite-(Y) Formula: YNbO4 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluor-dravite ? Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3F Locality: Bjordam, Bamble, Telemark, Norway Description: Added without any info on analysis. |
| ⓘ Gadolinite-(Y) Formula: Y2Fe2+Be2Si2O10 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 10 localities in this region. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: |
| ⓘ Gedrite Formula: ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 References: |
| ⓘ Goethite Formula: α-Fe3+O(OH) References: |
| ⓘ Graphite Formula: C |
| ⓘ 'Gummite' Localities: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: References: |
| ⓘ Halloysite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Hellandite-(Y) ? Formula: (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 9 localities in this region. |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Localities: |
| ⓘ Hercynite Formula: Fe2+Al2O4 Localities: |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) Description: Morton & Catanzaro (1964) states that hydroxylapatite is a product of metasomatosis of the primary chlorapatite. Chlorapatite usualy being transparent golden-yellow, while hydroxylapatite usaly is yellowish-white, bone like.
|
| ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite Formula: Ca5(PO4,CO3)3(OH,O) Habit: As 6-8 mm crust and veins on/in red apatite-(CaCl) Colour: pale yellowish white Description: Brøgger & Bäckström (1888) described "dahllite" as a new mineral from Ødegården. |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 Localities: |
| ⓘ 'Hypersthene' Formula: (Mg,Fe)SiO3 Localities: |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 14 localities in this region. References: |
| ⓘ 'Iron-bearing pargasite' Localities: |
| ⓘ Isokite Formula: CaMg(PO4)F Localities: Colour: colorless |
| ⓘ 'K Feldspar' Localities: Reported from at least 6 localities in this region. |
| ⓘ Kornerupine Formula: Mg3Al6(Si,Al,B)5O21(OH) Habit: elongated crystals to 1 cm in breadth Colour: green grey |
| ⓘ Kyanite Formula: Al2(SiO4)O Localities: |
| ⓘ Magnesio-hastingsite Formula: NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 Localities: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 8 localities in this region. |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Locality: Tråk (Tråg), Bamble, Telemark, Norway |
| ⓘ Marialite Formula: Na4Al3Si9O24Cl Description: Analyses of scapolite from Ødegården gives meionite "(CO3)" percentage from 20% to 25%, and anorthite "Ca" percentage from 23% to 30%, clearly showind a marialite dominance.
Marialite can be found as several centimeter-long euhedral crystals, and some plases marialite can constitute up to 85% of the rock ("Ødegårdite" = scapolitized metagabbro/amphibolites). |
| ⓘ 'Mica Group' Localities: |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Reported from at least 6 localities in this region. |
| ⓘ Millerite Formula: NiS |
| ⓘ Molybdenite Formula: MoS2 Locality: Tråk (Tråg), Bamble, Telemark, Norway |
| ⓘ 'Monazite' Formula: REE(PO4) |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) Locality: Isvann, Bamble, Telemark, Norway |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Orthopyroxene Subgroup' Localities: |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 Localities: Meikjær Mine, Skjilbreia, Bamble Nickel Mines, Bamble, Telemark, Norway Stoltz Mine, Skjilbreia, Bamble Nickel Mines, Bamble, Telemark, Norway Vissestad Mine, Nystein, Bamble Nickel Mines, Bamble, Telemark, Norway Nystein Mine, Nystein, Bamble Nickel Mines, Bamble, Telemark, Norway Hansås Mine, Nystein, Bamble Nickel Mines, Bamble, Telemark, Norway |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Phlogopite-3T' |
| ⓘ 'Pinite' Locality: Bjordam, Bamble, Telemark, Norway |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: Reported from at least 17 localities in this region. |
| ⓘ Formula: Fe2TiO5 Locality: Wagnerite Prospect, Midtre Havredal, Havredal, Bamble, Telemark, Norway - erroneously reported Description: Smith (1969) has showed that the "pseudobrookite" from Havredal in fact consists of an extremely fine-grained mixture of hematite and rutile with a lesser amount of quartz and chlorite |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 19 localities in this region. |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 10 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 31 localities in this region. |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Scapolite' Localities: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: |
| ⓘ Siderite Formula: FeCO3 Localities: |
| ⓘ Sillimanite Formula: Al2(SiO4)O Localities: Description: Erdmann describe what he thinks ia a new mineral as "bamblite", from a locality '1 mile south of Brevig' (Bamble area). This proved later to be sillimanite.
Sillimanite is not uncommon in gneisses and pegmatites related to gneisses in Bamble. |
| ⓘ Silver Formula: Ag Locality: Tråk (Tråg), Bamble, Telemark, Norway |
| ⓘ Sodalite Formula: Na4(Si3Al3)O12Cl Description: From Langesundfjord. |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 Locality: Tråk (Tråg), Bamble, Telemark, Norway |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 10 localities in this region. |
| ⓘ Spodumene Formula: LiAlSi2O6 Description: Sample in Collection of L`Ecole des Mines, Paris, labelled "Pegmatite à tourmaline & triphane, Bamble, Norvége". The very precise locality not known. |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: |
| ⓘ Talc var. Steatite Formula: Mg3(Si4O10)(OH)2 Localities: References: |
| ⓘ Thorite Formula: Th(SiO4) Localities: Description: Found in a plagioclasepegmatite vein, the socalled "dipyrgangen" |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Reported from at least 9 localities in this region. |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Vaesite Formula: NiS2 |
| ⓘ Violarite Formula: Fe2+Ni3+2S4 Localities: |
| ⓘ Vivianite ? Formula: Fe2+Fe2+2(PO4)2 · 8H2O Description: A blue mineral containing phosphate and iron was described by Brøgger & Reusch, from clay at the foot of the hill. This is probably vivianite. |
| ⓘ Wagnerite Formula: (Mg,Fe2+)2(PO4)F Localities: Reported from at least 6 localities in this region. Description: Kobell is the first to describe wagnerite from Bamble, but believe it's a new mineral and call it "kjerulfin". Bauer suspect it to be wagnerite, and Brøgger indicate a strong relation ship or the posibillity that they are identical. Pisani is the first to prove that "kjerulfin" is wagnerite. |
| ⓘ Whitlockite Formula: Ca9Mg(PO4)6(PO3OH) Description: Massive cavity fillings with woodhouseite, in a chlor-hydroxy-oxyapatite |
| ⓘ Woodhouseite Formula: CaAl3(PO4)(SO4)(OH)6 Description: Woodhoseite occure in cavities in a chlor-hydroxy-oxyapatite together with quarts and whitlockite, as violet to purple crystals up to 1,5mm. |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: |
| ⓘ Xenotime-(Y) Formula: Y(PO4) Localities: Description: Only found in a thin section from a pegmatite (Røsholt 1967). |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 6 localities in this region. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Violarite | 2.DA.05 | Fe2+Ni3+2S4 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Vaesite | 2.EB.05a | NiS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hercynite | 4.BB.05 | Fe2+Al2O4 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Pseudobrookite ? | 4.CB.15 | Fe2TiO5 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Fergusonite-(Y) | 7.GA.05 | YNbO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Whitlockite | 8.AC.45 | Ca9Mg(PO4)6(PO3OH) |
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Wagnerite | 8.BB.15 | (Mg,Fe2+)2(PO4)F |
| ⓘ | Isokite | 8.BH.10 | CaMg(PO4)F |
| ⓘ | Woodhouseite | 8.BL.05 | CaAl3(PO4)(SO4)(OH)6 |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | var. Carbonate-rich Hydroxylapatite | 8.BN.05 | Ca5(PO4,CO3)3(OH,O) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Chlorapatite | 8.BN.05 | Ca5(PO4)3Cl |
| ⓘ | Bobierrite | 8.CE.35 | Mg3(PO4)2 · 8H2O |
| ⓘ | Vivianite ? | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Dumortierite | 9.AJ.10 | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Gadolinite-(Y) | 9.AJ.20 | Y2Fe2+Be2Si2O10 |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Epidote var. Yttroepidote | 9.BG.05a | {(Ca,Y)2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Y) | 9.BG.05b | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Kornerupine | 9.BJ.50 | Mg3Al6(Si,Al,B)5O21(OH) |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Fluor-dravite ? | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Anthophyllite | 9.DD.05 | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Gedrite | 9.DD.05 | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| ⓘ | Magnesio-hastingsite | 9.DE.15 | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ | Hellandite-(Y) ? | 9.DK.20 | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | var. Steatite | 9.EC.05 | Mg3(Si4O10)(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Clinochlore var. Pennine | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 | |
| ⓘ | var. Sheridanite | 9.EC.55 | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ | 'Clinochrysotile' | 9.ED. | |
| ⓘ | Halloysite | 9.ED.10 | Al2(Si2O5)(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | 9.FA.35 | Na(AlSi3O8) | |
| ⓘ | Sodalite | 9.FB.10 | Na4(Si3Al3)O12Cl |
| ⓘ | Marialite | 9.FB.15 | Na4Al3Si9O24Cl |
| Unclassified | |||
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Asbestos' | - | |
| ⓘ | 'Phlogopite-3T' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Feldspar Group var. Sunstone' | - | |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Iron-bearing pargasite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Pinite' | - | |
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Gummite' | - | |
| ⓘ | 'Hypersthene' | - | (Mg,Fe)SiO3 |
| ⓘ | 'Alkali Feldspar' | - | |
| ⓘ | 'Coal blend' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Bobierrite | Mg3(PO4)2 · 8H2O |
| H | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| H | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| H | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| H | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| H | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| H | ⓘ Epidote var. Yttroepidote | {(Ca,Y)2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Li | Lithium | |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Be | Beryllium | |
| Be | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| B | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bobierrite | Mg3(PO4)2 · 8H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| O | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| O | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fergusonite-(Y) | YNbO4 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| O | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| O | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hercynite | Fe2+Al2O4 |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Isokite | CaMg(PO4)F |
| O | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Marialite | Na4Al3Si9O24Cl |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pseudobrookite | Fe2TiO5 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Wagnerite | (Mg,Fe2+)2(PO4)F |
| O | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| O | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| O | ⓘ Epidote var. Yttroepidote | {(Ca,Y)2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Isokite | CaMg(PO4)F |
| F | ⓘ Wagnerite | (Mg,Fe2+)2(PO4)F |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Na | ⓘ Marialite | Na4Al3Si9O24Cl |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| Mg | Magnesium | |
| Mg | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Bobierrite | Mg3(PO4)2 · 8H2O |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Mg | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Mg | ⓘ Isokite | CaMg(PO4)F |
| Mg | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Mg | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Wagnerite | (Mg,Fe2+)2(PO4)F |
| Mg | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| Mg | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| Mg | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Al | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| Al | ⓘ Hercynite | Fe2+Al2O4 |
| Al | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Al | ⓘ Marialite | Na4Al3Si9O24Cl |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| Al | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| Al | ⓘ Epidote var. Yttroepidote | {(Ca,Y)2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Si | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Si | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Si | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Si | ⓘ Marialite | Na4Al3Si9O24Cl |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| Si | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| Si | ⓘ Epidote var. Yttroepidote | {(Ca,Y)2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| P | Phosphorus | |
| P | ⓘ Bobierrite | Mg3(PO4)2 · 8H2O |
| P | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| P | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Isokite | CaMg(PO4)F |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Wagnerite | (Mg,Fe2+)2(PO4)F |
| P | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| P | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Vaesite | NiS2 |
| S | ⓘ Violarite | Fe2+Ni23+S4 |
| S | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Cl | ⓘ Marialite | Na4Al3Si9O24Cl |
| Cl | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| Ca | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Isokite | CaMg(PO4)F |
| Ca | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| Ca | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Epidote var. Yttroepidote | {(Ca,Y)2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Pseudobrookite | Fe2TiO5 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hercynite | Fe2+Al2O4 |
| Fe | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pseudobrookite | Fe2TiO5 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Violarite | Fe2+Ni23+S4 |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Wagnerite | (Mg,Fe2+)2(PO4)F |
| Fe | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| Fe | ⓘ Epidote var. Yttroepidote | {(Ca,Y)2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Ni | Nickel | |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Vaesite | NiS2 |
| Ni | ⓘ Violarite | Fe2+Ni23+S4 |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Zn | Zinc | |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Y | Yttrium | |
| Y | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Y | ⓘ Fergusonite-(Y) | YNbO4 |
| Y | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Y | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Y | ⓘ Epidote var. Yttroepidote | {(Ca,Y)2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Fergusonite-(Y) | YNbO4 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Silver | Ag |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Th | Thorium | |
| Th | ⓘ Thorite | Th(SiO4) |
| U | Uranium | |
| U | ⓘ Uraninite | UO2 |
Fossils
There are 7 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 41 |
|---|---|
| Youngest Fossil Listed | 446 Ma (Late/Upper Ordovician) |
| Oldest Fossil Listed | 541 Ma (Cambrian) |
| Stratigraphic Units | Click here to view 8 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 7 fossil localities |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Bamble |
|---|---|
| Wikidata ID: | Q484052 |
| GeoNames ID: | 3162078 |
Localities in this Region
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Bamble, Telemark, Norway