Ősi Hill, Pákozd, Gárdony District, Fejér County, Hungaryi
| Regional Level Types | |
|---|---|
| Ősi Hill | Hill |
| Pákozd | Village |
| Gárdony District | District |
| Fejér County | County |
| Hungary | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
47° North , 18° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~7km
Locality type:
Köppen climate type:
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 Reference: GEODA 2004 |
| ⓘ Cerussite Formula: PbCO3 Reference: Mineral Species of Hungary, 2005 |
| ⓘ Chalcopyrite Formula: CuFeS2 Reference: GEODA 2004 |
| ⓘ Covellite Formula: CuS Reference: GEODA 2004 |
| ⓘ Fluorite Formula: CaF2 Reference: GEODA 2004 |
| ⓘ Galena Formula: PbS Reference: Mineral Species of Hungary, 2005 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Reference: GEODA 2004 |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Reference: Szakáll & Gatter: Hun. Min. Spec., 1993 |
| ⓘ Pyrite Formula: FeS2 Reference: GEODA 2004 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Reference: Mineral Species of Hungary, 2005 |
| ⓘ Smithsonite Formula: ZnCO3 Reference: Mineral Species of Hungary, 2005 |
| ⓘ Sphalerite Formula: ZnS Reference: Mineral Species of Hungary, 2005 |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Reference: Mineral Species of Hungary, 2005 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| Group 9 - Silicates | |||
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Unclassified Minerals, Rocks, etc. | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| O | Oxygen | |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| S | Sulfur | |
| S | ⓘ Covellite | CuS |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Fluorite | CaF2 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Fe | Iron | |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Sb | Antimony | |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Cerussite | PbCO3 |
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopMineral List
