Croesus Gold Mine (Hannans Croesus; Croesus Proprietary), Kalgoorlie Consolidated Gold Mines, Kalgoorlie-Boulder, Kalgoorlie-Boulder Shire, Western Australia, Australiai
| Regional Level Types | |
|---|---|
| Croesus Gold Mine (Hannans Croesus; Croesus Proprietary) | Mine |
| Kalgoorlie Consolidated Gold Mines | Group of Mines |
| Kalgoorlie-Boulder | - not defined - |
| Kalgoorlie-Boulder Shire | Shire |
| Western Australia | State |
| Australia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
30° 45' 44'' South , 121° 29' 34'' East
Latitude & Longitude (decimal):
Type:
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Williamstown | 161 (2018) | 1.6km |
| Boulder | 5,178 (2017) | 2.2km |
| Kalgoorlie | 31,107 (2014) | 2.5km |
| Stoneville | 2,841 (2016) | 28.6km |
| Coolgardie | 802 (2016) | 37.9km |
Mindat Locality ID:
272333
Long-form identifier:
mindat:1:2:272333:7
GUID (UUID V4):
0e91b5c6-b7c8-4c36-ba94-f244adbecb8f
The Croesus Gold Mine is now part of the western edge of the Superpit. The Croesus Proprietary was a London based company which developed the mine from the late 1890's. The gold was found at depth in the calc-schist, for a long time a rock thought to carry no gold on the Golden Mile. Gold was described as fine and frosting the matrix.
Operations appeared to go continuously until a lack of labour during the Great War years forced its closure. Charles Edwin Bond died when he fell down a shaft in 1914.
In 1913, the Oroya Links company from neighbouring Brownhill lease controls the mine, but sell it in 1928 to the North Kalgurli (1912) Limited.
In January 1929, the South Kalgurli Consolidated took a 10 year tribute over the mine from North Kalgurli (1912) Limited. The shaft had reached a depth of 1050 feet. Their operations continued beyond the 10 years, with a new plant and steel headframe erected in 1947. The mine was still operational in the early 1950's when the sources stop.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
11 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| β Albite Formula: Na(AlSi3O8) |
| β Anhydrite Formula: CaSO4 |
| β Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| β Calaverite Formula: AuTe2 |
| β Chalcopyrite Formula: CuFeS2 |
| β 'Chlorite Group' |
| β Chloritoid Formula: (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| β Gold Formula: Au |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| β Petzite Formula: Ag3AuTe2 |
| β Quartz Formula: SiO2 |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| β 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| β 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Gold | 1.AA.05 | Au |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Petzite | 2.BA.75 | Ag3AuTe2 |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Calaverite | 2.EA.10 | AuTe2 |
| β | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| β | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| Group 4 - Oxides and Hydroxides | |||
| β | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Anhydrite | 7.AD.30 | CaSO4 |
| Group 9 - Silicates | |||
| β | Chloritoid | 9.AF.85 | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| β | 'Chlorite Group' | - | |
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Anhydrite | CaSO4 |
| O | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| S | Sulfur | |
| S | β Anhydrite | CaSO4 |
| S | β Chalcopyrite | CuFeS2 |
| S | β Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | β Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| K | Potassium | |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Anhydrite | CaSO4 |
| Ca | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mn | Manganese | |
| Mn | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Fe | Iron | |
| Fe | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | β Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| As | Arsenic | |
| As | β Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Ag | Silver | |
| Ag | β Petzite | Ag3AuTe2 |
| Sb | Antimony | |
| Sb | β Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Te | Tellurium | |
| Te | β Calaverite | AuTe2 |
| Te | β Petzite | Ag3AuTe2 |
| Au | Gold | |
| Au | β Calaverite | AuTe2 |
| Au | β Gold | Au |
| Au | β Petzite | Ag3AuTe2 |
Other Regions, Features and Areas containing this locality
Australia
- Western Australia
- Kambalda Nickel Metallogenic ProvinceGeologic Province
- West Australian ElementCraton
- Yilgarn CratonCraton
Australian PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
