Unnamed barite-quartz vein, Le Pouget - La Magdeleine area, Chilhac, Brioude, Haute-Loire, Auvergne-Rhône-Alpes, Francei
| Regional Level Types | |
|---|---|
| Unnamed barite-quartz vein | Vein |
| Le Pouget - La Magdeleine area | Area |
| Chilhac | Commune |
| Brioude | Arrondissement |
| Haute-Loire | Department |
| Auvergne-Rhône-Alpes | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
45° North , 3° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~2km
Type:
Köppen climate type:
Mindat Locality ID:
50764
Long-form identifier:
mindat:1:2:50764:9
GUID (UUID V4):
00f3db65-52c9-4eb8-920a-e247a3c8eac5
Other/historical names associated with this locality:
Auvergne; Rhône-Alpes
Barite-quartz-galena vein extending from N of La Magdeleine (on a path N from road D4, in front of Chilhac crossroad), to N of Le Pouget, along Veyssaires brook.
A quartzo-feldspathic pegmatite forms the roof of the vein.
This barite vein seems to cross Belmont-l'Estaing granite/pegmatite with quartz-cassiterite lenses vein, or a similar parallel vein.
Host rocks : leptyno-amphibolitic group and granite with pegmatite lenses.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Description: In galena cleavages. |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ 'Bindheimite' Formula: Pb2Sb2O6O |
| ⓘ Cerussite Formula: PbCO3 Description: Zoned alteration of galena. |
| ⓘ Covellite Formula: CuS Description: In galena cleavages. |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 Description: Inclusions in galena. |
| ⓘ Goethite Formula: α-Fe3+O(OH) |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Pyrargyrite Formula: Ag3SbS3 Description: Inclusions in galena. |
| ⓘ Pyrite Formula: FeS2 Description: In microbrecciated quartz, banded deposits of arsenopyrite-pyrite-marcasite. |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrrhotite Formula: Fe1-xS Description: - In warped crystals, replaced by hematite and goethite, associated with "hot" auburn/tan quartz.
- Associated with sphalerite and replaced by goethite, in quartz veinlets cutting across schorl pegmatites and tourmlinites. |
| ⓘ Quartz Formula: SiO2 Description: Several facies of quartz, corresponding to different stages :
- Microbrecciated greenish-grey to black quartz, with banded mineralization of arsenopyrite, pyrite and marcasite.
- "Hot" auburn/tan quartz brecciating host rocks with pyrrhotite.
- "Hot" white quartz in veinlets with pyrrhotite and sphalerite, cutting across tourmalinites.
- Quartz hyaline to microcrystalline (greenish grey to red), associated with barite. |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Description: In tourmalinites and pegmatites. |
| ⓘ Sphalerite Formula: ZnS |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | 'Bindheimite' | 4.DH.20 | Pb2Sb2O6O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | Oxygen | |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| P | Phosphorus | |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | Antimony | |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Pb | Lead | |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
