Estes Quarry, West Baldwin, Baldwin, Cumberland County, Maine, USAi
| Regional Level Types | |
|---|---|
| Estes Quarry | Quarry |
| West Baldwin | - not defined - |
| Baldwin | - not defined - |
| Cumberland County | County |
| Maine | State |
| USA | Country |
This page kindly sponsored in memory of Gene Bearrs
Latitude & Longitude (WGS84):
43° 51' 27'' North , 70° 47' 13'' West
Latitude & Longitude (decimal):
Type:
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Hiram | 1,479 (2017) | 2.7km |
| Cornish | 1,319 (2017) | 6.0km |
| Denmark | 1,044 (2017) | 12.6km |
| Steep Falls | 1,139 (2017) | 12.9km |
| Brownfield | 1,301 (2017) | 13.2km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Saco Valley Gem and Mineral Club | Conway, New Hampshire | 30km |
| Oxford County Mineral and Gem Association | South Paris, Maine | 46km |
| Maine Mineralogical & Geological Society | Portland, Maine | 48km |
Mindat Locality ID:
6164
Long-form identifier:
mindat:1:2:6164:6
GUID (UUID V4):
b3851f02-5bda-4167-9ad7-91f255d62d3b
Aggregate quarry in West Baldwin. Granite pegmatite. The quarry was opened in the late 1990s adjacent to an existing gravel pit. The geology of the deposit is complex and has been found to contain a remarkable range of rare phosphate minerals (Thompson et al. 2000). Collecting access to the site requires permission of the quarry owner and ordinarily is limited to organized field trips.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
63 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| β Albite Formula: Na(AlSi3O8) |
| β Albite var. Cleavelandite Formula: Na(AlSi3O8) |
| β Almandine Formula: Fe2+3Al2(SiO4)3 |
| β Aragonite Formula: CaCO3 |
| β Arsenopyrite Formula: FeAsS |
| β Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| β Beraunite Formula: Fe3+6(PO4)4O(OH)4 · 6H2O |
| β Beryl Formula: Be3Al2(Si6O18) |
| β Beryllonite Formula: NaBePO4 |
| β Calcite Formula: CaCO3 Description: Occurs in vesicles in basalt dikes associated with epidote. (Thompson et. al., 2000) |
| β Chalcopyrite Formula: CuFeS2 |
| β 'Chamosite-Clinochlore Series' |
| β Childrenite Formula: Fe2+Al(PO4)(OH)2 · H2O |
| β Columbite-(Fe) Formula: Fe2+Nb2O6 |
| β 'Columbite-(Fe)-Columbite-(Mn) Series' |
| β Diadochite Formula: Fe3+2(PO4)(SO4)(OH) · 6H2O |
| β Dolomite Formula: CaMg(CO3)2 |
| β Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Eosphorite Formula: Mn2+Al(PO4)(OH)2 · H2O |
| β Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Description: Occurs in vesicles in basalt dikes with calcite (Thompson et. al, 2000) |
| β Fairfieldite Formula: Ca2Mn2+(PO4)2 · 2H2O |
| β Falsterite Formula: Ca2MgMn2+2Fe2+2Fe3+2Zn4(PO4)8(OH)4(H2O)14 |
| β Fluorapatite Formula: Ca5(PO4)3F |
| β Footemineite Formula: Ca2Mn2+Mn2+2Mn2+2Be4(PO4)6(OH)4 · 6H2O |
| β Gahnite Formula: ZnAl2O4 |
| β Galena Formula: PbS |
| β Graphite Formula: C |
| β Greenockite Formula: CdS |
| β Greifensteinite Formula: Ca2Fe2+5Be4(PO4)6(OH)4 · 6H2O References: |
| β Heterosite Formula: (Fe3+,Mn3+)PO4 |
| β Hydroxylapatite Formula: Ca5(PO4)3(OH) References: |
| β Hydroxylherderite Formula: CaBe(PO4)(OH) |
| β Jahnsite-(CaMnMn) ? Formula: {Ca}{Mn2+}{Mn2+2}{Fe3+2}(PO4)4(OH)2 · 8H2O |
| β 'Jahnsite Group' Formula: XM1M22M32(H2O)8(OH)2(PO4)4 |
| β Laueite ? Formula: Mn2+Fe3+2(PO4)2(OH)2 · 8H2O |
| β 'Lithian Muscovite' Formula: KAl2(AlSi3O10)(OH)2 References: |
| β Lithiophilite Formula: LiMn2+PO4 References: |
| β LΓΆllingite Formula: FeAs2 |
| β Meta-autunite ? Formula: Ca(UO2)2(PO4)2 · 6H2O |
| β Microcline Formula: K(AlSi3O8) |
| β Mitridatite Formula: Ca2Fe3+3(PO4)3O2 · 3H2O |
| β Molybdenite Formula: MoS2 |
| β Montebrasite Formula: LiAl(PO4)(OH) |
| β Moraesite Formula: Be2(PO4)(OH) · 4H2O References: |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β Opal Formula: SiO2 · nH2O |
| β Opal var. Opal-AN Formula: SiO2 · nH2O |
| β Orthoclase ? Formula: K(AlSi3O8) References: |
| β Phosphosiderite Formula: FePO4 · 2H2O |
| β Purpurite Formula: Mn3+(PO4) References: |
| β Pyrite Formula: FeS2 |
| β Pyrrhotite Formula: Fe1-xS |
| β Quartz Formula: SiO2 |
| β Quartz var. Milky Quartz Formula: SiO2 References: |
| β Quartz var. Rose Quartz Formula: SiO2 |
| β Quartz var. Sceptre Quartz Formula: SiO2 |
| β Quartz var. Smoky Quartz Formula: SiO2 References: |
| β Rhodochrosite Formula: MnCO3 References: |
| β Rockbridgeite Formula: Fe2+Fe3+4(PO4)3(OH)5 |
| β Formula: Ca2Mn2+5Be4(PO4)6(OH)4 · 6H2O |
| β Schoonerite Formula: ZnMn2+Fe2+2Fe3+(PO4)3(OH)2 · 9H2O References: |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Siderite Formula: FeCO3 |
| β Sphalerite Formula: ZnS |
| β Sphalerite var. Marmatite Formula: (Zn,Fe)S |
| β Strunzite Formula: Mn2+Fe3+2(PO4)2(OH)2 · 6H2O |
| β Switzerite Formula: Mn2+3(PO4)2 · 7H2O |
| β Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| β 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| β Triphylite Formula: LiFe2+PO4 |
| β Uralolite Formula: Ca2Be4(PO4)3(OH)3 · 5H2O |
| β Uraninite Formula: UO2 |
| β VΓ€yrynenite Formula: BeMn2+(PO4)(OH) |
| β Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O |
| β Whitmoreite ? Formula: Fe2+Fe3+2(PO4)2(OH)2 · 4H2O |
| β Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Sphalerite var. Marmatite | 2.CB.05a | (Zn,Fe)S |
| β | 2.CB.05a | ZnS | |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Greenockite | 2.CB.45 | CdS |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | Galena | 2.CD.10 | PbS |
| β | Molybdenite | 2.EA.30 | MoS2 |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | LΓΆllingite | 2.EB.15a | FeAs2 |
| β | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 4 - Oxides and Hydroxides | |||
| β | Gahnite | 4.BB.05 | ZnAl2O4 |
| β | Quartz var. Sceptre Quartz | 4.DA.05 | SiO2 |
| β | var. Milky Quartz | 4.DA.05 | SiO2 |
| β | 4.DA.05 | SiO2 | |
| β | var. Rose Quartz | 4.DA.05 | SiO2 |
| β | var. Smoky Quartz | 4.DA.05 | SiO2 |
| β | Opal var. Opal-AN | 4.DA.10 | SiO2 Β· nH2O |
| β | 4.DA.10 | SiO2 Β· nH2O | |
| β | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| β | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 Β· 3-4H2O |
| β | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Rhodochrosite | 5.AB.05 | MnCO3 |
| β | Calcite | 5.AB.05 | CaCO3 |
| β | Siderite | 5.AB.05 | FeCO3 |
| β | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| β | Aragonite | 5.AB.15 | CaCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Beryllonite | 8.AA.10 | NaBePO4 |
| β | Purpurite | 8.AB.10 | Mn3+(PO4) |
| β | Triphylite | 8.AB.10 | LiFe2+PO4 |
| β | Lithiophilite | 8.AB.10 | LiMn2+PO4 |
| β | Heterosite | 8.AB.10 | (Fe3+,Mn3+)PO4 |
| β | VΓ€yrynenite | 8.BA.05 | BeMn2+(PO4)(OH) |
| β | Hydroxylherderite | 8.BA.10 | CaBe(PO4)(OH) |
| β | Montebrasite | 8.BB.05 | LiAl(PO4)(OH) |
| β | Rockbridgeite | 8.BC.10 | Fe2+Fe3+4(PO4)3(OH)5 |
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| β | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| β | Phosphosiderite | 8.CD.05 | FePO4 Β· 2H2O |
| β | Switzerite | 8.CE.25 | Mn2+3(PO4)2 Β· 7H2O |
| β | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 Β· 8H2O |
| β | Falsterite | 8.CF. | Ca2MgMn2+2Fe2+2Fe3+2Zn4(PO4)8(OH)4(H2O)14 |
| β | Fairfieldite | 8.CG.05 | Ca2Mn2+(PO4)2 Β· 2H2O |
| β | Moraesite | 8.DA.05 | Be2(PO4)(OH) Β· 4H2O |
| β | Footemineite | 8.DA.10 | Ca2Mn2+Mn2+2Mn2+2Be4(PO4)6(OH)4 Β· 6H2O |
| β | Roscherite ? | 8.DA.10 | Ca2Mn2+5Be4(PO4)6(OH)4 Β· 6H2O |
| β | Greifensteinite | 8.DA.10 | Ca2Fe2+5Be4(PO4)6(OH)4 Β· 6H2O |
| β | Uralolite | 8.DA.15 | Ca2Be4(PO4)3(OH)3 Β· 5H2O |
| β | Diadochite | 8.DB.05 | Fe3+2(PO4)(SO4)(OH) Β· 6H2O |
| β | Schoonerite | 8.DB.15 | ZnMn2+Fe2+2Fe3+(PO4)3(OH)2 Β· 9H2O |
| β | Whitmoreite ? | 8.DC.15 | Fe2+Fe3+2(PO4)2(OH)2 Β· 4H2O |
| β | Strunzite | 8.DC.25 | Mn2+Fe3+2(PO4)2(OH)2 Β· 6H2O |
| β | Beraunite | 8.DC.27 | Fe3+6(PO4)4O(OH)4 Β· 6H2O |
| β | Laueite ? | 8.DC.30 | Mn2+Fe3+2(PO4)2(OH)2 Β· 8H2O |
| β | Eosphorite | 8.DD.20 | Mn2+Al(PO4)(OH)2 Β· H2O |
| β | Childrenite | 8.DD.20 | Fe2+Al(PO4)(OH)2 Β· H2O |
| β | Jahnsite-(CaMnMn) ? | 8.DH.15 | {Ca}{Mn2+}{Mn2+2}{Fe3+2}(PO4)4(OH)2 Β· 8H2O |
| β | Mitridatite | 8.DH.30 | Ca2Fe3+3(PO4)3O2 Β· 3H2O |
| β | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 Β· 10-12H2O |
| β | Meta-autunite ? | 8.EB.10 | Ca(UO2)2(PO4)2 Β· 6H2O |
| Group 9 - Silicates | |||
| β | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| β | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Orthoclase ? | 9.FA.30 | K(AlSi3O8) |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Albite var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| β | 9.FA.35 | Na(AlSi3O8) | |
| Unclassified | |||
| β | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| β | 'Chamosite-Clinochlore Series' | - | |
| β | 'Lithian Muscovite' | - | KAl2(AlSi3O10)(OH)2 |
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| β | 'Jahnsite Group' | - | XM1M22M32(H2O)8(OH)2(PO4)4 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | β Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| H | β Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| H | β Diadochite | Fe23+(PO4)(SO4)(OH) · 6H2O |
| H | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| H | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | β Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| H | β Opal var. Opal-AN | SiO2 · nH2O |
| H | β Hydroxylherderite | CaBe(PO4)(OH) |
| H | β Hydroxylapatite | Ca5(PO4)3(OH) |
| H | β Jahnsite-(CaMnMn) | {Ca}{Mn2+}{Mn22+}{Fe23+}(PO4)4(OH)2 · 8H2O |
| H | β Laueite | Mn2+Fe23+(PO4)2(OH)2 · 8H2O |
| H | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| H | β Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| H | β Montebrasite | LiAl(PO4)(OH) |
| H | β Moraesite | Be2(PO4)(OH) · 4H2O |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Opal | SiO2 · nH2O |
| H | β Phosphosiderite | FePO4 · 2H2O |
| H | β Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| H | β Roscherite | Ca2Mn52+Be4(PO4)6(OH)4 · 6H2O |
| H | β Schoonerite | ZnMn2+Fe22+Fe3+(PO4)3(OH)2 · 9H2O |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| H | β Switzerite | Mn32+(PO4)2 · 7H2O |
| H | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | β Uralolite | Ca2Be4(PO4)3(OH)3 · 5H2O |
| H | β Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | β VΓ€yrynenite | BeMn2+(PO4)(OH) |
| H | β Whitmoreite | Fe2+Fe23+(PO4)2(OH)2 · 4H2O |
| H | β Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Greifensteinite | Ca2Fe52+Be4(PO4)6(OH)4 · 6H2O |
| H | β Footemineite | Ca2Mn2+Mn22+Mn22+Be4(PO4)6(OH)4 · 6H2O |
| H | β Jahnsite Group | XM1M22M32(H2O)8(OH)2(PO4)4 |
| H | β Falsterite | Ca2MgMn22+Fe22+Fe23+Zn4(PO4)8(OH)4(H2O)14 |
| Li | Lithium | |
| Li | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | β Lithiophilite | LiMn2+PO4 |
| Li | β Montebrasite | LiAl(PO4)(OH) |
| Li | β Triphylite | LiFe2+PO4 |
| Be | Beryllium | |
| Be | β Beryllonite | NaBePO4 |
| Be | β Beryl | Be3Al2(Si6O18) |
| Be | β Hydroxylherderite | CaBe(PO4)(OH) |
| Be | β Moraesite | Be2(PO4)(OH) · 4H2O |
| Be | β Roscherite | Ca2Mn52+Be4(PO4)6(OH)4 · 6H2O |
| Be | β Uralolite | Ca2Be4(PO4)3(OH)3 · 5H2O |
| Be | β VΓ€yrynenite | BeMn2+(PO4)(OH) |
| Be | β Greifensteinite | Ca2Fe52+Be4(PO4)6(OH)4 · 6H2O |
| Be | β Footemineite | Ca2Mn2+Mn22+Mn22+Be4(PO4)6(OH)4 · 6H2O |
| B | Boron | |
| B | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | β Aragonite | CaCO3 |
| C | β Calcite | CaCO3 |
| C | β Dolomite | CaMg(CO3)2 |
| C | β Graphite | C |
| C | β Rhodochrosite | MnCO3 |
| C | β Siderite | FeCO3 |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Aragonite | CaCO3 |
| O | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | β Almandine | Fe32+Al2(SiO4)3 |
| O | β Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| O | β Beryllonite | NaBePO4 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Calcite | CaCO3 |
| O | β Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| O | β Diadochite | Fe23+(PO4)(SO4)(OH) · 6H2O |
| O | β Dolomite | CaMg(CO3)2 |
| O | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| O | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | β Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| O | β Columbite-(Fe) | Fe2+Nb2O6 |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Gahnite | ZnAl2O4 |
| O | β Heterosite | (Fe3+,Mn3+)PO4 |
| O | β Opal var. Opal-AN | SiO2 · nH2O |
| O | β Hydroxylherderite | CaBe(PO4)(OH) |
| O | β Hydroxylapatite | Ca5(PO4)3(OH) |
| O | β Jahnsite-(CaMnMn) | {Ca}{Mn2+}{Mn22+}{Fe23+}(PO4)4(OH)2 · 8H2O |
| O | β Laueite | Mn2+Fe23+(PO4)2(OH)2 · 8H2O |
| O | β Lithiophilite | LiMn2+PO4 |
| O | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| O | β Microcline | K(AlSi3O8) |
| O | β Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| O | β Montebrasite | LiAl(PO4)(OH) |
| O | β Moraesite | Be2(PO4)(OH) · 4H2O |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Opal | SiO2 · nH2O |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Phosphosiderite | FePO4 · 2H2O |
| O | β Purpurite | Mn3+(PO4) |
| O | β Quartz | SiO2 |
| O | β Rhodochrosite | MnCO3 |
| O | β Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| O | β Roscherite | Ca2Mn52+Be4(PO4)6(OH)4 · 6H2O |
| O | β Quartz var. Rose Quartz | SiO2 |
| O | β Schoonerite | ZnMn2+Fe22+Fe3+(PO4)3(OH)2 · 9H2O |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Siderite | FeCO3 |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| O | β Switzerite | Mn32+(PO4)2 · 7H2O |
| O | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Triphylite | LiFe2+PO4 |
| O | β Uralolite | Ca2Be4(PO4)3(OH)3 · 5H2O |
| O | β Uraninite | UO2 |
| O | β Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | β VΓ€yrynenite | BeMn2+(PO4)(OH) |
| O | β Whitmoreite | Fe2+Fe23+(PO4)2(OH)2 · 4H2O |
| O | β Zircon | Zr(SiO4) |
| O | β Quartz var. Milky Quartz | SiO2 |
| O | β Quartz var. Sceptre Quartz | SiO2 |
| O | β Albite var. Cleavelandite | Na(AlSi3O8) |
| O | β Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Greifensteinite | Ca2Fe52+Be4(PO4)6(OH)4 · 6H2O |
| O | β Footemineite | Ca2Mn2+Mn22+Mn22+Be4(PO4)6(OH)4 · 6H2O |
| O | β Jahnsite Group | XM1M22M32(H2O)8(OH)2(PO4)4 |
| O | β Falsterite | Ca2MgMn22+Fe22+Fe23+Zn4(PO4)8(OH)4(H2O)14 |
| F | Fluorine | |
| F | β Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Beryllonite | NaBePO4 |
| Na | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Na | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Mg | Magnesium | |
| Mg | β Dolomite | CaMg(CO3)2 |
| Mg | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | β Falsterite | Ca2MgMn22+Fe22+Fe23+Zn4(PO4)8(OH)4(H2O)14 |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Almandine | Fe32+Al2(SiO4)3 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| Al | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| Al | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | β Gahnite | ZnAl2O4 |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Montebrasite | LiAl(PO4)(OH) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Al | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | β Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Almandine | Fe32+Al2(SiO4)3 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | β Opal var. Opal-AN | SiO2 · nH2O |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Opal | SiO2 · nH2O |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Quartz | SiO2 |
| Si | β Quartz var. Rose Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β Zircon | Zr(SiO4) |
| Si | β Quartz var. Milky Quartz | SiO2 |
| Si | β Quartz var. Sceptre Quartz | SiO2 |
| Si | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | β Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| P | Phosphorus | |
| P | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | β Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| P | β Beryllonite | NaBePO4 |
| P | β Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| P | β Diadochite | Fe23+(PO4)(SO4)(OH) · 6H2O |
| P | β Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| P | β Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| P | β Fluorapatite | Ca5(PO4)3F |
| P | β Heterosite | (Fe3+,Mn3+)PO4 |
| P | β Hydroxylherderite | CaBe(PO4)(OH) |
| P | β Hydroxylapatite | Ca5(PO4)3(OH) |
| P | β Jahnsite-(CaMnMn) | {Ca}{Mn2+}{Mn22+}{Fe23+}(PO4)4(OH)2 · 8H2O |
| P | β Laueite | Mn2+Fe23+(PO4)2(OH)2 · 8H2O |
| P | β Lithiophilite | LiMn2+PO4 |
| P | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| P | β Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| P | β Montebrasite | LiAl(PO4)(OH) |
| P | β Moraesite | Be2(PO4)(OH) · 4H2O |
| P | β Phosphosiderite | FePO4 · 2H2O |
| P | β Purpurite | Mn3+(PO4) |
| P | β Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| P | β Roscherite | Ca2Mn52+Be4(PO4)6(OH)4 · 6H2O |
| P | β Schoonerite | ZnMn2+Fe22+Fe3+(PO4)3(OH)2 · 9H2O |
| P | β Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| P | β Switzerite | Mn32+(PO4)2 · 7H2O |
| P | β Triphylite | LiFe2+PO4 |
| P | β Uralolite | Ca2Be4(PO4)3(OH)3 · 5H2O |
| P | β Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | β VΓ€yrynenite | BeMn2+(PO4)(OH) |
| P | β Whitmoreite | Fe2+Fe23+(PO4)2(OH)2 · 4H2O |
| P | β Greifensteinite | Ca2Fe52+Be4(PO4)6(OH)4 · 6H2O |
| P | β Footemineite | Ca2Mn2+Mn22+Mn22+Be4(PO4)6(OH)4 · 6H2O |
| P | β Jahnsite Group | XM1M22M32(H2O)8(OH)2(PO4)4 |
| P | β Falsterite | Ca2MgMn22+Fe22+Fe23+Zn4(PO4)8(OH)4(H2O)14 |
| S | Sulfur | |
| S | β Arsenopyrite | FeAsS |
| S | β Chalcopyrite | CuFeS2 |
| S | β Diadochite | Fe23+(PO4)(SO4)(OH) · 6H2O |
| S | β Galena | PbS |
| S | β Greenockite | CdS |
| S | β Molybdenite | MoS2 |
| S | β Pyrite | FeS2 |
| S | β Pyrrhotite | Fe1-xS |
| S | β Sphalerite | ZnS |
| S | β Sphalerite var. Marmatite | (Zn,Fe)S |
| K | Potassium | |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Orthoclase | K(AlSi3O8) |
| K | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| K | β Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Aragonite | CaCO3 |
| Ca | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | β Calcite | CaCO3 |
| Ca | β Dolomite | CaMg(CO3)2 |
| Ca | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | β Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Hydroxylherderite | CaBe(PO4)(OH) |
| Ca | β Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | β Jahnsite-(CaMnMn) | {Ca}{Mn2+}{Mn22+}{Fe23+}(PO4)4(OH)2 · 8H2O |
| Ca | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| Ca | β Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| Ca | β Roscherite | Ca2Mn52+Be4(PO4)6(OH)4 · 6H2O |
| Ca | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | β Uralolite | Ca2Be4(PO4)3(OH)3 · 5H2O |
| Ca | β Greifensteinite | Ca2Fe52+Be4(PO4)6(OH)4 · 6H2O |
| Ca | β Footemineite | Ca2Mn2+Mn22+Mn22+Be4(PO4)6(OH)4 · 6H2O |
| Ca | β Falsterite | Ca2MgMn22+Fe22+Fe23+Zn4(PO4)8(OH)4(H2O)14 |
| Mn | Manganese | |
| Mn | β Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| Mn | β Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
| Mn | β Heterosite | (Fe3+,Mn3+)PO4 |
| Mn | β Jahnsite-(CaMnMn) | {Ca}{Mn2+}{Mn22+}{Fe23+}(PO4)4(OH)2 · 8H2O |
| Mn | β Laueite | Mn2+Fe23+(PO4)2(OH)2 · 8H2O |
| Mn | β Lithiophilite | LiMn2+PO4 |
| Mn | β Purpurite | Mn3+(PO4) |
| Mn | β Rhodochrosite | MnCO3 |
| Mn | β Roscherite | Ca2Mn52+Be4(PO4)6(OH)4 · 6H2O |
| Mn | β Schoonerite | ZnMn2+Fe22+Fe3+(PO4)3(OH)2 · 9H2O |
| Mn | β Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| Mn | β Switzerite | Mn32+(PO4)2 · 7H2O |
| Mn | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mn | β VΓ€yrynenite | BeMn2+(PO4)(OH) |
| Mn | β Footemineite | Ca2Mn2+Mn22+Mn22+Be4(PO4)6(OH)4 · 6H2O |
| Mn | β Falsterite | Ca2MgMn22+Fe22+Fe23+Zn4(PO4)8(OH)4(H2O)14 |
| Fe | Iron | |
| Fe | β Arsenopyrite | FeAsS |
| Fe | β Almandine | Fe32+Al2(SiO4)3 |
| Fe | β Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| Fe | β Diadochite | Fe23+(PO4)(SO4)(OH) · 6H2O |
| Fe | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | β Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | β Heterosite | (Fe3+,Mn3+)PO4 |
| Fe | β Jahnsite-(CaMnMn) | {Ca}{Mn2+}{Mn22+}{Fe23+}(PO4)4(OH)2 · 8H2O |
| Fe | β Laueite | Mn2+Fe23+(PO4)2(OH)2 · 8H2O |
| Fe | β LΓΆllingite | FeAs2 |
| Fe | β Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| Fe | β Phosphosiderite | FePO4 · 2H2O |
| Fe | β Pyrite | FeS2 |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| Fe | β Schoonerite | ZnMn2+Fe22+Fe3+(PO4)3(OH)2 · 9H2O |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Siderite | FeCO3 |
| Fe | β Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| Fe | β Triphylite | LiFe2+PO4 |
| Fe | β Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | β Whitmoreite | Fe2+Fe23+(PO4)2(OH)2 · 4H2O |
| Fe | β Sphalerite var. Marmatite | (Zn,Fe)S |
| Fe | β Greifensteinite | Ca2Fe52+Be4(PO4)6(OH)4 · 6H2O |
| Fe | β Falsterite | Ca2MgMn22+Fe22+Fe23+Zn4(PO4)8(OH)4(H2O)14 |
| Cu | Copper | |
| Cu | β Chalcopyrite | CuFeS2 |
| Zn | Zinc | |
| Zn | β Gahnite | ZnAl2O4 |
| Zn | β Schoonerite | ZnMn2+Fe22+Fe3+(PO4)3(OH)2 · 9H2O |
| Zn | β Sphalerite | ZnS |
| Zn | β Sphalerite var. Marmatite | (Zn,Fe)S |
| Zn | β Falsterite | Ca2MgMn22+Fe22+Fe23+Zn4(PO4)8(OH)4(H2O)14 |
| As | Arsenic | |
| As | β Arsenopyrite | FeAsS |
| As | β LΓΆllingite | FeAs2 |
| Sr | Strontium | |
| Sr | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | β Columbite-(Fe) | Fe2+Nb2O6 |
| Mo | Molybdenum | |
| Mo | β Molybdenite | MoS2 |
| Cd | Cadmium | |
| Cd | β Greenockite | CdS |
| Ba | Barium | |
| Ba | β Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Pb | Lead | |
| Pb | β Galena | PbS |
| U | Uranium | |
| U | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| U | β Uraninite | UO2 |
Other Regions, Features and Areas containing this locality
North America PlateTectonic Plate
- Ganderia DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Thompson, Woodrow B., Bearss, Gene T., Falster, Alexander U., Simmons, William B., Nizamoff, Jams W. (2000) The Estes Quarry, Cumberland County, Maine: A New Pegmatite Mineral Locality. Rocks & Minerals, 75 (6) 408-418 doi:10.1080/00357520009605667
Kampf, A. R., Mills, S. J., Simmons, W. B., Nizamoff, J. W., Whitmore, R. W. (2012) Falsterite, Ca2MgMn2+2(Fe2+0.5Fe3+0.5)4Zn4(PO4)8(OH)4(H2O)14, a new secondary phosphate mineral from the Palermo No. 1 pegmatite, North Groton, New Hampshire. American Mineralogist, 97 (4) 496-502 doi:10.2138/am.2012.4008
Estes Quarry, West Baldwin, Baldwin, Cumberland County, Maine, USA