Viken, Norwayi
| Regional Level Types | |
|---|---|
| Viken | County |
| Norway | Country |
This page is currently not sponsored. Click here to sponsor this page.
Area:
4,918 km2
Type:
Mindat Locality ID:
14335
Long-form identifier:
mindat:1:2:14335:3
GUID (UUID V4):
03efb607-e5e4-434a-a6c5-72d2a29c10ab
Other Languages:
French:
Akershus, Norvège
German:
Viken, Norwegen
Italian:
Akershus, Norvegia
Russian:
Акерсхус, Норвегия
Simplified Chinese:
阿克什胡斯郡, 挪威
Spanish:
Akershus, Noruega
Norwegian:
Akershus, Norge
Afrikaans:
Akershus, Noorweë
Albanian:
Akershus, Norvegjia
Arabic:
آكرشوس, النرويج
Armenian:
Ակերսհուս, Նորվեգիա
Asturian:
Viken, Noruega
Basque:
Akershus, Norvegia
Bavarian:
Akershus, Norwegn
Belarusian:
Акерсхус, Нарвегія
Belarusian (Tarashkevitsa):
Акерсхус, Нарвэгія
Bengali:
একেরশাস, নরওয়ে
Bishnupriya Manipuri:
আকেরশুস, নরৱে
Bosnian:
Akershus, Norveška
Breton:
Akershus, Norvegia
Bulgarian:
Акешхус, Норвегия
Catalan:
Akershus, Noruega
Cebuano:
Akershus fylke, Norway
Chechen:
Акерсхус, Норвеги
Cornish:
Akershus, Norgagh
Croatian:
Akershus, Norveška
Czech:
Akershus, Norsko
Danish:
Viken , Norge
Dutch:
Viken, Noorwegen
Esperanto:
Akershus, Norvegio
Estonian:
Akershus, Norra
Farsi/Persian:
آکرشوس, نروژ
Finnish:
Akershusin lääni, Norja
Georgian:
აკერსხუსი, ნორვეგია
Greek:
Βίκεν, Νορβηγία
Gujarati:
અકર્સસ, નોર્વે
Hebrew:
אקרסהוס, נורבגיה
Hindi:
अकर्शस, नॉर्वे
Hungarian:
Akershus megye, Norvégia
Icelandic:
Akurshús, Noregur
Indonesian:
Akershus, Norwegia
Interlingua:
Contate Akershus, Norvegia
Japanese:
アーケシュフース県, ノルウェー
Kannada:
ಅಕರ್ಶಸ್, ಕಾಮೌ
Korean:
비켄주, 노르웨이
Latin:
Akershus, Norvegia
Latvian:
Ākešhusa, Norvēģija
Limburgian:
Akershus, Noorwege
Lithuanian:
Akershusas, Norvegija
Low Saxon/Low German:
Amt Akershus, Norwegen
Macedonian:
Акершус, Норвешка
Malay:
Akershus, Norway
Marathi:
अकर्सस, नॉर्वे
Minnan / Hokkien-Taiwanese:
Akershus, Lo̍k-ui
Nauruan:
Akershus, Norwei
Nepali:
एकर्सहस, नर्वे
Northern Sami:
Akershusa fylka, Norga
Norwegian (Nynorsk):
Viken fylke, Noreg
Occitan:
Akershus, Norvègia
Ossetian:
Акерсхус, Норвеги
Polish:
Akershus, Norwegia
Portuguese:
Akershus, Noruega
Romanian:
Akershus, Norvegia
Samogitian:
Akeškiūsos, Nuorvegėjė
Scots:
Akershus, Norawa
Serbian:
Акерсхус, Норвешка
Sinhalese:
අකෙර්ෂුස්, නෝර්වේ
Slovak:
Akershus, Nórsko
Slovenian:
Akershus, Norveška
South Azerbaijani:
آکرشوس, نوروژ
Swahili:
Akershus, Norwei
Swedish:
Viken, Norge
Tamil:
அகிற்ஸ்ஸ், நோர்வே
Telugu:
ఆకేర్షస, నార్వే
Thai:
อาเคอร์ชูส, นอร์เวย์
Turkish:
Akershus, Norveç
Ukrainian:
Акерсгус, Норвегія
Urdu:
آکیشوس, ناروے
Vietnamese:
Akershus, Na Uy
Waray:
Akershus, Noruega
West Frisian:
Akershus, Noarwegen
Western Punjabi:
اکرشس, ناروے
A county in Eastern Norway that was established on 1 January 2020 by the forced merger of Akershus, Buskerud and Østfold with the addition of three other municipalities.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities243 valid minerals. 4 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Localities: |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: |
| ⓘ Aegirine Formula: NaFe3+Si2O6 Localities: |
| ⓘ 'Aeschynite' Localities: |
| ⓘ Alamosite Formula: PbSiO3 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 26 localities in this region. |
| ⓘ Albite var. Andesine ? Formula: (Na,Ca)[Al(Si,Al)Si2O8] Locality: Lake Sandungen, Asker, Viken, Norway Description: As phenocryst in the rhombic porphyry lava. |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) Localities: Reported from at least 7 localities in this region. References: Stensrud, Sven (2004) Mineralfunn i ny sikkerhetstunnel i Vardåsen og langs ny gangvei langs Heggedalsveien i Asker 2002-2003. Bidrag til Drammengranittens beskrivelse [Mineral finds in a new safety tunnel in Vardåsen and along a walkway along Heggedalsveien in Asker 2002-2003 ]. Norsk Bergverksmuseum Skrift, 28. 76-103 |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Localities: References: |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O Localities: Colour: Brownish red Description: wax-like (X-ray amorphous materiale) References: |
| ⓘ Allophane var. Cupro-Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ 'Almandine-Spessartine Series' |
| ⓘ Altaite Formula: PbTe |
| ⓘ Aluminocopiapite Formula: Al2/3Fe3+4(SO4)6(OH)2 · 20H2O Locality: Usteberget, Ustaoset, Hol, Viken, Norway |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Amphibole Supergroup var. Byssolite' Formula: AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ 'Amphibole Supergroup var. Uralite' Formula: AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Localities: |
| ⓘ Analcime Formula: Na(AlSi2O6) · H2O |
| ⓘ Anatase Formula: TiO2 Localities: Reported from at least 20 localities in this region. Description: Small crystals (< 1mm) in pseudomorphoses after a Ti-mineral (narsarsukite?) |
| ⓘ Ancylite-(Ce) Formula: CeSr(CO3)2(OH) · H2O |
| ⓘ Andalusite Formula: Al2(SiO4)O Localities: |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Localities: Reported from at least 10 localities in this region. Colour: sulfur yellow; blackgreen |
| ⓘ 'Andradite-Grossular Series' |
| ⓘ Anglesite Formula: PbSO4 Localities: |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: |
| ⓘ Anorthite ? Formula: Ca(Al2Si2O8) Locality: Rv 7 Svenkerud, Gol, Viken, Norway |
| ⓘ Antarcticite ? Formula: CaCl2 · 6H2O |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: Reported from at least 10 localities in this region. |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O22]X · 8H2O Localities: |
| ⓘ Aragonite Formula: CaCO3 Localities: Description: Aragonite occure together with calcite in fracture fillings in hornfels, between Grubelien and Dalstjern. |
| ⓘ Arfvedsonite Formula: [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: |
| ⓘ Astrophyllite ? Formula: K2NaFe2+7Ti2Si8O26(OH)4F Localities: |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 References: |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 Localities: |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Baryte Formula: BaSO4 Localities: |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F |
| ⓘ Bastnäsite-(Ce) Formula: Ce(CO3)F Localities: Reported from at least 6 localities in this region. Habit: Yellow spherulites Description: Also as pseudomorphs after an octahedral pyrochlore group mineral and as pseudomorphs after flattened dipyramidal zircon crystals |
| ⓘ Bavenite Formula: Ca4Be2Al2Si9O26(OH)2 Description: Some laumontite has been misidentified as bavenite (Ellingsen 2003) |
| ⓘ Bazzite Formula: Be3Sc2(Si6O18) Locality: Midtmoen, Øståsen, Lunner, Viken, Norway |
| ⓘ Beraunite ? Formula: Fe3+6(PO4)4O(OH)4 · 6H2O Description: After publishing this find, identity done by XRD only, beraunite was redefined. Based on the color it could be ferroberaunite. |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Reported from at least 24 localities in this region. |
| ⓘ Beryl var. Aquamarine Formula: Be3Al2Si6O18 Localities: Reported from at least 9 localities in this region. |
| ⓘ Beryl var. Emerald Formula: Be3Al2(Si6O18) |
| ⓘ Beudantite Formula: PbFe3(AsO4)(SO4)(OH)6 Description: Found by E. Kamphaug. |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 15 localities in this region. |
| ⓘ Birnessite ? Formula: (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O Locality: Gjerdingselva, Lunner, Viken, Norway |
| ⓘ Bismuth Formula: Bi Localities: |
| ⓘ Bismuthinite Formula: Bi2S3 Localities: |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Boltwoodite Formula: (K,Na)(UO2)(SiO3OH) · 1.5H2O Locality: Storehaug, Rygge, Moss, Viken, Norway |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 9 localities in this region. |
| ⓘ Boulangerite Formula: Pb5Sb4S11 Description: As microsopic grains in sphalerite |
| ⓘ Brannerite ? Formula: UTi2O6 Localities: Description: Neumann (1985) states that brannerite have been identified at Mineralogical Museum of Oslo in 1981. This information has been deleted from 2010 revisison of the book (Selbekk 2010) |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 |
| ⓘ Brianyoungite Formula: Zn3(CO3,SO4)(OH)4 Localities: |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: |
| ⓘ Brookite Formula: TiO2 Localities: Reported from at least 8 localities in this region. Description: Occure usually in pseudomorphoses after a Ti mineral (narsarsukite?), as small black crystals together with anatase and elpidite. |
| ⓘ Byrudite (TL) Formula: (Be,◻)(V3+,Ti,Cr)3O6 Type Locality: Colour: Black |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 66 localities in this region. |
| ⓘ Carrollite Formula: CuCo2S4 Localities: |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Celadonite Formula: K(MgFe3+◻)(Si4O10)(OH)2 Locality: Gjelleråsen, Nittedal, Viken, Norway |
| ⓘ Cerianite-(Ce) ? Formula: (Ce4+,Th)O2 Locality: Gjerdingselva, Lunner, Viken, Norway Description: According to (Neumann 1985) Kristiansen reports having found cerianite-(Ce) in a caviety in elpidite-ekerite at Gjerdingen. The mineral sample was completely used for identification (XRD only). Identification doubtful. |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Chabazite' Localities: Reported from at least 9 localities in this region. References: |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 6 localities in this region. |
| ⓘ Chalcophanite Formula: ZnMn4+3O7 · 3H2O |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 39 localities in this region. |
| ⓘ Chamosite Formula: (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ Chamosite var. Thuringite Formula: (Fe,Fe,Mg,Al)6(Si,Al)4O10(O,OH)8 |
| ⓘ Cheralite Formula: CaTh(PO4)2 |
| ⓘ Chevkinite-(Ce) Formula: Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 Localities: |
| ⓘ 'Chevkinite Group' ? |
| ⓘ 'Chlorite Group' Localities: Reported from at least 23 localities in this region. References: |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Clinopyroxene Subgroup' Localities: |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: |
| ⓘ 'Coal blend' Localities: Reported from at least 10 localities in this region. |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 Localities: Reported from at least 6 localities in this region. References: |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Localities: Reported from at least 8 localities in this region. Habit: up to 2 cm; irregular masses |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 Locality: Fagerliåsen, Hurdal, Viken, Norway |
| ⓘ Copper Formula: Cu Localities: |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 |
| ✪ Corundum Formula: Al2O3 Habit: (0001), (1120), (1011) and (2243). Description: Crystals usually with a diameter about 2 cm and thickness about 5 mm, but crystals with a diameter larger than 4 cm and thickness to 2 cm is known. |
| ⓘ Cosalite Formula: Pb2Bi2S5 Locality: Grua Tunnel, Grua, Lunner, Viken, Norway |
| ⓘ Covellite Formula: CuS Localities: |
| ⓘ Cryolite Formula: Na2NaAlF6 Locality: Gjerdingselva, Lunner, Viken, Norway Description: Found in one piece only (K.Eldjarn collection) |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Cuprite Formula: Cu2O Localities: Description: Probably found in Gamle-gruben (Neumann 1985) |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Cyanotrichite Formula: Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ Dalyite Formula: K2ZrSi6O15 Locality: Gjerdingselva, Lunner, Viken, Norway Description: Typically found in close contact with janhaugite. |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ Diaspore ? Formula: AlO(OH) Description: Occurs in alteration product after corundum together with gibbsite . |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 Localities: |
| ⓘ Digenite Formula: Cu9S5 Localities: |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Doyleite Formula: Al(OH)3 Locality: Gjerdingselva, Lunner, Viken, Norway |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: |
| ⓘ 'Dravite-Uvite Series' Locality: Borgenåsen, Asker, Viken, Norway |
| ⓘ Elpidite Formula: Na2ZrSi6O15 · 3H2O |
| ⓘ Elpidite var. Calcium-bearing Elpidite Formula: (Na,Ca)2ZrSi6O15 · 3H2O Locality: Gjerdingselva, Lunner, Viken, Norway |
| ⓘ Epididymite Formula: Na2Be2Si6O15 · H2O Locality: Gjerdingselva, Lunner, Viken, Norway |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 33 localities in this region. |
| ⓘ 'Euxenite Group' |
| ⓘ Euxenite-(Y) Formula: (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 Localities: References: |
| ⓘ 'Fayalite-Forsterite Series' Localities: References: |
| ⓘ 'Feldspar Group' Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Feldspar Group var. Perthite' |
| ⓘ Ferberite Formula: FeWO4 Description: SEM-EDS analysis by Alf Olav Larsen, giving ca 60% ferberite and 40% hübnerite. Mostly damaged crystals, from weathering, but some good complete crystals to 0,5 cm, occuring on etched quartz with topaz. |
| ⓘ Fergusonite-(Y) Formula: YNbO4 Localities: Habit: small pointed crystals with the faces {231}, {001}, {111} |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O Localities: |
| ⓘ Ferroberaunite ? Formula: Fe2+Fe3+5(PO4)4(OH)5 · 6H2O Description: After publishing a find of beraunite (identity done by XRD only), beraunite was redefined. Based on the color it could be ferroberaunite. |
| ⓘ Ferro-gedrite Formula: ◻{Fe2+2}{Fe2+3Al2}(Al2Si6O22)(OH)2 Description: As crystals embedded in chlorite. The crystals (pseudomorphs ?)consists of ferrrogedrite calcite and ankerite |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: References: Stensrud, Sven (2004) Mineralfunn i ny sikkerhetstunnel i Vardåsen og langs ny gangvei langs Heggedalsveien i Asker 2002-2003. Bidrag til Drammengranittens beskrivelse [Mineral finds in a new safety tunnel in Vardåsen and along a walkway along Heggedalsveien in Asker 2002-2003 ]. Norsk Bergverksmuseum Skrift, 28. 76-103 |
| ⓘ Fluorapophyllite-(K) Formula: KCa4(Si8O20)(F,OH) · 8H2O Localities: |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 38 localities in this region. Habit: octahedron faces dominant or more complex formes Colour: violet; colorless |
| ⓘ Fluorphosphohedyphane Formula: Ca2Pb3(PO4)3F |
| ⓘ Fluor-schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ 'Fluor-uvite-Uvite Series' Locality: Borgenåsen, Asker, Viken, Norway Colour: White Description: Analysis of the light colored tourmaline has showed a composition of 69 % uvite and 30% dravite |
| ⓘ Forsterite Formula: Mg2SiO4 Locality: Moss Meteorite, Moss, Viken, Norway |
| ⓘ Gadolinite-(Y) Formula: Y2Fe2+Be2Si2O10 Locality: Rygge, Moss, Viken, Norway |
| ✪ Gagarinite-(Y) Formula: NaCaYF6 Locality: Gjerdingselva, Lunner, Viken, Norway Habit: tabular, long to short prismatic; hexagonal prisms; often not terminated xls Colour: Pale rose; colorless Description: Commonly in association with monazite-(Ce) |
| ⓘ Galena Formula: PbS Localities: Reported from at least 32 localities in this region. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 15 localities in this region. |
| ⓘ Gearksutite Formula: Ca[Al(F,OH)5(H2O)] Locality: Gjerdingselva, Lunner, Viken, Norway Habit: chalk-like masses Colour: white to light rose Description: Occure as white, chalky masses filling cavities, consisting of submicroscopic platy-crystals. |
| ⓘ Gedrite Formula: ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| ⓘ Genthelvite Formula: Be3Zn4(SiO4)3S Locality: Gjerdingselva, Lunner, Viken, Norway |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ Gibbsite Formula: Al(OH)3 |
| ⓘ Gjerdingenite-Fe (TL) Formula: K2Fe2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O Type Locality: |
| ⓘ Gjerdingenite-Mn (TL) Formula: K2Mn2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O Type Locality: |
| ⓘ Glaucodot Formula: (Co0.50Fe0.50)AsS Locality: Bjørkåsholmen, Asker, Viken, Norway Description: Glaucodote occurs together with pyrite in the outhermost parts of pyrrhotite concretions. |
| ⓘ 'Gmelinite Subgroup' |
| ⓘ Goethite Formula: α-Fe3+O(OH) Localities: Reported from at least 19 localities in this region. |
| ⓘ Gold Formula: Au Localities: Reported from at least 8 localities in this region. Description: one 1/2 mm- sized grain was found in 1984. |
| ⓘ Goslarite Formula: ZnSO4 · 7H2O Localities: |
| ⓘ Graphite Formula: C Localities: Reported from at least 7 localities in this region. |
| ⓘ Greenalite Formula: (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| ⓘ Greenockite Formula: CdS |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 Localities: Reported from at least 11 localities in this region. |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 14 localities in this region. |
| ⓘ Halite Formula: NaCl Localities: Description: Microcrystals in three-phase inclusions of quartz. |
| ⓘ Halloysite ? Formula: Al2(Si2O5)(OH)4 Locality: Gjelleråsen, Nittedal, Viken, Norway |
| ⓘ Harmotome Formula: Ba2(Si12Al4)O32 · 12H2O |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 Localities: Bjønndalen Quarry, Nittedal, Viken, Norway Kalkovnen, Østhagan Nature Reserve, Grua mining district, Grua, Lunner, Viken, Norway Mutta Mine, Grua mining district, Grua, Lunner, Viken, Norway Nyseter Zinc Mines, Grua mining district, Grua, Lunner, Viken, Norway Typografhjemmet Mine, Grua mining district, Grua, Lunner, Viken, Norway |
| ⓘ Helvine Formula: Be3Mn2+4(SiO4)3S Localities: Colour: reddish brown crystals |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 33 localities in this region. |
| ⓘ Hematite var. Specularite Formula: Fe2O3 |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Localities: Bjønndalen Quarry, Nittedal, Viken, Norway Lykkens Prøve, Grua mining district, Grua, Lunner, Viken, Norway Skjerpemyr Mine, Grua mining district, Grua, Lunner, Viken, Norway Mutta Mine, Grua mining district, Grua, Lunner, Viken, Norway Nyseter Zinc Mines, Grua mining district, Grua, Lunner, Viken, Norway ? (more information) |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ Hetaerolite Formula: ZnMn2O4 Description: NHM, Oslo XRD / SEM-EDS |
| ⓘ Hetaerolite var. Hydrohetaerolite Formula: Zn(Mn,◻)2(O,OH)4 Description: NHM, Oslo XRD / SEM-EDS |
| ⓘ Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O Localities: Description: a strontian heulandite-Ca with a distinct potasium content (Nordrum et al 2003) |
| ⓘ Heulandite-K Formula: (K,Ca,Na)5(Si27Al9)O72 · 26H2O Locality: Vardåsen Tunnel, Asker, Viken, Norway Description: A calcian Heulandite-K (Nordrum et al. 2005) |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O Localities: |
| ⓘ Hollandite Formula: Ba(Mn4+6Mn3+2)O16 |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 Locality: Spro pegmatite, Nesodden, Viken, Norway Description: Confirmed by XRD. Natural History Museum 1988 |
| ⓘ Hydrokenoralstonite Formula: Na0.5(Al,Mg)2(F,OH)6 · H2O Locality: Gjerdingselva, Lunner, Viken, Norway Habit: Masses filling interstices between feldspar xls; Botryoidal growths (white); Microcrystalline coatings on other minerals (Cubes and octahedras). Colour: Green, white and colourless. Description: Usually as green masses, consisting of submicroscopic crystals. Also as clear/white sugar-like coating in cavities. Rarely as up to 1 mm sized cubic or octahedral crystals. |
| ⓘ Hydrotungstite Formula: WO3 · 2H2O Description: NHM, Oslo XRD / SEM-EDS |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Illite-2M' |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 6 localities in this region. Description: Occur in small amounts in a larvikite SW of Lake Gjerdingen (not from the famous outcrops with fluorides, etc...). |
| ⓘ 'Ilmenite-Pyrophanite Series' |
| ⓘ Ilvaite Formula: CaFe3+Fe2+2(Si2O7)O(OH) Localities: |
| ⓘ Iron Formula: Fe Locality: Moss Meteorite, Moss, Viken, Norway |
| ⓘ Iron var. Kamacite Formula: (Fe,Ni) Locality: Moss Meteorite, Moss, Viken, Norway |
| ⓘ Janhaugite (TL) Formula: (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 Type Locality: |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 Localities: |
| ⓘ 'Jasper' Locality: Kolsås, Bærum (Baerum), Viken, Norway |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 7 localities in this region. |
| ⓘ Kentrolite Formula: Pb2Mn3+2(Si2O7)O2 Description: Small, brownish spherulites with a radial structure up to 0.5 mm |
| ⓘ 'K Feldspar' Localities: Reported from at least 7 localities in this region. Description: Orthoclase ? References: Stensrud, Sven (2004) Mineralfunn i ny sikkerhetstunnel i Vardåsen og langs ny gangvei langs Heggedalsveien i Asker 2002-2003. Bidrag til Drammengranittens beskrivelse [Mineral finds in a new safety tunnel in Vardåsen and along a walkway along Heggedalsveien in Asker 2002-2003 ]. Norsk Bergverksmuseum Skrift, 28. 76-103 |
| ⓘ Kupletskite Formula: (K,Na)3(Mn,Fe)7Ti2Si8O26(OH)4F Localities: References: |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O Localities: Reported from at least 10 localities in this region. |
| ⓘ Lepidocrocite Formula: γ-Fe3+O(OH) Locality: Katnosa, Lunner, Viken, Norway Description: Occur in the alteration product of biotite in the nordmarkite. |
| ⓘ 'Lepidolite' |
| ⓘ 'Leucoxene' |
| ⓘ 'Limonite' Localities: |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 Localities: |
| ⓘ Linnaeite Formula: Co2+Co3+2S4 Description: Cobaltian |
| ⓘ Lorenzenite Formula: Na2Ti2(Si2O6)O3 References: |
| ⓘ Mackinawite Formula: FeS Localities: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 35 localities in this region. |
| ⓘ Magnetite var. Lodestone Formula: Fe2+Fe3+2O4 Locality: Åserud, Nittedal, Viken, Norway |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 15 localities in this region. |
| ⓘ 'Manganese Oxides' Locality: Fuglemyr, Hurum, Asker, Viken, Norway |
| ⓘ Manganite Formula: Mn3+O(OH) Locality: Sætre, Hurum, Asker, Viken, Norway |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Melanotekite Formula: Pb2Fe3+2(Si2O7)O2 Habit: Powdery, earthy masses Colour: Brown-yellowish |
| ⓘ 'Mica Group' Localities: |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Reported from at least 11 localities in this region. |
| ⓘ 'Microlite Group' Formula: A2-mTa2X6-wZ-n Localities: Description: Found as small brown crystals to 3 mm or as irregular masses. |
| ⓘ Milarite Formula: K(◻H2O)Ca2(Be2Al)[Si12O30] Localities: |
| ⓘ Millerite Formula: NiS Localities: References: |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 22 localities in this region. |
| ⓘ 'Monazite' Formula: REE(PO4) Localities: Reported from at least 10 localities in this region. |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) Localities: |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O Localities: |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 23 localities in this region. |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 Localities: |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Fremmingvangen Mines, Eidsvoll gold mines, Eidsvoll, Viken, Norway Græsli Mine, Grasli Mines (Græsli Mines), Eidsvoll gold mines, Eidsvoll, Viken, Norway Gullkisgruva, Eidsvoll gold mines, Eidsvoll, Viken, Norway Sølvhølen Prospect, Bærum (Baerum), Viken, Norway Nordli molybdenum deposit, Hurdal, Viken, Norway |
| ⓘ 'Muscovite-1M' Localities: |
| ⓘ Narsarsukite Formula: Na4(Ti,Fe)2[Si8O20](O,OH,F)2 Locality: Gjerdingselva, Lunner, Viken, Norway |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O Localities: |
| ⓘ Neighborite Formula: NaMgF3 Locality: Gjerdingselva, Lunner, Viken, Norway Habit: simple cubelike, more or less elongated crystals Colour: colorless to pale brownish Description: Neighborite is only found in a fine grained variety of the ekerite rock.
NB: Difficult in some cases to distinguish from pale brownish cleavages of rhodochrosite |
| ⓘ Nepheline Formula: Na3K(Al4Si4O16) Locality: Moss Meteorite, Moss, Viken, Norway |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Opal Formula: SiO2 · nH2O Localities: Reported from at least 9 localities in this region. |
| ⓘ Opal var. Opal-AN Formula: SiO2 · nH2O Locality: Fuglemyr, Hurum, Asker, Viken, Norway |
| ⓘ Orthoclase Formula: K(AlSi3O8) Localities: Reported from at least 24 localities in this region. Description: Crystals up to 3-4 cm |
| ⓘ 'Orthopyroxene Subgroup' Description: Earlier classification as a 'hypersthene-olivine chondrite' indicates dominance of olivine and orthopyroxene in this well-equilibrated ordinary chondrite. |
| ⓘ Osarizawaite Formula: Pb(Al2Cu2+)(SO4)2(OH)6 Colour: yellowgreen |
| ⓘ Pachnolite Formula: NaCa[AlF6] · H2O Locality: Gjerdingselva, Lunner, Viken, Norway Habit: Columnar crystals with basal termination. Forms clusters with a network structure with 2 different orientations of the crystals at right angles. Basal pinacoid {001} and prism {110} Colour: white |
| ⓘ Parasymplesite ? Formula: Fe2+3(AsO4)2 · 8H2O Description: Might be symplesite. |
| ⓘ 'Parisite' Formula: Ca(Ce/La/Nd/REE)2(CO3)3F2 Locality: Lake Sandungen, Asker, Viken, Norway Description: Polycrystals of parisite and synchisiyte (Raade 1969) (probably parisite-(Ce)) |
| ⓘ Parisite-(Ce) Formula: CaCe2(CO3)3F2 |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Perovskite Formula: CaTiO3 Locality: Moss Meteorite, Moss, Viken, Norway |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ Phenakite Formula: Be2SiO4 Localities: Reported from at least 8 localities in this region. Habit: elongated prismatic xls up to 28 mm Colour: Colourless |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: Habit: Platy mica aggregates Description: Polytype 2M1 |
| ⓘ Phosgenite Formula: Pb2CO3Cl2 Habit: platy, shortprismatic and lonprismatic crystals Colour: colourless to white Description: identified by Kjartan Brastad in 1983 |
| ⓘ Phosphohedyphane Formula: Ca2Pb3(PO4)3Cl |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: |
| ⓘ Plimerite Formula: ZnFe3+4(PO4)3(OH)5 |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Pretulite Formula: Sc(PO4) |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 61 localities in this region. |
| ⓘ 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z Localities: Reported from at least 6 localities in this region. Description: A pyrochlore crystal is analyzed and show to consist of plumbopyrochlore annd ceriopyrochlore-(Ce) (Raade 2009) |
| ⓘ 'Pyrochlore Group var. Ceriopyrochlore (of Hogarth 1977)' Formula: A2Nb2(O,OH)6Z Locality: Gjerdingselva, Lunner, Viken, Norway Description: BSE-images and EMP analysis of a crystal of a pyrochlore group minera showed that the crystal consisted of ceriopyrochlore-(Y) as the central part and plumbopyrochlore as the outer rim (Raade 2009). |
| ⓘ 'Pyrochlore Group var. Plumbopyrochlore (of Skorobogatova et al.)' Formula: A2Nb2(O,OH)6Z Locality: Gjerdingselva, Lunner, Viken, Norway Description: Found in one crystals BSE-images and EMP analysis showed that the crystal consisted of ceriopyrochlore-(Y) as the central part and plumbopyrochlore as the outer rim (Raade 2009) |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrophanite Formula: Mn2+TiO3 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 Localities: Reported from at least 9 localities in this region. |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 14 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 127 localities in this region. |
| ⓘ Quartz var. Agate Locality: Kolsås, Bærum (Baerum), Viken, Norway |
| ⓘ Quartz var. Amethyst Formula: SiO2 Localities: Reported from at least 7 localities in this region. Description: Purple colored amethyst-quartz has been found somewhere near Nyseter |
| ⓘ Quartz var. Chalcedony Formula: SiO2 Localities: |
| ⓘ Quartz var. Citrine Formula: SiO2 Localities: Description: Smoky Quartz with citrine termination, some with inclusions of topaz has been found in this area |
| ⓘ Quartz var. Sceptre Quartz Formula: SiO2 Localities: |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Localities: Reported from at least 25 localities in this region. |
| ⓘ Rhodochrosite Formula: MnCO3 Localities: Colour: pale brownish Description: Occurs sometimes together with neighborite (Raade & Haug 1980) References: |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] Localities: References: |
| ⓘ Riebeckite Formula: ◻[Na2][Fe2+3Fe3+2]Si8O22(OH)2 |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 Localities: References: Raade, Gunnar, Sæbø, Per Chr. (1990) New Secondary Copper Minerals from Norway. Mineralogisk-Geologisk Museum - Universitetet i Oslo- Interne notater, Geologisk Museums venner. 145-148p.145 - XRD film 28502 & 28629, found by Harald Folvik |
| ⓘ Rozenite Formula: FeSO4 · 4H2O |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Rutile var. Ilmenorutile Formula: (Ti,Nb)O2 |
| ⓘ Rutile var. Niobium-bearing Rutile Formula: (Ti,Nb)O2 Locality: Gjerdingselva, Lunner, Viken, Norway |
| ⓘ Samarskite-(Y) Formula: YFe3+Nb2O8 Localities: |
| ⓘ Saponite Formula: Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O Locality: Midtmoen, Øståsen, Lunner, Viken, Norway |
| ⓘ 'Scapolite' Localities: |
| ⓘ Scheelite Formula: Ca(WO4) Localities: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Sellaite Formula: MgF2 Localities: Habit: masses; rough crystals in the form of a flat tetragonal bipyramids Colour: white Description: Found as nice colourless crystals in miarolitic cavities. |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 8 localities in this region. |
| ⓘ Silver Formula: Ag Localities: References: |
| ⓘ 'Smectite Group' Formula: A0.3D2-3[T4O10]Z2 · nH2O Locality: Holmsbu, Hurum, Asker, Viken, Norway |
| ⓘ Smithsonite Formula: ZnCO3 Localities: Bjønndalen Quarry, Nittedal, Viken, Norway Skjerpemyr Mine, Grua mining district, Grua, Lunner, Viken, Norway Lykkens Prøve, Grua mining district, Grua, Lunner, Viken, Norway Nyseter Zinc Mines, Grua mining district, Grua, Lunner, Viken, Norway Mutta Mine, Grua mining district, Grua, Lunner, Viken, Norway |
| ⓘ 'Soapstone' |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 34 localities in this region. Habit: singel & twin crystals Colour: yellow, dark redbrown References: |
| ⓘ Spinel Formula: MgAl2O4 Locality: Moss Meteorite, Moss, Viken, Norway |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O Localities: Reported from at least 16 localities in this region. |
| ⓘ Stilpnomelane Formula: (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O Localities: Reported from at least 7 localities in this region. |
| ⓘ Stolzite Formula: Pb(WO4) |
| ⓘ Strontianite Formula: SrCO3 |
| ⓘ Sulphur Formula: S8 Localities: Reported from at least 6 localities in this region. |
| ⓘ Sylvite Formula: KCl |
| ⓘ Symplesite ? Formula: Fe2+3(AsO4)2 · 8H2O Colour: brown to redorange Description: Reported by Kamphaug ((1986), however Raade (1993) has pointed to that the XRD film does not show any indentifiable refelctions, and its identitity can not be establish. |
| ⓘ 'Synchysite' Formula: Ca(Ce/Nd/Y/REE)(CO3)2F Localities: |
| ⓘ Synchysite-(Ce) Formula: CaCe(CO3)2F |
| ⓘ Szomolnokite Formula: FeSO4 · H2O Colour: Pale brown Description: Occure as an alteration product after pyrite, together with fine-grained pyrite on pyrite-bearing quartz. |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: |
| ⓘ Tantalite-(Fe) Formula: Fe2+Ta2O6 |
| ⓘ Tellurobismuthite Formula: Bi2Te3 Localities: |
| ⓘ Tenorite Formula: CuO Localities: |
| ⓘ Tetradymite Formula: Bi2Te2S Localities: |
| ⓘ Thomsenolite Formula: NaCa[AlF6] · H2O Locality: Gjerdingselva, Lunner, Viken, Norway Habit: Groups of tabular xls with prism {110} and basal pinacoid {001} Colour: white Description: Occure as tabular, white crystals, often associated with younger ralstonite. |
| ⓘ Thorianite Formula: ThO2 |
| ⓘ Thorite Formula: Th(SiO4) Localities: References: |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: Reported from at least 19 localities in this region. |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Colour: black to blue in fragments |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: |
| ⓘ Troilite Formula: FeS Localities: |
| ⓘ Ulvöspinel Formula: TiFe2+2O4 Description: Kristoffersen (1973) found small amounts of ulvöspinel with ilmenite in a larvikite-rock SW of Gjerdingen. |
| ⓘ Uraninite Formula: UO2 Localities: |
| ⓘ Uvarovite Formula: Ca3Cr2(SiO4)3 Localities: |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 Localities: Reported from at least 8 localities in this region. |
| ⓘ Violarite Formula: Fe2+Ni3+2S4 Locality: Mistberget area, Hurdal, Viken, Norway |
| ⓘ Wavellite ? Formula: Al3(PO4)2(OH,F)3 · 5H2O Description: Of doubtful origin. A sample was found in a box originating from the Norwegian Geological Survey (NGU) marked 300 M NV of Knepphaughytta.
Sample analyzed by P. Ihlen (Pers. communication by Tor Witsø to Knut Edvard Larsen 1997); Fjellvang, R. & Kvamsdal, L. O. (2018) Mysteriet om wavelitten. Stein 45 (1): 34-38 |
| ⓘ 'Wolframite Group' Localities: |
| ⓘ Wollastonite Formula: Ca3(Si3O9) Localities: Reported from at least 8 localities in this region. |
| ⓘ Woodwardite Formula: Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: Reported from at least 9 localities in this region. |
| ⓘ Xenotime-(Y) Formula: Y(PO4) Localities: |
| ⓘ Yttrotantalite-(Y) Formula: (Y,U,Fe2+)(Ta,Nb)(O,OH)4 Localities: Description: Brøgger found yttrotantalite-(Y) at this locality first time in 1881. |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 17 localities in this region. |
| ⓘ Zircon var. Alvite Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Iron var. Kamacite | 1.AE.05 | (Fe,Ni) |
| ⓘ | 1.AE.05 | Fe | |
| ⓘ | Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Troilite | 2.CC.10 | FeS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Violarite | 2.DA.05 | Fe2+Ni3+2S4 |
| ⓘ | Carrollite | 2.DA.05 | CuCo2S4 |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| Group 3 - Halides | |||
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Sylvite | 3.AA.20 | KCl |
| ⓘ | Neighborite | 3.AA.35 | NaMgF3 |
| ⓘ | Sellaite | 3.AB.15 | MgF2 |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Gagarinite-(Y) | 3.AB.35 | NaCaYF6 |
| ⓘ | Antarcticite ? | 3.BB.30 | CaCl2 · 6H2O |
| ⓘ | Cryolite | 3.CB.15 | Na2NaAlF6 |
| ⓘ | Thomsenolite | 3.CB.40 | NaCa[AlF6] · H2O |
| ⓘ | Pachnolite | 3.CB.40 | NaCa[AlF6] · H2O |
| ⓘ | Gearksutite | 3.CC.05 | Ca[Al(F,OH)5(H2O)] |
| ⓘ | Hydrokenoralstonite | 3.CF.05 | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ-n |
| ⓘ | 'Pyrochlore Group var. Plumbopyrochlore (of Skorobogatova et al.)' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | 'var. Ceriopyrochlore (of Hogarth 1977)' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite var. Lodestone | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Ulvöspinel | 4.BB.05 | TiFe2+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hetaerolite | 4.BB.10 | ZnMn2O4 |
| ⓘ | var. Hydrohetaerolite | 4.BB.10 | Zn(Mn,◻)2(O,OH)4 |
| ⓘ | Byrudite (TL) | 4.CA. | (Be,◻)(V3+,Ti,Cr)3O6 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Pyrophanite | 4.CB.05 | Mn2+TiO3 |
| ⓘ | Perovskite | 4.CC.30 | CaTiO3 |
| ⓘ | Quartz var. Citrine | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var. Sceptre Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Agate | 4.DA.05 | SiO2 |
| ⓘ | var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Rutile var. Niobium-bearing Rutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile var. Ilmenorutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | 4.DB.05 | TiO2 | |
| ⓘ | Samarskite-(Y) | 4.DB.25 | YFe3+Nb2O8 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Tantalite-(Fe) | 4.DB.35 | Fe2+Ta2O6 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Euxenite-(Y) | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ | Yttrotantalite-(Y) | 4.DG.10 | (Y,U,Fe2+)(Ta,Nb)(O,OH)4 |
| ⓘ | Brannerite ? | 4.DH.05 | UTi2O6 |
| ⓘ | Hollandite | 4.DK.05a | Ba(Mn4+6Mn3+2)O16 |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Thorianite | 4.DL.05 | ThO2 |
| ⓘ | Cerianite-(Ce) ? | 4.DL.05 | (Ce4+,Th)O2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Diaspore ? | 4.FD.10 | AlO(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Doyleite | 4.FE.10 | Al(OH)3 |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| ⓘ | Lepidocrocite | 4.FE.15 | γ-Fe3+O(OH) |
| ⓘ | Hydrotungstite | 4.FJ.15 | WO3 · 2H2O |
| ⓘ | Chalcophanite | 4.FL.20 | ZnMn4+3O7 · 3H2O |
| ⓘ | Birnessite ? | 4.FL.45 | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Strontianite | 5.AB.15 | SrCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Parisite-(Ce) | 5.BD.20b | CaCe2(CO3)3F2 |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Phosgenite | 5.BE.20 | Pb2CO3Cl2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Brianyoungite | 5.BF.30 | Zn3(CO3,SO4)(OH)4 |
| ⓘ | Ancylite-(Ce) | 5.DC.05 | CeSr(CO3)2(OH) · H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Osarizawaite | 7.BC.10 | Pb(Al2Cu2+)(SO4)2(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Szomolnokite | 7.CB.05 | FeSO4 · H2O |
| ⓘ | Rozenite | 7.CB.15 | FeSO4 · 4H2O |
| ⓘ | Goslarite | 7.CB.40 | ZnSO4 · 7H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Aluminocopiapite | 7.DB.35 | Al2/3Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Woodwardite | 7.DD.35 | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| ⓘ | Cyanotrichite | 7.DE.10 | Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Fergusonite-(Y) | 7.GA.05 | YNbO4 |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pretulite | 8.AD.35 | Sc(PO4) |
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Cheralite | 8.AD.50 | CaTh(PO4)2 |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Plimerite | 8.BC.10 | ZnFe3+4(PO4)3(OH)5 |
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Beudantite | 8.BL.05 | PbFe3(AsO4)(SO4)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Fluorphosphohedyphane | 8.BN.05 | Ca2Pb3(PO4)3F |
| ⓘ | Phosphohedyphane | 8.BN.05 | Ca2Pb3(PO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Parasymplesite ? | 8.CE.40 | Fe2+3(AsO4)2 · 8H2O |
| ⓘ | Symplesite ? | 8.CE.45 | Fe2+3(AsO4)2 · 8H2O |
| ⓘ | Beraunite ? | 8.DC.27 | Fe3+6(PO4)4O(OH)4 · 6H2O |
| ⓘ | Wavellite ? | 8.DC.50 | Al3(PO4)2(OH,F)3 · 5H2O |
| ⓘ | Ferroberaunite ? | 8.DH. | Fe2+Fe3+5(PO4)4(OH)5 · 6H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| Group 9 - Silicates | |||
| ⓘ | Phenakite | 9.AA.05 | Be2SiO4 |
| ⓘ | Forsterite | 9.AC.05 | Mg2SiO4 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Uvarovite | 9.AD.25 | Ca3Cr2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Zircon var. Alvite | 9.AD.30 | Zr(SiO4) |
| ⓘ | 9.AD.30 | Zr(SiO4) | |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Gadolinite-(Y) | 9.AJ.20 | Y2Fe2+Be2Si2O10 |
| ⓘ | Boltwoodite | 9.AK.15 | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Ilvaite | 9.BE.07 | CaFe3+Fe2+2(Si2O7)O(OH) |
| ⓘ | Janhaugite (TL) | 9.BE.17 | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| ⓘ | Chevkinite-(Ce) | 9.BE.70 | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| ⓘ | Melanotekite | 9.BE.80 | Pb2Fe3+2(Si2O7)O2 |
| ⓘ | Kentrolite | 9.BE.80 | Pb2Mn3+2(Si2O7)O2 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Gjerdingenite-Fe (TL) | 9.CE.30c | K2Fe2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| ⓘ | Gjerdingenite-Mn (TL) | 9.CE.30c | K2Mn2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Emerald | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| ⓘ | Bazzite | 9.CJ.05 | Be3Sc2(Si6O18) |
| ⓘ | Fluor-schorl | 9.CK. | NaFe2+3Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Milarite | 9.CM.05 | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Lorenzenite | 9.DB.10 | Na2Ti2(Si2O6)O3 |
| ⓘ | Astrophyllite ? | 9.DC.05 | K2NaFe2+7Ti2Si8O26(OH)4F |
| ⓘ | Kupletskite | 9.DC.05 | (K,Na)3(Mn,Fe)7Ti2Si8O26(OH)4F |
| ⓘ | Gedrite | 9.DD.05 | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| ⓘ | Ferro-gedrite | 9.DD.05 | ◻{Fe2+2}{Fe2+3Al2}(Al2Si6O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Arfvedsonite | 9.DE.25 | [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 |
| ⓘ | Riebeckite | 9.DE.25 | ◻[Na2][Fe2+3Fe3+2]Si8O22(OH)2 |
| ⓘ | Bavenite | 9.DF.25 | Ca4Be2Al2Si9O26(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Epididymite | 9.DG.55 | Na2Be2Si6O15 · H2O |
| ⓘ | Elpidite var. Calcium-bearing Elpidite | 9.DG.65 | (Na,Ca)2ZrSi6O15 · 3H2O |
| ⓘ | 9.DG.65 | Na2ZrSi6O15 · 3H2O | |
| ⓘ | Narsarsukite | 9.DJ.05 | Na4(Ti,Fe)2[Si8O20](O,OH,F)2 |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Alamosite | 9.DO.20 | PbSiO3 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Fluorapophyllite-(K) | 9.EA.15 | KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ | Dalyite | 9.EA.25 | K2ZrSi6O15 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Celadonite | 9.EC.15 | K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Saponite | 9.EC.45 | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Chamosite var. Thuringite | 9.EC.55 | (Fe,Fe,Mg,Al)6(Si,Al)4O10(O,OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Halloysite ? | 9.ED.10 | Al2(Si2O5)(OH)4 |
| ⓘ | Greenalite | 9.ED.15 | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | var. Cupro-Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Stilpnomelane | 9.EG.40 | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| ⓘ | Nepheline | 9.FA.05 | Na3K(Al4Si4O16) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite var. Andesine ? | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | 9.FA.35 | Na(AlSi3O8) | |
| ⓘ | Anorthite ? | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| ⓘ | Genthelvite | 9.FB.10 | Be3Zn4(SiO4)3S |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Harmotome | 9.GC.10 | Ba2(Si12Al4)O32 · 12H2O |
| ⓘ | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ | Heulandite-K | 9.GE.05 | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Unclassified | |||
| ⓘ | 'Soapstone' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Euxenite Group' | - | |
| ⓘ | 'Amphibole Supergroup var. Byssolite' | - | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Smectite Group' | - | A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'Coal blend' | - | |
| ⓘ | 'Illite-2M' | - | |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Aeschynite' | - | |
| ⓘ | 'Chevkinite Group' ? | - | |
| ⓘ | 'Muscovite-1M' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Dravite-Uvite Series' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Almandine-Spessartine Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Amphibole Supergroup var. Uralite' | - | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Fluor-uvite-Uvite Series' | - | |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O22]X · 8H2O |
| ⓘ | 'Gmelinite Subgroup' | - | |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Jasper' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Parisite' | - | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| ⓘ | 'Synchysite' | - | Ca(Ce/Nd/Y/REE)(CO3)2F |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Andradite-Grossular Series' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Ilmenite-Pyrophanite Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Lepidolite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Aluminocopiapite | Al2/3Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| H | ⓘ Antarcticite | CaCl2 · 6H2O |
| H | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| H | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| H | ⓘ Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| H | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| H | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| H | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| H | ⓘ Pyrochlore Group var. Ceriopyrochlore (of Hogarth 1977) | A2Nb2(O,OH)6Z |
| H | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| H | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Doyleite | Al(OH)3 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| H | ⓘ Epididymite | Na2Be2Si6O15 · H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Ferro-gedrite | ◻{Fe22+}{Fe32+Al2}(Al2Si6O22)(OH)2 |
| H | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| H | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| H | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Goslarite | ZnSO4 · 7H2O |
| H | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| H | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| H | ⓘ Hydrotungstite | WO3 · 2H2O |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| H | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kupletskite | (K,Na)3(Mn,Fe)7Ti2Si8O26(OH)4F |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Narsarsukite | Na4(Ti,Fe)2[Si8O20](O,OH,F)2 |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| H | ⓘ Pachnolite | NaCa[AlF6] · H2O |
| H | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Pyrochlore Group var. Plumbopyrochlore (of Skorobogatova et al.) | A2Nb2(O,OH)6Z |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| H | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Rozenite | FeSO4 · 4H2O |
| H | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| H | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| H | ⓘ Szomolnokite | FeSO4 · H2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Thomsenolite | NaCa[AlF6] · H2O |
| H | ⓘ Chamosite var. Thuringite | (Fe,Fe,Mg,Al)6(Si,Al)4O10(O,OH)8 |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| H | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| H | ⓘ Yttrotantalite-(Y) | (Y,U,Fe2+)(Ta,Nb)(O,OH)4 |
| H | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Allophane var. Cupro-Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Gjerdingenite-Fe | K2Fe2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| H | ⓘ Gjerdingenite-Mn | K2Mn2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| H | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Plimerite | ZnFe43+(PO4)3(OH)5 |
| H | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| H | ⓘ Ferroberaunite | Fe2+Fe53+(PO4)4(OH)5 · 6H2O |
| Be | Beryllium | |
| Be | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Be | ⓘ Bazzite | Be3Sc2(Si6O18) |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Be | ⓘ Epididymite | Na2Be2Si6O15 · H2O |
| Be | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Be | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Be | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Be | ⓘ Phenakite | Be2SiO4 |
| Be | ⓘ Byrudite | (Be,◻)(V3+,Ti,Cr)3O6 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| C | Carbon | |
| C | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| C | ⓘ Phosgenite | Pb2CO3Cl2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Strontianite | SrCO3 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| C | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| C | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Aluminocopiapite | Al2/3Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Alamosite | PbSiO3 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Zircon var. Alvite | Zr(SiO4) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Antarcticite | CaCl2 · 6H2O |
| O | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| O | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| O | ⓘ Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| O | ⓘ Bazzite | Be3Sc2(Si6O18) |
| O | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| O | ⓘ Cerianite-(Ce) | (Ce4+,Th)O2 |
| O | ⓘ Pyrochlore Group var. Ceriopyrochlore (of Hogarth 1977) | A2Nb2(O,OH)6Z |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Quartz var. Citrine | SiO2 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| O | ⓘ Dalyite | K2ZrSi6O15 |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Doyleite | Al(OH)3 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| O | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| O | ⓘ Epididymite | Na2Be2Si6O15 · H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Fergusonite-(Y) | YNbO4 |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Ferro-gedrite | ◻{Fe22+}{Fe32+Al2}(Al2Si6O22)(OH)2 |
| O | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| O | ⓘ Forsterite | Mg2SiO4 |
| O | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| O | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| O | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| O | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Goslarite | ZnSO4 · 7H2O |
| O | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| O | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hetaerolite | ZnMn2O4 |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| O | ⓘ Hydrotungstite | WO3 · 2H2O |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| O | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| O | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| O | ⓘ Kupletskite | (K,Na)3(Mn,Fe)7Ti2Si8O26(OH)4F |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Lorenzenite | Na2Ti2(Si2O6)O3 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Narsarsukite | Na4(Ti,Fe)2[Si8O20](O,OH,F)2 |
| O | ⓘ Nepheline | Na3K(Al4Si4O16) |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| O | ⓘ Pachnolite | NaCa[AlF6] · H2O |
| O | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| O | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| O | ⓘ Perovskite | CaTiO3 |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Phenakite | Be2SiO4 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Phosgenite | Pb2CO3Cl2 |
| O | ⓘ Pyrochlore Group var. Plumbopyrochlore (of Skorobogatova et al.) | A2Nb2(O,OH)6Z |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyrophanite | Mn2+TiO3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Rozenite | FeSO4 · 4H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| O | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Strontianite | SrCO3 |
| O | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Szomolnokite | FeSO4 · H2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Thomsenolite | NaCa[AlF6] · H2O |
| O | ⓘ Thorianite | ThO2 |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Chamosite var. Thuringite | (Fe,Fe,Mg,Al)6(Si,Al)4O10(O,OH)8 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Ulvöspinel | TiFe22+O4 |
| O | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| O | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Yttrotantalite-(Y) | (Y,U,Fe2+)(Ta,Nb)(O,OH)4 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Magnetite var. Lodestone | Fe2+Fe23+O4 |
| O | ⓘ Cheralite | CaTh(PO4)2 |
| O | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| O | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Pretulite | Sc(PO4) |
| O | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| O | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| O | ⓘ Quartz var. Sceptre Quartz | SiO2 |
| O | ⓘ Allophane var. Cupro-Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| O | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Gjerdingenite-Fe | K2Fe2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| O | ⓘ Gjerdingenite-Mn | K2Mn2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| O | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| O | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Plimerite | ZnFe43+(PO4)3(OH)5 |
| O | ⓘ Fluorphosphohedyphane | Ca2Pb3(PO4)3F |
| O | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| O | ⓘ Byrudite | (Be,◻)(V3+,Ti,Cr)3O6 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ferroberaunite | Fe2+Fe53+(PO4)4(OH)5 · 6H2O |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Cryolite | Na2NaAlF6 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Gagarinite-(Y) | NaCaYF6 |
| F | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| F | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| F | ⓘ Kupletskite | (K,Na)3(Mn,Fe)7Ti2Si8O26(OH)4F |
| F | ⓘ Narsarsukite | Na4(Ti,Fe)2[Si8O20](O,OH,F)2 |
| F | ⓘ Neighborite | NaMgF3 |
| F | ⓘ Pachnolite | NaCa[AlF6] · H2O |
| F | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| F | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| F | ⓘ Sellaite | MgF2 |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| F | ⓘ Thomsenolite | NaCa[AlF6] · H2O |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| F | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| F | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Fluorphosphohedyphane | Ca2Pb3(PO4)3F |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Na | ⓘ Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| Na | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Na | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| Na | ⓘ Cryolite | Na2NaAlF6 |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| Na | ⓘ Epididymite | Na2Be2Si6O15 · H2O |
| Na | ⓘ Gagarinite-(Y) | NaCaYF6 |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| Na | ⓘ Kupletskite | (K,Na)3(Mn,Fe)7Ti2Si8O26(OH)4F |
| Na | ⓘ Lorenzenite | Na2Ti2(Si2O6)O3 |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Narsarsukite | Na4(Ti,Fe)2[Si8O20](O,OH,F)2 |
| Na | ⓘ Neighborite | NaMgF3 |
| Na | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Pachnolite | NaCa[AlF6] · H2O |
| Na | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| Na | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Na | ⓘ Thomsenolite | NaCa[AlF6] · H2O |
| Na | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| Na | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Forsterite | Mg2SiO4 |
| Mg | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Neighborite | NaMgF3 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| Mg | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Mg | ⓘ Sellaite | MgF2 |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Chamosite var. Thuringite | (Fe,Fe,Mg,Al)6(Si,Al)4O10(O,OH)8 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | Aluminium | |
| Al | ⓘ Aluminocopiapite | Al2/3Fe43+(SO4)6(OH)2 · 20H2O |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Cryolite | Na2NaAlF6 |
| Al | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Doyleite | Al(OH)3 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Ferro-gedrite | ◻{Fe22+}{Fe32+Al2}(Al2Si6O22)(OH)2 |
| Al | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| Al | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Al | ⓘ Pachnolite | NaCa[AlF6] · H2O |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| Al | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Al | ⓘ Thomsenolite | NaCa[AlF6] · H2O |
| Al | ⓘ Chamosite var. Thuringite | (Fe,Fe,Mg,Al)6(Si,Al)4O10(O,OH)8 |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| Al | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Al | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Allophane var. Cupro-Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Alamosite | PbSiO3 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Zircon var. Alvite | Zr(SiO4) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| Si | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Si | ⓘ Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Si | ⓘ Bazzite | Be3Sc2(Si6O18) |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Quartz var. Citrine | SiO2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Dalyite | K2ZrSi6O15 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| Si | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Si | ⓘ Epididymite | Na2Be2Si6O15 · H2O |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Ferro-gedrite | ◻{Fe22+}{Fe32+Al2}(Al2Si6O22)(OH)2 |
| Si | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Si | ⓘ Forsterite | Mg2SiO4 |
| Si | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Si | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Si | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Si | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Si | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Si | ⓘ Kupletskite | (K,Na)3(Mn,Fe)7Ti2Si8O26(OH)4F |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Lorenzenite | Na2Ti2(Si2O6)O3 |
| Si | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Narsarsukite | Na4(Ti,Fe)2[Si8O20](O,OH,F)2 |
| Si | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Phenakite | Be2SiO4 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Si | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Chamosite var. Thuringite | (Fe,Fe,Mg,Al)6(Si,Al)4O10(O,OH)8 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Si | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Quartz var. Sceptre Quartz | SiO2 |
| Si | ⓘ Allophane var. Cupro-Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Gjerdingenite-Fe | K2Fe2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| Si | ⓘ Gjerdingenite-Mn | K2Mn2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| Si | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| Si | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Cheralite | CaTh(PO4)2 |
| P | ⓘ Pretulite | Sc(PO4) |
| P | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Plimerite | ZnFe43+(PO4)3(OH)5 |
| P | ⓘ Fluorphosphohedyphane | Ca2Pb3(PO4)3F |
| P | ⓘ Ferroberaunite | Fe2+Fe53+(PO4)4(OH)5 · 6H2O |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aluminocopiapite | Al2/3Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Carrollite | CuCo2S4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Galena | PbS |
| S | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| S | ⓘ Goslarite | ZnSO4 · 7H2O |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Rozenite | FeSO4 · 4H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Szomolnokite | FeSO4 · H2O |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Troilite | FeS |
| S | ⓘ Violarite | Fe2+Ni23+S4 |
| S | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Antarcticite | CaCl2 · 6H2O |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Phosgenite | Pb2CO3Cl2 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Sylvite | KCl |
| Cl | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| K | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| K | ⓘ Dalyite | K2ZrSi6O15 |
| K | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Kupletskite | (K,Na)3(Mn,Fe)7Ti2Si8O26(OH)4F |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Nepheline | Na3K(Al4Si4O16) |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| K | ⓘ Sylvite | KCl |
| K | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Gjerdingenite-Fe | K2Fe2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| K | ⓘ Gjerdingenite-Mn | K2Mn2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Antarcticite | CaCl2 · 6H2O |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Ca | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gagarinite-(Y) | NaCaYF6 |
| Ca | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Ca | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Pachnolite | NaCa[AlF6] · H2O |
| Ca | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ca | ⓘ Perovskite | CaTiO3 |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Thomsenolite | NaCa[AlF6] · H2O |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Cheralite | CaTh(PO4)2 |
| Ca | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| Ca | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Fluorphosphohedyphane | Ca2Pb3(PO4)3F |
| Ca | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Sc | Scandium | |
| Sc | ⓘ Bazzite | Be3Sc2(Si6O18) |
| Sc | ⓘ Pretulite | Sc(PO4) |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brannerite | UTi2O6 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Ti | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| Ti | ⓘ Kupletskite | (K,Na)3(Mn,Fe)7Ti2Si8O26(OH)4F |
| Ti | ⓘ Lorenzenite | Na2Ti2(Si2O6)O3 |
| Ti | ⓘ Narsarsukite | Na4(Ti,Fe)2[Si8O20](O,OH,F)2 |
| Ti | ⓘ Perovskite | CaTiO3 |
| Ti | ⓘ Pyrophanite | Mn2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Ulvöspinel | TiFe22+O4 |
| Ti | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Ti | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Ti | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Gjerdingenite-Fe | K2Fe2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| Ti | ⓘ Gjerdingenite-Mn | K2Mn2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| Ti | ⓘ Byrudite | (Be,◻)(V3+,Ti,Cr)3O6 |
| V | Vanadium | |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Byrudite | (Be,◻)(V3+,Ti,Cr)3O6 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| Cr | ⓘ Byrudite | (Be,◻)(V3+,Ti,Cr)3O6 |
| Mn | Manganese | |
| Mn | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Hetaerolite | ZnMn2O4 |
| Mn | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Mn | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| Mn | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| Mn | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Mn | ⓘ Kupletskite | (K,Na)3(Mn,Fe)7Ti2Si8O26(OH)4F |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Pyrophanite | Mn2+TiO3 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Mn | ⓘ Gjerdingenite-Mn | K2Mn2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Aluminocopiapite | Al2/3Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Fe | ⓘ Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| Fe | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Ferro-gedrite | ◻{Fe22+}{Fe32+Al2}(Al2Si6O22)(OH)2 |
| Fe | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| Fe | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Fe | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Fe | ⓘ Iron | Fe |
| Fe | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Iron var. Kamacite | (Fe,Ni) |
| Fe | ⓘ Kupletskite | (K,Na)3(Mn,Fe)7Ti2Si8O26(OH)4F |
| Fe | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Fe | ⓘ Narsarsukite | Na4(Ti,Fe)2[Si8O20](O,OH,F)2 |
| Fe | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Fe | ⓘ Rozenite | FeSO4 · 4H2O |
| Fe | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Fe | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Fe | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| Fe | ⓘ Szomolnokite | FeSO4 · H2O |
| Fe | ⓘ Chamosite var. Thuringite | (Fe,Fe,Mg,Al)6(Si,Al)4O10(O,OH)8 |
| Fe | ⓘ Troilite | FeS |
| Fe | ⓘ Ulvöspinel | TiFe22+O4 |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | ⓘ Violarite | Fe2+Ni23+S4 |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Yttrotantalite-(Y) | (Y,U,Fe2+)(Ta,Nb)(O,OH)4 |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Magnetite var. Lodestone | Fe2+Fe23+O4 |
| Fe | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Fe | ⓘ Gjerdingenite-Fe | K2Fe2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| Fe | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| Fe | ⓘ Plimerite | ZnFe43+(PO4)3(OH)5 |
| Fe | ⓘ Ferroberaunite | Fe2+Fe53+(PO4)4(OH)5 · 6H2O |
| Co | Cobalt | |
| Co | ⓘ Carrollite | CuCo2S4 |
| Co | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Ni | Nickel | |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Iron var. Kamacite | (Fe,Ni) |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Violarite | Fe2+Ni23+S4 |
| Cu | Copper | |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Carrollite | CuCo2S4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| Zn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Zn | ⓘ Goslarite | ZnSO4 · 7H2O |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hetaerolite | ZnMn2O4 |
| Zn | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Plimerite | ZnFe43+(PO4)3(OH)5 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| Sr | Strontium | |
| Sr | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| Sr | ⓘ Strontianite | SrCO3 |
| Y | Yttrium | |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Y | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Y | ⓘ Fergusonite-(Y) | YNbO4 |
| Y | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Y | ⓘ Gagarinite-(Y) | NaCaYF6 |
| Y | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Y | ⓘ Yttrotantalite-(Y) | (Y,U,Fe2+)(Ta,Nb)(O,OH)4 |
| Y | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Zr | Zirconium | |
| Zr | ⓘ Zircon var. Alvite | Zr(SiO4) |
| Zr | ⓘ Dalyite | K2ZrSi6O15 |
| Zr | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| Zr | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Nb | Niobium | |
| Nb | ⓘ Pyrochlore Group var. Ceriopyrochlore (of Hogarth 1977) | A2Nb2(O,OH)6Z |
| Nb | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Nb | ⓘ Fergusonite-(Y) | YNbO4 |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Nb | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Pyrochlore Group var. Plumbopyrochlore (of Skorobogatova et al.) | A2Nb2(O,OH)6Z |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Nb | ⓘ Yttrotantalite-(Y) | (Y,U,Fe2+)(Ta,Nb)(O,OH)4 |
| Nb | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Nb | ⓘ Gjerdingenite-Fe | K2Fe2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| Nb | ⓘ Gjerdingenite-Mn | K2Mn2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Silver | Ag |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Ba | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| La | Lanthanum | |
| La | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ce | ⓘ Cerianite-(Ce) | (Ce4+,Th)O2 |
| Ce | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ce | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Ce | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| Ce | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Nd | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| Nd | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Ta | Tantalum | |
| Ta | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ta | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ-n |
| Ta | ⓘ Yttrotantalite-(Y) | (Y,U,Fe2+)(Ta,Nb)(O,OH)4 |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Hydrotungstite | WO3 · 2H2O |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Alamosite | PbSiO3 |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Pb | ⓘ Phosgenite | Pb2CO3Cl2 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Pb | ⓘ Fluorphosphohedyphane | Ca2Pb3(PO4)3F |
| Bi | Bismuth | |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| Th | Thorium | |
| Th | ⓘ Cerianite-(Ce) | (Ce4+,Th)O2 |
| Th | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Th | ⓘ Thorianite | ThO2 |
| Th | ⓘ Thorite | Th(SiO4) |
| Th | ⓘ Cheralite | CaTh(PO4)2 |
| U | Uranium | |
| U | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| U | ⓘ Brannerite | UTi2O6 |
| U | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Yttrotantalite-(Y) | (Y,U,Fe2+)(Ta,Nb)(O,OH)4 |
Geochronology
Mineralization age: Paleozoic : 485.4 ± 1.9 Ma to 443.8 ± 1.5 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||
|---|---|---|---|---|---|---|---|
| Phanerozoic | |||||||
| Paleozoic | |||||||
| Ordovician |
| ||||||
Fossils
There are 227 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 3089 |
|---|---|
| Youngest Fossil Listed | 272 Ma (Permian) |
| Oldest Fossil Listed | 541 Ma (Cambrian) |
| Stratigraphic Units | Click here to view 91 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 227 fossil localities |
- Buskerud
- Drammen
- Flesberg
- Hole
- Ordovician🐚 Bratterud beach
- Paleozoic🐚 Bønsnes
- Late/Upper Ordovician🐚 Frognøya
- Ordovician🐚 Gomnes - Rud
- Ordovician🐚 Gomnes-Rud
- Late/Upper Ordovician🐚 Hole
- Paleozoic🐚 Nøstret
- Silurian🐚 Ringerike
- Late/Upper Ordovician🐚 Røyse
- Ordovician🐚 Røysetangen
- Late/Upper Ordovician🐚 Stamnestangen
- Paleozoic🐚 Store Svartøya
- Silurian🐚 Sønsterud farm
- Paleozoic🐚 Ullerntangen
- Late/Upper Ordovician🐚 Vestbråtan
- Late/Upper Ordovician🐚 Vestre Svartøy
- Paleozoic🐚 Vestre Svartøya
- Late/Upper Ordovician🐚 Western side of Frognöy
- Late/Upper Ordovician🐚 Western side of Frognøy
- Kongsberg
- Lier
- Modum
- Øvre Eiker
- Ringerike
- Silurian🐚 Atrypa 'reticularis'-Dicoelosia alticavata Community at Ringerike
- Late/Upper Ordovician🐚 Bjørkeåsen
- Ordovician🐚 Brattstad locality
- Late/Upper Ordovician🐚 Frok
- Paleozoic🐚 Grunntjern in Vakerdalen
- Ordovician🐚 Gullerud
- Cambrian🐚 Hval
- Cambrian🐚 N. Gausdal
- Ordovician🐚 Norderhov
- Late/Upper Ordovician🐚 Rud
- Paleozoic🐚 Stavnestangen
- Cambrian🐚 Steinsvika
- Late/Upper Ordovician🐚 Vaker
- Ordovician🐚 Vesleseter
- Cambrian🐚 Viul
- Rollag
- Østfold
- Viken
- Paleozoic🐚 Klunderud
- Cambrian🐚 Saltboden core
- Asker
- Ordovician🐚 Arnestad
- Paleozoic🐚 Autumn 1931 Holtedahl-Stormer collection
- Late/Upper Ordovician🐚 Bakke
- Late/Upper Ordovician🐚 between Hvalstad & Billingstad railway section
- Middle Ordovician🐚 between Sjøstrand and Hagebukta
- Middle Ordovician🐚 Bjerkås
- Paleozoic🐚 Bjerkåsholmen Penninsula
- Paleozoic🐚 Bjørkasholmen Penninsula
- Paleozoic🐚 Bjørkåsholmen
- Ordovician🐚 Bjørkøya
- Paleozoic🐚 Blakstad
- Silurian🐚 Bleikerveien
- Paleozoic🐚 Bronnøya
- Ordovician🐚 Bråten
- Ordovician🐚 Delebukta
- Ordovician🐚 Djuptrekkodden
- Ordovician🐚 Elnestangen
- Middle Ordovician🐚 Engervik
- Late/Upper Ordovician🐚 Furuholmen
- Ordovician🐚 Hareholmen
- Late/Upper Ordovician🐚 Hestesund
- Paleozoic🐚 Holmen
- Paleozoic🐚 Holmenskjæret
- Paleozoic🐚 Hvalsbakken
- Ordovician🐚 Hvalstad
- Ordovician🐚 Håkavik
- Paleozoic🐚 Høyerholmen
- Paleozoic🐚 Konglungen
- Silurian🐚 Konglungø. 9 meters up section.
- Late/Upper Ordovician🐚 Kuholmen
- Late/Upper Ordovician🐚 Landøya
- Paleozoic🐚 Langåra
- Silurian🐚 Leangbukta
- Silurian🐚 Leangen
- Paleozoic🐚 Nes terrasse 16
- Paleozoic🐚 Nesbrukrysset
- Paleozoic🐚 Nesøya
- Paleozoic🐚 Pentameroides subrectus Community
- Ordovician🐚 railroad section west of Billingstad Staion
- Late/Upper Ordovician🐚 Raudskjer
- Paleozoic🐚 Sem
- Viken
- Asker
- Silurian🐚 Semsvand
- Paleozoic🐚 Semsvannet
- Late/Upper Ordovician🐚 Skogerholmen
- Silurian🐚 Skytterveien
- Silurian🐚 Spirodden
- Paleozoic🐚 Syverstad
- Ordovician🐚 Søndre Kojatangen
- Ordovician🐚 Terneholmen
- Late/Upper Ordovician🐚 Torbjørnsøy
- Silurian🐚 Vakås
- Silurian🐚 Vettre Brygge
- Silurian🐚 Vettrebukkta
- Ordovician🐚 Vollen
- Late/Upper Ordovician🐚 Åstaddammen
- Hurum
- Røyken
- Middle Ordovician🐚 between Bø and Heggedal in Røyken
- Cambrian🐚 GIBB 13
- Cambrian🐚 Høvikvolden area - 1
- Cambrian🐚 KAM 4
- Paleozoic🐚 limestone nodule n0
- Paleozoic🐚 Naersnes
- Paleozoic🐚 Nærsnes
- Cambrian🐚 Nærsnes area
- Cambrian🐚 PEL13
- Paleozoic🐚 Rortunet
- Middle Ordovician🐚 Røykenveien at Dambo
- Paleozoic🐚 Slemmestad area
- Middle Ordovician🐚 Slemmestad stadium
- Paleozoic🐚 Slemmestad [Bjørkasholmen Fm]
- Ordovician🐚 Toje
- Bærum (Baerum)
- Silurian🐚 Avløs
- Late/Upper Ordovician🐚 Baerum
- Late/Upper Ordovician🐚 Bjørnsvikveien
- Ordovician🐚 Blommenholm
- Late/Upper Ordovician🐚 Borøya
- Late/Upper Ordovician🐚 Bærum
- Silurian🐚 Chr. Skredsviks vei
- Paleozoic🐚 Dalmanella association
- Late/Upper Ordovician🐚 Easternmost end of the road section on highway 242 near Skøyen
- Ordovician🐚 Fornebu
- Silurian🐚 Gjettum
- Silurian🐚 Gjettum in Bærum
- Late/Upper Ordovician🐚 Grønnsund
- Ordovician🐚 Gyssestad
- Ordovician🐚 Holtekilen
- Ordovician🐚 Høvik
- Ordovician🐚 Jar
- Silurian🐚 Jongsåskollen
- Late/Upper Ordovician🐚 Jongsåsveien
- Paleozoic🐚 Kalvøya
- Silurian🐚 Kampebråten
- Ordovician🐚 Kojatangen
- Late/Upper Ordovician🐚 Kråkholmen
- Paleozoic🐚 Nedre Ås in Bærum
- Ordovician🐚 Nye Drammensvei
- Silurian🐚 old quarry west of Løkkeås
- Ordovician🐚 Ostøya
- Silurian🐚 PMS 145
- Late/Upper Ordovician🐚 Ringeriksveien
- Silurian🐚 Ringerisveien
- Paleozoic🐚 Sandvika
- Paleozoic🐚 Sandviksåsen
- Late/Upper Ordovician🐚 Saraholmen
- Paleozoic🐚 Slependen
- Ordovician🐚 Snarøya
- Middle Ordovician🐚 Stabekk
- Ordovician🐚 Terneskjær
- Ordovician🐚 Vassholmen
- Gåsøya
- Hol
- Jevnaker
- Lillestrøm
- Lunner
- Late/Upper Ordovician🐚 Valborgtjern
- Late/Upper Ordovician🐚 048. Southeast of Øyskogtern Lake
- Late/Upper Ordovician🐚 Ballangrud
- Late/Upper Ordovician🐚 forest track between Nerby and Helgehagen
- Late/Upper Ordovician🐚 Haga
- Paleozoic🐚 Kalvsjø
- Late/Upper Ordovician🐚 Kjevlingen
- Late/Upper Ordovician🐚 Korsrud
- Middle Ordovician🐚 Lunder farm
- Ordovician🐚 Lunner
- Late/Upper Ordovician🐚 Lunner Kirkke
- Late/Upper Ordovician🐚 West of Høltjernet
- Late/Upper Ordovician🐚 Åslund
- Nesodden
- Paleozoic🐚 Husbergøya
- Ordovician🐚 Ildjernet
- Ordovician🐚 Knerten
- Paleozoic🐚 Langøyene
- Ordovician🐚 Northern Langøy in Bunnefjorden
- Ordovician🐚 Persteilen
- Paleozoic🐚 Skjaerholmen S
- Late/Upper Ordovician🐚 Skjellholmen island
- Late/Upper Ordovician🐚 Skjærholmen
- Ordovician🐚 Steilene
- Late/Upper Ordovician🐚 Søndre Langøy
- Nittedal
- Nordre Follo
- Vestby
- Asker
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Akershus |
|---|---|
| Wikidata ID: | Q50615 |
| GeoNames ID: | 3163480 |
Localities in this Region
- Viken
- ⭔Ål
- ⭔Ås
- ⭔Asker
- Bjørkås Day Care
- Bjørkåsholmen
- Bleiker
- Borgenåsen
- Dikemark
- Hajum waterfall
- Heggedal
- Heggedalsveien
- ⭔Hurum
- Bjorvatnet
- Brattebakke
- Engene
- Filtvet
- Fuglemyr
- Grimsrud Molybdenum prospect
- Grønsand
- Holmsbu
- Klokkarstua
- Knivsfjellet
- Langevann
- Lauvåsen
- Merraskot Tunnel
- Mølen Island
- Mørkvann
- Oslofjord Tunnel
- Roadcuts Rv 281
- Rødbyvannet area
- Rødsetra
- Rødtangen
- ⭔Rødvann
- Rørvik
- Røysåsen Mine
- Sandungen
- Sætre
- Selvigstranda Prospect
- Selvik quartz occurrence
- Tofte
- ⭔Tofteholmen Island
- ⭔Tofteskogen
- Torstvet (Torstvedt)
- Lake Sandungen
- Lieråsen Railway tunnel (Asker Railroad tunnel)
- Mobråtan
- Olledalen Shooting Range (Bergsmarka)
- ⭔Røyken
- Vardåsen
- Vardåsen Tunnel
- ⭔Aurskog-Høland
- ⭔Bærum (Baerum)
- ⭔Eidsvoll
- Eidsvoll gold mines
- Feiring
- Minnesund
- Mistberget and Feiring Mining Area
- Stensby
- Unnamed Mine No. 1
- Unnamed Mine No. 10
- Unnamed Mine No. 11
- Unnamed Mine No. 2
- Unnamed Mine No. 3
- Unnamed Mine No. 4
- Unnamed Mine No. 5
- Unnamed Mine No. 6
- Unnamed Mine No. 7
- Unnamed Mine No. 8
- Unnamed Mine No. 9
- Utsjø Mines
- ⭔Enebakk
- ⭔Flå
- ⭔Frogn
- ⭔Gjerdrum
- ⭔Gol
- ⭔Hemsedal
- ⭔Hol
- ⭔Hurdal
- Viken
- Hurdal
- ⭔Jevnaker
- Juve
- ⭔Lillestrøm
- ⭔Lørenskog
- ⭔Lunner
- ⭔Moss
- ⭔Nannestad
- ⭔Nes
- ⭔Nesbyen
- ⭔Nesodden
- ⭔Nittedal
- ⭔Nordre Follo
- ⭔Nore og Uvdal
- ⭔Rælingen
- ⭔Ullensaker
- ⭔Vestby
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
Norway
- Buskerud
- HallingdalValley
- Kongsberg silver mining districtMining District
- TyrifjordenLake
- NordmarkaWoods
- Oslo Volcanic ProvinceVolcanic Province
- Viken
- DrammensmarkaForest
- Western Gneiss RegionGeologic Region
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsOther DatabasesLocalities in RegionOther Regions
Gjerdingselva, Lunner, Viken, Norway