St Michael's Mount, Cornwall, England, UKi
| Regional Level Types | |
|---|---|
| St Michael's Mount | Mountain |
| Cornwall | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
50° 7' 2'' North , 5° 28' 39'' West
Latitude & Longitude (decimal):
UK National Grid Reference:
SW513298
Type:
Köppen climate type:
Mindat Locality ID:
1071
Long-form identifier:
mindat:1:2:1071:2
GUID (UUID V4):
7ef5eea4-b8df-4994-bdca-dae3b3fc2ce6
Other Languages:
Cornish:
Carrek Loos y'n Coos, Kernow, Pow Sows, Ruwvaneth Unys
French:
St Michael's Mount, Cornouailles, Angleterre, Royaume-Uni
German:
St. Michael’s Mount, Cornwall, England, Vereinigtes Königreich
Italian:
St Michael's Mount, Cornovaglia, Inghilterra, Regno Unito
Russian:
Сент-Майклз-Маунт, Корнуолл, Англия, Великобритания
Simplified Chinese:
聖邁克爾山, 康沃爾郡, 英格兰, 英国
Spanish:
St Michael's Mount, Cornualles, Inglaterra, Reino Unido
Basque:
St Michael's Mount, Kornualles, Ingalaterra, Erresuma Batua
Breton:
Karrek Loos y'n Koos, Kernev-Veur, Bro-Saoz, Rouantelezh-Unanet
Catalan:
St Michael's Mount, Cornualla, Anglaterra, Regne Unit
Cebuano:
St Michael's Mount, Cornwall, Inglatera, Hiniusang Gingharian
Danish:
St Michael's Mount, Cornwall, England, Storbritannien
Dutch:
St Michael's Mount, Cornwall, Engeland, Verenigd Koninkrijk
Esperanto:
Monto Sankta Mikaelo, Kornvalo, Anglio, Unuiĝinta Reĝlando
Estonian:
St Michael's Mount, Cornwall, Inglismaa, Suurbritannia
Hebrew:
גבעת סנט מייקל, קורנוול, אנגליה, הממלכה המאוחדת
Japanese:
セント・マイケルズ・マウント, コーンウォール, イングランド, イギリス
Latin:
Mons Sancti Michaelis , Cornubia, Anglia, Britanniarum regnum
Norwegian:
St Michael's Mount, Cornwall, England, Storbritannia
Norwegian (Nynorsk):
St Michael's Mount, Cornwall, England, Storbritannia
Polish:
St Michael's Mount, Kornwalia, Anglia, Wielka Brytania
Slovenian:
St. Michael's Mount, Cornwall, Anglija, Združeno kraljestvo Velike Britanije in Severne Irske
Swedish:
St Michael's Mount, Cornwall, England, Storbritannien
St Michael's Mount Civil Parish.
A vein of cassiterite runs out to sea from the seaward side of the mount.
Note: This is now a vigorously protected SSSI so no collecting.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
20 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) References: |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Beryl Formula: Be3Al2(Si6O18) References: |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ Fluorite Formula: CaF2 References: |
| ⓘ Galena Formula: PbS |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Kësterite Formula: Cu2ZnSnS4 Description: According to Moore and Howie (1984), kesterite is the most abundant tin-bearing sulfide at this locality. Most of the "stannite" previously reported is in fact misidentified kesterite, while true stannite is very rare and was detected in only two of more than 100 samples studied. |
| ⓘ 'Lepidolite' References: |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ 'Pinite' References: |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Citrine Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Stannite Formula: Cu2FeSnS4 Description: According to Moore and Howie (1984), stannite is a rare mineral at this locality, which was detected in only two of more than 100 samples studied. In both cases, it formed a narrow rim between kesterite and quartz. Most of the "stannite" previously reported is in fact misidentified kesterite, while the "yellow stannite" reported by some authors proved to be stannoidite. References: |
| ⓘ Stannoidite Formula: Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 Description: According to Moore and Howie (1984), stannoidite occurs abundantly at this locality. Their results suggest that most of the "yellow stannite" previously reported is in fact stannoidite. |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 References: |
| ⓘ 'Wolframite Group' References: |
| ⓘ Zippeite Formula: K3(UO2)4(SO4)2O3(OH) · 3H2O |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Kësterite | 2.CB.15a | Cu2ZnSnS4 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Stannoidite | 2.CB.15c | Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Citrine | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Zippeite | 7.EC.05 | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| Group 9 - Silicates | |||
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Pinite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Quartz var. Citrine | SiO2 |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | Aluminium | |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Citrine | SiO2 |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Kësterite | Cu2ZnSnS4 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Kësterite | Cu2ZnSnS4 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Zn | Zinc | |
| Zn | ⓘ Kësterite | Cu2ZnSnS4 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Löllingite | FeAs2 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Kësterite | Cu2ZnSnS4 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Sb | Antimony | |
| Sb | ⓘ Stibnite | Sb2S3 |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| U | Uranium | |
| U | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
Geochronology
Mineralization age: Permian : 284 ± 4 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | |||||||||||||||||||||||||
| Paleozoic | |||||||||||||||||||||||||
| Permian | |||||||||||||||||||||||||
| Guadalupian |
| ||||||||||||||||||||||||
| Cisuralian |
| ||||||||||||||||||||||||
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/St_Michael%27s_Mount |
|---|---|
| Wikidata ID: | Q1431121 |
| GeoNames ID: | 7294222 |
Other Regions, Features and Areas containing this locality
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
UK
- England
- Cornwall
- Mount's Bay Mining DistrictMining District
- Devon and Cornwall metalliferous mining districtMining District
- Cornwall
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
St Michael's Mount, Cornwall, England, UK