Gottesberg, Tannenbergsthal, Muldenhammer, Vogtlandkreis, Saxony, Germanyi
| Regional Level Types | |
|---|---|
| Gottesberg | - not defined - |
| Tannenbergsthal | Village |
| Muldenhammer | Municipality |
| Vogtlandkreis | District |
| Saxony | State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
50° 25' 23'' North , 12° 29' 20'' East
Latitude & Longitude (decimal):
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Tannenbergsthal | 1,536 (2015) | 2.7km |
| Morgenröthe-Rautenkranz | 893 (2015) | 3.1km |
| Hammerbrücke | 1,395 (2015) | 5.4km |
| Bublava | 334 (2018) | 5.5km |
| Klingenthal | 9,132 (2017) | 7.3km |
Mindat Locality ID:
192409
Long-form identifier:
mindat:1:2:192409:4
GUID (UUID V4):
0416aa44-3b8f-4c29-830d-f823ac3f3c39
Other Languages:
German:
Gottesberg, Tannenbergsthal, Muldenhammer, Vogtlandkreis, Sachsen, Deutschland
Old tin mining area. Includes several outcrops and diggings along the Hahnwald vein, and the Grummetstock Fundgrube (mine).
New exploration work since ca. 2011.
Located 2.5 km NE of the Schneckenstein locality.
Note on the mineral list: Tröger (2008) also mentions undefined(?) Co and Bi minerals reported in the older literature.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities15 valid minerals.
Detailed Mineral List:
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Galena Formula: PbS |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ 'Mica Group' |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Citrine Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ Uraninite Formula: UO2 |
| ⓘ 'Wolframite Group' |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Citrine | 4.DA.05 | SiO2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| Group 9 - Silicates | |||
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Unclassified | |||
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Mica Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Quartz var. Citrine | SiO2 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Uraninite | UO2 |
| F | Fluorine | |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | Silicon | |
| Si | ⓘ Quartz var. Citrine | SiO2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| P | Phosphorus | |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Pyrite | FeS2 |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Ni | Nickel | |
| Ni | ⓘ Nickeline | NiAs |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| U | Uranium | |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Uraninite | UO2 |
Localities in this Region
- Saxony
- Vogtlandkreis
- Muldenhammer
- Tannenbergsthal
- Gottesberg
- Tannenbergsthal
- Muldenhammer
- Vogtlandkreis
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
