Großer Auerberg, Stolberg, Südharz, Mansfeld-Südharz, Saxony-Anhalt, Germanyi
| Regional Level Types | |
|---|---|
| Großer Auerberg | - not defined - |
| Stolberg | Town |
| Südharz | Municipality |
| Mansfeld-Südharz | District |
| Saxony-Anhalt | State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
51° 35' 2'' North , 11° 0' 20'' East
Latitude & Longitude (decimal):
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Schwenda | 616 (2015) | 2.9km |
| Stolberg | 1,401 (2015) | 3.6km |
| Straßberg | 832 (2015) | 4.6km |
| Hayn | 619 (2015) | 5.3km |
| Breitenstein | 516 (2015) | 5.7km |
Mindat Locality ID:
21651
Long-form identifier:
mindat:1:2:21651:6
GUID (UUID V4):
a2630307-790b-4472-a295-9296c765b3fa
Name(s) in local language(s):
Großer Auerberg, Stolberg, Harz, Sachsen-Anhalt, Deutschland
Located 4 km north of Stolberg.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities16 valid minerals.
Detailed Mineral List:
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ 'Antimony Ochre' |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Boulangerite Formula: Pb5Sb4S11 Localities: |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Gorceixite Formula: BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ 'Limonite' |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ 'Pumpellyite-(Fe)' |
| ⓘ Pyrite Formula: FeS2 Localities: |
| ⓘ Quartz Formula: SiO2 Localities: |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Sphalerite Formula: ZnS Localities: |
| ⓘ Strengite Formula: FePO4 · 2H2O |
| ⓘ Sulphur Formula: S8 |
| ⓘ Variscite Formula: AlPO4 · 2H2O |
| ⓘ Wavellite Formula: Al3(PO4)2(OH,F)3 · 5H2O |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Gorceixite | 8.BL.10 | BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Strengite | 8.CD.10 | FePO4 · 2H2O |
| ⓘ | Variscite | 8.CD.10 | AlPO4 · 2H2O |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH,F)3 · 5H2O |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Antimony Ochre' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Pumpellyite-(Fe)' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Strengite | FePO4 · 2H2O |
| H | ⓘ Variscite | AlPO4 · 2H2O |
| H | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Strengite | FePO4 · 2H2O |
| O | ⓘ Variscite | AlPO4 · 2H2O |
| O | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| F | Fluorine | |
| F | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Variscite | AlPO4 · 2H2O |
| Al | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| Si | Silicon | |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| P | Phosphorus | |
| P | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Strengite | FePO4 · 2H2O |
| P | ⓘ Variscite | AlPO4 · 2H2O |
| P | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Sulphur | S8 |
| K | Potassium | |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Fe | Iron | |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Strengite | FePO4 · 2H2O |
| Cu | Copper | |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Sb | Antimony | |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
Localities in this Region
- Saxony-Anhalt
- Mansfeld-Südharz
- Südharz
- Stolberg
- Großer Auerberg
- Stolberg
- Südharz
- Mansfeld-Südharz
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
