State Line Chromite Mining District, USAi
| Regional Level Types | |
|---|---|
| State Line Chromite Mining District | Mining District |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
39° North , 76° West (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~11km
Type:
KΓΆppen climate type:
Mindat Locality ID:
237261
Long-form identifier:
mindat:1:2:237261:0
GUID (UUID V4):
c9a28de6-af9e-4e73-82e4-f96077d6f112
This district include portions of both Lancaster and Chester Counties, Pennsylvania, and Cecil County, Maryland.
Smith and Barnes (2011) found only the following sulfides and arsenides for the Lancaster County portion of the State Line District: orcelite, polydymite, godlevskite, shandite, maucherite, nickeline, heazlewoodite, millerite, and digenite. Likewise, they found only the following PGE elements for the Lancaster County portion of the district: iridium, laurite, and sudburyite. R. C. Smith, II 3/5/2012.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities91 valid minerals. 1 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| β Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| β Albite Formula: Na(AlSi3O8) Localities: Reported from at least 11 localities in this region. References: |
| β 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Localities: References: |
| β Anatase Formula: TiO2 |
| β Anthophyllite Formula: ◻{Mg2}{Mg5}(Si8O22)(OH)2 Localities: References: |
| β Antigorite Formula: Mg3(Si2O5)(OH)4 Localities: Reported from at least 8 localities in this region. References: |
| β Antigorite var. Williamsite Formula: Mg3(Si2O5)(OH)4 Localities: Line pit (Lowe's Chromite Mine), Fulton Township, Lancaster County, Pennsylvania, USA Jenkins Mine (Jenkins Corner; North Rock Springs), Fulton Township, Lancaster County, Pennsylvania, USA Cedar Hill Quarry (Stoltzfuss Quarry), Fulton Township, Lancaster County, Pennsylvania, USA Wood's Chrome Mine, Texas, Little Britain Township, Lancaster County, Pennsylvania, USA Habit: Micro-fiberous Colour: Emerald to apple green Description: A beautiful Apple Green variety, Williamsite, first described at Woods Chrome in 1849 by Lewis W. Williams, whom also first described Zaratite (Emerald Nickel) the same year. Williamsite is a semi-precious variety of Sepentine, usually in association with chromite. Although originally discovered at Wood's Chrome Mine, the occurance at Line Pit is renowned for occurances which are deemed to be of the finest quality. |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| β Aragonite Formula: CaCO3 Localities: |
| β Arsenopalladinite Formula: Pd8(As,Sb)3 |
| β Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| β Awaruite Formula: Ni3Fe Localities: |
| β Beidellite Formula: (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| β Formula: Be3Al2(Si6O18) Locality: Wiant's Quarry (Weiant Quarry), Pilot, Cecil County, Maryland, USA - erroneously reported Description: Originally reported as beryl, Samuel G. Gordon (1920's) suggested that the supposed beryls were probably apatite. This was later proven by Earl V. Shannon who analysed some of these specimens which Gordon had sent him. |
| β 'Bloodstone' Formula: SiO2 |
| β Bornite Formula: Cu5FeS4 |
| β Braggite Formula: PdPt3S4 |
| β Brucite Formula: Mg(OH)2 Localities: Reported from at least 6 localities in this region. Habit: tabular plates with pseudo-hexagonal edging. usually foliaed masses Colour: white to pale green, pearly to waxy luster, transparent in thin sections/plates Fluorescence: bright blue-white response Description: Worlds finest locality for the Brucite, hosting the largest crystal ever found (to 0.2m). Crystals from here are rich and well developed, in numerous modifications including large tabular crystals and occasional groups in rosettes. coloration from this locale tends towards pale green coloration in the richest specimens. |
| β Cacoxenite Formula: Fe3+24AlO6(PO4)17(OH)12 · 75H2O Localities: |
| β Calcite Formula: CaCO3 Localities: |
| β 'Chlorite Group' Localities: |
| β Chromite Formula: Fe2+Cr3+2O4 Localities: Reported from at least 20 localities in this region. |
| β 'Chrysolite' |
| β Chrysotile Formula: Mg3(Si2O5)(OH)4 Localities: Reported from at least 7 localities in this region. References: |
| β Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: Reported from at least 8 localities in this region. References: |
| β Clinochlore var. Chromium-bearing Clinochlore Formula: Mg5(Al,Cr)2Si3O10(OH)8 Localities: Reported from at least 8 localities in this region. References: |
| β Coalingite Formula: Mg10Fe3+2(OH)24[CO3] · 2H2O |
| β Desautelsite (TL) Formula: Mg6Mn3+2(OH)16[CO3] · 4H2O Type Locality: |
| β 'Deweylite' Formula: Mg4Si3O10 · 6H2O ? Localities: Reported from at least 6 localities in this region. |
| β Dolomite Formula: CaMg(CO3)2 Localities: Haines & Kibblehouse Penn-Maryland Materials Quarry, Fulton Township, Lancaster County, Pennsylvania, USA Wiant's Quarry (Weiant Quarry), Pilot, Cecil County, Maryland, USA Cedar Hill Quarry (Stoltzfuss Quarry), Fulton Township, Lancaster County, Pennsylvania, USA Wood's Chrome Mine, Texas, Little Britain Township, Lancaster County, Pennsylvania, USA References: |
| β Dozyite Formula: Mg7Al2(Al2Si4O15)(OH)12 |
| β Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: References: |
| β Dravite var. Chromium-bearing Dravite Formula: Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) Localities: References: |
| β Enstatite Formula: Mg2Si2O6 |
| β Erlichmanite Formula: OsS2 |
| β 'Fayalite-Forsterite Series' |
| β Ferronickelplatinum Formula: Pt2FeNi |
| β Forsterite Formula: Mg2SiO4 Localities: Line pit (Lowe's Chromite Mine), Fulton Township, Lancaster County, Pennsylvania, USA Cedar Hill Quarry (Stoltzfuss Quarry), Fulton Township, Lancaster County, Pennsylvania, USA Line pit (Lowe's Mine), Cecil County, Maryland, USA Wood's Chrome Mine, Texas, Little Britain Township, Lancaster County, Pennsylvania, USA References: |
| β Galena Formula: PbS |
| β 'Garnierite' Localities: References: |
| β GaspΓ©ite Formula: NiCO3 Description: Previously thought to be zaratite. |
| β 'Genthite' Localities: |
| β Godlevskite Formula: (Ni,Fe)9S8 |
| β Heazlewoodite Formula: Ni3S2 Localities: |
| β Hematite Formula: Fe2O3 |
| β Hollingworthite Formula: (Rh,Pt,Pd)AsS |
| β Huntite Formula: CaMg3(CO3)4 Locality: Cedar Hill Quarry (Stoltzfuss Quarry), Fulton Township, Lancaster County, Pennsylvania, USA Habit: masses with subconchoidal fracture Colour: dull nearly opaque, egg shell white Fluorescence: non fluorescent Description: Huntite is soluable in water and has formed above the water table in reaction of serpentine and carbonic acids. The perceived rarity at the site is likely due to weathering, misidentification with magnesite and collectors in the past "cleaning" specimens found, prior to examination. fresh exposure collecting reveals Huntite occuring in plentiful amounts at Cedar Hill. |
| β Hydromagnesite Formula: Mg5(CO3)4(OH)2 · 4H2O Localities: Reported from at least 6 localities in this region. |
| β Ilmenite Formula: Fe2+TiO3 |
| β Irarsite Formula: (Ir,Ru,Rh,Pt)AsS |
| β Iridium Formula: (Ir,Os,Ru) |
| β Iron Formula: Fe |
| β 'Jasper' |
| β Kotulskite Formula: Pd(Te,Bi)2-x (x ≈ 0.4) |
| β 'Lancasterite' |
| β Laurite Formula: RuS2 |
| β 'Limonite' Localities: |
| β Lizardite Formula: Mg3(Si2O5)(OH)4 Localities: |
| β Magnesiochromite Formula: MgCr2O4 Localities: References: |
| β Magnesite Formula: MgCO3 Localities: Reported from at least 11 localities in this region. |
| β Magnesite var. Iron-bearing Magnesite Formula: (Mg,Fe)CO3 |
| β Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 8 localities in this region. References: |
| β Majakite Formula: PdNiAs |
| β Malachite Formula: Cu2(CO3)(OH)2 |
| β Malanite Formula: Cu1+(Ir3+Pt4+)S4 |
| β Margarite Formula: CaAl2(Al2Si2O10)(OH)2 Localities: References: |
| β Maucherite Formula: Ni11As8 Localities: West Nottingham Township, Chester County, Pennsylvania, USA Line pit (Lowe's Chromite Mine), Fulton Township, Lancaster County, Pennsylvania, USA Line pit (Lowe's Mine), Cecil County, Maryland, USA Wood's Chrome Mine, Texas, Little Britain Township, Lancaster County, Pennsylvania, USA Cedar Hill Quarry (Stoltzfuss Quarry), Fulton Township, Lancaster County, Pennsylvania, USA ? (more information) |
| β Mcguinnessite Formula: (Mg,Cu)2(CO3)(OH)2 Localities: |
| β Melonite Formula: NiTe2 |
| β Menshikovite Formula: Pd3Ni2As3 |
| β Millerite Formula: NiS Localities: |
| β Nakauriite Formula: Cu8(SO4)4(CO3)(OH)6 · 48H2O Localities: |
| β Naldrettite Formula: Pd2Sb |
| β Nickeline Formula: NiAs |
| β Omeiite Formula: (Os,Ru)As2 |
| β Opal Formula: SiO2 · nH2O |
| β Palladium ? Formula: (Pd,Pt) |
| β Palladoarsenide Formula: Pd2As |
| β 'Pimelite' Formula: Ni3Si4O10(OH)2 · 4H2O |
| β 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| β Platinum Formula: Pt |
| β Pokrovskite Formula: Mg2(CO3)(OH)2 |
| β Polydymite Formula: Ni2+Ni3+2S4 |
| β Pyrite Formula: FeS2 Localities: Line pit (Lowe's Chromite Mine), Fulton Township, Lancaster County, Pennsylvania, USA Wiant's Quarry (Weiant Quarry), Pilot, Cecil County, Maryland, USA Cedar Hill Quarry (Stoltzfuss Quarry), Fulton Township, Lancaster County, Pennsylvania, USA Line pit (Lowe's Mine), Cecil County, Maryland, USA Wood's Chrome Mine, Texas, Little Britain Township, Lancaster County, Pennsylvania, USA References: |
| β Pyroaurite Formula: Mg6Fe3+2(OH)16[CO3] · 4H2O Localities: Line pit (Lowe's Chromite Mine), Fulton Township, Lancaster County, Pennsylvania, USA Cedar Hill Quarry (Stoltzfuss Quarry), Fulton Township, Lancaster County, Pennsylvania, USA Line pit (Lowe's Mine), Cecil County, Maryland, USA Wood's Chrome Mine, Texas, Little Britain Township, Lancaster County, Pennsylvania, USA References: |
| β Pyrolusite Formula: Mn4+O2 |
| β Quartz Formula: SiO2 Localities: Reported from at least 13 localities in this region. References: |
| β Quartz var. Carnelian |
| β Quartz var. Chalcedony Formula: SiO2 Localities: Reported from at least 8 localities in this region. References: |
| β Quartz var. Moss Agate Formula: SiO2 Localities: |
| β Quartz var. Prase Formula: SiO2 Localities: References: |
| β Ruarsite Formula: (Ru,Os)AsS |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O Localities: |
| β 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: Reported from at least 16 localities in this region. Colour: various colors due to impurities. Often light green to emerald green (Williamsite variety) Description: A beautiful Apple Green variety, Williamsite, first described at Woods Chrome in 1849 by Lewis W. Williams, whom also first described Zaratite (Emerald Nickel) the same year. Williamsite is a semi-precious variety of Sepentine, usually in association with chromite. Although originally discovered at Wood's Chrome Mine, the occurance at Line Pit is renowned for occurances which are deemed to be of the finest quality. |
| β 'Serpentine Subgroup var. Marmolite' Formula: D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn Localities: References: |
| β 'Serpentine Subgroup var. Picrolite' Formula: D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn Localities: |
| β Shandite Formula: Ni3Pb2S2 |
| β Sobolevskite Formula: PdBi |
| β Sperrylite Formula: PtAs2 |
| β Stevensite Formula: (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| β Stibiopalladinite Formula: Pd5Sb2 |
| β Sudburyite Formula: PdSb |
| β Talc Formula: Mg3Si4O10(OH)2 Localities: Reported from at least 12 localities in this region. References: |
| β Tellurobismuthite Formula: Bi2Te3 |
| β Telluropalladinite Formula: Pd9Te4 |
| β Tetraferroplatinum Formula: PtFe |
| β Tulameenite Formula: Pt2CuFe |
| β 'UM1965-08-OH:FeMgNi' Formula: Fe-Mg-Ni-O-H |
| β Ungavaite Formula: Pd4Sb3 |
| β Uvarovite Formula: Ca3Cr2(SiO4)3 |
| β VavΕΓnite ? Formula: Ni2SbTe2 |
| β Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O Localities: |
| β Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| β Vincentite Formula: Pd3As |
| β Vysotskite Formula: PdS |
| β 'Wad' |
| β WΓΌstite Formula: FeO |
| β Zaratite Formula: Ni3(CO3)(OH)4 · 4H2O ? Localities: Reported from at least 6 localities in this region. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Iron | 1.AE.05 | Fe |
| β | Awaruite | 1.AE.20 | Ni3Fe |
| β | Iridium | 1.AF.10 | (Ir,Os,Ru) |
| β | Palladium ? | 1.AF.10 | (Pd,Pt) |
| β | Platinum | 1.AF.10 | Pt |
| β | Ferronickelplatinum | 1.AG.40 | Pt2FeNi |
| β | Tetraferroplatinum | 1.AG.40 | PtFe |
| β | Tulameenite | 1.AG.40 | Pt2CuFe |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Maucherite | 2.AB.15 | Ni11As8 |
| β | Vincentite | 2.AC.05b | Pd3As |
| β | Arsenopalladinite | 2.AC.10c | Pd8(As,Sb)3 |
| β | Stibiopalladinite | 2.AC.20a | Pd5Sb2 |
| β | Menshikovite | 2.AC.20c | Pd3Ni2As3 |
| β | Palladoarsenide | 2.AC.25a | Pd2As |
| β | Naldrettite | 2.AC.25d | Pd2Sb |
| β | Majakite | 2.AC.25e | PdNiAs |
| β | Ungavaite | 2.AC.35b | Pd4Sb3 |
| β | Bornite | 2.BA.15 | Cu5FeS4 |
| β | Heazlewoodite | 2.BB.05 | Ni3S2 |
| β | Godlevskite | 2.BB.15 | (Ni,Fe)9S8 |
| β | Telluropalladinite | 2.BC.30 | Pd9Te4 |
| β | Shandite | 2.BE.15 | Ni3Pb2S2 |
| β | Sudburyite | 2.CC.05 | PdSb |
| β | Kotulskite | 2.CC.05 | Pd(Te,Bi)2-x (x β 0.4) |
| β | Sobolevskite | 2.CC.05 | PdBi |
| β | Nickeline | 2.CC.05 | NiAs |
| β | Millerite | 2.CC.20 | NiS |
| β | VavΕΓnite ? | 2.CC.30 | Ni2SbTe2 |
| β | Vysotskite | 2.CC.35a | PdS |
| β | Braggite | 2.CC.35a | PdPt3S4 |
| β | Galena | 2.CD.10 | PbS |
| β | Polydymite | 2.DA.05 | Ni2+Ni3+2S4 |
| β | Malanite | 2.DA.05 | Cu1+(Ir3+Pt4+)S4 |
| β | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| β | Melonite | 2.EA.20 | NiTe2 |
| β | Sperrylite | 2.EB.05a | PtAs2 |
| β | Laurite | 2.EB.05a | RuS2 |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | Erlichmanite | 2.EB.05a | OsS2 |
| β | Omeiite | 2.EB.15a | (Os,Ru)As2 |
| β | Ruarsite | 2.EB.20 | (Ru,Os)AsS |
| β | Hollingworthite | 2.EB.25 | (Rh,Pt,Pd)AsS |
| β | Irarsite | 2.EB.25 | (Ir,Ru,Rh,Pt)AsS |
| Group 4 - Oxides and Hydroxides | |||
| β | WΓΌstite | 4.AB.25 | FeO |
| β | Magnesiochromite | 4.BB.05 | MgCr2O4 |
| β | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| β | Hematite | 4.CB.05 | Fe2O3 |
| β | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| β | Quartz var. Carnelian | 4.DA.05 | SiO2 |
| β | var. Chalcedony | 4.DA.05 | SiO2 |
| β | var. Prase | 4.DA.05 | SiO2 |
| β | 4.DA.05 | SiO2 | |
| β | var. Moss Agate | 4.DA.05 | SiO2 |
| β | Opal | 4.DA.10 | SiO2 Β· nH2O |
| β | Pyrolusite | 4.DB.05 | Mn4+O2 |
| β | Anatase | 4.DD.05 | TiO2 |
| β | Brucite | 4.FE.05 | Mg(OH)2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Calcite | 5.AB.05 | CaCO3 |
| β | Magnesite var. Iron-bearing Magnesite | 5.AB.05 | (Mg,Fe)CO3 |
| β | GaspΓ©ite | 5.AB.05 | NiCO3 |
| β | Magnesite | 5.AB.05 | MgCO3 |
| β | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| β | Aragonite | 5.AB.15 | CaCO3 |
| β | Huntite | 5.AB.25 | CaMg3(CO3)4 |
| β | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| β | Mcguinnessite | 5.BA.10 | (Mg,Cu)2(CO3)(OH)2 |
| β | Pokrovskite | 5.BA.10 | Mg2(CO3)(OH)2 |
| β | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| β | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 Β· 4H2O |
| β | Zaratite | 5.DA.15 | Ni3(CO3)(OH)4 Β· 4H2O ? |
| β | Desautelsite (TL) | 5.DA.50 | Mg6Mn3+2(OH)16[CO3] Β· 4H2O |
| β | Pyroaurite | 5.DA.50 | Mg6Fe3+2(OH)16[CO3] Β· 4H2O |
| β | Coalingite | 5.DA.55 | Mg10Fe3+2(OH)24[CO3] Β· 2H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Nakauriite | 7.DG.30 | Cu8(SO4)4(CO3)(OH)6 Β· 48H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Cacoxenite | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 Β· 75H2O |
| Group 9 - Silicates | |||
| β | Chrysotile | 9.. | Mg3(Si2O5)(OH)4 |
| β | Forsterite | 9.AC.05 | Mg2SiO4 |
| β | Uvarovite | 9.AD.25 | Ca3Cr2(SiO4)3 |
| β | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(β»4)β»[Si2O7]4[(SiO4)10]O(OH)9 |
| β | Beryl ? | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | var. Chromium-bearing Dravite | 9.CK.05 | Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| β | Enstatite | 9.DA.05 | Mg2Si2O6 |
| β | Anthophyllite | 9.DD.05 | β»{Mg2}{Mg5}(Si8O22)(OH)2 |
| β | Actinolite | 9.DE.10 | β»Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| β | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| β | 'Pimelite' | 9.EC.22 | Ni3Si4O10(OH)2 Β· 4H2O |
| β | Margarite | 9.EC.30 | CaAl2(Al2Si2O10)(OH)2 |
| β | Beidellite | 9.EC.40 | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 Β· nH2O |
| β | Stevensite | 9.EC.45 | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| β | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 Β· 8H2O |
| β | Clinochlore var. Chromium-bearing Clinochlore | 9.EC.55 | Mg5(Al,Cr)2Si3O10(OH)8 |
| β | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 | |
| β | Dozyite | 9.EC.60 | Mg7Al2(Al2Si4O15)(OH)12 |
| β | Antigorite var. Williamsite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| β | Lizardite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| β | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| β | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 Β· 6H2O |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| β | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| β | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| β | 'var. Picrolite' | - | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| β | 'Genthite' | - | |
| β | 'Chlorite Group' | - | |
| β | 'Chrysolite' | - | |
| β | 'Garnierite' | - | |
| β | 'Serpentine Subgroup var. Marmolite' | - | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| β | 'Deweylite' | - | Mg4Si3O10 Β· 6H2O ? |
| β | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| β | 'Fayalite-Forsterite Series' | - | |
| β | 'Bloodstone' | - | SiO2 |
| β | 'Lancasterite' | - | |
| β | 'Jasper' | - | |
| β | 'Wad' | - | |
| β | 'Limonite' | - | |
| β | 'UM1965-08-OH:FeMgNi' | - | Fe-Mg-Ni-O-H |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | β Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | β Antigorite | Mg3(Si2O5)(OH)4 |
| H | β Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | β Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| H | β Brucite | Mg(OH)2 |
| H | β Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | β Chrysotile | Mg3(Si2O5)(OH)4 |
| H | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | β Coalingite | Mg10Fe23+(OH)24[CO3] · 2H2O |
| H | β Desautelsite | Mg6Mn23+(OH)16[CO3] · 4H2O |
| H | β Deweylite | Mg4Si3O10 · 6H2O ? |
| H | β Dozyite | Mg7Al2(Al2Si4O15)(OH)12 |
| H | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | β Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| H | β Lizardite | Mg3(Si2O5)(OH)4 |
| H | β Malachite | Cu2(CO3)(OH)2 |
| H | β Margarite | CaAl2(Al2Si2O10)(OH)2 |
| H | β Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| H | β Nakauriite | Cu8(SO4)4(CO3)(OH)6 · 48H2O |
| H | β Opal | SiO2 · nH2O |
| H | β Pokrovskite | Mg2(CO3)(OH)2 |
| H | β Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | β Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| H | β Talc | Mg3Si4O10(OH)2 |
| H | β Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | β Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| H | β Pimelite | Ni3Si4O10(OH)2 · 4H2O |
| H | β Dravite var. Chromium-bearing Dravite | Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| H | β Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | β Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| H | β Antigorite var. Williamsite | Mg3(Si2O5)(OH)4 |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | β UM1965-08-OH:FeMgNi | Fe-Mg-Ni-O-H |
| Be | Beryllium | |
| Be | β Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Dravite var. Chromium-bearing Dravite | Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Aragonite | CaCO3 |
| C | β Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | β Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| C | β Calcite | CaCO3 |
| C | β Coalingite | Mg10Fe23+(OH)24[CO3] · 2H2O |
| C | β Desautelsite | Mg6Mn23+(OH)16[CO3] · 4H2O |
| C | β Dolomite | CaMg(CO3)2 |
| C | β GaspΓ©ite | NiCO3 |
| C | β Huntite | CaMg3(CO3)4 |
| C | β Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | β Magnesite | MgCO3 |
| C | β Malachite | Cu2(CO3)(OH)2 |
| C | β Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| C | β Nakauriite | Cu8(SO4)4(CO3)(OH)6 · 48H2O |
| C | β Pokrovskite | Mg2(CO3)(OH)2 |
| C | β Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| C | β Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| O | Oxygen | |
| O | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | β Albite | Na(AlSi3O8) |
| O | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | β Anatase | TiO2 |
| O | β Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | β Antigorite | Mg3(Si2O5)(OH)4 |
| O | β Aragonite | CaCO3 |
| O | β Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | β Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| O | β Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Brucite | Mg(OH)2 |
| O | β Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | β Calcite | CaCO3 |
| O | β Quartz var. Chalcedony | SiO2 |
| O | β Chrysotile | Mg3(Si2O5)(OH)4 |
| O | β Chromite | Fe2+Cr23+O4 |
| O | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | β Coalingite | Mg10Fe23+(OH)24[CO3] · 2H2O |
| O | β Desautelsite | Mg6Mn23+(OH)16[CO3] · 4H2O |
| O | β Deweylite | Mg4Si3O10 · 6H2O ? |
| O | β Dolomite | CaMg(CO3)2 |
| O | β Dozyite | Mg7Al2(Al2Si4O15)(OH)12 |
| O | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Enstatite | Mg2Si2O6 |
| O | β Forsterite | Mg2SiO4 |
| O | β GaspΓ©ite | NiCO3 |
| O | β Hematite | Fe2O3 |
| O | β Huntite | CaMg3(CO3)4 |
| O | β Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | β Ilmenite | Fe2+TiO3 |
| O | β Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| O | β Lizardite | Mg3(Si2O5)(OH)4 |
| O | β Magnesite | MgCO3 |
| O | β Magnesiochromite | MgCr2O4 |
| O | β Magnetite | Fe2+Fe23+O4 |
| O | β Malachite | Cu2(CO3)(OH)2 |
| O | β Margarite | CaAl2(Al2Si2O10)(OH)2 |
| O | β Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| O | β Quartz var. Moss Agate | SiO2 |
| O | β Nakauriite | Cu8(SO4)4(CO3)(OH)6 · 48H2O |
| O | β Opal | SiO2 · nH2O |
| O | β Pokrovskite | Mg2(CO3)(OH)2 |
| O | β Pyrolusite | Mn4+O2 |
| O | β Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| O | β Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | β Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| O | β Talc | Mg3Si4O10(OH)2 |
| O | β Uvarovite | Ca3Cr2(SiO4)3 |
| O | β Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | β WΓΌstite | FeO |
| O | β Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| O | β Quartz var. Prase | SiO2 |
| O | β Pimelite | Ni3Si4O10(OH)2 · 4H2O |
| O | β Bloodstone | SiO2 |
| O | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | β Dravite var. Chromium-bearing Dravite | Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| O | β Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | β Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| O | β Antigorite var. Williamsite | Mg3(Si2O5)(OH)4 |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | β UM1965-08-OH:FeMgNi | Fe-Mg-Ni-O-H |
| F | Fluorine | |
| F | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Na | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Na | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | β Dravite var. Chromium-bearing Dravite | Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | β Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | β Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | β Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| Mg | β Brucite | Mg(OH)2 |
| Mg | β Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | β Coalingite | Mg10Fe23+(OH)24[CO3] · 2H2O |
| Mg | β Desautelsite | Mg6Mn23+(OH)16[CO3] · 4H2O |
| Mg | β Deweylite | Mg4Si3O10 · 6H2O ? |
| Mg | β Dolomite | CaMg(CO3)2 |
| Mg | β Dozyite | Mg7Al2(Al2Si4O15)(OH)12 |
| Mg | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | β Enstatite | Mg2Si2O6 |
| Mg | β Forsterite | Mg2SiO4 |
| Mg | β Huntite | CaMg3(CO3)4 |
| Mg | β Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | β Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Mg | β Lizardite | Mg3(Si2O5)(OH)4 |
| Mg | β Magnesite | MgCO3 |
| Mg | β Magnesiochromite | MgCr2O4 |
| Mg | β Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| Mg | β Pokrovskite | Mg2(CO3)(OH)2 |
| Mg | β Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| Mg | β Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | β Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Mg | β Talc | Mg3Si4O10(OH)2 |
| Mg | β Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | β Dravite var. Chromium-bearing Dravite | Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | β Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Mg | β Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Mg | β Antigorite var. Williamsite | Mg3(Si2O5)(OH)4 |
| Mg | β UM1965-08-OH:FeMgNi | Fe-Mg-Ni-O-H |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | β Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | β Dozyite | Mg7Al2(Al2Si4O15)(OH)12 |
| Al | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Al | β Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | β Dravite var. Chromium-bearing Dravite | Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Al | β Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Si | Silicon | |
| Si | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | β Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | β Antigorite | Mg3(Si2O5)(OH)4 |
| Si | β Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Quartz var. Chalcedony | SiO2 |
| Si | β Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | β Deweylite | Mg4Si3O10 · 6H2O ? |
| Si | β Dozyite | Mg7Al2(Al2Si4O15)(OH)12 |
| Si | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Enstatite | Mg2Si2O6 |
| Si | β Forsterite | Mg2SiO4 |
| Si | β Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Si | β Lizardite | Mg3(Si2O5)(OH)4 |
| Si | β Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Si | β Quartz var. Moss Agate | SiO2 |
| Si | β Opal | SiO2 · nH2O |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | β Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Si | β Talc | Mg3Si4O10(OH)2 |
| Si | β Uvarovite | Ca3Cr2(SiO4)3 |
| Si | β Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | β Quartz var. Prase | SiO2 |
| Si | β Pimelite | Ni3Si4O10(OH)2 · 4H2O |
| Si | β Bloodstone | SiO2 |
| Si | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | β Dravite var. Chromium-bearing Dravite | Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Si | β Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | β Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Si | β Antigorite var. Williamsite | Mg3(Si2O5)(OH)4 |
| P | Phosphorus | |
| P | β Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | β Bornite | Cu5FeS4 |
| S | β Braggite | PdPt3S4 |
| S | β Erlichmanite | OsS2 |
| S | β Galena | PbS |
| S | β Godlevskite | (Ni,Fe)9S8 |
| S | β Heazlewoodite | Ni3S2 |
| S | β Hollingworthite | (Rh,Pt,Pd)AsS |
| S | β Irarsite | (Ir,Ru,Rh,Pt)AsS |
| S | β Laurite | RuS2 |
| S | β Malanite | Cu1+(Ir3+Pt4+)S4 |
| S | β Millerite | NiS |
| S | β Nakauriite | Cu8(SO4)4(CO3)(OH)6 · 48H2O |
| S | β Polydymite | Ni2+Ni23+S4 |
| S | β Pyrite | FeS2 |
| S | β Ruarsite | (Ru,Os)AsS |
| S | β Shandite | Ni3Pb2S2 |
| S | β Vysotskite | PdS |
| Cl | Chlorine | |
| Cl | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | Calcium | |
| Ca | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | β Aragonite | CaCO3 |
| Ca | β Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Ca | β Calcite | CaCO3 |
| Ca | β Dolomite | CaMg(CO3)2 |
| Ca | β Huntite | CaMg3(CO3)4 |
| Ca | β Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Ca | β Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Ca | β Uvarovite | Ca3Cr2(SiO4)3 |
| Ca | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | β Anatase | TiO2 |
| Ti | β Ilmenite | Fe2+TiO3 |
| Cr | Chromium | |
| Cr | β Chromite | Fe2+Cr23+O4 |
| Cr | β Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Cr | β Magnesiochromite | MgCr2O4 |
| Cr | β Uvarovite | Ca3Cr2(SiO4)3 |
| Cr | β Dravite var. Chromium-bearing Dravite | Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| Mn | Manganese | |
| Mn | β Desautelsite | Mg6Mn23+(OH)16[CO3] · 4H2O |
| Mn | β Pyrolusite | Mn4+O2 |
| Mn | β Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Mn | β Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Fe | Iron | |
| Fe | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | β Awaruite | Ni3Fe |
| Fe | β Bornite | Cu5FeS4 |
| Fe | β Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| Fe | β Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | β Chromite | Fe2+Cr23+O4 |
| Fe | β Coalingite | Mg10Fe23+(OH)24[CO3] · 2H2O |
| Fe | β Ferronickelplatinum | Pt2FeNi |
| Fe | β Godlevskite | (Ni,Fe)9S8 |
| Fe | β Hematite | Fe2O3 |
| Fe | β Ilmenite | Fe2+TiO3 |
| Fe | β Iron | Fe |
| Fe | β Magnetite | Fe2+Fe23+O4 |
| Fe | β Pyrite | FeS2 |
| Fe | β Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Tetraferroplatinum | PtFe |
| Fe | β Tulameenite | Pt2CuFe |
| Fe | β Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | β WΓΌstite | FeO |
| Fe | β Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Fe | β Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Fe | β UM1965-08-OH:FeMgNi | Fe-Mg-Ni-O-H |
| Ni | Nickel | |
| Ni | β Awaruite | Ni3Fe |
| Ni | β Ferronickelplatinum | Pt2FeNi |
| Ni | β GaspΓ©ite | NiCO3 |
| Ni | β Godlevskite | (Ni,Fe)9S8 |
| Ni | β Heazlewoodite | Ni3S2 |
| Ni | β Majakite | PdNiAs |
| Ni | β Maucherite | Ni11As8 |
| Ni | β Melonite | NiTe2 |
| Ni | β Millerite | NiS |
| Ni | β Nickeline | NiAs |
| Ni | β Polydymite | Ni2+Ni23+S4 |
| Ni | β Shandite | Ni3Pb2S2 |
| Ni | β Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| Ni | β Pimelite | Ni3Si4O10(OH)2 · 4H2O |
| Ni | β Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Ni | β Menshikovite | Pd3Ni2As3 |
| Ni | β Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Ni | β VavΕΓnite | Ni2SbTe2 |
| Ni | β UM1965-08-OH:FeMgNi | Fe-Mg-Ni-O-H |
| Cu | Copper | |
| Cu | β Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | β Bornite | Cu5FeS4 |
| Cu | β Malachite | Cu2(CO3)(OH)2 |
| Cu | β Malanite | Cu1+(Ir3+Pt4+)S4 |
| Cu | β Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| Cu | β Nakauriite | Cu8(SO4)4(CO3)(OH)6 · 48H2O |
| Cu | β Tulameenite | Pt2CuFe |
| Zn | Zinc | |
| Zn | β Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | β Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Zn | β Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| As | Arsenic | |
| As | β Arsenopalladinite | Pd8(As,Sb)3 |
| As | β Hollingworthite | (Rh,Pt,Pd)AsS |
| As | β Irarsite | (Ir,Ru,Rh,Pt)AsS |
| As | β Majakite | PdNiAs |
| As | β Maucherite | Ni11As8 |
| As | β Nickeline | NiAs |
| As | β Omeiite | (Os,Ru)As2 |
| As | β Palladoarsenide | Pd2As |
| As | β Ruarsite | (Ru,Os)AsS |
| As | β Sperrylite | PtAs2 |
| As | β Vincentite | Pd3As |
| As | β Menshikovite | Pd3Ni2As3 |
| Ru | Ruthenium | |
| Ru | β Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Ru | β Iridium | (Ir,Os,Ru) |
| Ru | β Laurite | RuS2 |
| Ru | β Omeiite | (Os,Ru)As2 |
| Ru | β Ruarsite | (Ru,Os)AsS |
| Rh | Rhodium | |
| Rh | β Hollingworthite | (Rh,Pt,Pd)AsS |
| Rh | β Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Pd | Palladium | |
| Pd | β Arsenopalladinite | Pd8(As,Sb)3 |
| Pd | β Braggite | PdPt3S4 |
| Pd | β Hollingworthite | (Rh,Pt,Pd)AsS |
| Pd | β Kotulskite | Pd(Te,Bi)2-x (x ≈ 0.4) |
| Pd | β Majakite | PdNiAs |
| Pd | β Palladium | (Pd,Pt) |
| Pd | β Palladoarsenide | Pd2As |
| Pd | β Sobolevskite | PdBi |
| Pd | β Stibiopalladinite | Pd5Sb2 |
| Pd | β Sudburyite | PdSb |
| Pd | β Telluropalladinite | Pd9Te4 |
| Pd | β Vincentite | Pd3As |
| Pd | β Vysotskite | PdS |
| Pd | β Menshikovite | Pd3Ni2As3 |
| Pd | β Naldrettite | Pd2Sb |
| Pd | β Ungavaite | Pd4Sb3 |
| Sb | Antimony | |
| Sb | β Arsenopalladinite | Pd8(As,Sb)3 |
| Sb | β Stibiopalladinite | Pd5Sb2 |
| Sb | β Sudburyite | PdSb |
| Sb | β Naldrettite | Pd2Sb |
| Sb | β Ungavaite | Pd4Sb3 |
| Sb | β VavΕΓnite | Ni2SbTe2 |
| Te | Tellurium | |
| Te | β Kotulskite | Pd(Te,Bi)2-x (x ≈ 0.4) |
| Te | β Melonite | NiTe2 |
| Te | β Telluropalladinite | Pd9Te4 |
| Te | β Tellurobismuthite | Bi2Te3 |
| Te | β VavΕΓnite | Ni2SbTe2 |
| Os | Osmium | |
| Os | β Erlichmanite | OsS2 |
| Os | β Iridium | (Ir,Os,Ru) |
| Os | β Omeiite | (Os,Ru)As2 |
| Os | β Ruarsite | (Ru,Os)AsS |
| Ir | Iridium | |
| Ir | β Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Ir | β Iridium | (Ir,Os,Ru) |
| Ir | β Malanite | Cu1+(Ir3+Pt4+)S4 |
| Pt | Platinum | |
| Pt | β Braggite | PdPt3S4 |
| Pt | β Ferronickelplatinum | Pt2FeNi |
| Pt | β Hollingworthite | (Rh,Pt,Pd)AsS |
| Pt | β Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Pt | β Malanite | Cu1+(Ir3+Pt4+)S4 |
| Pt | β Palladium | (Pd,Pt) |
| Pt | β Platinum | Pt |
| Pt | β Sperrylite | PtAs2 |
| Pt | β Tetraferroplatinum | PtFe |
| Pt | β Tulameenite | Pt2CuFe |
| Pb | Lead | |
| Pb | β Galena | PbS |
| Pb | β Shandite | Ni3Pb2S2 |
| Bi | Bismuth | |
| Bi | β Kotulskite | Pd(Te,Bi)2-x (x ≈ 0.4) |
| Bi | β Sobolevskite | PdBi |
| Bi | β Tellurobismuthite | Bi2Te3 |
Localities in this Region
- Maryland
- Cecil County
- Bald Friar Quarry (Deland Mining and Milling Company)
- Bald Friar Quarry #2
- Browns Farm Placer (Cox Chromite Placer)
- Caldwell Quarries (Caldwell Quarry)
- Cedar Run Prospect (Run East of Rock Springs)
- Conowingo Marble and Mineral Quarry
- Dawson Quarry
- Lincoln Farm Placer
- Line pit (Lowe's Mine)
- McVey Quarry
- Pilot
- Preston Farm Pits
- Reynolds Farm Placer
- Riley Sand Chrome Property (Riley Quarry)
- Schofield Sand Chrome Deposit (Schofield Placer)
- Southwest Rock Springs Pits (Prospects Near Rock Springs)
- Stevenson Farm Placer
- Taylor Quarry
- Tweed Property (Tweed Placer)
- ⭔West Placer Area (Preston Placer; Sweigarts Run; Swaggarts Run; West Placer; Thornbottom Run)
- Cecil County
- Maryland
- Cecil County
- Pennsylvania
- Chester County
- Lancaster County
- Fulton Township
- Little Britain Township
Other Regions, Features and Areas that Intersect
North America PlateTectonic Plate
- Laurentides DomainDomain
- Piedmontia DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
State Line Chromite Mining District, USA