Stone Creek pegmatite, Ruby Range, Madison County, Montana, USAi
| Regional Level Types | |
|---|---|
| Stone Creek pegmatite | Pegmatite |
| Ruby Range | Mountain Range |
| Madison County | County |
| Montana | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
45° 12' 14'' North , 112° 23' 2'' West
Latitude & Longitude (decimal):
Type:
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Dillon | 4,210 (2017) | 19.9km |
| Alder | 103 (2011) | 25.4km |
| Sheridan | 677 (2017) | 31.5km |
| Virginia City | 199 (2017) | 35.7km |
| Twin Bridges | 394 (2017) | 38.1km |
Mindat Locality ID:
219578
Long-form identifier:
mindat:1:2:219578:3
GUID (UUID V4):
9ef44578-36f6-4153-936c-4e40f2169f7d
Pegmatite hosting minor lithium mineralization and an ilmenite area.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
11 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| β Albite Formula: Na(AlSi3O8) |
| β Beryl Formula: Be3Al2(Si6O18) |
| β Cookeite Formula: (LiAl4◻)[AlSi3O10](OH)8 |
| β Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Fluorapatite Formula: Ca5(PO4)3F |
| β Ilmenite Formula: Fe2+TiO3 |
| β 'Lepidolite' |
| β Microcline Formula: K(AlSi3O8) |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β Quartz Formula: SiO2 |
| β Quartz var. Rose Quartz Formula: SiO2 |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Spodumene Formula: LiAlSi2O6 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| β | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| β | Quartz | 4.DA.05 | SiO2 |
| β | var. Rose Quartz | 4.DA.05 | SiO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Spodumene | 9.DA.30 | LiAlSi2O6 |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Cookeite | 9.EC.55 | (LiAl4β»)[AlSi3O10](OH)8 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| β | 'Lepidolite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | Lithium | |
| Li | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Li | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | β Spodumene | LiAlSi2O6 |
| Be | Beryllium | |
| Be | β Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Ilmenite | Fe2+TiO3 |
| O | β Microcline | K(AlSi3O8) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Quartz | SiO2 |
| O | β Quartz var. Rose Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Spodumene | LiAlSi2O6 |
| F | Fluorine | |
| F | β Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Spodumene | LiAlSi2O6 |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Quartz var. Rose Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Spodumene | LiAlSi2O6 |
| P | Phosphorus | |
| P | β Fluorapatite | Ca5(PO4)3F |
| K | Potassium | |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ti | Titanium | |
| Ti | β Ilmenite | Fe2+TiO3 |
| Fe | Iron | |
| Fe | β Ilmenite | Fe2+TiO3 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
