Junda 3, Mount Dockrell pegmatites, Mount Dockrell Goldfield, Halls Creek Shire, Western Australia, Australiai
| Regional Level Types | |
|---|---|
| Junda 3 | - not defined - |
| Mount Dockrell pegmatites | Pegmatite Field |
| Mount Dockrell Goldfield | Ore Field |
| Halls Creek Shire | Shire |
| Western Australia | State |
| Australia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
18° 49' 22'' South , 127° 17' 35'' East
Latitude & Longitude (decimal):
KΓΆppen climate type:
Mindat Locality ID:
250990
Long-form identifier:
mindat:1:2:250990:0
GUID (UUID V4):
bdcc9c56-9718-44da-847a-30fc38800279
The pegmatite field is approximately 89 kilometres south-west of Halls Creek. See Mount Dockrell for more information.
Junda 3 is the northern most of the pegmatites noted by Jacobsen et.al.
The pegmatites along Columbium Creek were discovered in 1927. Across 1980-1982 the Australian Anglo American Prospecting Pty Ltd searched for niobium and tantalum in the Mount Dockrell area.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
12 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| β Albite Formula: Na(AlSi3O8) |
| β Albite var. Cleavelandite Formula: Na(AlSi3O8) |
| β Beryl Formula: Be3Al2(Si6O18) |
| β Cassiterite Formula: SnO2 |
| β 'Columbite-(Fe)-Columbite-(Mn) Series' |
| β Ilmenite Formula: Fe2+TiO3 |
| β Lithiophilite Formula: LiMn2+PO4 |
| β Microcline Formula: K(AlSi3O8) |
| β 'Microlite Group' Formula: A2-mTa2X6-wZ-n |
| β 'Monazite' Formula: REE(PO4) |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β Quartz Formula: SiO2 |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Spessartine Formula: Mn2+3Al2(SiO4)3 |
| β Spodumene Formula: LiAlSi2O6 |
| β Triphylite Formula: LiFe2+PO4 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| β | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ-n |
| β | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| β | Quartz | 4.DA.05 | SiO2 |
| β | Cassiterite | 4.DB.05 | SnO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Lithiophilite | 8.AB.10 | LiMn2+PO4 |
| β | Triphylite | 8.AB.10 | LiFe2+PO4 |
| Group 9 - Silicates | |||
| β | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Spodumene | 9.DA.30 | LiAlSi2O6 |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| β | 'Monazite' | - | REE(PO4) |
| β | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | Lithium | |
| Li | β Lithiophilite | LiMn2+PO4 |
| Li | β Spodumene | LiAlSi2O6 |
| Li | β Triphylite | LiFe2+PO4 |
| Be | Beryllium | |
| Be | β Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Cassiterite | SnO2 |
| O | β Ilmenite | Fe2+TiO3 |
| O | β Lithiophilite | LiMn2+PO4 |
| O | β Microcline | K(AlSi3O8) |
| O | β Monazite | REE(PO4) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Spessartine | Mn32+Al2(SiO4)3 |
| O | β Spodumene | LiAlSi2O6 |
| O | β Triphylite | LiFe2+PO4 |
| O | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Spessartine | Mn32+Al2(SiO4)3 |
| Al | β Spodumene | LiAlSi2O6 |
| Al | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Spessartine | Mn32+Al2(SiO4)3 |
| Si | β Spodumene | LiAlSi2O6 |
| Si | β Albite var. Cleavelandite | Na(AlSi3O8) |
| P | Phosphorus | |
| P | β Lithiophilite | LiMn2+PO4 |
| P | β Monazite | REE(PO4) |
| P | β Triphylite | LiFe2+PO4 |
| K | Potassium | |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ti | Titanium | |
| Ti | β Ilmenite | Fe2+TiO3 |
| Mn | Manganese | |
| Mn | β Lithiophilite | LiMn2+PO4 |
| Mn | β Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | β Ilmenite | Fe2+TiO3 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Triphylite | LiFe2+PO4 |
| Sn | Tin | |
| Sn | β Cassiterite | SnO2 |
| Ta | Tantalum | |
| Ta | β Microlite Group | A2-mTa2X6-wZ-n |
Other Regions, Features and Areas containing this locality
Australia
- Halls Creek OrogenOrogen
- Lamboo ProvinceGeologic Province
- North Australian ElementCraton
- Northern Territory
- Kalkarindji Igneous ProvinceGeologic Province
Australian PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
