Stithians, Cornwall, England, UKi
| Regional Level Types | |
|---|---|
| Stithians | Civil Parish |
| Cornwall | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Stithians | 1,463 (2017) |
Mindat Locality ID:
222241
Long-form identifier:
mindat:1:2:222241:0
GUID (UUID V4):
d5c7cea5-98f4-4c38-b46d-17f110b8740b
Other Languages:
French:
Stithians, Cornouailles, Angleterre, Royaume-Uni
Spanish:
Stithians, Cornualles, Inglaterra, Reino Unido
Basque:
Stithians, Kornualles, Ingalaterra, Erresuma Batua
Breton:
Sen Stedhyans, Kernev-Veur, Bro-Saoz, Rouantelezh-Unanet
Bulgarian:
Π‘ΡΠΈΡΡ
ΠΈΠ°Π½Ρ, ΠΠΎΡΠ½ΡΠΎΠ», ΠΠ½Π³Π»ΠΈΡ, ΠΠ±Π΅Π΄ΠΈΠ½Π΅Π½ΠΎ ΠΊΡΠ°Π»ΡΡΠ²ΠΎ ΠΠ΅Π»ΠΈΠΊΠΎΠ±ΡΠΈΡΠ°Π½ΠΈΡ ΠΈ Π‘Π΅Π²Π΅ΡΠ½Π° ΠΡΠ»Π°Π½Π΄ΠΈΡ
Cebuano:
Stithians, Cornwall, Inglatera, Hiniusang Gingharian
Dutch:
Stithians, Cornwall, Engeland, Verenigd Koninkrijk
Polish:
Stithians, Kornwalia, Anglia, Wielka Brytania
Swedish:
Stithians, Cornwall, England, Storbritannien
Welsh:
Stithians, Cernyw, Lloegr, Y Deyrnas Unedig
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities10 valid minerals.
Detailed Mineral List:
| β Albite Formula: Na(AlSi3O8) |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| β Bertrandite Formula: Be4(Si2O7)(OH)2 |
| β Fluorapatite Formula: Ca5(PO4)3F |
| β Fluorite Formula: CaF2 |
| β Monazite-(Ce) Formula: Ce(PO4) |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β Pyrite Formula: FeS2 |
| β Quartz Formula: SiO2 |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Sphalerite Formula: ZnS |
| β 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Sphalerite | 2.CB.05a | ZnS |
| β | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Quartz | 4.DA.05 | SiO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| β | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Bertrandite | Be4(Si2O7)(OH)2 |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Be | Beryllium | |
| Be | β Bertrandite | Be4(Si2O7)(OH)2 |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Bertrandite | Be4(Si2O7)(OH)2 |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Monazite-(Ce) | Ce(PO4) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | β Fluorapatite | Ca5(PO4)3F |
| F | β Fluorite | CaF2 |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Bertrandite | Be4(Si2O7)(OH)2 |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| P | Phosphorus | |
| P | β Fluorapatite | Ca5(PO4)3F |
| P | β Monazite-(Ce) | Ce(PO4) |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | β Pyrite | FeS2 |
| S | β Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Fluorite | CaF2 |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Fe | Iron | |
| Fe | β Pyrite | FeS2 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Zn | Zinc | |
| Zn | β Sphalerite | ZnS |
| Ce | Cerium | |
| Ce | β Monazite-(Ce) | Ce(PO4) |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Stithians |
|---|---|
| Wikidata ID: | Q7617662 |
| GeoNames ID: | 7297574 |
Localities in this Region
- England
- Cornwall
Other Regions, Features and Areas that Intersect
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
UK
- England
- Cornwall
- Camborne-Redruth and St Day Mining DistrictMining District
- Wendron and Falmouth Mining DistrictMining District
- Devon and Cornwall metalliferous mining districtMining District
- Cornwall
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Trolvis Quarry, Longdowns, Stithians, Cornwall, England, UK