Alpiga Valley, Codera Valley, Novate Mezzola, Sondrio Province, Lombardy, Italyi
| Regional Level Types | |
|---|---|
| Alpiga Valley | Valley |
| Codera Valley | Valley |
| Novate Mezzola | Municipality |
| Sondrio Province | Province |
| Lombardy | Region |
| Italy | - not defined - |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
46° North , 9° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~9km
Type:
KΓΆppen climate type:
Mindat Locality ID:
126935
Long-form identifier:
mindat:1:2:126935:5
GUID (UUID V4):
c2547e0a-bcf0-4d73-b26d-a3d263953372
Name(s) in local language(s):
Valle Alpiga, Val Codera, Novate Mezzola, Valchiavenna, Sondrio, Lombardia, Italia
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| β Almandine Formula: Fe2+3Al2(SiO4)3 |
| β Bavenite Formula: Ca4Be2Al2Si9O26(OH)2 |
| β Beryl Formula: Be3Al2(Si6O18) |
| β Beryl var. Aquamarine Formula: Be3Al2Si6O18 |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β Bismuthinite Formula: Bi2S3 |
| β Bismutite Formula: (BiO)2CO3 |
| β Columbite-(Fe) Formula: Fe2+Nb2O6 |
| β Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β Gladite Formula: PbCuBi5S9 |
| β Laumontite Formula: CaAl2Si4O12 · 4H2O |
| β Monazite-(Ce) Formula: Ce(PO4) |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β Orthoclase Formula: K(AlSi3O8) |
| β 'Pyrochlore Supergroup' Formula: A2-mD2X6-wZ1-n |
| β 'Pyrochlore Supergroup var. Betafite (of Hogarth 1977)' Formula: (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Scolecite Formula: CaAl2Si3O10 · 3H2O |
| β Spessartine Formula: Mn2+3Al2(SiO4)3 |
| β Stilbite-Ca Formula: NaCa4(Si27Al9)O72 · 28H2O |
| β Titanite Formula: CaTi(SiO4)O |
| β Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Bismuthinite | 2.DB.05 | Bi2S3 |
| β | Gladite | 2.HB.05a | PbCuBi5S9 |
| Group 4 - Oxides and Hydroxides | |||
| β | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| Group 5 - Nitrates and Carbonates | |||
| β | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| Group 9 - Silicates | |||
| β | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| β | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| β | 9.CJ.05 | Be3Al2(Si6O18) | |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Bavenite | 9.DF.25 | Ca4Be2Al2Si9O26(OH)2 |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| β | Scolecite | 9.GA.05 | CaAl2Si3O10 Β· 3H2O |
| β | Laumontite | 9.GB.10 | CaAl2Si4O12 Β· 4H2O |
| β | Stilbite-Ca | 9.GE.10 | NaCa4(Si27Al9)O72 Β· 28H2O |
| Unclassified | |||
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Pyrochlore Supergroup var. Betafite (of Hogarth 1977)' | - | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| β | '' | - | A2-mD2X6-wZ1-n |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| H | β Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | β Laumontite | CaAl2Si4O12 · 4H2O |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Scolecite | CaAl2Si3O10 · 3H2O |
| H | β Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Be | Beryllium | |
| Be | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | β Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Be | β Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Bismutite | (BiO)2CO3 |
| O | Oxygen | |
| O | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | β Almandine | Fe32+Al2(SiO4)3 |
| O | β Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| O | β Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Bismutite | (BiO)2CO3 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | β Columbite-(Fe) | Fe2+Nb2O6 |
| O | β Laumontite | CaAl2Si4O12 · 4H2O |
| O | β Monazite-(Ce) | Ce(PO4) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Scolecite | CaAl2Si3O10 · 3H2O |
| O | β Spessartine | Mn32+Al2(SiO4)3 |
| O | β Titanite | CaTi(SiO4)O |
| O | β Zircon | Zr(SiO4) |
| O | β Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| F | Fluorine | |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Na | Sodium | |
| Na | β Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Mg | Magnesium | |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | β Almandine | Fe32+Al2(SiO4)3 |
| Al | β Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | β Laumontite | CaAl2Si4O12 · 4H2O |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Scolecite | CaAl2Si3O10 · 3H2O |
| Al | β Spessartine | Mn32+Al2(SiO4)3 |
| Al | β Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Si | Silicon | |
| Si | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | β Almandine | Fe32+Al2(SiO4)3 |
| Si | β Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | β Laumontite | CaAl2Si4O12 · 4H2O |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Scolecite | CaAl2Si3O10 · 3H2O |
| Si | β Spessartine | Mn32+Al2(SiO4)3 |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Zircon | Zr(SiO4) |
| Si | β Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| P | Phosphorus | |
| P | β Monazite-(Ce) | Ce(PO4) |
| S | Sulfur | |
| S | β Bismuthinite | Bi2S3 |
| S | β Gladite | PbCuBi5S9 |
| K | Potassium | |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | β Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Ca | β Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Ca | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | β Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | β Scolecite | CaAl2Si3O10 · 3H2O |
| Ca | β Titanite | CaTi(SiO4)O |
| Ca | β Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Ti | Titanium | |
| Ti | β Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | β Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | β Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | β Almandine | Fe32+Al2(SiO4)3 |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | β Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | β Gladite | PbCuBi5S9 |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | β Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Nb | β Columbite-(Fe) | Fe2+Nb2O6 |
| Ce | Cerium | |
| Ce | β Monazite-(Ce) | Ce(PO4) |
| Ta | Tantalum | |
| Ta | β Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Pb | Lead | |
| Pb | β Gladite | PbCuBi5S9 |
| Bi | Bismuth | |
| Bi | β Bismuthinite | Bi2S3 |
| Bi | β Bismutite | (BiO)2CO3 |
| Bi | β Gladite | PbCuBi5S9 |
| U | Uranium | |
| U | β Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
EuropeContinent
- The AlpsMountain Range
Italy
- Lombardy
- Sondrio Province
- ValchiavennaGroup of Valleies
- Sondrio Province
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
