Toca da Onça pegmatite, Virgem da Lapa, Minas Gerais, Brazili
| Regional Level Types | |
|---|---|
| Toca da Onça pegmatite | Pegmatite |
| Virgem da Lapa | Municipality |
| Minas Gerais | State |
| Brazil | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
16° 40' 23'' South , 42° 22' 14'' West
Latitude & Longitude (decimal):
Type:
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Araçuaà | 22,005 (2012) | 37.5km |
Mindat Locality ID:
205529
Long-form identifier:
mindat:1:2:205529:2
GUID (UUID V4):
01772311-e259-44ac-abde-3cbf53c4d749
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
16 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| β Albite Formula: Na(AlSi3O8) |
| β Albite var. Cleavelandite Formula: Na(AlSi3O8) |
| β Amblygonite Formula: LiAl(PO4)F |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| β Beryl Formula: Be3Al2(Si6O18) |
| β Beryl var. Morganite Formula: Be3Al2(Si6O18) |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β 'Columbite-(Fe)-Columbite-(Mn) Series' |
| β Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β 'Feldspar Group' |
| β 'Garnet Supergroup' Formula: X3 Z2(TO4)3 |
| β Hematite Formula: Fe2O3 |
| β 'K Feldspar' |
| β Kyanite Formula: Al2(SiO4)O |
| β 'Lepidolite' |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| β Quartz Formula: SiO2 |
| β Rhodochrosite Formula: MnCO3 |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Spodumene Formula: LiAlSi2O6 |
| β Sulphur Formula: S8 |
| β 'Tantalite' Formula: (Mn,Fe)(Ta,Nb)2O6 |
| β Titanite Formula: CaTi(SiO4)O |
| β Topaz Formula: Al2(SiO4)(F,OH)2 |
| β 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| β Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Sulphur | 1.CC.05 | S8 |
| Group 4 - Oxides and Hydroxides | |||
| β | Hematite | 4.CB.05 | Fe2O3 |
| β | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Rhodochrosite | 5.AB.05 | MnCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Amblygonite | 8.BB.05 | LiAl(PO4)F |
| Group 9 - Silicates | |||
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| β | Kyanite | 9.AF.15 | Al2(SiO4)O |
| β | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | var. Morganite | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Spodumene | 9.DA.30 | LiAlSi2O6 |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Albite var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| β | 9.FA.35 | Na(AlSi3O8) | |
| Unclassified | |||
| β | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| β | 'Lepidolite' | - | |
| β | 'Garnet Supergroup' | - | X3 Z2(TO4)3 |
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| β | 'Feldspar Group' | - | |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| β | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| β | 'K Feldspar' | - | |
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Topaz | Al2(SiO4)(F,OH)2 |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Li | Lithium | |
| Li | β Amblygonite | LiAl(PO4)F |
| Li | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | β Spodumene | LiAlSi2O6 |
| Be | Beryllium | |
| Be | β Beryl | Be3Al2(Si6O18) |
| Be | β Beryl var. Morganite | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | β Rhodochrosite | MnCO3 |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Amblygonite | LiAl(PO4)F |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | β Garnet Supergroup | X3 Z2(TO4)3 |
| O | β Hematite | Fe2O3 |
| O | β Kyanite | Al2(SiO4)O |
| O | β Beryl var. Morganite | Be3Al2(Si6O18) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Quartz | SiO2 |
| O | β Rhodochrosite | MnCO3 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Spodumene | LiAlSi2O6 |
| O | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | β Titanite | CaTi(SiO4)O |
| O | β Topaz | Al2(SiO4)(F,OH)2 |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Zircon | Zr(SiO4) |
| O | β Albite var. Cleavelandite | Na(AlSi3O8) |
| O | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | β Amblygonite | LiAl(PO4)F |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β Topaz | Al2(SiO4)(F,OH)2 |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Amblygonite | LiAl(PO4)F |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | β Kyanite | Al2(SiO4)O |
| Al | β Beryl var. Morganite | Be3Al2(Si6O18) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Spodumene | LiAlSi2O6 |
| Al | β Topaz | Al2(SiO4)(F,OH)2 |
| Al | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | β Kyanite | Al2(SiO4)O |
| Si | β Beryl var. Morganite | Be3Al2(Si6O18) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Spodumene | LiAlSi2O6 |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Topaz | Al2(SiO4)(F,OH)2 |
| Si | β Zircon | Zr(SiO4) |
| Si | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| P | Phosphorus | |
| P | β Amblygonite | LiAl(PO4)F |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | β Sulphur | S8 |
| Cl | Chlorine | |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | β Titanite | CaTi(SiO4)O |
| Ca | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | β Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | β Rhodochrosite | MnCO3 |
| Mn | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | Iron | |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | β Hematite | Fe2O3 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Ta | Tantalum | |
| Ta | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
Other Regions, Features and Areas containing this locality
South AmericaContinent
South America PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Sauer, Jules Roger (1982) Brazil - Paradise of Gemstones. Gemological Institute of America (GIA)p.62
Toca da Onça pegmatite, Virgem da Lapa, Minas Gerais, Brazil